====== 5-Fluorouracil 2μM R00 exp1 ======
==== Mechanism of Action ====
Thymidylate synthase inhibitor, blocks DNA replication
  * **<color #00a2e8>Class / Subclass 1:</color>** Metabolism / Antimetabolite
  * **<color #00a2e8>Class / Subclass 2:</color>** DNA Damage, Repair and Replication / Replication Inhibitor



==== Technical Notes ====
<accordion collapsed='true'>
<panel title='Compound References' collapsed='true'>
    * **<color #00a2e8>PubChem Name:</color>** %%5-Fluorouracil%%
    * **<color #00a2e8>Synonyms:</color>** 5-FU
    * **<color #00a2e8>CAS #:</color>** 51-21-8
    * **<color #00a2e8>PubChem CID:</color>** [[https://pubchem.ncbi.nlm.nih.gov/compound/3385|3385]]
    * **<color #00a2e8>IUPAC:</color>** %%5-fluoro-1H-pyrimidine-2,4-dione%%
    * **<color #00a2e8>INCHI Name:</color>** InChI=1S/C4H3FN2O2/c5-2-1-6-4(9)7-3(2)8/h1H,(H2,6,7,8,9)
    * **<color #00a2e8>INCHI Key:</color>** GHASVSINZRGABV-UHFFFAOYSA-N
    * **<color #00a2e8>Molecular Weight:</color>** 130.08
    * **<color #00a2e8>Canonical SMILES:</color>** C1=C(C(=O)NC(=O)N1)F
    * **<color #00a2e8>Isomeric SMILES:</color>** N/A
    * **<color #00a2e8>Molecular Formula:</color>** C4H3FN2O2
{{:chemogenomics:structures:chem-0001.svg?nolink}}
</panel>


<panel title='Compound Supplier' collapsed='true'>
    * **<color #00a2e8>Supplier Name:</color>** Sigma-Aldrich
    * **<color #00a2e8>Catalog #:</color>** F6627
    * **<color #00a2e8>Lot #:</color>** 102K0970
</panel>


<panel title='Compound Characterization' collapsed='true'>
    * **<color #00a2e8>LCMS:</color>** Tr 0.14 min, m/z 129- [M-H]-
</panel>


<panel title='Dose Response Curve' collapsed='true'>
    * **<color #00a2e8>Platform ID:</color>** 5-FU
    * **<color #00a2e8>Min:</color>** -8.9515; **<color #00a2e8>Max:</color>** 61.1847
{{:chemogenomics:dose_response:dr_253.png?nolink&500 |}}
\\ 
\\ 
\\ 
\\ 
|< 300px 100px 200px >|
^ IC   ^ Concentration (µM) ^
| IC10  |N/A    |
| IC20  |12.7820    |
| IC30  |22.9250    |
| IC40  |37.0071    |
| IC50  |57.4305    |
| IC60  |N/A    |
| IC70  |N/A    |
| IC80  |N/A    |
| IC90  |N/A    |
\\ 
</panel>
</accordion>
==== Screen Summary ====
    * **<color #00a2e8>Round</color>**: 00
    * **<color #00a2e8>Dose</color>**: 2µM
    * **<color #00a2e8>Days of incubation</color>**: 8
    * **<color #00a2e8>Doublings</color>**: 5.6
    * **<color #00a2e8>Numbers of reads</color>**: 10701088


==== Screen Results ====


^Sensitive/Resistant hits (FDR<0.05)^CRANKS^Score Plot^Top 30 Genes^Screen Similarity^Top 30 Sensitive GO terms^Top 30 Resistant GO terms^
|2/3|<color #e85500>[[https://files.tyerslab.com/files/public/chemogenomics/cranks/5-Fluorouracil_2uM_Round-0_exp1.txt|Scores]]</color>|<button type="primary" size="sm" modal="ScorePlot">View</button>|<button type="primary" size="sm" modal="modal_hits">View</button>|<button type="primary" size="sm" modal="modal_screen_similarity">View</button>|<button type="default" size="sm" modal="modal_go_sensitive">View</button>|<button type="default" size="sm" modal="modal_go_resistant">View</button>|
<modal id='ScorePlot' size='lg' title='5-Fluorouracil 2μM R00 exp1'>
{{:chemogenomics:cranks_plots:exp1.png?nolink}}
</modal>


<modal id="modal_hits" size="sm" title="Top 30 S/R Genes">
^Gene^CRANKS Score^FDR^
|[[:human_genes:K:KIAA1432|KIAA1432]]|-3.24|<0.01|
|[[:human_genes:Y:YPEL5|YPEL5]]|-2.85|0.02|
|[[:human_genes:U:ULK3|ULK3]]|-2.64|0.06|
|[[:human_genes:Z:ZFYVE20|ZFYVE20]]|-2.60|0.08|
|[[:human_genes:Y:YTHDF2|YTHDF2]]|-2.56|0.06|
|[[:human_genes:Z:ZCCHC7|ZCCHC7]]|-2.55|0.06|
|[[:human_genes:P:PAPD5|PAPD5]]|-2.54|0.06|
|[[:human_genes:M:MCTS1|MCTS1]]|-2.54|0.06|
|[[:human_genes:D:DCAF15|DCAF15]]|-2.53|0.06|
|[[:human_genes:C:CCNG2|CCNG2]]|-2.46|0.06|
|[[:human_genes:L:LAMTOR4|LAMTOR4]]|-2.44|0.08|
|[[:human_genes:F:FTSJ1|FTSJ1]]|-2.44|0.06|
|[[:human_genes:M:MCM9|MCM9]]|-2.43|0.06|
|[[:human_genes:O:ORC3|ORC3]]|-2.43|0.14|
|[[:human_genes:C:CHRNB3|CHRNB3]]|-2.42|0.14|
|[[:human_genes:A:ALKBH8|ALKBH8]]|-2.39|0.06|
|[[:human_genes:E:EEFSEC|EEFSEC]]|-2.37|0.06|
|[[:human_genes:D:DDX39A|DDX39A]]|-2.29|0.08|
|[[:human_genes:N:NAF1|NAF1]]|-2.29|0.08|
|[[:human_genes:T:TCF4|TCF4]]|-2.28|0.08|
|[[:human_genes:U:UNG|UNG]]|-2.26|0.08|
|[[:human_genes:R:RNPS1|RNPS1]]|-2.24|0.27|
|[[:human_genes:H:HTR3E|HTR3E]]|-2.18|0.38|
|[[:human_genes:T:TEN1|TEN1]]|-2.16|0.14|
|[[:human_genes:G:GGPS1|GGPS1]]|-2.11|0.27|
|[[:human_genes:C:COX5A|COX5A]]|-2.10|0.27|
|[[:human_genes:P:PYCRL|PYCRL]]|-2.09|0.27|
|[[:human_genes:Z:ZSCAN32|ZSCAN32]]|-2.05|0.23|
|[[:human_genes:V:VEZT|VEZT]]|-2.03|0.30|
|[[:human_genes:M:MUS81|MUS81]]|-2.00|0.38|
|[[:human_genes:S:SNX3|SNX3]]|2.13|0.27|
|[[:human_genes:C:CKAP5|CKAP5]]|2.14|0.57|
|[[:human_genes:S:SCAMP1|SCAMP1]]|2.15|0.34|
|[[:human_genes:C:C19orf53|C19orf53]]|2.15|0.34|
|[[:human_genes:S:SSBP1|SSBP1]]|2.17|0.33|
|[[:human_genes:A:ABCG2|ABCG2]]|2.17|0.25|
|[[:human_genes:H:HPS1|HPS1]]|2.17|0.42|
|[[:human_genes:C:CLASP1|CLASP1]]|2.19|0.19|
|[[:human_genes:C:CDKL3|CDKL3]]|2.20|0.23|
|[[:human_genes:N:NADK|NADK]]|2.22|0.23|
|[[:human_genes:D:DNM2|DNM2]]|2.24|0.53|
|[[:human_genes:U:USP17L19|USP17L19]]|2.25|0.38|
|[[:human_genes:R:RPL23|RPL23]]|2.26|0.45|
|[[:human_genes:C:C18orf32|C18orf32]]|2.26|0.62|
|[[:human_genes:C:CHRAC1|CHRAC1]]|2.26|0.28|
|[[:human_genes:D:DCUN1D1|DCUN1D1]]|2.34|0.15|
|[[:human_genes:S:SCAP|SCAP]]|2.34|0.15|
|[[:human_genes:P:PAF1|PAF1]]|2.41|0.23|
|[[:human_genes:M:MPHOSPH9|MPHOSPH9]]|2.44|0.16|
|[[:human_genes:O:OR2G3|OR2G3]]|2.45|0.10|
|[[:human_genes:G:GCN1L1|GCN1L1]]|2.45|0.10|
|[[:human_genes:E:ECD|ECD]]|2.50|0.19|
|[[:human_genes:H:HNRNPA1|HNRNPA1]]|2.54|0.19|
|[[:human_genes:S:SUPT6H|SUPT6H]]|2.67|0.40|
|[[:human_genes:M:MIER3|MIER3]]|2.73|0.03|
|[[:human_genes:T:TPX2|TPX2]]|2.86|0.21|
|[[:human_genes:U:UCK2|UCK2]]|2.91|0.01|
|[[:human_genes:W:WEE1|WEE1]]|2.97|0.19|
|[[:human_genes:T:TOP1MT|TOP1MT]]|3.24|0.01|
|[[:human_genes:K:KIF11|KIF11]]|3.69|0.19|
</modal>


<modal id="modal_screen_similarity" size="lg" title="Correlated Screens">
^Screen^Correlation^Plot^
|[[:results:exp16|DABN 2μM R00 exp16]]|0.068|<button type="primary" size="small" modal="1">View</button>|
|[[:results:exp15|Cycloheximide 0.2μM R00 exp15]]|0.059|<button type="primary" size="small" modal="2">View</button>|
|[[:results:exp27|Pimelic-diphenylamide-106 0.5μM R00 exp27]]|0.053|<button type="primary" size="small" modal="3">View</button>|
</modal>


<modal id="1" size="lg" title="5-Fluorouracil 2μM R00 exp1  vs  DABN 2μM R00 exp16">
{{:chemogenomics:comparison_plots:exp1_vs_exp16.png?nolink |}}
</modal>

<modal id="2" size="lg" title="5-Fluorouracil 2μM R00 exp1  vs  Cycloheximide 0.2μM R00 exp15">
{{:chemogenomics:comparison_plots:exp1_vs_exp15.png?nolink |}}
</modal>

<modal id="3" size="lg" title="5-Fluorouracil 2μM R00 exp1  vs  Pimelic-diphenylamide-106 0.5μM R00 exp27">
{{:chemogenomics:comparison_plots:exp1_vs_exp27.png?nolink |}}
</modal>



<modal id="modal_go_sensitive" size="lg" title="Top 30 sensitive GO terms">No GO term hits below threshold. (FDR <0.05)</modal>
<modal id="modal_go_resistant" size="lg" title="Top 30 resistant GO terms">No GO term hits below threshold. (FDR <0.05)</modal>