====== GSK-LSD1 10μM R03 exp123 ======
==== Mechanism of Action ====
Inhibits LSD1 histone demethylase (H3K4me/me2, H3K9me)
  * **<color #00a2e8>Class / Subclass 1:</color>** Gene Regulation / Epigenetic Inhibitor




==== Technical Notes ====
<accordion collapsed='true'>
<panel title='Compound References' collapsed='true'>
    * **<color #00a2e8>PubChem Name:</color>** %%GSK-LSD1 Dihydrochloride%%
    * **<color #00a2e8>Synonyms:</color>** N/A
    * **<color #00a2e8>CAS #:</color>** N/A
    * **<color #00a2e8>PubChem CID:</color>** [[https://pubchem.ncbi.nlm.nih.gov/compound/91663353|91663353]]
    * **<color #00a2e8>IUPAC:</color>** %%N-[(1R,2S)-2-phenylcyclopropyl]piperidin-4-amine;dihydrochloride%%
    * **<color #00a2e8>INCHI Name:</color>** InChI=1S/C14H20N2.2ClH/c1-2-4-11(5-3-1)13-10-14(13)16-12-6-8-15-9-7-12;;/h1-5,12-16H,6-10H2;2*1H/t13-,14+;;/m0../s1
    * **<color #00a2e8>INCHI Key:</color>** PJFZOGMSPBHPNS-WICJZZOFSA-N
    * **<color #00a2e8>Molecular Weight:</color>** 289.2
    * **<color #00a2e8>Canonical SMILES:</color>** C1CNCCC1NC2CC2C3=CC=CC=C3.Cl.Cl
    * **<color #00a2e8>Isomeric SMILES:</color>** C1CNCCC1N[C@@H]2C[C@H]2C3=CC=CC=C3.Cl.Cl
    * **<color #00a2e8>Molecular Formula:</color>** C14H22Cl2N2
{{:chemogenomics:structures:chem-0076.svg?nolink}}
</panel>


<panel title='Compound Supplier' collapsed='true'>
    * **<color #00a2e8>Supplier Name:</color>** Tocris Bioscience
    * **<color #00a2e8>Catalog #:</color>** 5361
    * **<color #00a2e8>Lot #:</color>** N/A
</panel>


<panel title='Compound Characterization' collapsed='true'>
    * **<color #00a2e8>HRMS (ESI-TOF) m/z:</color>** (M+H)+ Calcd for C14H20N2 217.16993; found 217.16937
</panel>


<panel title='Dose Response Curve' collapsed='true'>
    * **<color #00a2e8>Platform ID:</color>** GSK-LSD1
    * **<color #00a2e8>Min:</color>** -4.3978; **<color #00a2e8>Max:</color>** 8.0909
{{:chemogenomics:dose_response:dr_81.png?nolink&500 |}}
\\ 
\\ 
\\ 
\\ 
|< 300px 100px 200px >|
^ IC   ^ Concentration (µM) ^
| IC10  |N/A    |
| IC20  |N/A    |
| IC30  |N/A    |
| IC40  |N/A    |
| IC50  |N/A    |
| IC60  |N/A    |
| IC70  |N/A    |
| IC80  |N/A    |
| IC90  |N/A    |
\\ 
</panel>
</accordion>
==== Screen Summary ====
    * **<color #00a2e8>Round</color>**: 03
    * **<color #00a2e8>Dose</color>**: 10µM
    * **<color #00a2e8>Days of incubation</color>**: 8
    * **<color #00a2e8>Doublings</color>**: 7.9
    * **<color #00a2e8>Numbers of reads</color>**: 10549262


==== Screen Results ====


^Sensitive/Resistant hits (FDR<0.05)^CRANKS^Score Plot^Top 30 Genes^Screen Similarity^Top 30 Sensitive GO terms^Top 30 Resistant GO terms^
|0/0|<color #e85500>[[https://files.tyerslab.com/files/public/chemogenomics/cranks/GSK-LSD1_10uM_Round-3_exp123.txt|Scores]]</color>|<button type="primary" size="sm" modal="ScorePlot">View</button>|<button type="primary" size="sm" modal="modal_hits">View</button>|<button type="default" size="sm" modal="modal_screen_similarity">View</button>|<button type="default" size="sm" modal="modal_go_sensitive">View</button>|<button type="default" size="sm" modal="modal_go_resistant">View</button>|
<modal id='ScorePlot' size='lg' title='GSK-LSD1 10μM R03 exp123'>
{{:chemogenomics:cranks_plots:exp123.png?nolink}}
</modal>


<modal id="modal_hits" size="sm" title="Top 30 S/R Genes">
^Gene^CRANKS Score^FDR^
|[[:human_genes:S:SLC6A12|SLC6A12]]|-2.56|0.18|
|[[:human_genes:N:NPPA|NPPA]]|-2.50|0.18|
|[[:human_genes:P:PEBP4|PEBP4]]|-2.27|0.49|
|[[:human_genes:D:DPAGT1|DPAGT1]]|-2.27|0.82|
|[[:human_genes:W:WDR60|WDR60]]|-2.24|0.82|
|[[:human_genes:S:SLC4A7|SLC4A7]]|-2.17|0.82|
|[[:human_genes:F:FAM231B|FAM231B]]|-2.14|0.82|
|[[:human_genes:H:HGC6.3|HGC6.3]]|-2.08|0.89|
|[[:human_genes:H:HPSE|HPSE]]|-2.03|0.82|
|[[:human_genes:N:NCBP1|NCBP1]]|-2.03|0.89|
|[[:human_genes:Z:ZNF343|ZNF343]]|-2.02|0.89|
|[[:human_genes:P:PRRG2|PRRG2]]|-2.02|0.82|
|[[:human_genes:S:SAE1|SAE1]]|-2.00|0.89|
|[[:human_genes:G:GATM|GATM]]|-1.99|0.89|
|[[:human_genes:F:FFAR1|FFAR1]]|-1.98|0.82|
|[[:human_genes:H:HABP4|HABP4]]|-1.97|0.82|
|[[:human_genes:S:SEPSECS|SEPSECS]]|-1.97|0.89|
|[[:human_genes:R:R3HCC1|R3HCC1]]|-1.97|0.89|
|[[:human_genes:S:STARD8|STARD8]]|-1.96|0.82|
|[[:human_genes:S:SRD5A1|SRD5A1]]|-1.95|0.82|
|[[:human_genes:A:AFF2|AFF2]]|-1.94|0.82|
|[[:human_genes:X:XCR1|XCR1]]|-1.90|0.82|
|[[:human_genes:T:TMEM179B|TMEM179B]]|-1.87|0.82|
|[[:human_genes:A:ATG9A|ATG9A]]|-1.86|0.82|
|[[:human_genes:I:ID3|ID3]]|-1.85|0.82|
|[[:human_genes:D:DCUN1D1|DCUN1D1]]|-1.84|0.82|
|[[:human_genes:G:GCM2|GCM2]]|-1.84|0.89|
|[[:human_genes:U:UBE3A|UBE3A]]|-1.84|0.82|
|[[:human_genes:I:INSR|INSR]]|-1.83|0.82|
|[[:human_genes:G:GCLC|GCLC]]|-1.83|0.89|
|[[:human_genes:G:GDF9|GDF9]]|1.99|0.81|
|[[:human_genes:C:CNOT3|CNOT3]]|2.02|0.81|
|[[:human_genes:S:SRSF3|SRSF3]]|2.02|0.66|
|[[:human_genes:C:COLCA2|COLCA2]]|2.03|0.81|
|[[:human_genes:C:CDK1|CDK1]]|2.04|0.85|
|[[:human_genes:M:MANBA|MANBA]]|2.05|0.64|
|[[:human_genes:A:ASPHD2|ASPHD2]]|2.06|0.40|
|[[:human_genes:G:GPNMB|GPNMB]]|2.08|0.81|
|[[:human_genes:C:CNTN1|CNTN1]]|2.08|0.40|
|[[:human_genes:T:TOPBP1|TOPBP1]]|2.10|0.81|
|[[:human_genes:A:ATRNL1|ATRNL1]]|2.10|0.40|
|[[:human_genes:T:TBC1D3I|TBC1D3I]]|2.12|0.85|
|[[:human_genes:T:TBC1D3E|TBC1D3E]]|2.12|0.85|
|[[:human_genes:T:TBC1D3K|TBC1D3K]]|2.13|0.85|
|[[:human_genes:T:TBC1D3L|TBC1D3L]]|2.13|0.85|
|[[:human_genes:E:EOMES|EOMES]]|2.14|0.40|
|[[:human_genes:E:EIF3J|EIF3J]]|2.14|0.85|
|[[:human_genes:G:G3BP1|G3BP1]]|2.15|0.40|
|[[:human_genes:S:ST5|ST5]]|2.15|0.45|
|[[:human_genes:C:CDT1|CDT1]]|2.18|0.81|
|[[:human_genes:P:PLN|PLN]]|2.19|0.85|
|[[:human_genes:R:RNF165|RNF165]]|2.19|0.40|
|[[:human_genes:E:ENPP4|ENPP4]]|2.19|0.40|
|[[:human_genes:B:B3GALNT2|B3GALNT2]]|2.25|0.40|
|[[:human_genes:P:PIWIL3|PIWIL3]]|2.26|0.40|
|[[:human_genes:K:KIF4A|KIF4A]]|2.32|0.28|
|[[:human_genes:F:FOLR1|FOLR1]]|2.32|0.28|
|[[:human_genes:T:TBC1D3C|TBC1D3C]]|2.33|0.28|
|[[:human_genes:S:SST|SST]]|2.34|0.28|
|[[:human_genes:R:RARS|RARS]]|2.37|0.85|
</modal>


<modal id="modal_screen_similarity" size="lg" title="Correlated Screens">
No correlation data above threshold. (correlation > 0.05)
</modal>


<modal id="modal_go_sensitive" size="lg" title="Top 30 sensitive GO terms">No GO term hits below threshold. (FDR <0.05)</modal>
<modal id="modal_go_resistant" size="lg" title="Top 30 resistant GO terms">No GO term hits below threshold. (FDR <0.05)</modal>