====== Isonicotinamide 500μM R03 exp129 ======
==== Mechanism of Action ====
nicotinamide antagonist, putative SIRT1 activator
  * **<color #00a2e8>Class / Subclass 1:</color>** Metabolism / Metabolite




==== Technical Notes ====
<accordion collapsed='true'>
<panel title='Compound References' collapsed='true'>
    * **<color #00a2e8>PubChem Name:</color>** %%Isonicotinamide%%
    * **<color #00a2e8>Synonyms:</color>** N/A
    * **<color #00a2e8>CAS #:</color>** 1453-82-3
    * **<color #00a2e8>PubChem CID:</color>** [[https://pubchem.ncbi.nlm.nih.gov/compound/15074|15074]]
    * **<color #00a2e8>IUPAC:</color>** %%pyridine-4-carboxamide%%
    * **<color #00a2e8>INCHI Name:</color>** InChI=1S/C6H6N2O/c7-6(9)5-1-3-8-4-2-5/h1-4H,(H2,7,9)
    * **<color #00a2e8>INCHI Key:</color>** VFQXVTODMYMSMJ-UHFFFAOYSA-N
    * **<color #00a2e8>Molecular Weight:</color>** 122.12
    * **<color #00a2e8>Canonical SMILES:</color>** C1=CN=CC=C1C(=O)N
    * **<color #00a2e8>Isomeric SMILES:</color>** N/A
    * **<color #00a2e8>Molecular Formula:</color>** C6H6N2O
{{:chemogenomics:structures:chem-0081.svg?nolink}}
</panel>


<panel title='Compound Supplier' collapsed='true'>
    * **<color #00a2e8>Supplier Name:</color>** Sigma-Aldrich
    * **<color #00a2e8>Catalog #:</color>** I17451
    * **<color #00a2e8>Lot #:</color>** BCBD6627V
</panel>


<panel title='Compound Characterization' collapsed='true'>
    * **<color #00a2e8>HRMS (ESI-TOF) m/z:</color>** (M+H)+ Calcd for C6H6N2O 123.05529; found 123.05433
</panel>


<panel title='Dose Response Curve' collapsed='true'>
    * **<color #00a2e8>Platform ID:</color>** ISONICOTINAMIDE
    * **<color #00a2e8>Min:</color>** -8.6917; **<color #00a2e8>Max:</color>** 18.3168
{{:chemogenomics:dose_response:dr_86.png?nolink&500 |}}
\\ 
\\ 
\\ 
\\ 
|< 300px 100px 200px >|
^ IC   ^ Concentration (µM) ^
| IC10  |N/A    |
| IC20  |N/A    |
| IC30  |N/A    |
| IC40  |N/A    |
| IC50  |N/A    |
| IC60  |N/A    |
| IC70  |N/A    |
| IC80  |N/A    |
| IC90  |N/A    |
\\ 
</panel>
</accordion>
==== Screen Summary ====
    * **<color #00a2e8>Round</color>**: 03
    * **<color #00a2e8>Dose</color>**: 500µM
    * **<color #00a2e8>Days of incubation</color>**: 8
    * **<color #00a2e8>Doublings</color>**: 7.7
    * **<color #00a2e8>Numbers of reads</color>**: 8871155


==== Screen Results ====


^Sensitive/Resistant hits (FDR<0.05)^CRANKS^Score Plot^Top 30 Genes^Screen Similarity^Top 30 Sensitive GO terms^Top 30 Resistant GO terms^
|0/1|<color #e85500>[[https://files.tyerslab.com/files/public/chemogenomics/cranks/Isonicotinamide_500uM_Round-3_exp129.txt|Scores]]</color>|<button type="primary" size="sm" modal="ScorePlot">View</button>|<button type="primary" size="sm" modal="modal_hits">View</button>|<button type="default" size="sm" modal="modal_screen_similarity">View</button>|<button type="default" size="sm" modal="modal_go_sensitive">View</button>|<button type="default" size="sm" modal="modal_go_resistant">View</button>|
<modal id='ScorePlot' size='lg' title='Isonicotinamide 500μM R03 exp129'>
{{:chemogenomics:cranks_plots:exp129.png?nolink}}
</modal>


<modal id="modal_hits" size="sm" title="Top 30 S/R Genes">
^Gene^CRANKS Score^FDR^
|[[:human_genes:G:GCLC|GCLC]]|-2.80|0.18|
|[[:human_genes:V:VPS25|VPS25]]|-2.67|0.68|
|[[:human_genes:T:TKTL2|TKTL2]]|-2.35|0.46|
|[[:human_genes:F:FANCC|FANCC]]|-2.19|0.57|
|[[:human_genes:A:ATP6V1G1|ATP6V1G1]]|-2.16|0.68|
|[[:human_genes:F:FAM219A|FAM219A]]|-2.16|0.57|
|[[:human_genes:G:GPR65|GPR65]]|-2.14|0.57|
|[[:human_genes:M:MARCH1|MARCH1]]|-2.12|0.57|
|[[:human_genes:C:C1orf21|C1orf21]]|-2.08|0.68|
|[[:human_genes:B:BICD2|BICD2]]|-2.07|0.68|
|[[:human_genes:C:CTC1|CTC1]]|-2.03|0.69|
|[[:human_genes:A:ABHD12|ABHD12]]|-2.00|0.68|
|[[:human_genes:G:GSS|GSS]]|-1.99|0.68|
|[[:human_genes:M:MNS1|MNS1]]|-1.98|0.84|
|[[:human_genes:T:TAF1C|TAF1C]]|-1.97|0.68|
|[[:human_genes:P:PPCS|PPCS]]|-1.94|0.69|
|[[:human_genes:Y:YARS2|YARS2]]|-1.92|0.69|
|[[:human_genes:H:HCFC1|HCFC1]]|-1.91|0.89|
|[[:human_genes:Z:ZNF829|ZNF829]]|-1.90|0.69|
|[[:human_genes:E:EEFSEC|EEFSEC]]|-1.88|0.69|
|[[:human_genes:U:UBE2N|UBE2N]]|-1.88|0.69|
|[[:human_genes:A:ATP8B2|ATP8B2]]|-1.88|0.76|
|[[:human_genes:T:TFDP2|TFDP2]]|-1.88|0.69|
|[[:human_genes:L:LIPT2|LIPT2]]|-1.86|0.69|
|[[:human_genes:U:UBXN1|UBXN1]]|-1.86|0.69|
|[[:human_genes:C:CABLES1|CABLES1]]|-1.86|0.69|
|[[:human_genes:A:ADAMTS18|ADAMTS18]]|-1.85|0.69|
|[[:human_genes:E:EMC6|EMC6]]|-1.84|0.69|
|[[:human_genes:R:RCHY1|RCHY1]]|-1.84|0.69|
|[[:human_genes:S:SLC7A1|SLC7A1]]|-1.82|0.85|
|[[:human_genes:T:TXLNA|TXLNA]]|1.92|0.69|
|[[:human_genes:D:DCD|DCD]]|1.94|0.69|
|[[:human_genes:M:MRPL46|MRPL46]]|1.95|0.69|
|[[:human_genes:P:PFN2|PFN2]]|1.98|0.69|
|[[:human_genes:Z:ZEB1|ZEB1]]|1.99|0.55|
|[[:human_genes:K:KISS1|KISS1]]|1.99|0.69|
|[[:human_genes:C:CARF|CARF]]|2.01|0.69|
|[[:human_genes:I:ICA1L|ICA1L]]|2.02|0.69|
|[[:human_genes:P:PRPF19|PRPF19]]|2.02|0.69|
|[[:human_genes:N:NRDE2|NRDE2]]|2.02|0.69|
|[[:human_genes:P:PSMB1|PSMB1]]|2.04|0.69|
|[[:human_genes:D:DYDC2|DYDC2]]|2.05|0.55|
|[[:human_genes:S:SHFM1|SHFM1]]|2.05|0.70|
|[[:human_genes:U:USP37|USP37]]|2.05|0.69|
|[[:human_genes:A:ACRBP|ACRBP]]|2.08|0.69|
|[[:human_genes:P:PPWD1|PPWD1]]|2.09|0.69|
|[[:human_genes:T:TXLNG|TXLNG]]|2.14|0.55|
|[[:human_genes:Z:ZNF610|ZNF610]]|2.14|0.41|
|[[:human_genes:G:GTPBP4|GTPBP4]]|2.16|0.70|
|[[:human_genes:L:LOC650293|LOC650293]]|2.26|0.55|
|[[:human_genes:T:THEGL|THEGL]]|2.27|0.41|
|[[:human_genes:A:AUNIP|AUNIP]]|2.27|0.26|
|[[:human_genes:M:MINA|MINA]]|2.35|0.53|
|[[:human_genes:R:RIPK1|RIPK1]]|2.41|0.14|
|[[:human_genes:T:TTLL9|TTLL9]]|2.42|0.14|
|[[:human_genes:P:PRPF4|PRPF4]]|2.43|0.69|
|[[:human_genes:V:VN1R4|VN1R4]]|2.58|0.14|
|[[:human_genes:C:CD2AP|CD2AP]]|2.64|0.09|
|[[:human_genes:Z:ZC3H12A|ZC3H12A]]|2.86|0.05|
|[[:human_genes:U:U2SURP|U2SURP]]|2.96|0.55|
</modal>


<modal id="modal_screen_similarity" size="lg" title="Correlated Screens">
No correlation data above threshold. (correlation > 0.05)
</modal>


<modal id="modal_go_sensitive" size="lg" title="Top 30 sensitive GO terms">No GO term hits below threshold. (FDR <0.05)</modal>
<modal id="modal_go_resistant" size="lg" title="Top 30 resistant GO terms">No GO term hits below threshold. (FDR <0.05)</modal>