====== Celastrol 0.12μM R05 exp225 ======
==== Mechanism of Action ====
Putative antioxidant, anti-inflammatory, antiobesity anticancer, proteasome inhibitor
* **Class / Subclass 1:** Uncharacterized Mechanism / Natural Product
* **Class / Subclass 2:** Proteostasis / Ubiquitin-Proteasome Inhibitor
==== Technical Notes ====
* **PubChem Name:** %%Celastrol%%
* **Synonyms:** Celastrol
* **CAS #:** 34157-83-0
* **PubChem CID:** [[https://pubchem.ncbi.nlm.nih.gov/compound/122724|122724]]
* **IUPAC:** %%(2R,4aS,6aR,6aS,14aS,14bR)-10-hydroxy-2,4a,6a,6a,9,14a-hexamethyl-11-oxo-1,3,4,5,6,13,14,14b-octahydropicene-2-carboxylic acid%%
* **INCHI Name:** InChI=1S/C29H38O4/c1-17-18-7-8-21-27(4,19(18)15-20(30)23(17)31)12-14-29(6)22-16-26(3,24(32)33)10-9-25(22,2)11-13-28(21,29)5/h7-8,15,22,31H,9-14,16H2,1-6H3,(H,32,33)/t22-,25-,26-,27+,28-,29+/m1/s1
* **INCHI Key:** KQJSQWZMSAGSHN-JJWQIEBTSA-N
* **Molecular Weight:** 450.6
* **Canonical SMILES:** CC1=C(C(=O)C=C2C1=CC=C3C2(CCC4(C3(CCC5(C4CC(CC5)(C)C(=O)O)C)C)C)C)O
* **Isomeric SMILES:** CC1=C(C(=O)C=C2C1=CC=C3[C@]2(CC[C@@]4([C@@]3(CC[C@@]5([C@H]4C[C@](CC5)(C)C(=O)O)C)C)C)C)O
* **Molecular Formula:** C29H38O4
{{:chemogenomics:structures:chem-0130.svg?nolink}}
* **Supplier Name:** Sigma-Aldrich
* **Catalog #:** C0869
* **Lot #:** 18134
* **HRMS (ESI-TOF) m/z:** (M+H)+ Calcd for C29H38O4 451.28429; found 451.2861
* **Platform ID:** Celastrol
* **Min:** 0.0523; **Max:** 99.6884
{{:chemogenomics:dose_response:dr_195.png?nolink&500 |}}
\\
\\
\\
\\
|< 300px 100px 200px >|
^ IC ^ Concentration (µM) ^
| IC10 |N/A |
| IC20 |0.0955 |
| IC30 |0.1091 |
| IC40 |0.1218 |
| IC50 |0.1347 |
| IC60 |N/A |
| IC70 |N/A |
| IC80 |N/A |
| IC90 |N/A |
\\
==== Screen Summary ====
* **Round**: 05
* **Dose**: 120nM
* **Days of incubation**: 8
* **Doublings**: 6.8
* **Numbers of reads**: 17259093
==== Screen Results ====
^Sensitive/Resistant hits (FDR<0.05)^CRANKS^Score Plot^Top 30 Genes^Screen Similarity^Top 30 Sensitive GO terms^Top 30 Resistant GO terms^
|3/0|[[https://files.tyerslab.com/files/public/chemogenomics/cranks/Celastrol_0.12uM_Round-5_exp225.txt|Scores]]||||||
{{:chemogenomics:cranks_plots:exp225.png?nolink}}
^Gene^CRANKS Score^FDR^
|[[:human_genes:G:GPR107|GPR107]]|-3.22|<0.01|
|[[:human_genes:G:GSR|GSR]]|-2.83|0.05|
|[[:human_genes:A:ARL1|ARL1]]|-2.78|0.03|
|[[:human_genes:S:SCAP|SCAP]]|-2.77|0.05|
|[[:human_genes:K:KIAA1432|KIAA1432]]|-2.47|0.08|
|[[:human_genes:A:ALG9|ALG9]]|-2.43|0.09|
|[[:human_genes:E:ERCC2|ERCC2]]|-2.34|0.49|
|[[:human_genes:C:CD69|CD69]]|-2.23|0.26|
|[[:human_genes:S:SEPHS2|SEPHS2]]|-2.20|0.27|
|[[:human_genes:F:FRY|FRY]]|-2.12|0.38|
|[[:human_genes:A:AGPAT1|AGPAT1]]|-2.11|0.49|
|[[:human_genes:M:MBTPS1|MBTPS1]]|-2.10|0.49|
|[[:human_genes:P:PPIL4|PPIL4]]|-2.10|0.49|
|[[:human_genes:X:XPOT|XPOT]]|-2.07|0.49|
|[[:human_genes:A:ATP8B2|ATP8B2]]|-2.04|0.62|
|[[:human_genes:L:LGALS14|LGALS14]]|-2.03|0.49|
|[[:human_genes:C:CHP1|CHP1]]|-2.01|0.49|
|[[:human_genes:S:SUMO2|SUMO2]]|-2.01|0.54|
|[[:human_genes:P:PDCD5|PDCD5]]|-1.99|0.49|
|[[:human_genes:Z:ZNF350|ZNF350]]|-1.99|0.49|
|[[:human_genes:S:SREK1|SREK1]]|-1.97|0.49|
|[[:human_genes:A:ATP2B1|ATP2B1]]|-1.96|0.49|
|[[:human_genes:F:FAM212A|FAM212A]]|-1.96|0.49|
|[[:human_genes:C:C14orf39|C14orf39]]|-1.94|0.49|
|[[:human_genes:S:SSX2IP|SSX2IP]]|-1.94|0.50|
|[[:human_genes:N:NRG2|NRG2]]|-1.94|0.49|
|[[:human_genes:C:CAMSAP2|CAMSAP2]]|-1.93|0.49|
|[[:human_genes:C:CMTR2|CMTR2]]|-1.91|0.49|
|[[:human_genes:T:TBCEL|TBCEL]]|-1.91|0.49|
|[[:human_genes:A:ACTL6A|ACTL6A]]|-1.91|0.68|
|[[:human_genes:I:INTS5|INTS5]]|1.95|0.71|
|[[:human_genes:X:XPO1|XPO1]]|1.97|0.82|
|[[:human_genes:P:P2RX3|P2RX3]]|2.01|0.51|
|[[:human_genes:P:PLEKHM3|PLEKHM3]]|2.02|0.51|
|[[:human_genes:K:KLHL42|KLHL42]]|2.02|0.55|
|[[:human_genes:T:TRIM52|TRIM52]]|2.02|0.73|
|[[:human_genes:D:DHX37|DHX37]]|2.03|0.67|
|[[:human_genes:S:SLC16A4|SLC16A4]]|2.04|0.51|
|[[:human_genes:H:HDGFRP2|HDGFRP2]]|2.04|0.55|
|[[:human_genes:G:GRID1|GRID1]]|2.05|0.51|
|[[:human_genes:U:URI1|URI1]]|2.07|0.58|
|[[:human_genes:G:GAPDHS|GAPDHS]]|2.11|0.51|
|[[:human_genes:T:TCHP|TCHP]]|2.11|0.55|
|[[:human_genes:I:IFFO2|IFFO2]]|2.11|0.43|
|[[:human_genes:P:PCF11|PCF11]]|2.11|0.51|
|[[:human_genes:M:MUC15|MUC15]]|2.15|0.55|
|[[:human_genes:N:NDC80|NDC80]]|2.16|0.73|
|[[:human_genes:T:THRB|THRB]]|2.18|0.37|
|[[:human_genes:S:STAC2|STAC2]]|2.18|0.37|
|[[:human_genes:E:EIF3B|EIF3B]]|2.19|0.58|
|[[:human_genes:T:TAT|TAT]]|2.22|0.37|
|[[:human_genes:L:LRR1|LRR1]]|2.26|0.55|
|[[:human_genes:P:PRSS50|PRSS50]]|2.29|0.37|
|[[:human_genes:D:DET1|DET1]]|2.30|0.37|
|[[:human_genes:P:POLA1|POLA1]]|2.31|0.73|
|[[:human_genes:I:IFNW1|IFNW1]]|2.32|0.37|
|[[:human_genes:N:NDUFAF5|NDUFAF5]]|2.38|0.54|
|[[:human_genes:R:RFC1|RFC1]]|2.46|0.55|
|[[:human_genes:R:RXFP2|RXFP2]]|2.60|0.19|
|[[:human_genes:M:MCL1|MCL1]]|2.66|0.19|
^Screen^Correlation^Plot^
|[[:results:exp233|EPZ-5676 30μM R05 exp233]]|0.057||
{{:chemogenomics:comparison_plots:exp225_vs_exp233.png?nolink |}}
No GO term hits below threshold. (FDR <0.05)
No GO term hits below threshold. (FDR <0.05)