====== UM0011500 5μM R05 exp245 ======
==== Mechanism of Action ====
Unknown
* **Class / Subclass 1:** Uncharacterized Mechanism / Chemical Screen Hit
==== Technical Notes ====
* **PubChem Name:** %%3-(5,6-Dimethyl-1,3-dihydroisoindol-2-yl)-N-[(Z)-furan-2-ylmethylideneamino]benzamide%%
* **Synonyms:** N/A
* **CAS #:** 331431-73-3
* **PubChem CID:** [[https://pubchem.ncbi.nlm.nih.gov/compound/5440778|5440778]]
* **IUPAC:** %%3-(5,6-dimethyl-1,3-dihydroisoindol-2-yl)-N-[(Z)-furan-2-ylmethylideneamino]benzamide%%
* **INCHI Name:** InChI=1S/C22H21N3O2/c1-15-9-18-13-25(14-19(18)10-16(15)2)20-6-3-5-17(11-20)22(26)24-23-12-21-7-4-8-27-21/h3-12H,13-14H2,1-2H3,(H,24,26)/b23-12-
* **INCHI Key:** GEVKZGPEQJGUIW-FMCGGJTJSA-N
* **Molecular Weight:** 359.42
* **Canonical SMILES:** CC1=CC2=C(CN(C2)C3=CC=CC(=C3)C(=O)NN=CC4=CC=CO4)C=C1C
* **Isomeric SMILES:** CC1=CC2=C(CN(C2)C3=CC=CC(=C3)C(=O)N/N=C\\C4=CC=CO4)C=C1C
* **Molecular Formula:** C22H21N3O2
{{:chemogenomics:structures:chem-0150.svg?nolink}}
* **Supplier Name:** Chem Bridge
* **Catalog #:** 5554888
* **Lot #:** Batch #01
* **HRMS (ESI-TOF) m/z:** [M+H]+ Calcd for C22H22N3O2 360.1707; found 360.1618
* **Platform ID:** UM0011500
* **Min:** -8.2089; **Max:** 6.7698
{{:chemogenomics:dose_response:dr_246.png?nolink&500 |}}
\\
\\
\\
\\
|< 300px 100px 200px >|
^ IC ^ Concentration (µM) ^
| IC10 |N/A |
| IC20 |N/A |
| IC30 |N/A |
| IC40 |N/A |
| IC50 |N/A |
| IC60 |N/A |
| IC70 |N/A |
| IC80 |N/A |
| IC90 |N/A |
\\
==== Screen Summary ====
* **Round**: 05
* **Dose**: 5µM
* **Days of incubation**: 8
* **Doublings**: 6.6
* **Numbers of reads**: 17275503
==== Screen Results ====
^Sensitive/Resistant hits (FDR<0.05)^CRANKS^Score Plot^Top 30 Genes^Screen Similarity^Top 30 Sensitive GO terms^Top 30 Resistant GO terms^
|7/2|[[https://files.tyerslab.com/files/public/chemogenomics/cranks/UM0011500_5uM_Round-5_exp245.txt|Scores]]||||||
{{:chemogenomics:cranks_plots:exp245.png?nolink}}
^Gene^CRANKS Score^FDR^
|[[:human_genes:P:PPT1|PPT1]]|-3.82|<0.01|
|[[:human_genes:K:KDSR|KDSR]]|-3.57|<0.01|
|[[:human_genes:M:MEF2C|MEF2C]]|-3.29|<0.01|
|[[:human_genes:S:SSR2|SSR2]]|-3.02|<0.01|
|[[:human_genes:N:NPRL3|NPRL3]]|-3.00|0.02|
|[[:human_genes:C:CCDC22|CCDC22]]|-2.80|0.01|
|[[:human_genes:S:SLC5A3|SLC5A3]]|-2.67|0.02|
|[[:human_genes:A:ADSL|ADSL]]|-2.57|0.16|
|[[:human_genes:U:UGGT1|UGGT1]]|-2.55|0.08|
|[[:human_genes:S:STT3A|STT3A]]|-2.48|0.15|
|[[:human_genes:P:PLA2G15|PLA2G15]]|-2.46|0.09|
|[[:human_genes:P:PGGT1B|PGGT1B]]|-2.40|0.08|
|[[:human_genes:Z:ZRSR2|ZRSR2]]|-2.35|0.09|
|[[:human_genes:A:ATRX|ATRX]]|-2.33|0.09|
|[[:human_genes:R:RPP21|RPP21]]|-2.31|0.09|
|[[:human_genes:M:MCM9|MCM9]]|-2.28|0.15|
|[[:human_genes:R:RABGEF1|RABGEF1]]|-2.27|0.15|
|[[:human_genes:R:RPE|RPE]]|-2.27|0.15|
|[[:human_genes:L:LIPA|LIPA]]|-2.25|0.12|
|[[:human_genes:S:SEPHS1|SEPHS1]]|-2.17|0.18|
|[[:human_genes:S:SNX18|SNX18]]|-2.16|0.25|
|[[:human_genes:M:MBNL1|MBNL1]]|-2.15|0.15|
|[[:human_genes:Z:ZBTB7A|ZBTB7A]]|-2.15|0.15|
|[[:human_genes:A:AP5Z1|AP5Z1]]|-2.14|0.15|
|[[:human_genes:G:GYS2|GYS2]]|-2.11|0.16|
|[[:human_genes:G:GCLC|GCLC]]|-2.09|0.22|
|[[:human_genes:A:ASB3|ASB3]]|-2.09|0.17|
|[[:human_genes:U:UNC50|UNC50]]|-2.08|0.17|
|[[:human_genes:S:SCO2|SCO2]]|-2.08|0.17|
|[[:human_genes:P:PMM2|PMM2]]|-2.07|0.17|
|[[:human_genes:C:CD33|CD33]]|2.01|0.35|
|[[:human_genes:A:AURKA|AURKA]]|2.02|0.49|
|[[:human_genes:R:RPL10A|RPL10A]]|2.04|0.51|
|[[:human_genes:P:PSMC2|PSMC2]]|2.07|0.51|
|[[:human_genes:N:NKAP|NKAP]]|2.07|0.45|
|[[:human_genes:P:PDE7A|PDE7A]]|2.09|0.30|
|[[:human_genes:P:POLR2L|POLR2L]]|2.10|0.69|
|[[:human_genes:K:KIAA1671|KIAA1671]]|2.11|0.35|
|[[:human_genes:C:CHD4|CHD4]]|2.14|0.44|
|[[:human_genes:C:COPB2|COPB2]]|2.15|0.57|
|[[:human_genes:R:RRP7A|RRP7A]]|2.18|0.31|
|[[:human_genes:C:CCDC41|CCDC41]]|2.21|0.30|
|[[:human_genes:U:UBE2G1|UBE2G1]]|2.22|0.18|
|[[:human_genes:P:POLA1|POLA1]]|2.23|0.60|
|[[:human_genes:M:MGST1|MGST1]]|2.26|0.15|
|[[:human_genes:C:COPB1|COPB1]]|2.26|0.51|
|[[:human_genes:K:KRTAP4-9|KRTAP4-9]]|2.27|0.15|
|[[:human_genes:N:NPC2|NPC2]]|2.31|0.15|
|[[:human_genes:M:M6PR|M6PR]]|2.35|0.14|
|[[:human_genes:L:LLPH|LLPH]]|2.41|0.27|
|[[:human_genes:E:EIF4E1B|EIF4E1B]]|2.41|0.15|
|[[:human_genes:N:NGDN|NGDN]]|2.45|0.35|
|[[:human_genes:R:RPS19|RPS19]]|2.46|0.45|
|[[:human_genes:C:CD72|CD72]]|2.47|0.09|
|[[:human_genes:N:NPC1|NPC1]]|2.51|0.09|
|[[:human_genes:D:DTL|DTL]]|2.52|0.30|
|[[:human_genes:S:SEC23B|SEC23B]]|2.53|0.14|
|[[:human_genes:T:TP53I13|TP53I13]]|2.81|0.06|
|[[:human_genes:P:PLBD2|PLBD2]]|2.92|0.01|
|[[:human_genes:P:PSAP|PSAP]]|4.08|<0.01|
^Screen^Correlation^Plot^
|[[:results:exp246|UM0011500 10μM R05 exp246]]|0.097||
|[[:results:exp453|B02 10μM R08 exp453]]|0.056||
|[[:results:exp271|CCT251545 0.2μM R06 exp271]]|0.052||
{{:chemogenomics:comparison_plots:exp245_vs_exp246.png?nolink |}}
{{:chemogenomics:comparison_plots:exp245_vs_exp453.png?nolink |}}
{{:chemogenomics:comparison_plots:exp245_vs_exp271.png?nolink |}}
No GO term hits below threshold. (FDR <0.05)
No GO term hits below threshold. (FDR <0.05)