====== VE-822 0.04μM R06 exp300 ======
==== Mechanism of Action ====
Inhibits ATR
  * **<color #00a2e8>Class / Subclass 1:</color>** DNA Damage, Repair and Replication / Checkpoint Signaling Inhibitor
  * **<color #00a2e8>Class / Subclass 2:</color>** Signal Transduction / Kinase Inhibitor



==== Technical Notes ====
<accordion collapsed='true'>
<panel title='Compound References' collapsed='true'>
    * **<color #00a2e8>PubChem Name:</color>** %%Berzosertib%%
    * **<color #00a2e8>Synonyms:</color>** VE-822; VX-970
    * **<color #00a2e8>CAS #:</color>** 1232416-25-9
    * **<color #00a2e8>PubChem CID:</color>** [[https://pubchem.ncbi.nlm.nih.gov/compound/59472121|59472121]]
    * **<color #00a2e8>IUPAC:</color>** %%3-[3-[4-(methylaminomethyl)phenyl]-1,2-oxazol-5-yl]-5-(4-propan-2-ylsulfonylphenyl)pyrazin-2-amine%%
    * **<color #00a2e8>INCHI Name:</color>** InChI=1S/C24H25N5O3S/c1-15(2)33(30,31)19-10-8-18(9-11-19)21-14-27-24(25)23(28-21)22-12-20(29-32-22)17-6-4-16(5-7-17)13-26-3/h4-12,14-15,26H,13H2,1-3H3,(H2,25,27)
    * **<color #00a2e8>INCHI Key:</color>** JZCWLJDSIRUGIN-UHFFFAOYSA-N
    * **<color #00a2e8>Molecular Weight:</color>** 463.6
    * **<color #00a2e8>Canonical SMILES:</color>** CC(C)S(=O)(=O)C1=CC=C(C=C1)C2=CN=C(C(=N2)C3=CC(=NO3)C4=CC=C(C=C4)CNC)N
    * **<color #00a2e8>Isomeric SMILES:</color>** N/A
    * **<color #00a2e8>Molecular Formula:</color>** C24H25N5O3S
{{:chemogenomics:structures:chem-0187.svg?nolink}}
</panel>


<panel title='Compound Supplier' collapsed='true'>
    * **<color #00a2e8>Supplier Name:</color>** Med Chem Express
    * **<color #00a2e8>Catalog #:</color>** HY-13902
    * **<color #00a2e8>Lot #:</color>** 17079
</panel>


<panel title='Compound Characterization' collapsed='true'>
Characterization data not available.
</panel>


<panel title='Dose Response Curve' collapsed='true'>
    * **<color #00a2e8>Platform ID:</color>** VE-822
    * **<color #00a2e8>Min:</color>** -5.9628; **<color #00a2e8>Max:</color>** 99.8728
{{:chemogenomics:dose_response:dr_321.png?nolink&500 |}}
\\ 
\\ 
\\ 
\\ 
|< 300px 100px 200px >|
^ IC   ^ Concentration (µM) ^
| IC10  |N/A    |
| IC20  |N/A    |
| IC30  |0.0441    |
| IC40  |N/A    |
| IC50  |0.0816    |
| IC60  |N/A    |
| IC70  |N/A    |
| IC80  |N/A    |
| IC90  |N/A    |
\\ 
</panel>
</accordion>
==== Screen Summary ====
    * **<color #00a2e8>Round</color>**: 06
    * **<color #00a2e8>Dose</color>**: 40nM
    * **<color #00a2e8>Days of incubation</color>**: 8
    * **<color #00a2e8>Doublings</color>**: 7.2
    * **<color #00a2e8>Numbers of reads</color>**: 8181743


==== Screen Results ====


^Sensitive/Resistant hits (FDR<0.05)^CRANKS^Score Plot^Top 30 Genes^Screen Similarity^Top 30 Sensitive GO terms^Top 30 Resistant GO terms^
|0/0|<color #e85500>[[https://files.tyerslab.com/files/public/chemogenomics/cranks/VE-822_0.04uM_Round-6_exp300.txt|Scores]]</color>|<button type="primary" size="sm" modal="ScorePlot">View</button>|<button type="primary" size="sm" modal="modal_hits">View</button>|<button type="default" size="sm" modal="modal_screen_similarity">View</button>|<button type="default" size="sm" modal="modal_go_sensitive">View</button>|<button type="default" size="sm" modal="modal_go_resistant">View</button>|
<modal id='ScorePlot' size='lg' title='VE-822 0.04μM R06 exp300'>
{{:chemogenomics:cranks_plots:exp300.png?nolink}}
</modal>


<modal id="modal_hits" size="sm" title="Top 30 S/R Genes">
^Gene^CRANKS Score^FDR^
|[[:human_genes:E:ELSPBP1|ELSPBP1]]|-2.65|0.22|
|[[:human_genes:P:PRPS1|PRPS1]]|-2.61|0.30|
|[[:human_genes:A:ADSL|ADSL]]|-2.59|0.34|
|[[:human_genes:D:DPAGT1|DPAGT1]]|-2.56|0.22|
|[[:human_genes:C:COPS7B|COPS7B]]|-2.42|0.22|
|[[:human_genes:Z:ZNF202|ZNF202]]|-2.37|0.34|
|[[:human_genes:N:NLRP4|NLRP4]]|-2.27|0.34|
|[[:human_genes:T:TMEM155|TMEM155]]|-2.22|0.34|
|[[:human_genes:Z:ZNF219|ZNF219]]|-2.22|0.45|
|[[:human_genes:M:MEST|MEST]]|-2.20|0.34|
|[[:human_genes:P:PFAS|PFAS]]|-2.20|0.71|
|[[:human_genes:N:NAGS|NAGS]]|-2.10|0.34|
|[[:human_genes:P:PMVK|PMVK]]|-2.09|0.34|
|[[:human_genes:M:MYH15|MYH15]]|-2.08|0.34|
|[[:human_genes:R:RMND5A|RMND5A]]|-2.07|0.34|
|[[:human_genes:C:CASP10|CASP10]]|-2.05|0.34|
|[[:human_genes:L:LRRC61|LRRC61]]|-2.05|0.34|
|[[:human_genes:L:LRRC4|LRRC4]]|-2.04|0.34|
|[[:human_genes:C:CLP1|CLP1]]|-2.00|0.84|
|[[:human_genes:C:C8B|C8B]]|-1.97|0.45|
|[[:human_genes:C:CNOT8|CNOT8]]|-1.97|0.45|
|[[:human_genes:L:LAYN|LAYN]]|-1.92|0.65|
|[[:human_genes:Z:ZBTB8OS|ZBTB8OS]]|-1.92|0.83|
|[[:human_genes:M:MTMR6|MTMR6]]|-1.90|0.71|
|[[:human_genes:T:TCF4|TCF4]]|-1.89|0.57|
|[[:human_genes:M:MRPS22|MRPS22]]|-1.89|0.57|
|[[:human_genes:H:HELQ|HELQ]]|-1.88|0.57|
|[[:human_genes:P:PAPD4|PAPD4]]|-1.88|0.57|
|[[:human_genes:K:KPNA4|KPNA4]]|-1.87|0.58|
|[[:human_genes:S:SMAD9|SMAD9]]|-1.87|0.71|
|[[:human_genes:D:DDX54|DDX54]]|1.93|0.77|
|[[:human_genes:P:PPP3CA|PPP3CA]]|1.93|0.59|
|[[:human_genes:A:AURKA|AURKA]]|1.94|0.77|
|[[:human_genes:N:NVL|NVL]]|1.97|0.77|
|[[:human_genes:I:IQCE|IQCE]]|1.97|0.67|
|[[:human_genes:S:SI|SI]]|1.97|0.51|
|[[:human_genes:T:TREML4|TREML4]]|1.98|0.67|
|[[:human_genes:L:LOC643669|LOC643669]]|2.00|0.63|
|[[:human_genes:R:RPL27A|RPL27A]]|2.02|0.82|
|[[:human_genes:P:PLA2G2E|PLA2G2E]]|2.02|0.41|
|[[:human_genes:R:RPS6KL1|RPS6KL1]]|2.02|0.60|
|[[:human_genes:R:RMI1|RMI1]]|2.03|0.60|
|[[:human_genes:I:IER3IP1|IER3IP1]]|2.07|0.38|
|[[:human_genes:N:NPIPB3|NPIPB3]]|2.08|0.87|
|[[:human_genes:C:CCDC169|CCDC169]]|2.13|0.34|
|[[:human_genes:C:C14orf2|C14orf2]]|2.14|0.41|
|[[:human_genes:Z:ZKSCAN8|ZKSCAN8]]|2.15|0.34|
|[[:human_genes:C:COPB2|COPB2]]|2.15|0.77|
|[[:human_genes:Z:ZNF292|ZNF292]]|2.16|0.34|
|[[:human_genes:N:NUDT11|NUDT11]]|2.18|0.38|
|[[:human_genes:Z:ZNF135|ZNF135]]|2.21|0.34|
|[[:human_genes:S:SLC35E2B|SLC35E2B]]|2.36|0.34|
|[[:human_genes:E:ERLIN2|ERLIN2]]|2.37|0.34|
|[[:human_genes:B:BLM|BLM]]|2.39|0.34|
|[[:human_genes:N:NPIPA5|NPIPA5]]|2.50|0.38|
|[[:human_genes:U:USP51|USP51]]|2.51|0.34|
|[[:human_genes:E:EIF5|EIF5]]|2.61|0.34|
|[[:human_genes:R:RPL13|RPL13]]|2.67|0.77|
|[[:human_genes:H:HAP1|HAP1]]|2.84|0.15|
|[[:human_genes:P:POLA1|POLA1]]|3.05|0.38|
</modal>


<modal id="modal_screen_similarity" size="lg" title="Correlated Screens">
No correlation data above threshold. (correlation > 0.05)
</modal>


<modal id="modal_go_sensitive" size="lg" title="Top 30 sensitive GO terms">No GO term hits below threshold. (FDR <0.05)</modal>
<modal id="modal_go_resistant" size="lg" title="Top 30 resistant GO terms">No GO term hits below threshold. (FDR <0.05)</modal>