====== Pifithrin-alpha 20μM R07 exp390 ======
==== Mechanism of Action ====
Claimed to inhibit p53 but has p53-independent effects, cyclic form may increase stem cell reprogramming
  * **<color #00a2e8>Class / Subclass 1:</color>** Signal Transduction / Apoptosis Inhibitor




==== Technical Notes ====
<accordion collapsed='true'>
<panel title='Compound References' collapsed='true'>
    * **<color #00a2e8>PubChem Name:</color>** %%Pifithrin-alpha%%
    * **<color #00a2e8>Synonyms:</color>** Pifithrin hydrobromide; PFTα hydrobromide
    * **<color #00a2e8>CAS #:</color>** 63208-82-2
    * **<color #00a2e8>PubChem CID:</color>** [[https://pubchem.ncbi.nlm.nih.gov/compound/9929138|9929138]]
    * **<color #00a2e8>IUPAC:</color>** %%2-(2-imino-4,5,6,7-tetrahydro-1,3-benzothiazol-3-yl)-1-(4-methylphenyl)ethanone;hydrobromide%%
    * **<color #00a2e8>INCHI Name:</color>** InChI=1S/C16H18N2OS.BrH/c1-11-6-8-12(9-7-11)14(19)10-18-13-4-2-3-5-15(13)20-16(18)17;/h6-9,17H,2-5,10H2,1H3;1H
    * **<color #00a2e8>INCHI Key:</color>** HAGVCKULCLQGRF-UHFFFAOYSA-N
    * **<color #00a2e8>Molecular Weight:</color>** 367.3
    * **<color #00a2e8>Canonical SMILES:</color>** CC1=CC=C(C=C1)C(=O)CN2C3=C(CCCC3)SC2=N.Br
    * **<color #00a2e8>Isomeric SMILES:</color>** N/A
    * **<color #00a2e8>Molecular Formula:</color>** C16H19BrN2OS
{{:chemogenomics:structures:chem-0232.svg?nolink}}
</panel>


<panel title='Compound Supplier' collapsed='true'>
    * **<color #00a2e8>Supplier Name:</color>** Sigma-Aldrich
    * **<color #00a2e8>Catalog #:</color>** P4359
    * **<color #00a2e8>Lot #:</color>** N/A
</panel>


<panel title='Compound Characterization' collapsed='true'>
    * **<color #00a2e8>HRMS (ESI-TOF) m/z:</color>** (M+H)+ Calcd for C16H18N2OS 287.12126; found 287.12088
</panel>


<panel title='Dose Response Curve' collapsed='true'>
    * **<color #00a2e8>Platform ID:</color>** pifithrin-alpha
    * **<color #00a2e8>Min:</color>** -5.8398; **<color #00a2e8>Max:</color>** 30.3674
{{:chemogenomics:dose_response:dr_397.png?nolink&500 |}}
\\ 
\\ 
\\ 
\\ 
|< 300px 100px 200px >|
^ IC   ^ Concentration (µM) ^
| IC10  |N/A    |
| IC20  |N/A    |
| IC30  |N/A    |
| IC40  |N/A    |
| IC50  |N/A    |
| IC60  |N/A    |
| IC70  |N/A    |
| IC80  |N/A    |
| IC90  |N/A    |
\\ 
</panel>
</accordion>
==== Screen Summary ====
    * **<color #00a2e8>Round</color>**: 07
    * **<color #00a2e8>Dose</color>**: 20µM
    * **<color #00a2e8>Days of incubation</color>**: 8
    * **<color #00a2e8>Doublings</color>**: 6.0
    * **<color #00a2e8>Numbers of reads</color>**: 20313436


==== Screen Results ====


^Sensitive/Resistant hits (FDR<0.05)^CRANKS^Score Plot^Top 30 Genes^Screen Similarity^Top 30 Sensitive GO terms^Top 30 Resistant GO terms^
|1/0|<color #e85500>[[https://files.tyerslab.com/files/public/chemogenomics/cranks/Pifithrin-alpha_20uM_Round-7_exp390.txt|Scores]]</color>|<button type="primary" size="sm" modal="ScorePlot">View</button>|<button type="primary" size="sm" modal="modal_hits">View</button>|<button type="default" size="sm" modal="modal_screen_similarity">View</button>|<button type="default" size="sm" modal="modal_go_sensitive">View</button>|<button type="default" size="sm" modal="modal_go_resistant">View</button>|
<modal id='ScorePlot' size='lg' title='Pifithrin-alpha 20μM R07 exp390'>
{{:chemogenomics:cranks_plots:exp390.png?nolink}}
</modal>


<modal id="modal_hits" size="sm" title="Top 30 S/R Genes">
^Gene^CRANKS Score^FDR^
|[[:human_genes:S:SLC5A3|SLC5A3]]|-4.81|<0.01|
|[[:human_genes:B:BANF1|BANF1]]|-2.85|0.11|
|[[:human_genes:E:ECM2|ECM2]]|-2.62|0.12|
|[[:human_genes:N:NOC3L|NOC3L]]|-2.58|0.44|
|[[:human_genes:C:C6orf203|C6orf203]]|-2.55|0.11|
|[[:human_genes:A:ALG5|ALG5]]|-2.43|0.12|
|[[:human_genes:D:DKC1|DKC1]]|-2.41|0.78|
|[[:human_genes:H:HSPA9|HSPA9]]|-2.28|0.87|
|[[:human_genes:M:MS4A13|MS4A13]]|-2.21|0.88|
|[[:human_genes:U:UBE2NL|UBE2NL]]|-2.16|0.39|
|[[:human_genes:C:C11orf30|C11orf30]]|-2.16|0.39|
|[[:human_genes:O:OSGEP|OSGEP]]|-2.11|0.73|
|[[:human_genes:N:NHLRC2|NHLRC2]]|-2.10|0.58|
|[[:human_genes:N:NSD1|NSD1]]|-2.10|0.58|
|[[:human_genes:C:CSRP2BP|CSRP2BP]]|-2.05|0.58|
|[[:human_genes:S:SLC35A4|SLC35A4]]|-1.99|0.58|
|[[:human_genes:L:LRFN5|LRFN5]]|-1.97|0.58|
|[[:human_genes:K:KIF21A|KIF21A]]|-1.97|0.58|
|[[:human_genes:R:RBX1|RBX1]]|-1.96|0.75|
|[[:human_genes:G:GMPPB|GMPPB]]|-1.95|0.82|
|[[:human_genes:R:RPL36A|RPL36A]]|-1.92|0.70|
|[[:human_genes:K:KLHL31|KLHL31]]|-1.91|0.70|
|[[:human_genes:C:CRYBA2|CRYBA2]]|-1.90|0.70|
|[[:human_genes:C:CHKA|CHKA]]|-1.86|0.73|
|[[:human_genes:K:KIAA1432|KIAA1432]]|-1.84|0.73|
|[[:human_genes:S:SCAP|SCAP]]|-1.84|0.73|
|[[:human_genes:S:SMARCAD1|SMARCAD1]]|-1.84|0.73|
|[[:human_genes:M:MMP8|MMP8]]|-1.82|0.73|
|[[:human_genes:P:PAFAH1B2|PAFAH1B2]]|-1.82|0.75|
|[[:human_genes:R:RNF40|RNF40]]|-1.82|0.73|
|[[:human_genes:G:GPX5|GPX5]]|1.95|0.56|
|[[:human_genes:V:VPS8|VPS8]]|1.96|0.48|
|[[:human_genes:A:ADIPOR1|ADIPOR1]]|1.97|0.48|
|[[:human_genes:K:KLK9|KLK9]]|1.97|0.56|
|[[:human_genes:M:MYOC|MYOC]]|1.97|0.64|
|[[:human_genes:S:SMIM6|SMIM6]]|1.98|0.56|
|[[:human_genes:E:ERMP1|ERMP1]]|2.02|0.48|
|[[:human_genes:P:PSMD6|PSMD6]]|2.03|0.69|
|[[:human_genes:H:HOXC6|HOXC6]]|2.05|0.51|
|[[:human_genes:R:RBM8A|RBM8A]]|2.05|0.56|
|[[:human_genes:T:TMEM71|TMEM71]]|2.05|0.46|
|[[:human_genes:M:MKI67|MKI67]]|2.07|0.48|
|[[:human_genes:F:FBXW11|FBXW11]]|2.08|0.48|
|[[:human_genes:I:IQSEC2|IQSEC2]]|2.09|0.39|
|[[:human_genes:D:DYNC1I1|DYNC1I1]]|2.12|0.39|
|[[:human_genes:H:HPS5|HPS5]]|2.14|0.56|
|[[:human_genes:P:PSME3|PSME3]]|2.16|0.36|
|[[:human_genes:A:AUNIP|AUNIP]]|2.17|0.36|
|[[:human_genes:S:SLC31A1|SLC31A1]]|2.18|0.36|
|[[:human_genes:S:SUPT5H|SUPT5H]]|2.21|0.56|
|[[:human_genes:P:PDS5B|PDS5B]]|2.22|0.36|
|[[:human_genes:G:GANAB|GANAB]]|2.23|0.48|
|[[:human_genes:E:EXOSC3|EXOSC3]]|2.24|0.39|
|[[:human_genes:M:MYB|MYB]]|2.25|0.56|
|[[:human_genes:I:IL21R|IL21R]]|2.25|0.36|
|[[:human_genes:E:EIF3A|EIF3A]]|2.45|0.36|
|[[:human_genes:S:SLC1A5|SLC1A5]]|2.69|0.36|
|[[:human_genes:M:MGAT4D|MGAT4D]]|2.80|0.65|
|[[:human_genes:U:USP17L19|USP17L19]]|2.87|0.48|
|[[:human_genes:P:POLA1|POLA1]]|3.76|0.36|
</modal>


<modal id="modal_screen_similarity" size="lg" title="Correlated Screens">
No correlation data above threshold. (correlation > 0.05)
</modal>


<modal id="modal_go_sensitive" size="lg" title="Top 30 sensitive GO terms">No GO term hits below threshold. (FDR <0.05)</modal>
<modal id="modal_go_resistant" size="lg" title="Top 30 resistant GO terms">No GO term hits below threshold. (FDR <0.05)</modal>