====== Cincreasin 100μM R08 exp473 ======
==== Mechanism of Action ====
Inhibits budding yeast Mps1 but not human MPS1 (TTK), overrides spindle checkpoint
  * **<color #00a2e8>Class / Subclass 1:</color>** Signal Transduction / Kinase Inhibitor
  * **<color #00a2e8>Class / Subclass 2:</color>** Organelle Function / Cytoskeletal Inhibitor
  * **<color #00a2e8>Class / Subclass 3:</color>** Cell Cycle / Actin Inhibitor


==== Technical Notes ====
<accordion collapsed='true'>
<panel title='Compound References' collapsed='true'>
    * **<color #00a2e8>PubChem Name:</color>** %%6-Bromo-2-benzoxazolinone%%
    * **<color #00a2e8>Synonyms:</color>** N/A
    * **<color #00a2e8>CAS #:</color>** 19932-85-5
    * **<color #00a2e8>PubChem CID:</color>** [[https://pubchem.ncbi.nlm.nih.gov/compound/29859|29859]]
    * **<color #00a2e8>IUPAC:</color>** %%6-bromo-3H-1,3-benzoxazol-2-one%%
    * **<color #00a2e8>INCHI Name:</color>** InChI=1S/C7H4BrNO2/c8-4-1-2-5-6(3-4)11-7(10)9-5/h1-3H,(H,9,10)
    * **<color #00a2e8>INCHI Key:</color>** DDNKJFBQMQOIKI-UHFFFAOYSA-N
    * **<color #00a2e8>Molecular Weight:</color>** 214.02
    * **<color #00a2e8>Canonical SMILES:</color>** C1=CC2=C(C=C1Br)OC(=O)N2
    * **<color #00a2e8>Isomeric SMILES:</color>** N/A
    * **<color #00a2e8>Molecular Formula:</color>** C7H4BrNO2
{{:chemogenomics:structures:chem-0282.svg?nolink}}
</panel>


<panel title='Compound Supplier' collapsed='true'>
    * **<color #00a2e8>Supplier Name:</color>** Combi-Blocks
    * **<color #00a2e8>Catalog #:</color>** HI-1909
    * **<color #00a2e8>Lot #:</color>** B75436
</panel>


<panel title='Compound Characterization' collapsed='true'>
    * **<color #00a2e8>LCMS:</color>** Tr 1.16 min, m/z 212- [M-H]-
</panel>


<panel title='Dose Response Curve' collapsed='true'>
    * **<color #00a2e8>Platform ID:</color>** Cincreasin
    * **<color #00a2e8>Min:</color>** -10.4527; **<color #00a2e8>Max:</color>** 28.7557
{{:chemogenomics:dose_response:dr_519.png?nolink&500 |}}
\\ 
\\ 
\\ 
\\ 
|< 300px 100px 200px >|
^ IC   ^ Concentration (µM) ^
| IC10  |N/A    |
| IC20  |N/A    |
| IC30  |N/A    |
| IC40  |N/A    |
| IC50  |N/A    |
| IC60  |N/A    |
| IC70  |N/A    |
| IC80  |N/A    |
| IC90  |N/A    |
\\ 
</panel>
</accordion>
==== Screen Summary ====
    * **<color #00a2e8>Round</color>**: 08
    * **<color #00a2e8>Dose</color>**: 100µM
    * **<color #00a2e8>Days of incubation</color>**: 8
    * **<color #00a2e8>Doublings</color>**: 6.5
    * **<color #00a2e8>Numbers of reads</color>**: 20599152


==== Screen Results ====


^Sensitive/Resistant hits (FDR<0.05)^CRANKS^Score Plot^Top 30 Genes^Screen Similarity^Top 30 Sensitive GO terms^Top 30 Resistant GO terms^
|1/0|<color #e85500>[[https://files.tyerslab.com/files/public/chemogenomics/cranks/Cincreasin_100uM_Round-8_exp473.txt|Scores]]</color>|<button type="primary" size="sm" modal="ScorePlot">View</button>|<button type="primary" size="sm" modal="modal_hits">View</button>|<button type="primary" size="sm" modal="modal_screen_similarity">View</button>|<button type="primary" size="sm" modal="modal_go_sensitive">View</button>|<button type="default" size="sm" modal="modal_go_resistant">View</button>|
<modal id='ScorePlot' size='lg' title='Cincreasin 100μM R08 exp473'>
{{:chemogenomics:cranks_plots:exp473.png?nolink}}
</modal>


<modal id="modal_hits" size="sm" title="Top 30 S/R Genes">
^Gene^CRANKS Score^FDR^
|[[:human_genes:K:KDSR|KDSR]]|-3.07|<0.01|
|[[:human_genes:T:TRIM44|TRIM44]]|-2.62|0.11|
|[[:human_genes:C:CHKA|CHKA]]|-2.62|0.08|
|[[:human_genes:T:TMED10|TMED10]]|-2.59|0.08|
|[[:human_genes:A:AUP1|AUP1]]|-2.47|0.37|
|[[:human_genes:C:CYP1A1|CYP1A1]]|-2.43|0.12|
|[[:human_genes:D:DYNC1H1|DYNC1H1]]|-2.24|0.83|
|[[:human_genes:D:DPAGT1|DPAGT1]]|-2.22|0.45|
|[[:human_genes:J:JTB|JTB]]|-2.17|0.37|
|[[:human_genes:G:GPR107|GPR107]]|-2.15|0.37|
|[[:human_genes:S:SARS|SARS]]|-2.15|0.90|
|[[:human_genes:G:GPN1|GPN1]]|-2.15|0.52|
|[[:human_genes:S:SLIT1|SLIT1]]|-2.13|0.52|
|[[:human_genes:I:IQCD|IQCD]]|-2.00|0.52|
|[[:human_genes:Y:YARS|YARS]]|-2.00|0.83|
|[[:human_genes:P:P2RY2|P2RY2]]|-2.00|0.52|
|[[:human_genes:N:NOSTRIN|NOSTRIN]]|-1.99|0.52|
|[[:human_genes:C:CHTOP|CHTOP]]|-1.94|0.69|
|[[:human_genes:A:ALG3|ALG3]]|-1.91|0.62|
|[[:human_genes:T:TUBA1C|TUBA1C]]|-1.91|0.79|
|[[:human_genes:L:LAMTOR4|LAMTOR4]]|-1.91|0.62|
|[[:human_genes:T:TBK1|TBK1]]|-1.90|0.62|
|[[:human_genes:A:ALG12|ALG12]]|-1.89|0.62|
|[[:human_genes:S:SYT10|SYT10]]|-1.89|0.62|
|[[:human_genes:P:PPP1R1B|PPP1R1B]]|-1.89|0.62|
|[[:human_genes:S:SLC39A10|SLC39A10]]|-1.88|0.63|
|[[:human_genes:M:MBTPS2|MBTPS2]]|-1.87|0.63|
|[[:human_genes:M:MAGI2|MAGI2]]|-1.85|0.79|
|[[:human_genes:F:FETUB|FETUB]]|-1.84|0.69|
|[[:human_genes:R:RER1|RER1]]|-1.83|0.69|
|[[:human_genes:C:CHAF1A|CHAF1A]]|1.83|0.80|
|[[:human_genes:O:OR5R1|OR5R1]]|1.83|0.76|
|[[:human_genes:R:RPS13|RPS13]]|1.85|0.80|
|[[:human_genes:R:RPS15A|RPS15A]]|1.85|0.83|
|[[:human_genes:K:KRTAP4-1|KRTAP4-1]]|1.85|0.76|
|[[:human_genes:D:DTX3|DTX3]]|1.86|0.80|
|[[:human_genes:C:CNGB3|CNGB3]]|1.90|0.66|
|[[:human_genes:P:PSMD7|PSMD7]]|1.91|0.80|
|[[:human_genes:R:REV1|REV1]]|1.92|0.65|
|[[:human_genes:I:INTS6|INTS6]]|1.93|0.80|
|[[:human_genes:E:EPPIN|EPPIN]]|1.94|0.65|
|[[:human_genes:M:MST4|MST4]]|1.95|0.65|
|[[:human_genes:F:FAM179A|FAM179A]]|1.97|0.76|
|[[:human_genes:S:SLC6A17|SLC6A17]]|2.01|0.66|
|[[:human_genes:P:PSMC3|PSMC3]]|2.02|0.80|
|[[:human_genes:D:DEPDC4|DEPDC4]]|2.04|0.65|
|[[:human_genes:S:SDHB|SDHB]]|2.04|0.57|
|[[:human_genes:M:MIR205HG|MIR205HG]]|2.08|0.80|
|[[:human_genes:C:CDKL1|CDKL1]]|2.10|0.53|
|[[:human_genes:K:KIAA0355|KIAA0355]]|2.10|0.65|
|[[:human_genes:H:HAT1|HAT1]]|2.11|0.53|
|[[:human_genes:K:KRTAP9-9|KRTAP9-9]]|2.15|0.57|
|[[:human_genes:E:EXOSC3|EXOSC3]]|2.17|0.57|
|[[:human_genes:T:TINF2|TINF2]]|2.18|0.65|
|[[:human_genes:T:TMEM174|TMEM174]]|2.22|0.53|
|[[:human_genes:F:FRMD1|FRMD1]]|2.24|0.47|
|[[:human_genes:R:RPN2|RPN2]]|2.29|0.47|
|[[:human_genes:E:EXOSC9|EXOSC9]]|2.29|0.47|
|[[:human_genes:A:ATP8B2|ATP8B2]]|2.49|0.47|
|[[:human_genes:N:NUP214|NUP214]]|2.53|0.47|
</modal>


<modal id="modal_screen_similarity" size="lg" title="Correlated Screens">
^Screen^Correlation^Plot^
|[[:results:exp438|NN-Diethyl-meta-toluamide 500μM R08 exp438]]|0.06|<button type="primary" size="small" modal="1">View</button>|
</modal>


<modal id="1" size="lg" title="Cincreasin 100μM R08 exp473  vs  NN-Diethyl-meta-toluamide 500μM R08 exp438">
{{:chemogenomics:comparison_plots:exp438_vs_exp473.png?nolink |}}
</modal>



<modal id="modal_go_sensitive" size="lg" title="Top 30 sensitive GO terms">
^GO Term^Fold Change^Genes^
|oligosaccharide-lipid intermediate biosynthetic process|85.70|DPAGT1,ALG3,ALG12|
|dolichol metabolic process|81.62|DPAGT1,ALG3,ALG12|
</modal>
<modal id="modal_go_resistant" size="lg" title="Top 30 resistant GO terms">No GO term hits below threshold. (FDR <0.05)</modal>