====== INK128 0.2μM R02 exp70 ======
==== Mechanism of Action ====
Inhibits mTORC1 and mTORC2, ATP-competitive
* **Class / Subclass 1:** Signal Transduction / Kinase Inhibitor
* **Class / Subclass 2:** Proteostasis / mTOR inhibitor
==== Technical Notes ====
* **PubChem Name:** %%Sapanisertib%%
* **Synonyms:** INK-128; MLN0128; TAK-228
* **CAS #:** 1224844-38-5
* **PubChem CID:** [[https://pubchem.ncbi.nlm.nih.gov/compound/45375953|45375953]]
* **IUPAC:** %%5-(4-amino-1-propan-2-ylpyrazolo[3,4-d]pyrimidin-3-yl)-1,3-benzoxazol-2-amine%%
* **INCHI Name:** InChI=1S/C15H15N7O/c1-7(2)22-14-11(13(16)18-6-19-14)12(21-22)8-3-4-10-9(5-8)20-15(17)23-10/h3-7H,1-2H3,(H2,17,20)(H2,16,18,19)
* **INCHI Key:** GYLDXIAOMVERTK-UHFFFAOYSA-N
* **Molecular Weight:** 309.33
* **Canonical SMILES:** CC(C)N1C2=NC=NC(=C2C(=N1)C3=CC4=C(C=C3)OC(=N4)N)N
* **Isomeric SMILES:** N/A
* **Molecular Formula:** C15H15N7O
{{:chemogenomics:structures:chem-0046.svg?nolink}}
* **Supplier Name:** Selleck Chemicals
* **Catalog #:** S2811
* **Lot #:** N/A
* **HRMS (ESI-TOF) m/z:** (M+H)+ Calcd for C15H15N7O 310.14108; found 310.1415
* **Platform ID:** INK128
* **Min:** -13.2131; **Max:** 80.1073
{{:chemogenomics:dose_response:dr_11.png?nolink&500 |}}
\\
\\
\\
\\
|< 300px 100px 200px >|
^ IC ^ Concentration (µM) ^
| IC10 |N/A |
| IC20 |0.0967 |
| IC30 |0.1748 |
| IC40 |0.2838 |
| IC50 |0.4429 |
| IC60 |N/A |
| IC70 |N/A |
| IC80 |N/A |
| IC90 |N/A |
\\
==== Screen Summary ====
* **Round**: 02
* **Dose**: 200nM
* **Days of incubation**: 8
* **Doublings**: 3.4
* **Numbers of reads**: 9512731
==== Screen Results ====
^Sensitive/Resistant hits (FDR<0.05)^CRANKS^Score Plot^Top 30 Genes^Screen Similarity^Top 30 Sensitive GO terms^Top 30 Resistant GO terms^
|0/5|[[https://files.tyerslab.com/files/public/chemogenomics/cranks/INK128_0.2uM_Round-2_exp70.txt|Scores]]||||||
{{:chemogenomics:cranks_plots:exp70.png?nolink}}
^Gene^CRANKS Score^FDR^
|[[:human_genes:R:RRAGA|RRAGA]]|-2.75|0.12|
|[[:human_genes:T:THAP1|THAP1]]|-2.74|0.12|
|[[:human_genes:B:BIRC2|BIRC2]]|-2.62|0.12|
|[[:human_genes:R:RNF38|RNF38]]|-2.58|0.12|
|[[:human_genes:S:SLC1A2|SLC1A2]]|-2.42|0.12|
|[[:human_genes:L:LAMTOR4|LAMTOR4]]|-2.38|0.13|
|[[:human_genes:A:AQP10|AQP10]]|-2.32|0.49|
|[[:human_genes:G:GINS2|GINS2]]|-2.22|0.58|
|[[:human_genes:Z:ZXDB|ZXDB]]|-2.11|0.47|
|[[:human_genes:L:LAMTOR2|LAMTOR2]]|-2.10|0.47|
|[[:human_genes:T:TRAPPC8|TRAPPC8]]|-2.10|0.58|
|[[:human_genes:S:SIN3A|SIN3A]]|-2.09|0.47|
|[[:human_genes:N:NOP58|NOP58]]|-2.08|0.58|
|[[:human_genes:G:GPC1|GPC1]]|-2.05|0.49|
|[[:human_genes:X:XPO1|XPO1]]|-2.05|0.78|
|[[:human_genes:T:TRIM3|TRIM3]]|-2.03|0.49|
|[[:human_genes:F:FAM219A|FAM219A]]|-2.02|0.58|
|[[:human_genes:N:NRAS|NRAS]]|-2.00|0.58|
|[[:human_genes:K:KCTD5|KCTD5]]|-1.98|0.58|
|[[:human_genes:T:TIPRL|TIPRL]]|-1.98|0.58|
|[[:human_genes:C:C6orf118|C6orf118]]|-1.98|0.58|
|[[:human_genes:H:HEXIM1|HEXIM1]]|-1.97|0.58|
|[[:human_genes:U:U2AF2|U2AF2]]|-1.97|0.58|
|[[:human_genes:A:AKT1|AKT1]]|-1.95|0.58|
|[[:human_genes:L:LAMC2|LAMC2]]|-1.94|0.58|
|[[:human_genes:I:ICA1L|ICA1L]]|-1.91|0.58|
|[[:human_genes:O:OR5P3|OR5P3]]|-1.89|0.58|
|[[:human_genes:P:PDGFRB|PDGFRB]]|-1.89|0.58|
|[[:human_genes:V:VTA1|VTA1]]|-1.88|0.58|
|[[:human_genes:C:C3orf43|C3orf43]]|-1.86|0.58|
|[[:human_genes:T:TCTE3|TCTE3]]|2.05|0.31|
|[[:human_genes:D:DIAPH3|DIAPH3]]|2.08|0.37|
|[[:human_genes:B:BTK|BTK]]|2.09|0.31|
|[[:human_genes:A:ADIPOR1|ADIPOR1]]|2.09|0.21|
|[[:human_genes:F:FAM136A|FAM136A]]|2.10|0.34|
|[[:human_genes:T:TRIAP1|TRIAP1]]|2.10|0.34|
|[[:human_genes:D:DHX35|DHX35]]|2.10|0.21|
|[[:human_genes:E:EIF2AK3|EIF2AK3]]|2.12|0.21|
|[[:human_genes:N:NFATC3|NFATC3]]|2.13|0.27|
|[[:human_genes:E:EIF4A1|EIF4A1]]|2.14|0.27|
|[[:human_genes:D:DNAJC2|DNAJC2]]|2.20|0.39|
|[[:human_genes:U:UBE2H|UBE2H]]|2.20|0.16|
|[[:human_genes:P:PTEN|PTEN]]|2.23|0.15|
|[[:human_genes:R:RREB1|RREB1]]|2.24|0.21|
|[[:human_genes:P:POLRMT|POLRMT]]|2.24|0.15|
|[[:human_genes:L:LDHB|LDHB]]|2.27|0.20|
|[[:human_genes:E:EIF4EBP1|EIF4EBP1]]|2.30|0.14|
|[[:human_genes:S:SON|SON]]|2.31|0.17|
|[[:human_genes:T:TNC|TNC]]|2.38|0.10|
|[[:human_genes:Z:ZFC3H1|ZFC3H1]]|2.41|0.14|
|[[:human_genes:P:PGM3|PGM3]]|2.43|0.14|
|[[:human_genes:M:MEIG1|MEIG1]]|2.45|0.34|
|[[:human_genes:K:KIAA0195|KIAA0195]]|2.63|0.06|
|[[:human_genes:P:PSMD7|PSMD7]]|2.63|0.40|
|[[:human_genes:R:RPE|RPE]]|2.63|0.06|
|[[:human_genes:A:AKT1S1|AKT1S1]]|2.83|0.01|
|[[:human_genes:D:DAZAP1|DAZAP1]]|2.90|<0.01|
|[[:human_genes:F:FIBP|FIBP]]|4.09|<0.01|
|[[:human_genes:P:PPP3CA|PPP3CA]]|4.22|<0.01|
|[[:human_genes:P:PPP3R1|PPP3R1]]|4.73|<0.01|
^Screen^Correlation^Plot^
|[[:results:exp82|Torin1 0.08μM R02 exp82]]|0.116||
|[[:results:exp71|KU-0063794 3.8μM R02 exp71]]|0.094||
|[[:results:exp30|Rapamycin 10μM R00 exp30]]|0.058||
|[[:results:exp29|Rapamycin 1μM R00 exp29]]|0.057||
{{:chemogenomics:comparison_plots:exp70_vs_exp82.png?nolink |}}
{{:chemogenomics:comparison_plots:exp70_vs_exp71.png?nolink |}}
{{:chemogenomics:comparison_plots:exp30_vs_exp70.png?nolink |}}
{{:chemogenomics:comparison_plots:exp29_vs_exp70.png?nolink |}}
^GO Term^Fold Change^Genes^
|GTPase activator complex|184.27|RRAGA,LAMTOR4,LAMTOR2|
|enzyme activator complex|122.84|RRAGA,LAMTOR4,LAMTOR2|
|positive regulation of TORC1 signaling|49.14|RRAGA,LAMTOR4,LAMTOR2,AKT1|
^GO Term^Fold Change^Genes^
|calcineurin-NFAT signaling cascade|118.46|PPP3R1,PPP3CA,NFATC3|
|calcineurin-mediated signaling|97.55|PPP3R1,PPP3CA,NFATC3|
|calcium-mediated signaling|17.95|PPP3R1,PPP3CA,NFATC3,EIF2AK3,BTK|