====== S-DABN 8μM R03 exp112 ======
==== Mechanism of Action ====
Unknown, (S) atropisomer of 1,1'-Binaphthyl-2,2'-diamine
  * **<color #00a2e8>Class / Subclass 1:</color>** Uncharacterized Mechanism / Chemical Screen Hit




==== Technical Notes ====
<accordion collapsed='true'>
<panel title='Protein References' collapsed='true'>
    * **<color #00a2e8>PubChem Name:</color>** %%[1,1'-Binaphthalene]-2,2'-diamine%%
    * **<color #00a2e8>Synonyms:</color>** N/A
    * **<color #00a2e8>CAS #:</color>** 18531-95-8
    * **<color #00a2e8>PubChem CID:</color>** [[https://pubchem.ncbi.nlm.nih.gov/compound/20571|20571]]
    * **<color #00a2e8>IUPAC:</color>** %%1-(2-aminonaphthalen-1-yl)naphthalen-2-amine%%
    * **<color #00a2e8>INCHI Name:</color>** InChI=1S/C20H16N2/c21-17-11-9-13-5-1-3-7-15(13)19(17)20-16-8-4-2-6-14(16)10-12-18(20)22/h1-12H,21-22H2
    * **<color #00a2e8>INCHI Key:</color>** DDAPSNKEOHDLKB-UHFFFAOYSA-N
    * **<color #00a2e8>Molecular Weight:</color>** 284.4
    * **<color #00a2e8>Canonical SMILES:</color>** C1=CC=C2C(=C1)C=CC(=C2C3=C(C=CC4=CC=CC=C43)N)N
    * **<color #00a2e8>Isomeric SMILES:</color>** N/A
    * **<color #00a2e8>Molecular Formula:</color>** C20H16N2
{{:chemogenomics:structures:chem-0068.svg?nolink}}
</panel>


<panel title='Protein Supplier' collapsed='true'>
    * **<color #00a2e8>Supplier Name:</color>** Chem-Impex International
    * **<color #00a2e8>Catalog #:</color>** 24613
    * **<color #00a2e8>Lot #:</color>** 001702-20130513
</panel>


<panel title='Protein Characterization' collapsed='true'>
    * **<color #00a2e8>HRMS (ESI-TOF) m/z:</color>** (M+H)+ Calcd for C20H16N2 285.13862; found 285.13895
</panel>


<panel title='Dose Response Curve' collapsed='true'>
    * **<color #00a2e8>Platform ID:</color>** S-DABN
    * **<color #00a2e8>Min:</color>** 1.5908; **<color #00a2e8>Max:</color>** 30.0400
{{:chemogenomics:dose_response:dr_118.png?nolink&500 |}}
\\ 
\\ 
\\ 
\\ 
|< 300px 100px 200px >|
^ IC   ^ Concentration (µM) ^
| IC10  |N/A    |
| IC20  |N/A    |
| IC30  |N/A    |
| IC40  |N/A    |
| IC50  |N/A    |
| IC60  |N/A    |
| IC70  |N/A    |
| IC80  |N/A    |
| IC90  |N/A    |
\\ 
</panel>
</accordion>
==== Screen Summary ====
    * **<color #00a2e8>Round</color>**: 03
    * **<color #00a2e8>Dose</color>**: 8µM
    * **<color #00a2e8>Days of incubation</color>**: 8
    * **<color #00a2e8>Doublings</color>**: 7.8
    * **<color #00a2e8>Numbers of reads</color>**: 9548262


==== Screen Results ====


^Sensitive/Resistant hits (FDR<0.05)^CRANKS^Score Plot^Top 30 Genes^Screen Similarity^Top 30 Sensitive GO terms^Top 30 Resistant GO terms^
|0/1|<color #e85500>[[https://files.tyerslab.com/files/public/chemogenomics/cranks/S-DABN_8uM_Round-3_exp112.txt|Scores]]</color>|<button type="primary" size="sm" modal="ScorePlot">View</button>|<button type="primary" size="sm" modal="modal_hits">View</button>|<button type="default" size="sm" modal="modal_screen_similarity">View</button>|<button type="default" size="sm" modal="modal_go_sensitive">View</button>|<button type="default" size="sm" modal="modal_go_resistant">View</button>|
<modal id='ScorePlot' size='lg' title='S-DABN 8μM R03 exp112'>
{{:chemogenomics:cranks_plots:exp112.png?nolink}}
</modal>


<modal id="modal_hits" size="sm" title="Top 30 S/R Genes">
^Gene^CRANKS Score^FDR^
|[[:human_genes:C:CACHD1|CACHD1]]|-2.55|0.34|
|[[:human_genes:S:STAT6|STAT6]]|-2.35|0.34|
|[[:human_genes:F:FAM76B|FAM76B]]|-2.33|0.34|
|[[:human_genes:R:RABGGTB|RABGGTB]]|-2.33|0.53|
|[[:human_genes:S:SUCLG1|SUCLG1]]|-2.32|0.53|
|[[:human_genes:D:DDOST|DDOST]]|-2.14|0.74|
|[[:human_genes:T:THG1L|THG1L]]|-2.14|0.53|
|[[:human_genes:V:VPS25|VPS25]]|-2.11|0.89|
|[[:human_genes:G:GPR107|GPR107]]|-2.10|0.53|
|[[:human_genes:G:GRIK1|GRIK1]]|-2.08|0.53|
|[[:human_genes:S:SOS1|SOS1]]|-2.05|0.53|
|[[:human_genes:R:RAB7A|RAB7A]]|-2.04|0.53|
|[[:human_genes:L:LIN9|LIN9]]|-2.03|0.72|
|[[:human_genes:A:ATP5J|ATP5J]]|-2.03|0.53|
|[[:human_genes:G:GTF3C6|GTF3C6]]|-2.00|0.89|
|[[:human_genes:M:MOGAT3|MOGAT3]]|-1.99|0.61|
|[[:human_genes:A:ARL3|ARL3]]|-1.93|0.72|
|[[:human_genes:U:UROD|UROD]]|-1.92|0.89|
|[[:human_genes:E:ELP2|ELP2]]|-1.92|0.72|
|[[:human_genes:Z:ZCCHC13|ZCCHC13]]|-1.90|0.89|
|[[:human_genes:O:OSBPL9|OSBPL9]]|-1.89|0.89|
|[[:human_genes:C:C16orf47|C16orf47]]|-1.87|0.74|
|[[:human_genes:U:UNC93B1|UNC93B1]]|-1.87|0.74|
|[[:human_genes:L:LST1|LST1]]|-1.87|0.89|
|[[:human_genes:H:HELT|HELT]]|-1.86|0.89|
|[[:human_genes:D:DPAGT1|DPAGT1]]|-1.86|0.89|
|[[:human_genes:R:RAPGEF6|RAPGEF6]]|-1.85|0.74|
|[[:human_genes:N:NOL11|NOL11]]|-1.85|0.74|
|[[:human_genes:P:PTAFR|PTAFR]]|-1.85|0.89|
|[[:human_genes:T:TRIM66|TRIM66]]|-1.85|0.74|
|[[:human_genes:A:ARL17B|ARL17B]]|1.98|0.49|
|[[:human_genes:C:CHRND|CHRND]]|1.98|0.54|
|[[:human_genes:C:CCDC94|CCDC94]]|1.99|0.72|
|[[:human_genes:W:WTH3DI|WTH3DI]]|2.00|0.49|
|[[:human_genes:A:ARCN1|ARCN1]]|2.01|0.67|
|[[:human_genes:T:TOP1MT|TOP1MT]]|2.01|0.50|
|[[:human_genes:S:SPDYC|SPDYC]]|2.01|0.49|
|[[:human_genes:K:KRTAP12-3|KRTAP12-3]]|2.01|0.49|
|[[:human_genes:N:NFE2L1|NFE2L1]]|2.03|0.49|
|[[:human_genes:J:JPH3|JPH3]]|2.04|0.49|
|[[:human_genes:O:OR4F21|OR4F21]]|2.07|0.72|
|[[:human_genes:H:HOXC10|HOXC10]]|2.07|0.65|
|[[:human_genes:R:RPL13A|RPL13A]]|2.08|0.65|
|[[:human_genes:V:VSIG10L|VSIG10L]]|2.09|0.49|
|[[:human_genes:T:TAS2R50|TAS2R50]]|2.13|0.49|
|[[:human_genes:P:PTPLB|PTPLB]]|2.16|0.48|
|[[:human_genes:Z:ZNF763|ZNF763]]|2.17|0.49|
|[[:human_genes:T:TMSB15B|TMSB15B]]|2.17|0.72|
|[[:human_genes:K:KLHL41|KLHL41]]|2.18|0.48|
|[[:human_genes:M:MMS22L|MMS22L]]|2.19|0.48|
|[[:human_genes:S:SCAF11|SCAF11]]|2.27|0.49|
|[[:human_genes:M:MARVELD1|MARVELD1]]|2.33|0.76|
|[[:human_genes:P:PNN|PNN]]|2.33|0.49|
|[[:human_genes:C:CCT8|CCT8]]|2.37|0.49|
|[[:human_genes:S:SNX33|SNX33]]|2.42|0.48|
|[[:human_genes:L:LOC391322|LOC391322]]|2.50|0.72|
|[[:human_genes:S:SH3KBP1|SH3KBP1]]|2.53|0.17|
|[[:human_genes:C:COPB2|COPB2]]|2.55|0.49|
|[[:human_genes:N:NHP2L1|NHP2L1]]|2.56|0.49|
|[[:human_genes:W:WNT4|WNT4]]|2.84|0.05|
</modal>


<modal id="modal_screen_similarity" size="lg" title="Correlated Screens">
No correlation data above threshold. (correlation > 0.05)
</modal>


<modal id="modal_go_sensitive" size="lg" title="Top 30 sensitive GO terms">No GO term hits below threshold. (FDR <0.05)</modal>
<modal id="modal_go_resistant" size="lg" title="Top 30 resistant GO terms">No GO term hits below threshold. (FDR <0.05)</modal>