====== Nicotinate 1000μM R03 exp140 ======
==== Mechanism of Action ====
NAD precursor (a.k.a. niacin, vitamin B3)
  * **<color #00a2e8>Class / Subclass 1:</color>** Metabolism / Metabolite




==== Technical Notes ====
<accordion collapsed='true'>
<panel title='Protein References' collapsed='true'>
    * **<color #00a2e8>PubChem Name:</color>** %%Nicotinic acid%%
    * **<color #00a2e8>Synonyms:</color>** Nicotinic acid; Vitamin B3
    * **<color #00a2e8>CAS #:</color>** 59-67-6
    * **<color #00a2e8>PubChem CID:</color>** [[https://pubchem.ncbi.nlm.nih.gov/compound/938|938]]
    * **<color #00a2e8>IUPAC:</color>** %%pyridine-3-carboxylic acid%%
    * **<color #00a2e8>INCHI Name:</color>** InChI=1S/C6H5NO2/c8-6(9)5-2-1-3-7-4-5/h1-4H,(H,8,9)
    * **<color #00a2e8>INCHI Key:</color>** PVNIIMVLHYAWGP-UHFFFAOYSA-N
    * **<color #00a2e8>Molecular Weight:</color>** 123.11
    * **<color #00a2e8>Canonical SMILES:</color>** C1=CC(=CN=C1)C(=O)O
    * **<color #00a2e8>Isomeric SMILES:</color>** N/A
    * **<color #00a2e8>Molecular Formula:</color>** C6H5NO2
{{:chemogenomics:structures:chem-0091.svg?nolink}}
</panel>


<panel title='Protein Supplier' collapsed='true'>
    * **<color #00a2e8>Supplier Name:</color>** Sigma-Aldrich
    * **<color #00a2e8>Catalog #:</color>** N4126
    * **<color #00a2e8>Lot #:</color>** 065K0177
</panel>


<panel title='Protein Characterization' collapsed='true'>
    * **<color #00a2e8>HRMS (ESI-TOF) m/z:</color>** (M-H)- Calcd for C6 H5 N O2 122.02475; found 122.02472
</panel>


<panel title='Dose Response Curve' collapsed='true'>
    * **<color #00a2e8>Platform ID:</color>** POTASSIUM-NICOTINATE
    * **<color #00a2e8>Min:</color>** -4.7237; **<color #00a2e8>Max:</color>** 10.9209
{{:chemogenomics:dose_response:dr_111.png?nolink&500 |}}
\\ 
\\ 
\\ 
\\ 
|< 300px 100px 200px >|
^ IC   ^ Concentration (µM) ^
| IC10  |N/A    |
| IC20  |N/A    |
| IC30  |N/A    |
| IC40  |N/A    |
| IC50  |N/A    |
| IC60  |N/A    |
| IC70  |N/A    |
| IC80  |N/A    |
| IC90  |N/A    |
\\ 
</panel>
</accordion>
==== Screen Summary ====
    * **<color #00a2e8>Round</color>**: 03
    * **<color #00a2e8>Dose</color>**: 1000µM
    * **<color #00a2e8>Days of incubation</color>**: 8
    * **<color #00a2e8>Doublings</color>**: 7.9
    * **<color #00a2e8>Numbers of reads</color>**: 7271685


==== Screen Results ====


^Sensitive/Resistant hits (FDR<0.05)^CRANKS^Score Plot^Top 30 Genes^Screen Similarity^Top 30 Sensitive GO terms^Top 30 Resistant GO terms^
|0/0|<color #e85500>[[https://files.tyerslab.com/files/public/chemogenomics/cranks/Nicotinate_1000uM_Round-3_exp140.txt|Scores]]</color>|<button type="primary" size="sm" modal="ScorePlot">View</button>|<button type="primary" size="sm" modal="modal_hits">View</button>|<button type="default" size="sm" modal="modal_screen_similarity">View</button>|<button type="default" size="sm" modal="modal_go_sensitive">View</button>|<button type="default" size="sm" modal="modal_go_resistant">View</button>|
<modal id='ScorePlot' size='lg' title='Nicotinate 1000μM R03 exp140'>
{{:chemogenomics:cranks_plots:exp140.png?nolink}}
</modal>


<modal id="modal_hits" size="sm" title="Top 30 S/R Genes">
^Gene^CRANKS Score^FDR^
|[[:human_genes:S:SNAPIN|SNAPIN]]|-2.52|0.19|
|[[:human_genes:Z:ZNF136|ZNF136]]|-2.47|0.19|
|[[:human_genes:S:STK10|STK10]]|-2.43|0.19|
|[[:human_genes:Z:ZCRB1|ZCRB1]]|-2.35|0.43|
|[[:human_genes:H:HGC6.3|HGC6.3]]|-2.28|0.86|
|[[:human_genes:C:CDIPT|CDIPT]]|-2.28|0.86|
|[[:human_genes:C:CTBP2|CTBP2]]|-2.21|0.43|
|[[:human_genes:G:GCLC|GCLC]]|-2.18|0.43|
|[[:human_genes:P:PPP1R9B|PPP1R9B]]|-2.17|0.43|
|[[:human_genes:Y:YLPM1|YLPM1]]|-2.16|0.52|
|[[:human_genes:S:SLC29A2|SLC29A2]]|-2.15|0.43|
|[[:human_genes:K:KLC2|KLC2]]|-2.14|0.43|
|[[:human_genes:T:TRMT10A|TRMT10A]]|-2.13|0.43|
|[[:human_genes:L:LRMP|LRMP]]|-2.13|0.43|
|[[:human_genes:A:AKR1C2|AKR1C2]]|-2.11|0.43|
|[[:human_genes:I:ITGBL1|ITGBL1]]|-2.10|0.43|
|[[:human_genes:A:ARHGAP11B|ARHGAP11B]]|-2.08|0.43|
|[[:human_genes:H:HSPH1|HSPH1]]|-2.06|0.48|
|[[:human_genes:P:PYROXD1|PYROXD1]]|-2.05|0.86|
|[[:human_genes:H:HOXD1|HOXD1]]|-2.05|0.43|
|[[:human_genes:L:LEO1|LEO1]]|-2.02|0.52|
|[[:human_genes:S:SEPSECS|SEPSECS]]|-2.01|0.78|
|[[:human_genes:T:TAF6L|TAF6L]]|-2.01|0.43|
|[[:human_genes:A:ALDH18A1|ALDH18A1]]|-1.99|0.43|
|[[:human_genes:A:ABCA3|ABCA3]]|-1.96|0.48|
|[[:human_genes:S:SPRR3|SPRR3]]|-1.94|0.48|
|[[:human_genes:N:NUDT11|NUDT11]]|-1.89|0.78|
|[[:human_genes:O:OXSR1|OXSR1]]|-1.89|0.78|
|[[:human_genes:A:ASPHD2|ASPHD2]]|-1.89|0.54|
|[[:human_genes:V:VPS25|VPS25]]|-1.84|0.86|
|[[:human_genes:M:MED15|MED15]]|1.92|0.69|
|[[:human_genes:E:EIF3J|EIF3J]]|1.92|0.81|
|[[:human_genes:P:PSMB1|PSMB1]]|1.94|0.69|
|[[:human_genes:T:TIGD7|TIGD7]]|1.95|0.69|
|[[:human_genes:I:IER5L|IER5L]]|1.96|0.69|
|[[:human_genes:H:HIST1H2BB|HIST1H2BB]]|1.97|0.78|
|[[:human_genes:Z:ZNF571|ZNF571]]|1.98|0.69|
|[[:human_genes:E:EXOSC8|EXOSC8]]|2.05|0.69|
|[[:human_genes:D:DAPK1|DAPK1]]|2.09|0.36|
|[[:human_genes:M:MS4A13|MS4A13]]|2.09|0.81|
|[[:human_genes:B:BIRC5|BIRC5]]|2.10|0.78|
|[[:human_genes:P:PLEKHA2|PLEKHA2]]|2.10|0.69|
|[[:human_genes:T:TOP1MT|TOP1MT]]|2.10|0.57|
|[[:human_genes:W:WBSCR22|WBSCR22]]|2.15|0.78|
|[[:human_genes:M:MAP3K2|MAP3K2]]|2.16|0.29|
|[[:human_genes:P:PREX2|PREX2]]|2.18|0.29|
|[[:human_genes:S:SP8|SP8]]|2.18|0.29|
|[[:human_genes:I:IFT27|IFT27]]|2.19|0.69|
|[[:human_genes:U:UBXN8|UBXN8]]|2.25|0.69|
|[[:human_genes:A:ADAM10|ADAM10]]|2.25|0.29|
|[[:human_genes:T:TPBG|TPBG]]|2.27|0.30|
|[[:human_genes:T:TP53I11|TP53I11]]|2.30|0.29|
|[[:human_genes:S:SGSH|SGSH]]|2.36|0.29|
|[[:human_genes:C:CD52|CD52]]|2.40|0.29|
|[[:human_genes:F:FAM163B|FAM163B]]|2.48|0.44|
|[[:human_genes:I:ISCU|ISCU]]|2.49|0.78|
|[[:human_genes:E:ESPL1|ESPL1]]|2.49|0.69|
|[[:human_genes:M:MYO1H|MYO1H]]|2.51|0.29|
|[[:human_genes:R:RNF17|RNF17]]|2.56|0.29|
|[[:human_genes:R:RPL10|RPL10]]|2.62|0.29|
</modal>


<modal id="modal_screen_similarity" size="lg" title="Correlated Screens">
No correlation data above threshold. (correlation > 0.05)
</modal>


<modal id="modal_go_sensitive" size="lg" title="Top 30 sensitive GO terms">No GO term hits below threshold. (FDR <0.05)</modal>
<modal id="modal_go_resistant" size="lg" title="Top 30 resistant GO terms">No GO term hits below threshold. (FDR <0.05)</modal>