====== Nifurtimox 1μM R03 exp141 ======
==== Mechanism of Action ====
Nitrofuran derivative, forms nitro-anion radical metabolite, induces ROS
  * **<color #00a2e8>Class / Subclass 1:</color>** Infectious Disease / Antitrypanosomal




==== Technical Notes ====
<accordion collapsed='true'>
<panel title='Protein References' collapsed='true'>
    * **<color #00a2e8>PubChem Name:</color>** %%Nifurtimox%%
    * **<color #00a2e8>Synonyms:</color>** N/A
    * **<color #00a2e8>CAS #:</color>** 23256-30-6
    * **<color #00a2e8>PubChem CID:</color>** [[https://pubchem.ncbi.nlm.nih.gov/compound/6842999|6842999]]
    * **<color #00a2e8>IUPAC:</color>** %%(E)-N-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)-1-(5-nitrofuran-2-yl)methanimine%%
    * **<color #00a2e8>INCHI Name:</color>** InChI=1S/C10H13N3O5S/c1-8-7-19(16,17)5-4-12(8)11-6-9-2-3-10(18-9)13(14)15/h2-3,6,8H,4-5,7H2,1H3/b11-6+
    * **<color #00a2e8>INCHI Key:</color>** ARFHIAQFJWUCFH-IZZDOVSWSA-N
    * **<color #00a2e8>Molecular Weight:</color>** 287.29
    * **<color #00a2e8>Canonical SMILES:</color>** CC1CS(=O)(=O)CCN1N=CC2=CC=C(O2)[N+](=O)[O-]
    * **<color #00a2e8>Isomeric SMILES:</color>** CC1CS(=O)(=O)CCN1/N=C/C2=CC=C(O2)[N+](=O)[O-]
    * **<color #00a2e8>Molecular Formula:</color>** C10H13N3O5S
{{:chemogenomics:structures:chem-0092.svg?nolink}}
</panel>


<panel title='Protein Supplier' collapsed='true'>
    * **<color #00a2e8>Supplier Name:</color>** Sigma-Aldrich
    * **<color #00a2e8>Catalog #:</color>** N3415
    * **<color #00a2e8>Lot #:</color>** N/A
</panel>


<panel title='Protein Characterization' collapsed='true'>
    * **<color #00a2e8>HRMS (ESI-TOF) m/z:</color>** (M+COOH)- Calcd for C10 H13 N3 O5 S 332.05579; found 332.05672
</panel>


<panel title='Dose Response Curve' collapsed='true'>
    * **<color #00a2e8>Platform ID:</color>** RC-NFN5
    * **<color #00a2e8>Min:</color>** -7.4928; **<color #00a2e8>Max:</color>** 14.3019
{{:chemogenomics:dose_response:dr_114.png?nolink&500 |}}
\\ 
\\ 
\\ 
\\ 
|< 300px 100px 200px >|
^ IC   ^ Concentration (µM) ^
| IC10  |N/A    |
| IC20  |N/A    |
| IC30  |N/A    |
| IC40  |N/A    |
| IC50  |N/A    |
| IC60  |N/A    |
| IC70  |N/A    |
| IC80  |N/A    |
| IC90  |N/A    |
\\ 
</panel>
</accordion>
==== Screen Summary ====
    * **<color #00a2e8>Round</color>**: 03
    * **<color #00a2e8>Dose</color>**: 1µM
    * **<color #00a2e8>Days of incubation</color>**: 8
    * **<color #00a2e8>Doublings</color>**: 8.0
    * **<color #00a2e8>Numbers of reads</color>**: 9780191


==== Screen Results ====


^Sensitive/Resistant hits (FDR<0.05)^CRANKS^Score Plot^Top 30 Genes^Screen Similarity^Top 30 Sensitive GO terms^Top 30 Resistant GO terms^
|0/0|<color #e85500>[[https://files.tyerslab.com/files/public/chemogenomics/cranks/Nifurtimox_1uM_Round-3_exp141.txt|Scores]]</color>|<button type="primary" size="sm" modal="ScorePlot">View</button>|<button type="primary" size="sm" modal="modal_hits">View</button>|<button type="default" size="sm" modal="modal_screen_similarity">View</button>|<button type="default" size="sm" modal="modal_go_sensitive">View</button>|<button type="default" size="sm" modal="modal_go_resistant">View</button>|
<modal id='ScorePlot' size='lg' title='Nifurtimox 1μM R03 exp141'>
{{:chemogenomics:cranks_plots:exp141.png?nolink}}
</modal>


<modal id="modal_hits" size="sm" title="Top 30 S/R Genes">
^Gene^CRANKS Score^FDR^
|[[:human_genes:G:GPR152|GPR152]]|-2.51|0.60|
|[[:human_genes:S:SLC31A2|SLC31A2]]|-2.15|0.60|
|[[:human_genes:P:PLD2|PLD2]]|-2.15|0.60|
|[[:human_genes:E:EEFSEC|EEFSEC]]|-2.15|0.60|
|[[:human_genes:G:GCLC|GCLC]]|-2.14|0.60|
|[[:human_genes:K:KCNH8|KCNH8]]|-2.13|0.60|
|[[:human_genes:A:ASIC4|ASIC4]]|-2.08|0.60|
|[[:human_genes:A:AAK1|AAK1]]|-2.08|0.60|
|[[:human_genes:M:MARVELD1|MARVELD1]]|-2.08|0.87|
|[[:human_genes:P:PCGF5|PCGF5]]|-2.05|0.60|
|[[:human_genes:C:C15orf41|C15orf41]]|-2.03|0.60|
|[[:human_genes:O:OLIG1|OLIG1]]|-1.99|0.60|
|[[:human_genes:A:ACSL4|ACSL4]]|-1.98|0.60|
|[[:human_genes:S:SFTA2|SFTA2]]|-1.97|0.60|
|[[:human_genes:E:EBF4|EBF4]]|-1.96|0.60|
|[[:human_genes:A:ANO1|ANO1]]|-1.96|0.60|
|[[:human_genes:T:TNFRSF14|TNFRSF14]]|-1.93|0.67|
|[[:human_genes:F:FBXW4|FBXW4]]|-1.93|0.60|
|[[:human_genes:P:PGP|PGP]]|-1.91|0.62|
|[[:human_genes:C:CEPT1|CEPT1]]|-1.90|0.60|
|[[:human_genes:M:MAP3K5|MAP3K5]]|-1.90|0.60|
|[[:human_genes:P:PAFAH1B2|PAFAH1B2]]|-1.90|0.62|
|[[:human_genes:G:GLS2|GLS2]]|-1.89|0.60|
|[[:human_genes:R:RNF167|RNF167]]|-1.88|0.60|
|[[:human_genes:H:HOXA13|HOXA13]]|-1.88|0.60|
|[[:human_genes:S:STK4|STK4]]|-1.88|0.60|
|[[:human_genes:M:MTX1|MTX1]]|-1.87|0.61|
|[[:human_genes:M:MRPS10|MRPS10]]|-1.85|0.62|
|[[:human_genes:M:MYH9|MYH9]]|-1.85|0.62|
|[[:human_genes:S:SUCLG1|SUCLG1]]|-1.85|0.69|
|[[:human_genes:E:EFCAB3|EFCAB3]]|1.88|0.65|
|[[:human_genes:E:ECT2|ECT2]]|1.89|0.65|
|[[:human_genes:A:ATP1A3|ATP1A3]]|1.90|0.65|
|[[:human_genes:F:FAM50A|FAM50A]]|1.91|0.74|
|[[:human_genes:O:OR1J4|OR1J4]]|1.92|0.65|
|[[:human_genes:S:SLC6A20|SLC6A20]]|1.93|0.65|
|[[:human_genes:S:SLK|SLK]]|1.94|0.65|
|[[:human_genes:P:PNMA2|PNMA2]]|1.96|0.65|
|[[:human_genes:U:UBE2I|UBE2I]]|1.97|0.66|
|[[:human_genes:V:VAMP3|VAMP3]]|2.00|0.65|
|[[:human_genes:X:XKR3|XKR3]]|2.01|0.65|
|[[:human_genes:M:MAPK8|MAPK8]]|2.01|0.65|
|[[:human_genes:N:NOP16|NOP16]]|2.02|0.75|
|[[:human_genes:M:MED13L|MED13L]]|2.02|0.65|
|[[:human_genes:A:ATP6V0D1|ATP6V0D1]]|2.02|0.65|
|[[:human_genes:L:LOC643802|LOC643802]]|2.03|0.65|
|[[:human_genes:C:CNIH4|CNIH4]]|2.03|0.65|
|[[:human_genes:E:ESPL1|ESPL1]]|2.08|0.67|
|[[:human_genes:S:SPATA31E1|SPATA31E1]]|2.08|0.65|
|[[:human_genes:C:COIL|COIL]]|2.09|0.65|
|[[:human_genes:N:NSA2|NSA2]]|2.12|0.66|
|[[:human_genes:P:POP1|POP1]]|2.13|0.65|
|[[:human_genes:P:PLXNA4|PLXNA4]]|2.15|0.61|
|[[:human_genes:T:TPBG|TPBG]]|2.16|0.65|
|[[:human_genes:Z:ZNF516|ZNF516]]|2.17|0.61|
|[[:human_genes:E:EIF5B|EIF5B]]|2.21|0.72|
|[[:human_genes:S:SMU1|SMU1]]|2.26|0.65|
|[[:human_genes:T:TGFBR3|TGFBR3]]|2.34|0.61|
|[[:human_genes:R:RAPSN|RAPSN]]|2.85|0.14|
|[[:human_genes:C:CCT8|CCT8]]|2.87|0.47|
</modal>


<modal id="modal_screen_similarity" size="lg" title="Correlated Screens">
No correlation data above threshold. (correlation > 0.05)
</modal>


<modal id="modal_go_sensitive" size="lg" title="Top 30 sensitive GO terms">No GO term hits below threshold. (FDR <0.05)</modal>
<modal id="modal_go_resistant" size="lg" title="Top 30 resistant GO terms">No GO term hits below threshold. (FDR <0.05)</modal>