====== OICR-9429 10μM R03 exp142 ======
==== Mechanism of Action ====
Inhibits interaction between WDR5 and MLL1 (KMT2A) in MLL H3K4 trimethylase complex
* **Class / Subclass 1:** Gene Regulation / Epigenetic Inhibitor
==== Technical Notes ====
* **PubChem Name:** %%N-[2-(4-Methylpiperazin-1-yl)-5-[3-(morpholin-4-ylmethyl)phenyl]phenyl]-6-oxo-4-(trifluoromethyl)-1H-pyridine-3-carboxamide%%
* **Synonyms:** N/A
* **CAS #:** 1801787-56-3
* **PubChem CID:** [[https://pubchem.ncbi.nlm.nih.gov/compound/91623360|91623360]]
* **IUPAC:** %%N-[2-(4-methylpiperazin-1-yl)-5-[3-(morpholin-4-ylmethyl)phenyl]phenyl]-6-oxo-4-(trifluoromethyl)-1H-pyridine-3-carboxamide%%
* **INCHI Name:** InChI=1S/C29H32F3N5O3/c1-35-7-9-37(10-8-35)26-6-5-22(21-4-2-3-20(15-21)19-36-11-13-40-14-12-36)16-25(26)34-28(39)23-18-33-27(38)17-24(23)29(30,31)32/h2-6,15-18H,7-14,19H2,1H3,(H,33,38)(H,34,39)
* **INCHI Key:** DJOVLOYCGXNVPI-UHFFFAOYSA-N
* **Molecular Weight:** 555.6
* **Canonical SMILES:** CN1CCN(CC1)C2=C(C=C(C=C2)C3=CC=CC(=C3)CN4CCOCC4)NC(=O)C5=CNC(=O)C=C5C(F)(F)F
* **Isomeric SMILES:** N/A
* **Molecular Formula:** C29H32F3N5O3
{{:chemogenomics:structures:chem-0093.svg?nolink}}
* **Supplier Name:** Structural Genomics Consortium
* **Catalog #:** N/A
* **Lot #:** N/A
* **HRMS (ESI-TOF) m/z:** (M+H)+ Calcd for C29H32F3N5O3 556.253; found 556.25499
* **Platform ID:** OICR9429
* **Min:** -4.8409; **Max:** 11.8137
{{:chemogenomics:dose_response:dr_104.png?nolink&500 |}}
\\
\\
\\
\\
|< 300px 100px 200px >|
^ IC ^ Concentration (µM) ^
| IC10 |N/A |
| IC20 |N/A |
| IC30 |N/A |
| IC40 |N/A |
| IC50 |N/A |
| IC60 |N/A |
| IC70 |N/A |
| IC80 |N/A |
| IC90 |N/A |
\\
==== Screen Summary ====
* **Round**: 03
* **Dose**: 10µM
* **Days of incubation**: 8
* **Doublings**: 7.6
* **Numbers of reads**: 10688227
==== Screen Results ====
^Sensitive/Resistant hits (FDR<0.05)^CRANKS^Score Plot^Top 30 Genes^Screen Similarity^Top 30 Sensitive GO terms^Top 30 Resistant GO terms^
|1/0|[[https://files.tyerslab.com/files/public/chemogenomics/cranks/OICR-9429_10uM_Round-3_exp142.txt|Scores]]||||||
{{:chemogenomics:cranks_plots:exp142.png?nolink}}
^Gene^CRANKS Score^FDR^
|[[:human_genes:S:SLC7A6|SLC7A6]]|-3.31|<0.01|
|[[:human_genes:R:RABIF|RABIF]]|-2.64|0.08|
|[[:human_genes:K:KBTBD7|KBTBD7]]|-2.56|0.09|
|[[:human_genes:E:EPAS1|EPAS1]]|-2.39|0.62|
|[[:human_genes:D:DNAJC13|DNAJC13]]|-2.17|0.52|
|[[:human_genes:L:LGI1|LGI1]]|-2.17|0.52|
|[[:human_genes:L:LEMD2|LEMD2]]|-2.16|0.63|
|[[:human_genes:E:EEFSEC|EEFSEC]]|-2.13|0.63|
|[[:human_genes:C:C7orf55-LUC7L2|C7orf55-LUC7L2]]|-2.06|0.69|
|[[:human_genes:D:DDX39A|DDX39A]]|-2.06|0.63|
|[[:human_genes:S:SASH3|SASH3]]|-2.02|0.63|
|[[:human_genes:P:PABPC1L|PABPC1L]]|-2.01|0.70|
|[[:human_genes:O:OR6C1|OR6C1]]|-2.00|0.69|
|[[:human_genes:C:CTDNEP1|CTDNEP1]]|-2.00|0.63|
|[[:human_genes:C:CDIPT|CDIPT]]|-2.00|0.79|
|[[:human_genes:C:CCNB3|CCNB3]]|-1.97|0.68|
|[[:human_genes:C:COX10|COX10]]|-1.96|0.70|
|[[:human_genes:P:PNKP|PNKP]]|-1.93|0.70|
|[[:human_genes:L:LGALS12|LGALS12]]|-1.92|0.69|
|[[:human_genes:A:AP3B1|AP3B1]]|-1.92|0.69|
|[[:human_genes:T:THOC6|THOC6]]|-1.92|0.70|
|[[:human_genes:P:PROK2|PROK2]]|-1.91|0.70|
|[[:human_genes:B:BTN3A1|BTN3A1]]|-1.90|0.69|
|[[:human_genes:M:MS4A13|MS4A13]]|-1.89|0.84|
|[[:human_genes:P:PELO|PELO]]|-1.89|0.71|
|[[:human_genes:M:MOB2|MOB2]]|-1.89|0.69|
|[[:human_genes:P:PABPC4|PABPC4]]|-1.88|0.69|
|[[:human_genes:U:UHRF1|UHRF1]]|-1.88|0.70|
|[[:human_genes:O:OR7A5|OR7A5]]|-1.87|0.70|
|[[:human_genes:S:SNCB|SNCB]]|-1.87|0.70|
|[[:human_genes:R:RRM2|RRM2]]|1.85|0.91|
|[[:human_genes:C:CLCN5|CLCN5]]|1.85|0.87|
|[[:human_genes:E:ENTPD6|ENTPD6]]|1.85|0.87|
|[[:human_genes:L:LIPG|LIPG]]|1.85|0.87|
|[[:human_genes:S:SMC2|SMC2]]|1.88|0.91|
|[[:human_genes:Z:ZBED6CL|ZBED6CL]]|1.90|0.87|
|[[:human_genes:H:HM13|HM13]]|1.92|0.87|
|[[:human_genes:T:THBS4|THBS4]]|1.93|0.87|
|[[:human_genes:O:OR8K3|OR8K3]]|1.95|0.87|
|[[:human_genes:C:CTTNBP2|CTTNBP2]]|1.95|0.87|
|[[:human_genes:P:PSMB7|PSMB7]]|1.96|0.87|
|[[:human_genes:C:C1orf174|C1orf174]]|1.97|0.87|
|[[:human_genes:S:SLC29A1|SLC29A1]]|2.00|0.87|
|[[:human_genes:R:RPS19|RPS19]]|2.02|0.89|
|[[:human_genes:R:RPL34|RPL34]]|2.02|0.89|
|[[:human_genes:R:RARS|RARS]]|2.04|0.91|
|[[:human_genes:R:RAD9A|RAD9A]]|2.04|0.89|
|[[:human_genes:S:SHFM1|SHFM1]]|2.05|0.89|
|[[:human_genes:P:PPFIBP2|PPFIBP2]]|2.07|0.87|
|[[:human_genes:P:PRICKLE1|PRICKLE1]]|2.10|0.82|
|[[:human_genes:P:PRPF19|PRPF19]]|2.11|0.87|
|[[:human_genes:T:TGM1|TGM1]]|2.16|0.72|
|[[:human_genes:T:TICAM2|TICAM2]]|2.20|0.72|
|[[:human_genes:C:C8orf89|C8orf89]]|2.20|0.87|
|[[:human_genes:S:SYVN1|SYVN1]]|2.21|0.87|
|[[:human_genes:P:PARP6|PARP6]]|2.21|0.72|
|[[:human_genes:M:MRTO4|MRTO4]]|2.21|0.87|
|[[:human_genes:R:RBX1|RBX1]]|2.44|0.87|
|[[:human_genes:E:ESPL1|ESPL1]]|2.63|0.87|
|[[:human_genes:A:ANKLE2|ANKLE2]]|2.66|0.72|
^Screen^Correlation^Plot^
|[[:results:exp132|Metformin 40μM R03 exp132]]|0.056||
{{:chemogenomics:comparison_plots:exp132_vs_exp142.png?nolink |}}
No GO term hits below threshold. (FDR <0.05)
No GO term hits below threshold. (FDR <0.05)