====== Metformin 100 to 150μM on day4 R04 exp170 ======
==== Mechanism of Action ====
Inhibits mitochondrial respiratory chain complex I, indirectly activates AMPK
  * **<color #00a2e8>Class / Subclass 1:</color>** Organelle Function / Mitochondrial Inhibitor
  * **<color #00a2e8>Class / Subclass 2:</color>** Signal Transduction / Kinase Activator



==== Technical Notes ====
<accordion collapsed='true'>
<panel title='Protein References' collapsed='true'>
    * **<color #00a2e8>PubChem Name:</color>** %%Metformin hydrochloride%%
    * **<color #00a2e8>Synonyms:</color>** 1,1-Dimethylbiguanide hydrochloride
    * **<color #00a2e8>CAS #:</color>** 1115-70-4
    * **<color #00a2e8>PubChem CID:</color>** [[https://pubchem.ncbi.nlm.nih.gov/compound/14219|14219]]
    * **<color #00a2e8>IUPAC:</color>** %%3-(diaminomethylidene)-1,1-dimethylguanidine;hydrochloride%%
    * **<color #00a2e8>INCHI Name:</color>** InChI=1S/C4H11N5.ClH/c1-9(2)4(7)8-3(5)6;/h1-2H3,(H5,5,6,7,8);1H
    * **<color #00a2e8>INCHI Key:</color>** OETHQSJEHLVLGH-UHFFFAOYSA-N
    * **<color #00a2e8>Molecular Weight:</color>** 165.62
    * **<color #00a2e8>Canonical SMILES:</color>** CN(C)C(=N)N=C(N)N.Cl
    * **<color #00a2e8>Isomeric SMILES:</color>** N/A
    * **<color #00a2e8>Molecular Formula:</color>** C4H12ClN5
{{:chemogenomics:structures:chem-0084.svg?nolink}}
</panel>


<panel title='Protein Supplier' collapsed='true'>
    * **<color #00a2e8>Supplier Name:</color>** Sigma-Aldrich
    * **<color #00a2e8>Catalog #:</color>** D150959
    * **<color #00a2e8>Lot #:</color>** BCBF1484V
</panel>


<panel title='Protein Characterization' collapsed='true'>
    * **<color #00a2e8>HRMS (ESI-TOF) m/z:</color>** (M+H)+ Calcd for C4H11N5 130.10872; found 130.10841
</panel>


<panel title='Dose Response Curve' collapsed='true'>
    * **<color #00a2e8>Platform ID:</color>** METFORMINE
    * **<color #00a2e8>Min:</color>** -7.1295; **<color #00a2e8>Max:</color>** 19.3310
{{:chemogenomics:dose_response:dr_91.png?nolink&500 |}}
\\ 
\\ 
\\ 
\\ 
|< 300px 100px 200px >|
^ IC   ^ Concentration (µM) ^
| IC10  |N/A    |
| IC20  |N/A    |
| IC30  |N/A    |
| IC40  |N/A    |
| IC50  |N/A    |
| IC60  |N/A    |
| IC70  |N/A    |
| IC80  |N/A    |
| IC90  |N/A    |
\\ 
</panel>
</accordion>
==== Screen Summary ====
    * **<color #00a2e8>Round</color>**: 04
    * **<color #00a2e8>Dose</color>**: 100-150µM
    * **<color #00a2e8>Days of incubation</color>**: 8
    * **<color #00a2e8>Doublings</color>**: 7.1
    * **<color #00a2e8>Numbers of reads</color>**: 21873859


==== Screen Results ====


^Sensitive/Resistant hits (FDR<0.05)^CRANKS^Score Plot^Top 30 Genes^Screen Similarity^Top 30 Sensitive GO terms^Top 30 Resistant GO terms^
|0/0|<color #e85500>[[https://files.tyerslab.com/files/public/chemogenomics/cranks/Metformin_100-150day4uM_Round-4_exp170.txt|Scores]]</color>|<button type="primary" size="sm" modal="ScorePlot">View</button>|<button type="primary" size="sm" modal="modal_hits">View</button>|<button type="default" size="sm" modal="modal_screen_similarity">View</button>|<button type="default" size="sm" modal="modal_go_sensitive">View</button>|<button type="default" size="sm" modal="modal_go_resistant">View</button>|
<modal id='ScorePlot' size='lg' title='Metformin 100 to 150μM on day4 R04 exp170'>
{{:chemogenomics:cranks_plots:exp170.png?nolink}}
</modal>


<modal id="modal_hits" size="sm" title="Top 30 S/R Genes">
^Gene^CRANKS Score^FDR^
|[[:human_genes:T:TCF4|TCF4]]|-2.51|0.33|
|[[:human_genes:R:RBMX2|RBMX2]]|-2.38|0.35|
|[[:human_genes:T:TRMT10A|TRMT10A]]|-2.32|0.35|
|[[:human_genes:C:C1orf173|C1orf173]]|-2.30|0.35|
|[[:human_genes:S:SEPHS1|SEPHS1]]|-2.24|0.35|
|[[:human_genes:S:SMC6|SMC6]]|-2.18|0.35|
|[[:human_genes:T:TAS2R1|TAS2R1]]|-2.18|0.35|
|[[:human_genes:W:WT1|WT1]]|-2.14|0.36|
|[[:human_genes:L:LARP1B|LARP1B]]|-2.13|0.36|
|[[:human_genes:E:ENO1|ENO1]]|-2.04|0.67|
|[[:human_genes:R:RNASEH1|RNASEH1]]|-2.03|0.58|
|[[:human_genes:T:TCAF2|TCAF2]]|-2.01|0.69|
|[[:human_genes:X:XPO5|XPO5]]|-1.99|0.70|
|[[:human_genes:S:SPATA31C1|SPATA31C1]]|-1.97|0.67|
|[[:human_genes:P:PGGT1B|PGGT1B]]|-1.95|0.67|
|[[:human_genes:A:ADSL|ADSL]]|-1.94|0.67|
|[[:human_genes:H:H2AFV|H2AFV]]|-1.93|0.67|
|[[:human_genes:A:ADK|ADK]]|-1.93|0.67|
|[[:human_genes:S:SLC25A11|SLC25A11]]|-1.93|0.67|
|[[:human_genes:G:GPR113|GPR113]]|-1.91|0.67|
|[[:human_genes:A:ALKBH1|ALKBH1]]|-1.90|0.76|
|[[:human_genes:D:DCAF15|DCAF15]]|-1.89|0.67|
|[[:human_genes:M:MRPL12|MRPL12]]|-1.89|0.67|
|[[:human_genes:M:MCM8|MCM8]]|-1.89|0.67|
|[[:human_genes:M:MRPS33|MRPS33]]|-1.87|0.69|
|[[:human_genes:P:PRR7|PRR7]]|-1.85|0.67|
|[[:human_genes:A:ATF7IP|ATF7IP]]|-1.84|0.67|
|[[:human_genes:G:GARS|GARS]]|-1.83|0.80|
|[[:human_genes:E:EARS2|EARS2]]|-1.83|0.67|
|[[:human_genes:E:EIF4A1|EIF4A1]]|-1.82|0.67|
|[[:human_genes:S:SCAF1|SCAF1]]|1.84|0.77|
|[[:human_genes:A:AKIRIN2|AKIRIN2]]|1.86|0.71|
|[[:human_genes:G:GPR179|GPR179]]|1.87|0.71|
|[[:human_genes:C:C14orf93|C14orf93]]|1.89|0.71|
|[[:human_genes:T:TMEM38B|TMEM38B]]|1.90|0.70|
|[[:human_genes:R:RCC1|RCC1]]|1.91|0.71|
|[[:human_genes:P:POLR2D|POLR2D]]|1.93|0.71|
|[[:human_genes:P:PRRC2B|PRRC2B]]|1.93|0.63|
|[[:human_genes:P:POLA1|POLA1]]|1.94|0.79|
|[[:human_genes:P:PCYOX1|PCYOX1]]|1.95|0.60|
|[[:human_genes:M:MKI67|MKI67]]|1.95|0.71|
|[[:human_genes:I:IFI44|IFI44]]|1.97|0.71|
|[[:human_genes:I:INTS6|INTS6]]|1.97|0.71|
|[[:human_genes:S:SOX5|SOX5]]|1.97|0.58|
|[[:human_genes:T:TMEM106B|TMEM106B]]|2.02|0.57|
|[[:human_genes:C:CHST8|CHST8]]|2.15|0.57|
|[[:human_genes:P:PARD3|PARD3]]|2.16|0.57|
|[[:human_genes:K:KPNB1|KPNB1]]|2.16|0.71|
|[[:human_genes:D:DTL|DTL]]|2.23|0.58|
|[[:human_genes:K:KIAA1429|KIAA1429]]|2.24|0.58|
|[[:human_genes:Z:ZSCAN12|ZSCAN12]]|2.27|0.71|
|[[:human_genes:A:ALMS1|ALMS1]]|2.28|0.57|
|[[:human_genes:M:MED15|MED15]]|2.31|0.20|
|[[:human_genes:C:COLGALT2|COLGALT2]]|2.42|0.16|
|[[:human_genes:Z:ZFAND5|ZFAND5]]|2.51|0.13|
|[[:human_genes:Z:ZNF652|ZNF652]]|2.54|0.16|
|[[:human_genes:S:SEPT2|SEPT2]]|2.57|0.13|
|[[:human_genes:A:ATP6AP1|ATP6AP1]]|2.67|0.35|
|[[:human_genes:C:CDC45|CDC45]]|2.85|0.39|
|[[:human_genes:C:CDT1|CDT1]]|3.05|0.13|
</modal>


<modal id="modal_screen_similarity" size="lg" title="Correlated Screens">
No correlation data above threshold. (correlation > 0.05)
</modal>


<modal id="modal_go_sensitive" size="lg" title="Top 30 sensitive GO terms">No GO term hits below threshold. (FDR <0.05)</modal>
<modal id="modal_go_resistant" size="lg" title="Top 30 resistant GO terms">No GO term hits below threshold. (FDR <0.05)</modal>