====== IU1-C 25μM R04 exp183 ======
==== Mechanism of Action ====
Inactive analog of IU1-47
  * **<color #00a2e8>Class / Subclass 1:</color>** Proteostasis / Ubiquitin-Proteasome Inhibitor




==== Technical Notes ====
<accordion collapsed='true'>
<panel title='Protein References' collapsed='true'>
    * **<color #00a2e8>PubChem Name:</color>** %%[1-(4-Fluorophenyl)-2,5-dimethylpyrrol-3-yl]-(4-methylpiperidin-1-yl)methanone%%
    * **<color #00a2e8>Synonyms:</color>** N/A
    * **<color #00a2e8>CAS #:</color>** 853725-21-0
    * **<color #00a2e8>PubChem CID:</color>** [[https://pubchem.ncbi.nlm.nih.gov/compound/4791181|4791181]]
    * **<color #00a2e8>IUPAC:</color>** %%[1-(4-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-(4-methylpiperidin-1-yl)methanone%%
    * **<color #00a2e8>INCHI Name:</color>** InChI=1S/C19H23FN2O/c1-13-8-10-21(11-9-13)19(23)18-12-14(2)22(15(18)3)17-6-4-16(20)5-7-17/h4-7,12-13H,8-11H2,1-3H3
    * **<color #00a2e8>INCHI Key:</color>** RBDWITRZTOAEIG-UHFFFAOYSA-N
    * **<color #00a2e8>Molecular Weight:</color>** 314.4
    * **<color #00a2e8>Canonical SMILES:</color>** CC1CCN(CC1)C(=O)C2=C(N(C(=C2)C)C3=CC=C(C=C3)F)C
    * **<color #00a2e8>Isomeric SMILES:</color>** N/A
    * **<color #00a2e8>Molecular Formula:</color>** C19H23FN2O
{{:chemogenomics:structures:chem-0116.svg?nolink}}
</panel>


<panel title='Protein Supplier' collapsed='true'>
    * **<color #00a2e8>Supplier Name:</color>** In house - Harvard Medical School - Daniel Finley group - Synthesized as described in Lee and al., 2010
    * **<color #00a2e8>Catalog #:</color>** N/A
    * **<color #00a2e8>Lot #:</color>** N/A
</panel>


<panel title='Protein Characterization' collapsed='true'>
    * **<color #00a2e8>HRMS (ESI-TOF) m/z:</color>** (M+H)+ Calcd for C19H23FN2O 315.18672; found 315.18712
</panel>


<panel title='Dose Response Curve' collapsed='true'>
    * **<color #00a2e8>Platform ID:</color>** IU1-C
    * **<color #00a2e8>Min:</color>** -17.6616; **<color #00a2e8>Max:</color>** 19.0561
{{:chemogenomics:dose_response:dr_226.png?nolink&500 |}}
\\ 
\\ 
\\ 
\\ 
|< 300px 100px 200px >|
^ IC   ^ Concentration (µM) ^
| IC10  |N/A    |
| IC20  |N/A    |
| IC30  |N/A    |
| IC40  |N/A    |
| IC50  |N/A    |
| IC60  |N/A    |
| IC70  |N/A    |
| IC80  |N/A    |
| IC90  |N/A    |
\\ 
</panel>
</accordion>
==== Screen Summary ====
    * **<color #00a2e8>Round</color>**: 04
    * **<color #00a2e8>Dose</color>**: 25µM
    * **<color #00a2e8>Days of incubation</color>**: 8
    * **<color #00a2e8>Doublings</color>**: 4.9
    * **<color #00a2e8>Numbers of reads</color>**: 12555462


==== Screen Results ====


^Sensitive/Resistant hits (FDR<0.05)^CRANKS^Score Plot^Top 30 Genes^Screen Similarity^Top 30 Sensitive GO terms^Top 30 Resistant GO terms^
|3/7|<color #e85500>[[https://files.tyerslab.com/files/public/chemogenomics/cranks/IU1-C_25uM_Round-4_exp183.txt|Scores]]</color>|<button type="primary" size="sm" modal="ScorePlot">View</button>|<button type="primary" size="sm" modal="modal_hits">View</button>|<button type="primary" size="sm" modal="modal_screen_similarity">View</button>|<button type="default" size="sm" modal="modal_go_sensitive">View</button>|<button type="default" size="sm" modal="modal_go_resistant">View</button>|
<modal id='ScorePlot' size='lg' title='IU1-C 25μM R04 exp183'>
{{:chemogenomics:cranks_plots:exp183.png?nolink}}
</modal>


<modal id="modal_hits" size="sm" title="Top 30 S/R Genes">
^Gene^CRANKS Score^FDR^
|[[:human_genes:F:FLVCR1|FLVCR1]]|-2.99|0.01|
|[[:human_genes:M:MSI2|MSI2]]|-2.92|0.01|
|[[:human_genes:C:C6orf136|C6orf136]]|-2.66|0.09|
|[[:human_genes:Z:ZNF283|ZNF283]]|-2.66|0.05|
|[[:human_genes:P:PCYT1A|PCYT1A]]|-2.62|0.09|
|[[:human_genes:P:PRKAA1|PRKAA1]]|-2.42|0.10|
|[[:human_genes:K:KDSR|KDSR]]|-2.34|0.14|
|[[:human_genes:Q:QRICH1|QRICH1]]|-2.30|0.34|
|[[:human_genes:A:ADAMTS14|ADAMTS14]]|-2.29|0.16|
|[[:human_genes:G:GLRX5|GLRX5]]|-2.27|0.49|
|[[:human_genes:T:TRPV5|TRPV5]]|-2.21|0.23|
|[[:human_genes:D:DHX36|DHX36]]|-2.18|0.34|
|[[:human_genes:M:MRPS33|MRPS33]]|-2.18|0.37|
|[[:human_genes:A:AKAP12|AKAP12]]|-2.17|0.37|
|[[:human_genes:C:COX17|COX17]]|-2.16|0.37|
|[[:human_genes:P:PKM|PKM]]|-2.16|0.27|
|[[:human_genes:S:SARS2|SARS2]]|-2.15|0.27|
|[[:human_genes:S:SLC43A3|SLC43A3]]|-2.14|0.35|
|[[:human_genes:R:RMND5A|RMND5A]]|-2.12|0.28|
|[[:human_genes:H:HOXB4|HOXB4]]|-2.11|0.28|
|[[:human_genes:O:OR10G2|OR10G2]]|-2.10|0.35|
|[[:human_genes:W:WTH3DI|WTH3DI]]|-2.09|0.30|
|[[:human_genes:S:SNF8|SNF8]]|-2.08|0.35|
|[[:human_genes:S:SEPHS1|SEPHS1]]|-2.04|0.34|
|[[:human_genes:C:CDIPT|CDIPT]]|-2.00|0.53|
|[[:human_genes:Z:ZCRB1|ZCRB1]]|-1.98|0.35|
|[[:human_genes:A:ANKHD1|ANKHD1]]|-1.98|0.35|
|[[:human_genes:T:TOP3A|TOP3A]]|-1.97|0.35|
|[[:human_genes:Z:ZRSR2|ZRSR2]]|-1.97|0.35|
|[[:human_genes:S:SLC32A1|SLC32A1]]|-1.94|0.37|
|[[:human_genes:Z:ZNF713|ZNF713]]|2.02|0.36|
|[[:human_genes:M:MTMR12|MTMR12]]|2.05|0.32|
|[[:human_genes:Z:ZC3H13|ZC3H13]]|2.06|0.47|
|[[:human_genes:E:EIF3J|EIF3J]]|2.06|0.42|
|[[:human_genes:G:GAS7|GAS7]]|2.08|0.32|
|[[:human_genes:N:NCBP1|NCBP1]]|2.08|0.40|
|[[:human_genes:R:RPS15A|RPS15A]]|2.08|0.57|
|[[:human_genes:T:TAF1|TAF1]]|2.09|0.36|
|[[:human_genes:P:POLR2J3|POLR2J3]]|2.15|0.65|
|[[:human_genes:P:PADI3|PADI3]]|2.17|0.25|
|[[:human_genes:Z:ZFP64|ZFP64]]|2.18|0.32|
|[[:human_genes:G:GLE1|GLE1]]|2.18|0.55|
|[[:human_genes:M:METTL3|METTL3]]|2.20|0.38|
|[[:human_genes:T:TMEM245|TMEM245]]|2.21|0.22|
|[[:human_genes:M:MTRR|MTRR]]|2.25|0.19|
|[[:human_genes:R:RPS4X|RPS4X]]|2.36|0.32|
|[[:human_genes:S:STRAP|STRAP]]|2.37|0.11|
|[[:human_genes:S:SLC19A1|SLC19A1]]|2.38|0.32|
|[[:human_genes:T:TPSB2|TPSB2]]|2.38|0.36|
|[[:human_genes:P:POLR2J|POLR2J]]|2.38|0.50|
|[[:human_genes:I:INTS6|INTS6]]|2.51|0.32|
|[[:human_genes:L:LARS|LARS]]|2.53|0.39|
|[[:human_genes:S:SMIM11A|SMIM11A]]|2.54|0.44|
|[[:human_genes:P:PDHB|PDHB]]|2.80|<0.01|
|[[:human_genes:H:HNRNPD|HNRNPD]]|2.84|<0.01|
|[[:human_genes:P:PRPS1|PRPS1]]|3.12|<0.01|
|[[:human_genes:D:DNAJA1|DNAJA1]]|3.18|<0.01|
|[[:human_genes:P:PDHA1|PDHA1]]|3.37|<0.01|
|[[:human_genes:C:CDK2|CDK2]]|3.89|<0.01|
|[[:human_genes:M:MDH1|MDH1]]|4.01|<0.01|
</modal>


<modal id="modal_screen_similarity" size="lg" title="Correlated Screens">
^Screen^Correlation^Plot^
|[[:results:exp107|UMK57 0.6μM R03 exp107]]|0.051|<button type="primary" size="small" modal="1">View</button>|
|[[:results:exp274|Citral 50μM R06 exp274]]|0.06|<button type="primary" size="small" modal="2">View</button>|
|[[:results:exp358|FK-506 5μM R07 exp358]]|0.053|<button type="primary" size="small" modal="3">View</button>|
</modal>


<modal id="1" size="lg" title="IU1-C 25μM R04 exp183  vs  UMK57 0.6μM R03 exp107">
{{:chemogenomics:comparison_plots:exp107_vs_exp183.png?nolink |}}
</modal>

<modal id="2" size="lg" title="Citral 50μM R06 exp274  vs  IU1-C 25μM R04 exp183">
{{:chemogenomics:comparison_plots:exp183_vs_exp274.png?nolink |}}
</modal>

<modal id="3" size="lg" title="FK-506 5μM R07 exp358  vs  IU1-C 25μM R04 exp183">
{{:chemogenomics:comparison_plots:exp183_vs_exp358.png?nolink |}}
</modal>



<modal id="modal_go_sensitive" size="lg" title="Top 30 sensitive GO terms">No GO term hits below threshold. (FDR <0.05)</modal>
<modal id="modal_go_resistant" size="lg" title="Top 30 resistant GO terms">No GO term hits below threshold. (FDR <0.05)</modal>