====== L-BMAA 500 to 750μM on day4 R04 exp185 ======
==== Mechanism of Action ====
‘_-Methylamino-l-alanine, cyanobacterial neurotoxin, possible causative agent of ALS
  * **<color #00a2e8>Class / Subclass 1:</color>** Environmental Stresses / Toxin




==== Technical Notes ====
<accordion collapsed='true'>
<panel title='Protein References' collapsed='true'>
    * **<color #00a2e8>PubChem Name:</color>** %%(S)-2-Amino-3-(methylamino)propanoic acid hydrochloride%%
    * **<color #00a2e8>Synonyms:</color>** N/A
    * **<color #00a2e8>CAS #:</color>** 16012-55-8
    * **<color #00a2e8>PubChem CID:</color>** [[https://pubchem.ncbi.nlm.nih.gov/compound/51358333|51358333]]
    * **<color #00a2e8>IUPAC:</color>** %%(2S)-2-amino-3-(methylamino)propanoic acid;hydrochloride%%
    * **<color #00a2e8>INCHI Name:</color>** InChI=1S/C4H10N2O2.ClH/c1-6-2-3(5)4(7)8;/h3,6H,2,5H2,1H3,(H,7,8);1H/t3-;/m0./s1
    * **<color #00a2e8>INCHI Key:</color>** VDXYGASOGLSIDM-DFWYDOINSA-N
    * **<color #00a2e8>Molecular Weight:</color>** 154.59
    * **<color #00a2e8>Canonical SMILES:</color>** CNCC(C(=O)O)N.Cl
    * **<color #00a2e8>Isomeric SMILES:</color>** CNC[C@@H](C(=O)O)N.Cl
    * **<color #00a2e8>Molecular Formula:</color>** C4H11ClN2O2
{{:chemogenomics:structures:chem-0118.svg?nolink}}
</panel>


<panel title='Protein Supplier' collapsed='true'>
    * **<color #00a2e8>Supplier Name:</color>** BePharm Limited
    * **<color #00a2e8>Catalog #:</color>** B216961
    * **<color #00a2e8>Lot #:</color>** FC03-179
</panel>


<panel title='Protein Characterization' collapsed='true'>
    * **<color #00a2e8>HRMS (ESI-TOF) m/z:</color>** (M+H)+ Calcd for C4H10N2O2 119.0815; found 119.07908
</panel>


<panel title='Dose Response Curve' collapsed='true'>
    * **<color #00a2e8>Platform ID:</color>** L-BMAA
    * **<color #00a2e8>Min:</color>** -10.9269; **<color #00a2e8>Max:</color>** 5.5251
{{:chemogenomics:dose_response:dr_229.png?nolink&500 |}}
\\ 
\\ 
\\ 
\\ 
|< 300px 100px 200px >|
^ IC   ^ Concentration (µM) ^
| IC10  |N/A    |
| IC20  |N/A    |
| IC30  |N/A    |
| IC40  |N/A    |
| IC50  |N/A    |
| IC60  |N/A    |
| IC70  |N/A    |
| IC80  |N/A    |
| IC90  |N/A    |
\\ 
</panel>
</accordion>
==== Screen Summary ====
    * **<color #00a2e8>Round</color>**: 04
    * **<color #00a2e8>Dose</color>**: 500-750µM
    * **<color #00a2e8>Days of incubation</color>**: 8
    * **<color #00a2e8>Doublings</color>**: 7.2
    * **<color #00a2e8>Numbers of reads</color>**: 13378608


==== Screen Results ====


^Sensitive/Resistant hits (FDR<0.05)^CRANKS^Score Plot^Top 30 Genes^Screen Similarity^Top 30 Sensitive GO terms^Top 30 Resistant GO terms^
|2/1|<color #e85500>[[https://files.tyerslab.com/files/public/chemogenomics/cranks/L-BMAA_500-750day4uM_Round-4_exp185.txt|Scores]]</color>|<button type="primary" size="sm" modal="ScorePlot">View</button>|<button type="primary" size="sm" modal="modal_hits">View</button>|<button type="primary" size="sm" modal="modal_screen_similarity">View</button>|<button type="default" size="sm" modal="modal_go_sensitive">View</button>|<button type="default" size="sm" modal="modal_go_resistant">View</button>|
<modal id='ScorePlot' size='lg' title='L-BMAA 500 to 750μM on day4 R04 exp185'>
{{:chemogenomics:cranks_plots:exp185.png?nolink}}
</modal>


<modal id="modal_hits" size="sm" title="Top 30 S/R Genes">
^Gene^CRANKS Score^FDR^
|[[:human_genes:R:RSRC2|RSRC2]]|-3.37|0.05|
|[[:human_genes:K:KDSR|KDSR]]|-2.77|0.05|
|[[:human_genes:V:VEZT|VEZT]]|-2.61|0.07|
|[[:human_genes:F:FBXW7|FBXW7]]|-2.40|0.17|
|[[:human_genes:T:TNNI3|TNNI3]]|-2.36|0.18|
|[[:human_genes:T:TRMT10A|TRMT10A]]|-2.32|0.18|
|[[:human_genes:R:RBM14|RBM14]]|-2.31|0.26|
|[[:human_genes:T:TRIM44|TRIM44]]|-2.25|0.31|
|[[:human_genes:R:RBM14-RBM4|RBM14-RBM4]]|-2.24|0.31|
|[[:human_genes:T:TAS2R3|TAS2R3]]|-2.24|0.25|
|[[:human_genes:R:RTCB|RTCB]]|-2.19|0.37|
|[[:human_genes:G:GTF3C6|GTF3C6]]|-2.18|0.26|
|[[:human_genes:C:CCDC13|CCDC13]]|-2.17|0.26|
|[[:human_genes:R:RNASEH2A|RNASEH2A]]|-2.09|0.47|
|[[:human_genes:S:SUMO2|SUMO2]]|-2.08|0.71|
|[[:human_genes:A:ATIC|ATIC]]|-2.01|0.41|
|[[:human_genes:A:ASB3|ASB3]]|-2.01|0.41|
|[[:human_genes:A:ALDH18A1|ALDH18A1]]|-2.01|0.41|
|[[:human_genes:L:LCTL|LCTL]]|-1.99|0.57|
|[[:human_genes:R:R3HCC1|R3HCC1]]|-1.98|0.71|
|[[:human_genes:G:GAS2L1|GAS2L1]]|-1.93|0.62|
|[[:human_genes:Z:ZNF415|ZNF415]]|-1.93|0.53|
|[[:human_genes:U:UBE3D|UBE3D]]|-1.92|0.53|
|[[:human_genes:C:CDA|CDA]]|-1.92|0.53|
|[[:human_genes:D:DPAGT1|DPAGT1]]|-1.91|0.53|
|[[:human_genes:S:SEPHS1|SEPHS1]]|-1.89|0.56|
|[[:human_genes:D:DCD|DCD]]|-1.88|0.65|
|[[:human_genes:S:SMUG1|SMUG1]]|-1.85|0.62|
|[[:human_genes:T:TMEM217|TMEM217]]|-1.84|0.62|
|[[:human_genes:S:SYNC|SYNC]]|-1.84|0.62|
|[[:human_genes:Z:ZNF829|ZNF829]]|1.88|0.81|
|[[:human_genes:R:RRP15|RRP15]]|1.88|0.81|
|[[:human_genes:C:CYYR1|CYYR1]]|1.88|0.81|
|[[:human_genes:S:SLC22A17|SLC22A17]]|1.88|0.81|
|[[:human_genes:R:RPL30|RPL30]]|1.89|0.81|
|[[:human_genes:K:KDM4D|KDM4D]]|1.89|0.81|
|[[:human_genes:N:NPIPB8|NPIPB8]]|1.92|0.81|
|[[:human_genes:P:POLR2D|POLR2D]]|1.92|0.81|
|[[:human_genes:C:CDC16|CDC16]]|1.93|0.81|
|[[:human_genes:P:PRCP|PRCP]]|1.93|0.81|
|[[:human_genes:C:C16orf47|C16orf47]]|1.93|0.81|
|[[:human_genes:D:DNM2|DNM2]]|1.94|0.81|
|[[:human_genes:C:CEP128|CEP128]]|1.96|0.81|
|[[:human_genes:M:MINPP1|MINPP1]]|1.98|0.81|
|[[:human_genes:T:TFIP11|TFIP11]]|2.00|0.81|
|[[:human_genes:P:PSMA7|PSMA7]]|2.00|0.81|
|[[:human_genes:M:MROH7|MROH7]]|2.01|0.81|
|[[:human_genes:U:UNC93B1|UNC93B1]]|2.04|0.81|
|[[:human_genes:R:RNF113A|RNF113A]]|2.11|0.81|
|[[:human_genes:S:SF3B3|SF3B3]]|2.13|0.81|
|[[:human_genes:P:PCF11|PCF11]]|2.13|0.81|
|[[:human_genes:U:USP27X|USP27X]]|2.15|0.81|
|[[:human_genes:S:SNRPB|SNRPB]]|2.15|0.81|
|[[:human_genes:A:ATF6|ATF6]]|2.18|0.81|
|[[:human_genes:T:TOP1MT|TOP1MT]]|2.19|0.81|
|[[:human_genes:C:CMYA5|CMYA5]]|2.31|0.81|
|[[:human_genes:G:GPR179|GPR179]]|2.32|0.81|
|[[:human_genes:S:SMG5|SMG5]]|2.32|0.81|
|[[:human_genes:Z:ZNF474|ZNF474]]|2.55|0.37|
|[[:human_genes:D:DCSTAMP|DCSTAMP]]|3.01|0.05|
</modal>


<modal id="modal_screen_similarity" size="lg" title="Correlated Screens">
^Screen^Correlation^Plot^
|[[:results:exp73|LJH685 5μM R02 exp73]]|0.069|<button type="primary" size="small" modal="1">View</button>|
|[[:results:exp421|VHL-ligand-1 20μM R07 exp421]]|0.054|<button type="primary" size="small" modal="2">View</button>|
|[[:results:exp187|proTAME 5μM R04 exp187]]|0.054|<button type="primary" size="small" modal="3">View</button>|
|[[:results:exp392|PT-1 25μM R07 exp392]]|0.051|<button type="primary" size="small" modal="4">View</button>|
|[[:results:exp471|Cholesterol 0.003 to 0.006 to 0.1μM on day2 then day6 R08 exp471]]|0.065|<button type="primary" size="small" modal="5">View</button>|
|[[:results:exp124|GSK343 3μM R03 exp124]]|0.052|<button type="primary" size="small" modal="6">View</button>|
|[[:results:exp340|BN82002 4μM R07 exp340]]|0.051|<button type="primary" size="small" modal="7">View</button>|
</modal>


<modal id="1" size="lg" title="L-BMAA 500 to 750μM on day4 R04 exp185  vs  LJH685 5μM R02 exp73">
{{:chemogenomics:comparison_plots:exp185_vs_exp73.png?nolink |}}
</modal>

<modal id="2" size="lg" title="L-BMAA 500 to 750μM on day4 R04 exp185  vs  VHL-ligand-1 20μM R07 exp421">
{{:chemogenomics:comparison_plots:exp185_vs_exp421.png?nolink |}}
</modal>

<modal id="3" size="lg" title="L-BMAA 500 to 750μM on day4 R04 exp185  vs  proTAME 5μM R04 exp187">
{{:chemogenomics:comparison_plots:exp185_vs_exp187.png?nolink |}}
</modal>

<modal id="4" size="lg" title="L-BMAA 500 to 750μM on day4 R04 exp185  vs  PT-1 25μM R07 exp392">
{{:chemogenomics:comparison_plots:exp185_vs_exp392.png?nolink |}}
</modal>

<modal id="5" size="lg" title="Cholesterol 0.003 to 0.006 to 0.1μM on day2 then day6 R08 exp471  vs  L-BMAA 500 to 750μM on day4 R04 exp185">
{{:chemogenomics:comparison_plots:exp185_vs_exp471.png?nolink |}}
</modal>

<modal id="6" size="lg" title="GSK343 3μM R03 exp124  vs  L-BMAA 500 to 750μM on day4 R04 exp185">
{{:chemogenomics:comparison_plots:exp124_vs_exp185.png?nolink |}}
</modal>

<modal id="7" size="lg" title="BN82002 4μM R07 exp340  vs  L-BMAA 500 to 750μM on day4 R04 exp185">
{{:chemogenomics:comparison_plots:exp185_vs_exp340.png?nolink |}}
</modal>



<modal id="modal_go_sensitive" size="lg" title="Top 30 sensitive GO terms">No GO term hits below threshold. (FDR <0.05)</modal>
<modal id="modal_go_resistant" size="lg" title="Top 30 resistant GO terms">No GO term hits below threshold. (FDR <0.05)</modal>