====== Etoposide 10μM R00 exp20 ======
==== Mechanism of Action ====
Binds DNA-TopII complex, blocks re-ligation, induces strand breaks, semi-synthetic derivative of podophyllotoxin
* **Class / Subclass 1:** DNA Damage, Repair and Replication / Topoisomerase II Inhibitor
==== Technical Notes ====
* **PubChem Name:** %%Etoposide%%
* **Synonyms:** VP-16; VP-16-213
* **CAS #:** 33419-42-0
* **PubChem CID:** [[https://pubchem.ncbi.nlm.nih.gov/compound/36462|36462]]
* **IUPAC:** %%(5S,5aR,8aR,9R)-5-[[(2R,4aR,6R,7R,8R,8aS)-7,8-dihydroxy-2-methyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl]oxy]-9-(4-hydroxy-3,5-dimethoxyphenyl)-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[6,5-f][1,3]benzodioxol-8-one%%
* **INCHI Name:** InChI=1S/C29H32O13/c1-11-36-9-20-27(40-11)24(31)25(32)29(41-20)42-26-14-7-17-16(38-10-39-17)6-13(14)21(22-15(26)8-37-28(22)33)12-4-18(34-2)23(30)19(5-12)35-3/h4-7,11,15,20-22,24-27,29-32H,8-10H2,1-3H3/t11-,15+,20-,21-,22+,24-,25-,26-,27-,29+/m1/s1
* **INCHI Key:** VJJPUSNTGOMMGY-MRVIYFEKSA-N
* **Molecular Weight:** 588.6
* **Canonical SMILES:** CC1OCC2C(O1)C(C(C(O2)OC3C4COC(=O)C4C(C5=CC6=C(C=C35)OCO6)C7=CC(=C(C(=C7)OC)O)OC)O)O
* **Isomeric SMILES:** C[C@@H]1OC[C@@H]2[C@@H](O1)[C@@H]([C@H]([C@@H](O2)O[C@H]3[C@H]4COC(=O)[C@@H]4[C@@H](C5=CC6=C(C=C35)OCO6)C7=CC(=C(C(=C7)OC)O)OC)O)O
* **Molecular Formula:** C29H32O13
{{:chemogenomics:structures:chem-0011.svg?nolink}}
* **Supplier Name:** Sigma-Aldrich
* **Catalog #:** E1383
* **Lot #:** N/A
* **HRMS (ESI-TOF) m/z:** (M+H)+ Calcd for C29H32O13 589.19157; found 589.19262
* **Platform ID:** Etoposide
* **Min:** -33.3567; **Max:** 88.0314
{{:chemogenomics:dose_response:dr_265.png?nolink&500 |}}
\\
\\
\\
\\
|< 300px 100px 200px >|
^ IC ^ Concentration (µM) ^
| IC10 |N/A |
| IC20 |0.1877 |
| IC30 |0.2644 |
| IC40 |0.3501 |
| IC50 |0.4531 |
| IC60 |N/A |
| IC70 |N/A |
| IC80 |N/A |
| IC90 |N/A |
\\
==== Screen Summary ====
* **Round**: 00
* **Dose**: 10µM
* **Days of incubation**: 8
* **Doublings**: 0.1
* **Numbers of reads**: 24781748
==== Screen Results ====
^Sensitive/Resistant hits (FDR<0.05)^CRANKS^Score Plot^Top 30 Genes^Screen Similarity^Top 30 Sensitive GO terms^Top 30 Resistant GO terms^
|3/1|[[https://files.tyerslab.com/files/public/chemogenomics/cranks/Etoposide_10uM_Round-0_exp20.txt|Scores]]||||||
{{:chemogenomics:cranks_plots:exp20.png?nolink}}
^Gene^CRANKS Score^FDR^
|[[:human_genes:G:GOLGA6L1|GOLGA6L1]]|-3.40|0.13|
|[[:human_genes:C:COX7A2L|COX7A2L]]|-3.39|0.01|
|[[:human_genes:S:STARD7|STARD7]]|-2.89|0.04|
|[[:human_genes:H:HNRNPA0|HNRNPA0]]|-2.87|0.03|
|[[:human_genes:F:FANCI|FANCI]]|-2.81|0.13|
|[[:human_genes:S:SEPSECS|SEPSECS]]|-2.47|0.21|
|[[:human_genes:U:UBE2Q1|UBE2Q1]]|-2.47|0.21|
|[[:human_genes:S:SLC6A9|SLC6A9]]|-2.45|0.13|
|[[:human_genes:M:MAPK13|MAPK13]]|-2.44|0.13|
|[[:human_genes:L:LRP8|LRP8]]|-2.43|0.13|
|[[:human_genes:N:NME6|NME6]]|-2.37|0.13|
|[[:human_genes:M:MSI2|MSI2]]|-2.37|0.13|
|[[:human_genes:G:GCLC|GCLC]]|-2.31|0.13|
|[[:human_genes:R:RPL35|RPL35]]|-2.20|0.30|
|[[:human_genes:P:POLR2J3|POLR2J3]]|-2.20|0.79|
|[[:human_genes:C:CHAF1A|CHAF1A]]|-2.16|0.79|
|[[:human_genes:M:MRS2|MRS2]]|-2.16|0.22|
|[[:human_genes:L:LSR|LSR]]|-2.15|0.37|
|[[:human_genes:C:CDK6|CDK6]]|-2.14|0.23|
|[[:human_genes:N:NPIPB3|NPIPB3]]|-2.10|0.79|
|[[:human_genes:O:OGFR|OGFR]]|-2.08|0.67|
|[[:human_genes:N:NMNAT1|NMNAT1]]|-2.07|0.30|
|[[:human_genes:A:ATXN2L|ATXN2L]]|-2.02|0.55|
|[[:human_genes:Z:ZHX2|ZHX2]]|-1.98|0.43|
|[[:human_genes:T:TMEM212|TMEM212]]|-1.97|0.43|
|[[:human_genes:F:FBXO38|FBXO38]]|-1.97|0.43|
|[[:human_genes:K:KIDINS220|KIDINS220]]|-1.92|0.68|
|[[:human_genes:Z:ZBTB10|ZBTB10]]|-1.92|0.68|
|[[:human_genes:E:EP300|EP300]]|-1.92|0.79|
|[[:human_genes:C:C16orf80|C16orf80]]|-1.92|0.79|
|[[:human_genes:S:SLC40A1|SLC40A1]]|1.67|0.99|
|[[:human_genes:B:BNC1|BNC1]]|1.67|0.99|
|[[:human_genes:C:CREB3|CREB3]]|1.68|0.99|
|[[:human_genes:T:TRAPPC13|TRAPPC13]]|1.68|0.99|
|[[:human_genes:M:MRPS11|MRPS11]]|1.70|0.99|
|[[:human_genes:D:DNA2|DNA2]]|1.71|0.99|
|[[:human_genes:T:TM4SF20|TM4SF20]]|1.71|0.99|
|[[:human_genes:C:CASP7|CASP7]]|1.71|0.99|
|[[:human_genes:D:DMPK|DMPK]]|1.72|0.99|
|[[:human_genes:V:VSIG1|VSIG1]]|1.73|0.99|
|[[:human_genes:R:RNPS1|RNPS1]]|1.74|0.99|
|[[:human_genes:Z:ZNF334|ZNF334]]|1.82|0.99|
|[[:human_genes:G:GADL1|GADL1]]|1.85|0.99|
|[[:human_genes:D:DIABLO|DIABLO]]|1.86|0.99|
|[[:human_genes:A:APOBEC3F|APOBEC3F]]|1.88|0.99|
|[[:human_genes:C:CDKN1A|CDKN1A]]|1.89|0.98|
|[[:human_genes:H:HSPA9|HSPA9]]|1.92|0.99|
|[[:human_genes:B:BTF3L4|BTF3L4]]|1.95|0.95|
|[[:human_genes:P:POLR2L|POLR2L]]|2.01|0.98|
|[[:human_genes:C:CHD7|CHD7]]|2.02|0.78|
|[[:human_genes:C:C2CD5|C2CD5]]|2.02|0.78|
|[[:human_genes:B:BTBD9|BTBD9]]|2.03|0.98|
|[[:human_genes:Z:ZNF681|ZNF681]]|2.06|0.99|
|[[:human_genes:C:CCT6A|CCT6A]]|2.09|0.78|
|[[:human_genes:P:PLAA|PLAA]]|2.12|0.78|
|[[:human_genes:E:ENY2|ENY2]]|2.13|0.78|
|[[:human_genes:T:TIMM23B|TIMM23B]]|2.15|0.78|
|[[:human_genes:D:DDX23|DDX23]]|2.17|0.99|
|[[:human_genes:T:TP53|TP53]]|2.19|0.78|
|[[:human_genes:A:APAF1|APAF1]]|3.16|<0.01|
^Screen^Correlation^Plot^
|[[:results:exp34|Rotenone 20μM R00 exp34]]|0.061||
|[[:results:exp2|5-Fluorouracil 20μM R00 exp2]]|0.055||
{{:chemogenomics:comparison_plots:exp20_vs_exp34.png?nolink |}}
{{:chemogenomics:comparison_plots:exp2_vs_exp20.png?nolink |}}
No GO term hits below threshold. (FDR <0.05)
^GO Term^Fold Change^Genes^
|muscle cell apoptotic process|118.49|APAF1,TP53,DMPK|
|replicative senescence|110.59|TP53,CDKN1A,CHEK1|