====== Aphidicolin 0.04μM R06 exp263 ======
==== Mechanism of Action ====
Inhibits DNA polymerases Polα, Polδ, Polϵ and Polζ
  * **<color #00a2e8>Class / Subclass 1:</color>** DNA Damage, Repair and Replication / Replication Inhibitor
  * **<color #00a2e8>Class / Subclass 2:</color>** Cell Cycle / Replication Inhibitor
  * **<color #00a2e8>Class / Subclass 3:</color>** Infectious Disease / Antiviral


==== Technical Notes ====
<accordion collapsed='true'>
<panel title='Protein References' collapsed='true'>
    * **<color #00a2e8>PubChem Name:</color>** %%Aphidicolin%%
    * **<color #00a2e8>Synonyms:</color>** N/A
    * **<color #00a2e8>CAS #:</color>** 38966-21-1
    * **<color #00a2e8>PubChem CID:</color>** [[https://pubchem.ncbi.nlm.nih.gov/compound/457964|457964]]
    * **<color #00a2e8>IUPAC:</color>** %%(1S,2S,5R,6R,7R,10S,12R,13R)-6,13-bis(hydroxymethyl)-2,6-dimethyltetracyclo[10.3.1.01,10.02,7]hexadecane-5,13-diol%%
    * **<color #00a2e8>INCHI Name:</color>** InChI=1S/C20H34O4/c1-17(11-21)15-4-3-13-9-14-10-19(13,7-8-20(14,24)12-22)18(15,2)6-5-16(17)23/h13-16,21-24H,3-12H2,1-2H3/t13-,14+,15-,16+,17-,18-,19-,20-/m0/s1
    * **<color #00a2e8>INCHI Key:</color>** NOFOAYPPHIUXJR-APNQCZIXSA-N
    * **<color #00a2e8>Molecular Weight:</color>** 338.5
    * **<color #00a2e8>Canonical SMILES:</color>** CC12CCC(C(C1CCC3C24CCC(C(C3)C4)(CO)O)(C)CO)O
    * **<color #00a2e8>Isomeric SMILES:</color>** C[C@]12CC[C@H]([C@@]([C@@H]1CC[C@@H]3[C@@]24CC[C@@]([C@H](C3)C4)(CO)O)(C)CO)O
    * **<color #00a2e8>Molecular Formula:</color>** C20H34O4
{{:chemogenomics:structures:chem-0157.svg?nolink}}
</panel>


<panel title='Protein Supplier' collapsed='true'>
    * **<color #00a2e8>Supplier Name:</color>** Toronto Research Chemicals
    * **<color #00a2e8>Catalog #:</color>** A726260
    * **<color #00a2e8>Lot #:</color>** 1-TSS-153-1
</panel>


<panel title='Protein Characterization' collapsed='true'>
    * **<color #00a2e8>HRMS (ESI-TOF) m/z:</color>** (M+Na)+ Calcd for C20H34O4 361.23493; found 361.23594
</panel>


<panel title='Dose Response Curve' collapsed='true'>
    * **<color #00a2e8>Platform ID:</color>** Aphidicolin_A
    * **<color #00a2e8>Min:</color>** 12.3100; **<color #00a2e8>Max:</color>** 89.3842
{{:chemogenomics:dose_response:dr_314.png?nolink&500 |}}
\\ 
\\ 
\\ 
\\ 
|< 300px 100px 200px >|
^ IC   ^ Concentration (µM) ^
| IC10  |N/A    |
| IC20  |N/A    |
| IC30  |0.0187    |
| IC40  |N/A    |
| IC50  |0.0634    |
| IC60  |N/A    |
| IC70  |N/A    |
| IC80  |N/A    |
| IC90  |N/A    |
\\ 
</panel>
</accordion>
==== Screen Summary ====
    * **<color #00a2e8>Round</color>**: 06
    * **<color #00a2e8>Dose</color>**: 40nM
    * **<color #00a2e8>Days of incubation</color>**: 8
    * **<color #00a2e8>Doublings</color>**: 6.4
    * **<color #00a2e8>Numbers of reads</color>**: 8228186


==== Screen Results ====


^Sensitive/Resistant hits (FDR<0.05)^CRANKS^Score Plot^Top 30 Genes^Screen Similarity^Top 30 Sensitive GO terms^Top 30 Resistant GO terms^
|0/0|<color #e85500>[[https://files.tyerslab.com/files/public/chemogenomics/cranks/Aphidicolin_0.04uM_Round-6_exp263.txt|Scores]]</color>|<button type="primary" size="sm" modal="ScorePlot">View</button>|<button type="primary" size="sm" modal="modal_hits">View</button>|<button type="default" size="sm" modal="modal_screen_similarity">View</button>|<button type="default" size="sm" modal="modal_go_sensitive">View</button>|<button type="default" size="sm" modal="modal_go_resistant">View</button>|
<modal id='ScorePlot' size='lg' title='Aphidicolin 0.04μM R06 exp263'>
{{:chemogenomics:cranks_plots:exp263.png?nolink}}
</modal>


<modal id="modal_hits" size="sm" title="Top 30 S/R Genes">
^Gene^CRANKS Score^FDR^
|[[:human_genes:I:IGSF23|IGSF23]]|-2.68|0.34|
|[[:human_genes:M:MCM9|MCM9]]|-2.37|0.59|
|[[:human_genes:O:OPRM1|OPRM1]]|-2.22|0.59|
|[[:human_genes:D:DERA|DERA]]|-2.19|0.59|
|[[:human_genes:L:LSM11|LSM11]]|-2.18|0.66|
|[[:human_genes:E:EZH2|EZH2]]|-2.12|0.65|
|[[:human_genes:M:MED12|MED12]]|-2.11|0.83|
|[[:human_genes:B:BRSK1|BRSK1]]|-2.10|0.65|
|[[:human_genes:K:KRTAP9-2|KRTAP9-2]]|-2.09|0.65|
|[[:human_genes:C:CLTB|CLTB]]|-2.08|0.65|
|[[:human_genes:C:CEP95|CEP95]]|-2.07|0.65|
|[[:human_genes:G:GTPBP2|GTPBP2]]|-2.03|0.65|
|[[:human_genes:U:UBE2N|UBE2N]]|-2.02|0.66|
|[[:human_genes:R:RNF220|RNF220]]|-1.99|0.65|
|[[:human_genes:L:LUZP2|LUZP2]]|-1.99|0.65|
|[[:human_genes:H:HMGN5|HMGN5]]|-1.97|0.70|
|[[:human_genes:T:TEN1|TEN1]]|-1.97|0.65|
|[[:human_genes:V:VPS25|VPS25]]|-1.94|0.89|
|[[:human_genes:G:GRIN2A|GRIN2A]]|-1.94|0.70|
|[[:human_genes:R:RAMP1|RAMP1]]|-1.94|0.66|
|[[:human_genes:W:WNT6|WNT6]]|-1.93|0.76|
|[[:human_genes:W:WDR6|WDR6]]|-1.91|0.66|
|[[:human_genes:D:DNAJC3|DNAJC3]]|-1.90|0.66|
|[[:human_genes:C:CCDC101|CCDC101]]|-1.89|0.70|
|[[:human_genes:C:CSK|CSK]]|-1.88|0.70|
|[[:human_genes:A:ABCB11|ABCB11]]|-1.87|0.70|
|[[:human_genes:P:PPP1CB|PPP1CB]]|-1.86|0.83|
|[[:human_genes:R:REP15|REP15]]|-1.86|0.70|
|[[:human_genes:O:OSGEP|OSGEP]]|-1.84|0.74|
|[[:human_genes:O:OSTF1|OSTF1]]|-1.83|0.70|
|[[:human_genes:S:SLC10A7|SLC10A7]]|1.86|0.77|
|[[:human_genes:L:LPAR5|LPAR5]]|1.87|0.77|
|[[:human_genes:A:ADAMTS10|ADAMTS10]]|1.88|0.77|
|[[:human_genes:V:VWA5A|VWA5A]]|1.88|0.77|
|[[:human_genes:R:RPA1|RPA1]]|1.88|0.92|
|[[:human_genes:R:RNF6|RNF6]]|1.88|0.77|
|[[:human_genes:R:RPL30|RPL30]]|1.89|0.92|
|[[:human_genes:C:CTR9|CTR9]]|1.91|0.87|
|[[:human_genes:S:SCIMP|SCIMP]]|1.92|0.77|
|[[:human_genes:G:GRM5|GRM5]]|1.92|0.77|
|[[:human_genes:C:C10orf62|C10orf62]]|1.93|0.77|
|[[:human_genes:L:LBX2|LBX2]]|1.94|0.77|
|[[:human_genes:R:RPS3|RPS3]]|2.00|0.90|
|[[:human_genes:P:PSMB4|PSMB4]]|2.01|0.80|
|[[:human_genes:C:CCT2|CCT2]]|2.02|0.90|
|[[:human_genes:B:BCL11A|BCL11A]]|2.02|0.64|
|[[:human_genes:R:RPL13|RPL13]]|2.04|0.92|
|[[:human_genes:G:GMEB1|GMEB1]]|2.06|0.77|
|[[:human_genes:P:POLR2A|POLR2A]]|2.08|0.90|
|[[:human_genes:G:GIPR|GIPR]]|2.09|0.48|
|[[:human_genes:Z:ZIC4|ZIC4]]|2.09|0.48|
|[[:human_genes:K:KPNB1|KPNB1]]|2.13|0.80|
|[[:human_genes:T:TVP23A|TVP23A]]|2.15|0.44|
|[[:human_genes:P:PSMC3|PSMC3]]|2.19|0.89|
|[[:human_genes:P:PTPRD|PTPRD]]|2.20|0.39|
|[[:human_genes:K:KRTAP10-12|KRTAP10-12]]|2.34|0.39|
|[[:human_genes:M:MTHFD2|MTHFD2]]|2.34|0.34|
|[[:human_genes:R:RAB27A|RAB27A]]|2.40|0.34|
|[[:human_genes:F:FBXW12|FBXW12]]|2.42|0.34|
|[[:human_genes:A:AKAP12|AKAP12]]|2.49|0.39|
</modal>


<modal id="modal_screen_similarity" size="lg" title="Correlated Screens">
No correlation data above threshold. (correlation > 0.05)
</modal>


<modal id="modal_go_sensitive" size="lg" title="Top 30 sensitive GO terms">No GO term hits below threshold. (FDR <0.05)</modal>
<modal id="modal_go_resistant" size="lg" title="Top 30 resistant GO terms">No GO term hits below threshold. (FDR <0.05)</modal>