====== Hydroxyurea 15μM R06 exp289 ======
==== Mechanism of Action ====
Inhibits ribonucleotide reductase, scavenges tyrosyl radicals
  * **<color #00a2e8>Class / Subclass 1:</color>** Metabolism / Metabolic Enzyme Inhibitor
  * **<color #00a2e8>Class / Subclass 2:</color>** DNA Damage, Repair and Replication / Replication Inhibitor



==== Technical Notes ====
<accordion collapsed='true'>
<panel title='Protein References' collapsed='true'>
    * **<color #00a2e8>PubChem Name:</color>** %%Hydroxyurea%%
    * **<color #00a2e8>Synonyms:</color>** Hydroxycarbamide
    * **<color #00a2e8>CAS #:</color>** 127-07-1
    * **<color #00a2e8>PubChem CID:</color>** [[https://pubchem.ncbi.nlm.nih.gov/compound/3657|3657]]
    * **<color #00a2e8>IUPAC:</color>** %%hydroxyurea%%
    * **<color #00a2e8>INCHI Name:</color>** InChI=1S/CH4N2O2/c2-1(4)3-5/h5H,(H3,2,3,4)
    * **<color #00a2e8>INCHI Key:</color>** VSNHCAURESNICA-UHFFFAOYSA-N
    * **<color #00a2e8>Molecular Weight:</color>** 76.055
    * **<color #00a2e8>Canonical SMILES:</color>** C(=O)(N)NO
    * **<color #00a2e8>Isomeric SMILES:</color>** N/A
    * **<color #00a2e8>Molecular Formula:</color>** CH4N2O2
{{:chemogenomics:structures:chem-0177.svg?nolink}}
</panel>


<panel title='Protein Supplier' collapsed='true'>
    * **<color #00a2e8>Supplier Name:</color>** Sigma-Aldrich
    * **<color #00a2e8>Catalog #:</color>** H8627
    * **<color #00a2e8>Lot #:</color>** MKBK3764V
</panel>


<panel title='Protein Characterization' collapsed='true'>
    * **<color #00a2e8>HRMS (ESI-TOF) m/z:</color>** (M+H)+ Calcd for CH4N2O2 77.03455; found 77.03325
</panel>


<panel title='Dose Response Curve' collapsed='true'>
    * **<color #00a2e8>Platform ID:</color>** Hydroxyurea
    * **<color #00a2e8>Min:</color>** 15.1964; **<color #00a2e8>Max:</color>** 85.9305
{{:chemogenomics:dose_response:dr_319.png?nolink&500 |}}
\\ 
\\ 
\\ 
\\ 
|< 300px 100px 200px >|
^ IC   ^ Concentration (µM) ^
| IC10  |N/A    |
| IC20  |N/A    |
| IC30  |2.1781    |
| IC40  |N/A    |
| IC50  |45.0127    |
| IC60  |N/A    |
| IC70  |N/A    |
| IC80  |N/A    |
| IC90  |N/A    |
\\ 
</panel>
</accordion>
==== Screen Summary ====
    * **<color #00a2e8>Round</color>**: 06
    * **<color #00a2e8>Dose</color>**: 15µM
    * **<color #00a2e8>Days of incubation</color>**: 8
    * **<color #00a2e8>Doublings</color>**: 7.0
    * **<color #00a2e8>Numbers of reads</color>**: 8591149


==== Screen Results ====


^Sensitive/Resistant hits (FDR<0.05)^CRANKS^Score Plot^Top 30 Genes^Screen Similarity^Top 30 Sensitive GO terms^Top 30 Resistant GO terms^
|0/0|<color #e85500>[[https://files.tyerslab.com/files/public/chemogenomics/cranks/Hydroxyurea_15uM_Round-6_exp289.txt|Scores]]</color>|<button type="primary" size="sm" modal="ScorePlot">View</button>|<button type="primary" size="sm" modal="modal_hits">View</button>|<button type="default" size="sm" modal="modal_screen_similarity">View</button>|<button type="default" size="sm" modal="modal_go_sensitive">View</button>|<button type="default" size="sm" modal="modal_go_resistant">View</button>|
<modal id='ScorePlot' size='lg' title='Hydroxyurea 15μM R06 exp289'>
{{:chemogenomics:cranks_plots:exp289.png?nolink}}
</modal>


<modal id="modal_hits" size="sm" title="Top 30 S/R Genes">
^Gene^CRANKS Score^FDR^
|[[:human_genes:H:HIST1H2AK|HIST1H2AK]]|-3.12|0.08|
|[[:human_genes:D:DCAF7|DCAF7]]|-2.78|0.63|
|[[:human_genes:U:UBE3D|UBE3D]]|-2.56|0.14|
|[[:human_genes:M:MS4A13|MS4A13]]|-2.32|0.92|
|[[:human_genes:P:PWWP2B|PWWP2B]]|-2.29|0.43|
|[[:human_genes:F:FAF2|FAF2]]|-2.28|0.63|
|[[:human_genes:F:FAM110B|FAM110B]]|-2.20|0.55|
|[[:human_genes:X:XPO5|XPO5]]|-2.19|0.63|
|[[:human_genes:N:NWD1|NWD1]]|-2.14|0.63|
|[[:human_genes:U:USP8|USP8]]|-2.12|0.67|
|[[:human_genes:C:CBX3|CBX3]]|-2.09|0.63|
|[[:human_genes:U:UHRF1|UHRF1]]|-2.05|0.74|
|[[:human_genes:M:MAP6|MAP6]]|-2.05|0.63|
|[[:human_genes:B:BRE|BRE]]|-2.03|0.63|
|[[:human_genes:D:DLX4|DLX4]]|-2.02|0.63|
|[[:human_genes:C:CFL1|CFL1]]|-2.00|0.92|
|[[:human_genes:R:RBM14|RBM14]]|-2.00|0.80|
|[[:human_genes:K:KIAA0430|KIAA0430]]|-1.99|0.63|
|[[:human_genes:R:RBM14-RBM4|RBM14-RBM4]]|-1.98|0.85|
|[[:human_genes:T:TEC|TEC]]|-1.98|0.67|
|[[:human_genes:Z:ZNF626|ZNF626]]|-1.97|0.63|
|[[:human_genes:D:DCAF17|DCAF17]]|-1.94|0.63|
|[[:human_genes:S:SNRPD3|SNRPD3]]|-1.93|0.92|
|[[:human_genes:I:INTS2|INTS2]]|-1.93|0.76|
|[[:human_genes:C:CUL4B|CUL4B]]|-1.92|0.74|
|[[:human_genes:D:DCLRE1A|DCLRE1A]]|-1.92|0.63|
|[[:human_genes:Z:ZCCHC2|ZCCHC2]]|-1.92|0.63|
|[[:human_genes:P:PSMC3IP|PSMC3IP]]|-1.91|0.74|
|[[:human_genes:A:ASB3|ASB3]]|-1.90|0.74|
|[[:human_genes:S:SP7|SP7]]|-1.89|0.75|
|[[:human_genes:P:PRR14L|PRR14L]]|1.97|0.53|
|[[:human_genes:D:DIS3L|DIS3L]]|1.99|0.53|
|[[:human_genes:N:NOTCH2|NOTCH2]]|2.00|0.64|
|[[:human_genes:S:SCAP|SCAP]]|2.00|0.42|
|[[:human_genes:G:GRHPR|GRHPR]]|2.01|0.42|
|[[:human_genes:F:FANK1|FANK1]]|2.02|0.42|
|[[:human_genes:K:KRTAP4-1|KRTAP4-1]]|2.03|0.42|
|[[:human_genes:C:CHIC1|CHIC1]]|2.05|0.47|
|[[:human_genes:L:LRRC8E|LRRC8E]]|2.06|0.42|
|[[:human_genes:M:MDK|MDK]]|2.06|0.47|
|[[:human_genes:D:DDX54|DDX54]]|2.08|0.53|
|[[:human_genes:I:INTS1|INTS1]]|2.09|0.53|
|[[:human_genes:P:PTPRF|PTPRF]]|2.11|0.42|
|[[:human_genes:N:NONO|NONO]]|2.11|0.42|
|[[:human_genes:Z:ZNF628|ZNF628]]|2.12|0.42|
|[[:human_genes:Z:ZNF697|ZNF697]]|2.13|0.42|
|[[:human_genes:P:PRAMEF26|PRAMEF26]]|2.16|0.84|
|[[:human_genes:P:PRAMEF25|PRAMEF25]]|2.16|0.84|
|[[:human_genes:N:NOP16|NOP16]]|2.20|0.76|
|[[:human_genes:L:LMBR1L|LMBR1L]]|2.23|0.35|
|[[:human_genes:R:RPL26|RPL26]]|2.23|0.64|
|[[:human_genes:A:ADAM17|ADAM17]]|2.27|0.35|
|[[:human_genes:R:RNF169|RNF169]]|2.28|0.35|
|[[:human_genes:T:TCTN2|TCTN2]]|2.32|0.35|
|[[:human_genes:R:RABGAP1|RABGAP1]]|2.34|0.35|
|[[:human_genes:G:GPBP1|GPBP1]]|2.36|0.35|
|[[:human_genes:L:LARS|LARS]]|2.36|0.42|
|[[:human_genes:S:SNRPF|SNRPF]]|2.42|0.79|
|[[:human_genes:S:SEC13|SEC13]]|2.44|0.42|
|[[:human_genes:T:TTC26|TTC26]]|2.77|0.07|
</modal>


<modal id="modal_screen_similarity" size="lg" title="Correlated Screens">
No correlation data above threshold. (correlation > 0.05)
</modal>


<modal id="modal_go_sensitive" size="lg" title="Top 30 sensitive GO terms">No GO term hits below threshold. (FDR <0.05)</modal>
<modal id="modal_go_resistant" size="lg" title="Top 30 resistant GO terms">No GO term hits below threshold. (FDR <0.05)</modal>