====== Dimethyloxaloylglycine 11μM R07 exp314 ======
==== Mechanism of Action ====
Prolylhydroxylase inhibitor, induces HIF-1α accumulation
* **Class / Subclass 1:** Metabolism / Metabolic Enzyme Inhibitor
* **Class / Subclass 2:** Signal Transduction / Other inhibitor
==== Technical Notes ====
* **PubChem Name:** %%Dimethyloxalylglycine%%
* **Synonyms:** Dimethyloxallyl Glycine
* **CAS #:** 89464-63-1
* **PubChem CID:** [[https://pubchem.ncbi.nlm.nih.gov/compound/560326|560326]]
* **IUPAC:** %%methyl 2-[(2-methoxy-2-oxoethyl)amino]-2-oxoacetate%%
* **INCHI Name:** InChI=1S/C6H9NO5/c1-11-4(8)3-7-5(9)6(10)12-2/h3H2,1-2H3,(H,7,9)
* **INCHI Key:** BNJOZDZCRHCODO-UHFFFAOYSA-N
* **Molecular Weight:** 175.14
* **Canonical SMILES:** COC(=O)CNC(=O)C(=O)OC
* **Isomeric SMILES:** N/A
* **Molecular Formula:** C6H9NO5
{{:chemogenomics:structures:chem-0134.svg?nolink}}
* **Supplier Name:** Toronto Research Chemicals
* **Catalog #:** D476325
* **Lot #:** 5-RUS-16-1
* **HRMS (ESI-TOF) m/z:** (M+H)+ Calcd for C6H9NO5 176.05535; found 176.05545
* **Platform ID:** DMOG
* **Min:** -16.4864; **Max:** 89.0929
{{:chemogenomics:dose_response:dr_384.png?nolink&500 |}}
\\
\\
\\
\\
|< 300px 100px 200px >|
^ IC ^ Concentration (µM) ^
| IC10 |N/A |
| IC20 |6.0680 |
| IC30 |8.8278 |
| IC40 |12.6233 |
| IC50 |18.2304 |
| IC60 |N/A |
| IC70 |N/A |
| IC80 |N/A |
| IC90 |N/A |
\\
==== Screen Summary ====
* **Round**: 07
* **Dose**: 11µM
* **Days of incubation**: 8
* **Doublings**: 7.0
* **Numbers of reads**: 21046274
==== Screen Results ====
^Sensitive/Resistant hits (FDR<0.05)^CRANKS^Score Plot^Top 30 Genes^Screen Similarity^Top 30 Sensitive GO terms^Top 30 Resistant GO terms^
|1/0|[[https://files.tyerslab.com/files/public/chemogenomics/cranks/Dimethyloxaloylglycine_11uM_Round-7_exp314.txt|Scores]]||||||
{{:chemogenomics:cranks_plots:exp314.png?nolink}}
^Gene^CRANKS Score^FDR^
|[[:human_genes:E:EGLN1|EGLN1]]|-2.85|0.05|
|[[:human_genes:U:UHRF1|UHRF1]]|-2.68|0.10|
|[[:human_genes:V:VEZT|VEZT]]|-2.51|0.10|
|[[:human_genes:A:ABCC4|ABCC4]]|-2.48|0.10|
|[[:human_genes:T:TRIM33|TRIM33]]|-2.34|0.19|
|[[:human_genes:S:SEPHS1|SEPHS1]]|-2.27|0.24|
|[[:human_genes:P:PAX3|PAX3]]|-2.18|0.54|
|[[:human_genes:B:BZW2|BZW2]]|-2.16|0.39|
|[[:human_genes:B:BUD13|BUD13]]|-2.15|0.54|
|[[:human_genes:N:NWD1|NWD1]]|-2.14|0.54|
|[[:human_genes:K:KRTAP10-10|KRTAP10-10]]|-2.12|0.54|
|[[:human_genes:G:GMPPB|GMPPB]]|-2.07|0.75|
|[[:human_genes:T:TACR3|TACR3]]|-2.05|0.54|
|[[:human_genes:T:TAF1A|TAF1A]]|-2.01|0.73|
|[[:human_genes:M:MRPS33|MRPS33]]|-2.01|0.62|
|[[:human_genes:E:EIF4G3|EIF4G3]]|-1.98|0.66|
|[[:human_genes:T:TMIE|TMIE]]|-1.98|0.54|
|[[:human_genes:C:CEP95|CEP95]]|-1.97|0.54|
|[[:human_genes:C:CUL2|CUL2]]|-1.97|0.54|
|[[:human_genes:O:OR6C1|OR6C1]]|-1.95|0.73|
|[[:human_genes:O:OR5I1|OR5I1]]|-1.94|0.54|
|[[:human_genes:S:SH2D3C|SH2D3C]]|-1.94|0.54|
|[[:human_genes:H:HMGB2|HMGB2]]|-1.94|0.54|
|[[:human_genes:H:HNRNPM|HNRNPM]]|-1.92|0.73|
|[[:human_genes:S:SLC6A15|SLC6A15]]|-1.88|0.65|
|[[:human_genes:C:CEP63|CEP63]]|-1.88|0.73|
|[[:human_genes:A:ATP6V1D|ATP6V1D]]|-1.87|0.73|
|[[:human_genes:A:ATPIF1|ATPIF1]]|-1.87|0.73|
|[[:human_genes:Z:ZSCAN12|ZSCAN12]]|-1.84|0.80|
|[[:human_genes:K:KDELC1|KDELC1]]|-1.82|0.73|
|[[:human_genes:N:NPIPB6|NPIPB6]]|1.88|0.72|
|[[:human_genes:A:ANO6|ANO6]]|1.89|0.65|
|[[:human_genes:K:KLRG2|KLRG2]]|1.91|0.65|
|[[:human_genes:S:SF1|SF1]]|1.93|0.65|
|[[:human_genes:M:MDH1|MDH1]]|1.94|0.65|
|[[:human_genes:N:NOTCH4|NOTCH4]]|1.95|0.65|
|[[:human_genes:C:CLP1|CLP1]]|1.95|0.65|
|[[:human_genes:S:SLC16A7|SLC16A7]]|1.96|0.65|
|[[:human_genes:C:CCDC140|CCDC140]]|1.96|0.65|
|[[:human_genes:R:RPL15|RPL15]]|1.97|0.65|
|[[:human_genes:N:NUDCD1|NUDCD1]]|1.97|0.65|
|[[:human_genes:A:ALX1|ALX1]]|1.97|0.65|
|[[:human_genes:P:POU2AF1|POU2AF1]]|1.99|0.65|
|[[:human_genes:R:RPL10A|RPL10A]]|2.00|0.72|
|[[:human_genes:D:DACT3|DACT3]]|2.00|0.65|
|[[:human_genes:H:HLA-DQA1|HLA-DQA1]]|2.03|0.65|
|[[:human_genes:U:USP17L19|USP17L19]]|2.04|0.73|
|[[:human_genes:P:PLK4|PLK4]]|2.04|0.72|
|[[:human_genes:I:IL31RA|IL31RA]]|2.06|0.65|
|[[:human_genes:R:RPL22|RPL22]]|2.06|0.65|
|[[:human_genes:R:RPL35A|RPL35A]]|2.09|0.78|
|[[:human_genes:U:UPK3BL|UPK3BL]]|2.14|0.65|
|[[:human_genes:C:COPG1|COPG1]]|2.14|0.65|
|[[:human_genes:Z:ZNF101|ZNF101]]|2.17|0.65|
|[[:human_genes:P:PSMD3|PSMD3]]|2.22|0.66|
|[[:human_genes:L:LRRC30|LRRC30]]|2.24|0.65|
|[[:human_genes:R:RPL30|RPL30]]|2.25|0.72|
|[[:human_genes:T:TSHZ3|TSHZ3]]|2.28|0.65|
|[[:human_genes:L:LOC391322|LOC391322]]|2.54|0.72|
|[[:human_genes:P:POLE|POLE]]|3.00|0.52|
No correlation data above threshold. (correlation > 0.05)
No GO term hits below threshold. (FDR <0.05)
^GO Term^Fold Change^Genes^
|cytosolic large ribosomal subunit|65.02|RPL30,RPL35A,RPL22,RPL10A,RPL15,RPL37|
|cytosolic ribosome|31.88|RPL30,RPL35A,RPL22,RPL10A,RPL15,RPL37|
|large ribosomal subunit|30.70|RPL30,RPL35A,RPL22,RPL10A,RPL15,RPL37|
|cytoplasmic translation|29.61|RPL30,RPL35A,RPL22,RPL10A,RPL15,RPL37|
|structural constituent of ribosome|22.11|RPL30,RPL35A,RPL22,RPL10A,RPL15,RPL37|
|ribosomal subunit|19.06|RPL30,RPL35A,RPL22,RPL10A,RPL15,RPL37|
|ribosome|17.75|RPL30,RPL35A,RPL22,RPL10A,RPL15,SF1,RPL37|
|ribonucleoprotein complex|6.39|RPL30,RPL35A,RPL22,RPL10A,RPL15,SF1,RBMXL3,RPL37|