====== 5-Azacytidine 2μM R07 exp330 ======
==== Mechanism of Action ====
Analog of cytidine ribonucleoside, DNA methyltransferase inhibitor
* **Class / Subclass 1:** Metabolism / Antimetabolite
* **Class / Subclass 2:** Gene Regulation / Epigenetic Inhibitor
* **Class / Subclass 3:** DNA Damage, Repair and Replication / Replication Inhibitor
==== Technical Notes ====
* **PubChem Name:** %%Azacitidine%%
* **Synonyms:** Ladakamycin; 5-AzaC; Azacitidine
* **CAS #:** 320-67-2
* **PubChem CID:** [[https://pubchem.ncbi.nlm.nih.gov/compound/9444|9444]]
* **IUPAC:** %%4-amino-1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,3,5-triazin-2-one%%
* **INCHI Name:** InChI=1S/C8H12N4O5/c9-7-10-2-12(8(16)11-7)6-5(15)4(14)3(1-13)17-6/h2-6,13-15H,1H2,(H2,9,11,16)/t3-,4-,5-,6-/m1/s1
* **INCHI Key:** NMUSYJAQQFHJEW-KVTDHHQDSA-N
* **Molecular Weight:** 244.2
* **Canonical SMILES:** C1=NC(=NC(=O)N1C2C(C(C(O2)CO)O)O)N
* **Isomeric SMILES:** C1=NC(=NC(=O)N1[C@H]2[C@@H]([C@@H]([C@H](O2)CO)O)O)N
* **Molecular Formula:** C8H12N4O5
{{:chemogenomics:structures:chem-0189.svg?nolink}}
* **Supplier Name:** Toronto Research Chemicals
* **Catalog #:** A796000
* **Lot #:** 2-LXM-142-1
* **HRMS (ESI-TOF) m/z:** (M+H)+ Calcd for C8H12N4O5 245.08805; found 245.08809
* **Platform ID:** 5-Azacytidine
* **Min:** -0.0848; **Max:** 97.5455
{{:chemogenomics:dose_response:dr_368.png?nolink&500 |}}
\\
\\
\\
\\
|< 300px 100px 200px >|
^ IC ^ Concentration (µM) ^
| IC10 |N/A |
| IC20 |0.8797 |
| IC30 |1.6236 |
| IC40 |2.6917 |
| IC50 |4.2961 |
| IC60 |N/A |
| IC70 |N/A |
| IC80 |N/A |
| IC90 |N/A |
\\
==== Screen Summary ====
* **Round**: 07
* **Dose**: 2µM
* **Days of incubation**: 8
* **Doublings**: 4.1
* **Numbers of reads**: 20253580
==== Screen Results ====
^Sensitive/Resistant hits (FDR<0.05)^CRANKS^Score Plot^Top 30 Genes^Screen Similarity^Top 30 Sensitive GO terms^Top 30 Resistant GO terms^
|2/7|[[https://files.tyerslab.com/files/public/chemogenomics/cranks/5-Azacytidine_2uM_Round-7_exp330.txt|Scores]]||||||
{{:chemogenomics:cranks_plots:exp330.png?nolink}}
^Gene^CRANKS Score^FDR^
|[[:human_genes:U:UXS1|UXS1]]|-3.41|<0.01|
|[[:human_genes:C:CCM2|CCM2]]|-3.30|<0.01|
|[[:human_genes:C:CNOT2|CNOT2]]|-2.62|0.06|
|[[:human_genes:B:BCL2|BCL2]]|-2.57|0.06|
|[[:human_genes:L:LEMD3|LEMD3]]|-2.49|0.16|
|[[:human_genes:P:PSMA2|PSMA2]]|-2.47|0.27|
|[[:human_genes:S:SAFB|SAFB]]|-2.43|0.19|
|[[:human_genes:Z:ZNF259|ZNF259]]|-2.36|0.19|
|[[:human_genes:R:RNF25|RNF25]]|-2.35|0.16|
|[[:human_genes:U:UBE2I|UBE2I]]|-2.34|0.19|
|[[:human_genes:N:NFIA|NFIA]]|-2.34|0.19|
|[[:human_genes:S:SUMO2|SUMO2]]|-2.31|0.34|
|[[:human_genes:A:ALDOA|ALDOA]]|-2.31|0.55|
|[[:human_genes:M:MESDC1|MESDC1]]|-2.30|0.19|
|[[:human_genes:W:WNK1|WNK1]]|-2.30|0.27|
|[[:human_genes:S:SARS|SARS]]|-2.28|0.35|
|[[:human_genes:D:DDX6|DDX6]]|-2.26|0.27|
|[[:human_genes:M:MTF2|MTF2]]|-2.25|0.19|
|[[:human_genes:A:ADCY4|ADCY4]]|-2.25|0.19|
|[[:human_genes:C:CMTM2|CMTM2]]|-2.24|0.20|
|[[:human_genes:R:RIBC1|RIBC1]]|-2.19|0.30|
|[[:human_genes:P:PTEN|PTEN]]|-2.19|0.19|
|[[:human_genes:N:NCAPH2|NCAPH2]]|-2.16|0.19|
|[[:human_genes:C:CNOT8|CNOT8]]|-2.15|0.19|
|[[:human_genes:G:GID8|GID8]]|-2.14|0.19|
|[[:human_genes:D:DYNC1H1|DYNC1H1]]|-2.14|0.58|
|[[:human_genes:T:TCF4|TCF4]]|-2.13|0.19|
|[[:human_genes:U:USP7|USP7]]|-2.10|0.27|
|[[:human_genes:R:RSRC2|RSRC2]]|-2.08|0.60|
|[[:human_genes:B:BLNK|BLNK]]|-2.07|0.23|
|[[:human_genes:Z:ZBTB17|ZBTB17]]|1.99|0.34|
|[[:human_genes:R:RHOH|RHOH]]|2.02|0.32|
|[[:human_genes:P:PPP1R10|PPP1R10]]|2.03|0.34|
|[[:human_genes:R:RNF112|RNF112]]|2.03|0.34|
|[[:human_genes:C:CMC2|CMC2]]|2.05|0.52|
|[[:human_genes:A:ADCY6|ADCY6]]|2.06|0.28|
|[[:human_genes:S:SF3B2|SF3B2]]|2.08|0.35|
|[[:human_genes:A:ALAS1|ALAS1]]|2.10|0.35|
|[[:human_genes:C:C7orf26|C7orf26]]|2.11|0.23|
|[[:human_genes:S:SELP|SELP]]|2.13|0.23|
|[[:human_genes:S:SNRPF|SNRPF]]|2.13|0.63|
|[[:human_genes:N:NPIPB3|NPIPB3]]|2.14|0.63|
|[[:human_genes:T:TAF15|TAF15]]|2.15|0.34|
|[[:human_genes:S:SSBP1|SSBP1]]|2.18|0.28|
|[[:human_genes:E:E4F1|E4F1]]|2.19|0.34|
|[[:human_genes:M:ME2|ME2]]|2.19|0.19|
|[[:human_genes:M:MARCH5|MARCH5]]|2.19|0.19|
|[[:human_genes:D:DCK|DCK]]|2.19|0.19|
|[[:human_genes:M:METTL23|METTL23]]|2.20|0.19|
|[[:human_genes:N:NSUN5|NSUN5]]|2.31|0.19|
|[[:human_genes:R:ROMO1|ROMO1]]|2.38|0.09|
|[[:human_genes:B:BAK1|BAK1]]|2.45|0.06|
|[[:human_genes:P:PSMC6|PSMC6]]|2.57|0.23|
|[[:human_genes:C:CRLS1|CRLS1]]|2.57|0.04|
|[[:human_genes:A:AEBP2|AEBP2]]|2.69|0.02|
|[[:human_genes:E:EIF4A1|EIF4A1]]|3.08|<0.01|
|[[:human_genes:V:VDAC2|VDAC2]]|3.09|<0.01|
|[[:human_genes:I:IMPDH2|IMPDH2]]|3.25|<0.01|
|[[:human_genes:S:SLC29A1|SLC29A1]]|5.60|<0.01|
|[[:human_genes:U:UCK2|UCK2]]|8.49|<0.01|
^Screen^Correlation^Plot^
|[[:results:exp216|Erlotinib 10μM R05 exp216]]|0.075||
|[[:results:exp134|MS023 2μM R03 exp134]]|0.068||
|[[:results:exp436|Dynasore 7μM R08 exp436]]|0.065||
|[[:results:exp474|CR131-b 0.005μM R08 exp474]]|0.061||
|[[:results:exp455|Benzoate 10000μM R08 exp455]]|0.056||
|[[:results:exp357|Dorsomorphin 5μM R07 exp357]]|0.053||
|[[:results:exp517|Quercetin 20μM R08 exp517]]|0.052||
{{:chemogenomics:comparison_plots:exp216_vs_exp330.png?nolink |}}
{{:chemogenomics:comparison_plots:exp134_vs_exp330.png?nolink |}}
{{:chemogenomics:comparison_plots:exp330_vs_exp436.png?nolink |}}
{{:chemogenomics:comparison_plots:exp330_vs_exp474.png?nolink |}}
{{:chemogenomics:comparison_plots:exp330_vs_exp455.png?nolink |}}
{{:chemogenomics:comparison_plots:exp330_vs_exp357.png?nolink |}}
{{:chemogenomics:comparison_plots:exp330_vs_exp517.png?nolink |}}
No GO term hits below threshold. (FDR <0.05)
No GO term hits below threshold. (FDR <0.05)