====== Adefovir 20μM R07 exp332 ======
==== Mechanism of Action ====
Nucleoside reverse transcriptase inhibitor (NRTI), active against HBV and HSV
  * **<color #00a2e8>Class / Subclass 1:</color>** Infectious Disease / Antiviral
  * **<color #00a2e8>Class / Subclass 2:</color>** DNA Damage, Repair and Replication / Reverse Transcriptase Inhibitor
  * **<color #00a2e8>Class / Subclass 3:</color>** Metabolism / Antimetabolite


==== Technical Notes ====
<accordion collapsed='true'>
<panel title='Protein References' collapsed='true'>
    * **<color #00a2e8>PubChem Name:</color>** %%Adefovir%%
    * **<color #00a2e8>Synonyms:</color>** GS-0393; PMEA
    * **<color #00a2e8>CAS #:</color>** 106941-25-7
    * **<color #00a2e8>PubChem CID:</color>** [[https://pubchem.ncbi.nlm.nih.gov/compound/60172|60172]]
    * **<color #00a2e8>IUPAC:</color>** %%2-(6-aminopurin-9-yl)ethoxymethylphosphonic acid%%
    * **<color #00a2e8>INCHI Name:</color>** InChI=1S/C8H12N5O4P/c9-7-6-8(11-3-10-7)13(4-12-6)1-2-17-5-18(14,15)16/h3-4H,1-2,5H2,(H2,9,10,11)(H2,14,15,16)
    * **<color #00a2e8>INCHI Key:</color>** SUPKOOSCJHTBAH-UHFFFAOYSA-N
    * **<color #00a2e8>Molecular Weight:</color>** 273.19
    * **<color #00a2e8>Canonical SMILES:</color>** C1=NC(=C2C(=N1)N(C=N2)CCOCP(=O)(O)O)N
    * **<color #00a2e8>Isomeric SMILES:</color>** N/A
    * **<color #00a2e8>Molecular Formula:</color>** C8H12N5O4P
{{:chemogenomics:structures:chem-0191.svg?nolink}}
</panel>


<panel title='Protein Supplier' collapsed='true'>
    * **<color #00a2e8>Supplier Name:</color>** Ark Pharm Inc.
    * **<color #00a2e8>Catalog #:</color>** AK-75903
    * **<color #00a2e8>Lot #:</color>** WG0017455-170306001
</panel>


<panel title='Protein Characterization' collapsed='true'>
    * **<color #00a2e8>HRMS (ESI-TOF) m/z:</color>** (M+H)+ Calcd for C8H12N5O4P 274.06997; found 274.06966
</panel>


<panel title='Dose Response Curve' collapsed='true'>
    * **<color #00a2e8>Platform ID:</color>** Adefovir
    * **<color #00a2e8>Min:</color>** -8.5475; **<color #00a2e8>Max:</color>** 70.4919
{{:chemogenomics:dose_response:dr_415.png?nolink&500 |}}
\\ 
\\ 
\\ 
\\ 
|< 300px 100px 200px >|
^ IC   ^ Concentration (µM) ^
| IC10  |N/A    |
| IC20  |0.0648    |
| IC30  |0.1411    |
| IC40  |0.3040    |
| IC50  |0.7276    |
| IC60  |N/A    |
| IC70  |N/A    |
| IC80  |N/A    |
| IC90  |N/A    |
\\ 
</panel>
</accordion>
==== Screen Summary ====
    * **<color #00a2e8>Round</color>**: 07
    * **<color #00a2e8>Dose</color>**: 20µM
    * **<color #00a2e8>Days of incubation</color>**: 8
    * **<color #00a2e8>Doublings</color>**: 6.3
    * **<color #00a2e8>Numbers of reads</color>**: 22625883


==== Screen Results ====


^Sensitive/Resistant hits (FDR<0.05)^CRANKS^Score Plot^Top 30 Genes^Screen Similarity^Top 30 Sensitive GO terms^Top 30 Resistant GO terms^
|2/0|<color #e85500>[[https://files.tyerslab.com/files/public/chemogenomics/cranks/Adefovir_20uM_Round-7_exp332.txt|Scores]]</color>|<button type="primary" size="sm" modal="ScorePlot">View</button>|<button type="primary" size="sm" modal="modal_hits">View</button>|<button type="default" size="sm" modal="modal_screen_similarity">View</button>|<button type="default" size="sm" modal="modal_go_sensitive">View</button>|<button type="default" size="sm" modal="modal_go_resistant">View</button>|
<modal id='ScorePlot' size='lg' title='Adefovir 20μM R07 exp332'>
{{:chemogenomics:cranks_plots:exp332.png?nolink}}
</modal>


<modal id="modal_hits" size="sm" title="Top 30 S/R Genes">
^Gene^CRANKS Score^FDR^
|[[:human_genes:A:ABCC4|ABCC4]]|-3.24|<0.01|
|[[:human_genes:A:APEX2|APEX2]]|-3.06|<0.01|
|[[:human_genes:T:TCF4|TCF4]]|-2.64|0.05|
|[[:human_genes:R:RABGGTB|RABGGTB]]|-2.51|0.15|
|[[:human_genes:M:MST4|MST4]]|-2.38|0.15|
|[[:human_genes:R:RBM6|RBM6]]|-2.36|0.15|
|[[:human_genes:A:ANAPC15|ANAPC15]]|-2.28|0.34|
|[[:human_genes:L:LEO1|LEO1]]|-2.21|0.30|
|[[:human_genes:A:ANO4|ANO4]]|-2.19|0.35|
|[[:human_genes:M:MAPK4|MAPK4]]|-2.14|0.34|
|[[:human_genes:W:WDR55|WDR55]]|-2.13|0.39|
|[[:human_genes:A:ARID4A|ARID4A]]|-2.11|0.35|
|[[:human_genes:C:CAB39|CAB39]]|-2.09|0.47|
|[[:human_genes:E:ERCC2|ERCC2]]|-2.09|0.47|
|[[:human_genes:H:HIST1H4C|HIST1H4C]]|-2.08|0.35|
|[[:human_genes:C:CCDC111|CCDC111]]|-2.07|0.35|
|[[:human_genes:S:SLC10A5|SLC10A5]]|-2.06|0.35|
|[[:human_genes:R:RSC1A1|RSC1A1]]|-2.03|0.39|
|[[:human_genes:T:TRAF2|TRAF2]]|-2.02|0.45|
|[[:human_genes:A:ABCF3|ABCF3]]|-2.01|0.39|
|[[:human_genes:D:DYTN|DYTN]]|-2.00|0.45|
|[[:human_genes:A:ATXN10|ATXN10]]|-1.98|0.45|
|[[:human_genes:C:CDK2|CDK2]]|-1.97|0.41|
|[[:human_genes:I:IFITM10|IFITM10]]|-1.97|0.41|
|[[:human_genes:T:TXNL4B|TXNL4B]]|-1.97|0.41|
|[[:human_genes:V:VCPIP1|VCPIP1]]|-1.96|0.41|
|[[:human_genes:Z:ZNF259|ZNF259]]|-1.96|0.45|
|[[:human_genes:S:SYT8|SYT8]]|-1.96|0.47|
|[[:human_genes:P:PHB2|PHB2]]|-1.95|0.59|
|[[:human_genes:T:TBCC|TBCC]]|-1.94|0.59|
|[[:human_genes:R:RGS9BP|RGS9BP]]|1.89|0.62|
|[[:human_genes:P:POLA1|POLA1]]|1.90|0.77|
|[[:human_genes:G:GP5|GP5]]|1.91|0.63|
|[[:human_genes:N:NUP133|NUP133]]|1.91|0.68|
|[[:human_genes:G:GHRH|GHRH]]|1.93|0.56|
|[[:human_genes:G:GPAM|GPAM]]|1.94|0.62|
|[[:human_genes:C:CPNE4|CPNE4]]|1.94|0.62|
|[[:human_genes:I:IRGQ|IRGQ]]|1.94|0.56|
|[[:human_genes:T:TMEM70|TMEM70]]|1.95|0.56|
|[[:human_genes:E:ETFB|ETFB]]|1.96|0.62|
|[[:human_genes:C:CLVS1|CLVS1]]|2.01|0.53|
|[[:human_genes:M:MEGF9|MEGF9]]|2.01|0.53|
|[[:human_genes:P:PSMD3|PSMD3]]|2.04|0.68|
|[[:human_genes:T:THRSP|THRSP]]|2.04|0.53|
|[[:human_genes:L:LIG1|LIG1]]|2.08|0.76|
|[[:human_genes:Z:ZFAND5|ZFAND5]]|2.19|0.33|
|[[:human_genes:S:SAP30BP|SAP30BP]]|2.22|0.56|
|[[:human_genes:B:BRPF3|BRPF3]]|2.22|0.56|
|[[:human_genes:A:AK2|AK2]]|2.24|0.31|
|[[:human_genes:C:CREBBP|CREBBP]]|2.31|0.33|
|[[:human_genes:S:SCAP|SCAP]]|2.33|0.31|
|[[:human_genes:M:MPHOSPH10|MPHOSPH10]]|2.36|0.46|
|[[:human_genes:P:PRRC1|PRRC1]]|2.40|0.56|
|[[:human_genes:K:KANK1|KANK1]]|2.42|0.31|
|[[:human_genes:K:KIAA1211|KIAA1211]]|2.50|0.62|
|[[:human_genes:K:KPNB1|KPNB1]]|2.52|0.66|
|[[:human_genes:A:AAMP|AAMP]]|2.53|0.46|
|[[:human_genes:R:RPS4X|RPS4X]]|2.56|0.31|
|[[:human_genes:S:SZRD1|SZRD1]]|2.59|0.12|
|[[:human_genes:C:CHCHD5|CHCHD5]]|2.64|0.12|
</modal>


<modal id="modal_screen_similarity" size="lg" title="Correlated Screens">
No correlation data above threshold. (correlation > 0.05)
</modal>


<modal id="modal_go_sensitive" size="lg" title="Top 30 sensitive GO terms">No GO term hits below threshold. (FDR <0.05)</modal>
<modal id="modal_go_resistant" size="lg" title="Top 30 resistant GO terms">No GO term hits below threshold. (FDR <0.05)</modal>