====== All-trans-Retinoic-Acid 8μM R07 exp333 ======
==== Mechanism of Action ====
Ligand for retinoic acid receptor (RAR) and retinoid X receptor (RXR), metabolite of vitamin A1
* **Class / Subclass 1:** Gene Regulation / Nuclear Receptor Ligand
* **Class / Subclass 2:** Metabolism / Metabolite
==== Technical Notes ====
* **PubChem Name:** %%Tretinoin%%
* **Synonyms:** ATRA; Tretinoin; Vitamin A acid; all-trans-Retinoic acid; ATRA;Tretinoin;Vitamin A acid;all-trans-Retinoic acid
* **CAS #:** 302-79-4
* **PubChem CID:** [[https://pubchem.ncbi.nlm.nih.gov/compound/444795|444795]]
* **IUPAC:** %%(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoic acid%%
* **INCHI Name:** InChI=1S/C20H28O2/c1-15(8-6-9-16(2)14-19(21)22)11-12-18-17(3)10-7-13-20(18,4)5/h6,8-9,11-12,14H,7,10,13H2,1-5H3,(H,21,22)/b9-6+,12-11+,15-8+,16-14+
* **INCHI Key:** SHGAZHPCJJPHSC-YCNIQYBTSA-N
* **Molecular Weight:** 300.4
* **Canonical SMILES:** CC1=C(C(CCC1)(C)C)C=CC(=CC=CC(=CC(=O)O)C)C
* **Isomeric SMILES:** CC1=C(C(CCC1)(C)C)/C=C/C(=C/C=C/C(=C/C(=O)O)/C)/C
* **Molecular Formula:** C20H28O2
{{:chemogenomics:structures:chem-0192.svg?nolink}}
* **Supplier Name:** Sigma-Aldrich
* **Catalog #:** R2625
* **Lot #:** SLBB5473V
* **HRMS (ESI-TOF) m/z:** (M+H)+ Calcd for C20H28O2 301.21621; found 301.21722
* **Platform ID:** ATRA
* **Min:** 8.9864; **Max:** 98.8174
{{:chemogenomics:dose_response:dr_488.png?nolink&500 |}}
\\
\\
\\
\\
|< 300px 100px 200px >|
^ IC ^ Concentration (µM) ^
| IC10 |N/A |
| IC20 |0.0445 |
| IC30 |0.8254 |
| IC40 |6.3558 |
| IC50 |36.2335 |
| IC60 |N/A |
| IC70 |N/A |
| IC80 |N/A |
| IC90 |N/A |
\\
==== Screen Summary ====
* **Round**: 07
* **Dose**: 8µM
* **Days of incubation**: 8
* **Doublings**: 6.5
* **Numbers of reads**: 22540106
==== Screen Results ====
^Sensitive/Resistant hits (FDR<0.05)^CRANKS^Score Plot^Top 30 Genes^Screen Similarity^Top 30 Sensitive GO terms^Top 30 Resistant GO terms^
|0/0|[[https://files.tyerslab.com/files/public/chemogenomics/cranks/All-trans-Retinoic-Acid_8uM_Round-7_exp333.txt|Scores]]||||||
{{:chemogenomics:cranks_plots:exp333.png?nolink}}
^Gene^CRANKS Score^FDR^
|[[:human_genes:G:GNA13|GNA13]]|-2.69|0.07|
|[[:human_genes:R:RHOA|RHOA]]|-2.65|0.07|
|[[:human_genes:P:PGGT1B|PGGT1B]]|-2.56|0.08|
|[[:human_genes:Z:ZBTB10|ZBTB10]]|-2.53|0.08|
|[[:human_genes:S:SCAF8|SCAF8]]|-2.47|0.08|
|[[:human_genes:S:SEC61A2|SEC61A2]]|-2.40|0.11|
|[[:human_genes:U:UBE2A|UBE2A]]|-2.38|0.11|
|[[:human_genes:D:DDRGK1|DDRGK1]]|-2.30|0.23|
|[[:human_genes:C:CREBBP|CREBBP]]|-2.29|0.23|
|[[:human_genes:D:DERL2|DERL2]]|-2.27|0.18|
|[[:human_genes:C:CPPED1|CPPED1]]|-2.26|0.23|
|[[:human_genes:P:PRKAG1|PRKAG1]]|-2.21|0.21|
|[[:human_genes:A:ALG6|ALG6]]|-2.21|0.21|
|[[:human_genes:Z:ZFY|ZFY]]|-2.13|0.23|
|[[:human_genes:A:ABCB7|ABCB7]]|-2.10|0.24|
|[[:human_genes:S:SPEN|SPEN]]|-2.10|0.24|
|[[:human_genes:X:XPO5|XPO5]]|-2.07|0.34|
|[[:human_genes:R:RTCB|RTCB]]|-2.07|0.34|
|[[:human_genes:P:PSMA2|PSMA2]]|-2.06|0.51|
|[[:human_genes:D:DNAJC3|DNAJC3]]|-2.05|0.28|
|[[:human_genes:F:FAM219A|FAM219A]]|-2.05|0.28|
|[[:human_genes:C:CDC42BPA|CDC42BPA]]|-2.04|0.28|
|[[:human_genes:W:WARS|WARS]]|-2.04|0.35|
|[[:human_genes:A:ASIC2|ASIC2]]|-2.04|0.28|
|[[:human_genes:T:TCF4|TCF4]]|-2.03|0.28|
|[[:human_genes:S:SYCE2|SYCE2]]|-1.99|0.33|
|[[:human_genes:S:SHOX2|SHOX2]]|-1.99|0.49|
|[[:human_genes:Z:ZBTB7A|ZBTB7A]]|-1.98|0.33|
|[[:human_genes:T:TRIAP1|TRIAP1]]|-1.98|0.41|
|[[:human_genes:S:STAG2|STAG2]]|-1.96|0.34|
|[[:human_genes:S:SCAP|SCAP]]|1.90|0.59|
|[[:human_genes:A:ADO|ADO]]|1.93|0.59|
|[[:human_genes:N:NDRG1|NDRG1]]|1.94|0.59|
|[[:human_genes:O:OR8U8|OR8U8]]|1.94|0.64|
|[[:human_genes:R:RBM39|RBM39]]|1.94|0.66|
|[[:human_genes:C:CDK8|CDK8]]|1.95|0.59|
|[[:human_genes:Z:ZP1|ZP1]]|1.96|0.59|
|[[:human_genes:T:TRIM52|TRIM52]]|1.97|0.64|
|[[:human_genes:P:POLA2|POLA2]]|1.99|0.64|
|[[:human_genes:T:TMSB15B|TMSB15B]]|2.03|0.65|
|[[:human_genes:K:KIAA1211|KIAA1211]]|2.07|0.64|
|[[:human_genes:D:DPY19L2|DPY19L2]]|2.11|0.56|
|[[:human_genes:C:C4orf17|C4orf17]]|2.11|0.35|
|[[:human_genes:I:IFT74|IFT74]]|2.16|0.59|
|[[:human_genes:R:RPL11|RPL11]]|2.17|0.64|
|[[:human_genes:H:HOXA13|HOXA13]]|2.21|0.35|
|[[:human_genes:N:NAPA|NAPA]]|2.23|0.58|
|[[:human_genes:C:CCNB2|CCNB2]]|2.24|0.35|
|[[:human_genes:L:LTBP4|LTBP4]]|2.25|0.56|
|[[:human_genes:P:PSMB4|PSMB4]]|2.27|0.35|
|[[:human_genes:I:IQCK|IQCK]]|2.29|0.35|
|[[:human_genes:R:RCAN3|RCAN3]]|2.30|0.35|
|[[:human_genes:F:FAM200B|FAM200B]]|2.33|0.35|
|[[:human_genes:Z:ZNF217|ZNF217]]|2.33|0.35|
|[[:human_genes:C:CEP192|CEP192]]|2.33|0.44|
|[[:human_genes:R:RANGAP1|RANGAP1]]|2.41|0.35|
|[[:human_genes:N:NPIPB8|NPIPB8]]|2.53|0.59|
|[[:human_genes:P:PSMD3|PSMD3]]|2.56|0.59|
|[[:human_genes:P:PSMA7|PSMA7]]|2.62|0.35|
|[[:human_genes:S:SLC6A17|SLC6A17]]|2.69|0.34|
^Screen^Correlation^Plot^
|[[:results:exp347|Cyclosporin-A 0.8μM R07 exp347]]|0.063||
|[[:results:exp316|Geldanamycin 0.015 to 0.025μM on day4 R07 exp316]]|0.053||
{{:chemogenomics:comparison_plots:exp333_vs_exp347.png?nolink |}}
{{:chemogenomics:comparison_plots:exp316_vs_exp333.png?nolink |}}
No GO term hits below threshold. (FDR <0.05)
No GO term hits below threshold. (FDR <0.05)