====== Palbociclib 1μM R07 exp382 ======
==== Mechanism of Action ====
Inhibits CDK4 and CDK6, causes G1 arrest
* **Class / Subclass 1:** Cell Cycle / Cyclin Dependent Kinase Inhibitor
* **Class / Subclass 2:** Signal Transduction / Kinase Inhibitor
==== Technical Notes ====
* **PubChem Name:** %%Palbociclib%%
* **Synonyms:** PD 0332991
* **CAS #:** 571190-30-2
* **PubChem CID:** [[https://pubchem.ncbi.nlm.nih.gov/compound/5330286|5330286]]
* **IUPAC:** %%6-acetyl-8-cyclopentyl-5-methyl-2-[(5-piperazin-1-ylpyridin-2-yl)amino]pyrido[2,3-d]pyrimidin-7-one%%
* **INCHI Name:** InChI=1S/C24H29N7O2/c1-15-19-14-27-24(28-20-8-7-18(13-26-20)30-11-9-25-10-12-30)29-22(19)31(17-5-3-4-6-17)23(33)21(15)16(2)32/h7-8,13-14,17,25H,3-6,9-12H2,1-2H3,(H,26,27,28,29)
* **INCHI Key:** AHJRHEGDXFFMBM-UHFFFAOYSA-N
* **Molecular Weight:** 447.5
* **Canonical SMILES:** CC1=C(C(=O)N(C2=NC(=NC=C12)NC3=NC=C(C=C3)N4CCNCC4)C5CCCC5)C(=O)C
* **Isomeric SMILES:** N/A
* **Molecular Formula:** C24H29N7O2
{{:chemogenomics:structures:chem-0229.svg?nolink}}
* **Supplier Name:** Ark Pharm Inc.
* **Catalog #:** AK173631
* **Lot #:** WG0167187-160912001
* **HRMS (ESI-TOF) m/z:** (M+H)+ Calcd for C24H29N7O2 448.24555; found 448.24521
* **Platform ID:** Palbociclib
* **Min:** 12.7342; **Max:** 53.0111
{{:chemogenomics:dose_response:dr_438.png?nolink&500 |}}
\\
\\
\\
\\
|< 300px 100px 200px >|
^ IC ^ Concentration (µM) ^
| IC10 |N/A |
| IC20 |0.0476 |
| IC30 |0.3364 |
| IC40 |1.7300 |
| IC50 |N/A |
| IC60 |N/A |
| IC70 |N/A |
| IC80 |N/A |
| IC90 |N/A |
\\
==== Screen Summary ====
* **Round**: 07
* **Dose**: 1µM
* **Days of incubation**: 8
* **Doublings**: 0.6
* **Numbers of reads**: 16273129
==== Screen Results ====
^Sensitive/Resistant hits (FDR<0.05)^CRANKS^Score Plot^Top 30 Genes^Screen Similarity^Top 30 Sensitive GO terms^Top 30 Resistant GO terms^
|12/5|[[https://files.tyerslab.com/files/public/chemogenomics/cranks/Palbociclib_1uM_Round-7_exp382.txt|Scores]]||||||
{{:chemogenomics:cranks_plots:exp382.png?nolink}}
^Gene^CRANKS Score^FDR^
|[[:human_genes:Y:YPEL5|YPEL5]]|-4.95|<0.01|
|[[:human_genes:U:UBE2H|UBE2H]]|-3.48|<0.01|
|[[:human_genes:W:WDR26|WDR26]]|-3.35|<0.01|
|[[:human_genes:G:GPX4|GPX4]]|-3.32|<0.01|
|[[:human_genes:S:SEPHS2|SEPHS2]]|-3.31|<0.01|
|[[:human_genes:S:SNF8|SNF8]]|-3.09|<0.01|
|[[:human_genes:E:EEFSEC|EEFSEC]]|-3.02|<0.01|
|[[:human_genes:P:PSTK|PSTK]]|-3.01|<0.01|
|[[:human_genes:V:VPS25|VPS25]]|-2.87|0.14|
|[[:human_genes:C:CHMP4B|CHMP4B]]|-2.74|<0.01|
|[[:human_genes:A:ATP6V1B2|ATP6V1B2]]|-2.71|0.03|
|[[:human_genes:M:MAU2|MAU2]]|-2.70|0.40|
|[[:human_genes:E:ELAVL1|ELAVL1]]|-2.65|0.01|
|[[:human_genes:M:MON2|MON2]]|-2.51|0.03|
|[[:human_genes:X:XAB2|XAB2]]|-2.47|0.50|
|[[:human_genes:N:NAPA|NAPA]]|-2.44|0.14|
|[[:human_genes:M:MS4A13|MS4A13]]|-2.37|0.61|
|[[:human_genes:N:NEFM|NEFM]]|-2.37|0.28|
|[[:human_genes:C:CDS2|CDS2]]|-2.33|0.13|
|[[:human_genes:C:CUL1|CUL1]]|-2.31|0.09|
|[[:human_genes:S:SHFM1|SHFM1]]|-2.31|0.47|
|[[:human_genes:P:PCYT1A|PCYT1A]]|-2.27|0.11|
|[[:human_genes:T:TTC1|TTC1]]|-2.26|0.15|
|[[:human_genes:P:PPP1R12A|PPP1R12A]]|-2.25|0.11|
|[[:human_genes:T:TVP23A|TVP23A]]|-2.25|0.11|
|[[:human_genes:H:HMGCR|HMGCR]]|-2.24|0.40|
|[[:human_genes:C:CHMP6|CHMP6]]|-2.24|0.25|
|[[:human_genes:P:PHYHIPL|PHYHIPL]]|-2.20|0.13|
|[[:human_genes:A:ATP6V0A2|ATP6V0A2]]|-2.18|0.19|
|[[:human_genes:G:GID8|GID8]]|-2.18|0.14|
|[[:human_genes:M:MRPS14|MRPS14]]|1.96|0.33|
|[[:human_genes:L:LSM10|LSM10]]|1.96|0.33|
|[[:human_genes:C:CREBBP|CREBBP]]|1.96|0.40|
|[[:human_genes:A:ASCL2|ASCL2]]|2.00|0.33|
|[[:human_genes:C:COL21A1|COL21A1]]|2.00|0.37|
|[[:human_genes:D:DEPDC5|DEPDC5]]|2.01|0.33|
|[[:human_genes:A:ALG5|ALG5]]|2.02|0.33|
|[[:human_genes:W:WDR11|WDR11]]|2.05|0.33|
|[[:human_genes:P:PRKG2|PRKG2]]|2.06|0.33|
|[[:human_genes:A:ATP4B|ATP4B]]|2.07|0.33|
|[[:human_genes:T:TIPRL|TIPRL]]|2.10|0.26|
|[[:human_genes:T:TUFM|TUFM]]|2.11|0.33|
|[[:human_genes:P:PTGS1|PTGS1]]|2.11|0.26|
|[[:human_genes:N:NPRL2|NPRL2]]|2.15|0.24|
|[[:human_genes:A:AGPAT2|AGPAT2]]|2.17|0.32|
|[[:human_genes:R:RPIA|RPIA]]|2.18|0.22|
|[[:human_genes:M:MED25|MED25]]|2.22|0.33|
|[[:human_genes:W:WNT5B|WNT5B]]|2.24|0.26|
|[[:human_genes:K:KCTD5|KCTD5]]|2.31|0.14|
|[[:human_genes:C:C15orf41|C15orf41]]|2.38|0.13|
|[[:human_genes:R:RFXAP|RFXAP]]|2.40|0.16|
|[[:human_genes:P:PRRC2C|PRRC2C]]|2.41|0.16|
|[[:human_genes:A:ASB3|ASB3]]|2.45|0.14|
|[[:human_genes:C:CCND3|CCND3]]|2.70|0.32|
|[[:human_genes:A:ALDOA|ALDOA]]|2.81|0.33|
|[[:human_genes:D:DYRK1A|DYRK1A]]|2.86|0.02|
|[[:human_genes:R:RFX7|RFX7]]|2.92|<0.01|
|[[:human_genes:A:ATIC|ATIC]]|3.41|<0.01|
|[[:human_genes:R:RB1|RB1]]|7.97|<0.01|
|[[:human_genes:A:AMBRA1|AMBRA1]]|8.38|<0.01|
^Screen^Correlation^Plot^
|[[:results:exp435|JQ1 0.8μM R08 exp435]]|0.087||
|[[:results:exp502|Milciclib 2μM R08 exp502]]|0.065||
{{:chemogenomics:comparison_plots:exp382_vs_exp435.png?nolink |}}
{{:chemogenomics:comparison_plots:exp382_vs_exp502.png?nolink |}}
^GO Term^Fold Change^Genes^
|ESCRT II complex|614.04|SNF8,VPS25|
|late endosome to vacuole transport via multivesicular body sorting pathway|98.25|SNF8,VPS25,CHMP4B,CHMP6|
|ESCRT complex|94.47|SNF8,VPS25,CHMP4B,CHMP6|
|multivesicular body assembly|81.87|SNF8,VPS25,CHMP4B,CHMP6|
|multivesicular body organization|79.23|SNF8,VPS25,CHMP4B,CHMP6|
|late endosome to vacuole transport|72.24|SNF8,VPS25,CHMP4B,CHMP6|
|ubiquitin-dependent protein catabolic process via the multivesicular body sorting pathway|70.18|SNF8,VPS25,CHMP4B,CHMP6|
|endosome transport via multivesicular body sorting pathway|62.98|SNF8,VPS25,CHMP4B,CHMP6|
|membrane fission|59.91|SNF8,VPS25,CHMP4B,CHMP6|
|multivesicular body sorting pathway|52.26|SNF8,VPS25,CHMP4B,CHMP6|
|endosome organization|27.91|SNF8,VPS25,CHMP4B,CHMP6|
|ubiquitin-dependent protein catabolic process|8.41|UBE2H,WDR26,SNF8,VPS25,CHMP4B,CUL1,CHMP6|
|modification-dependent protein catabolic process|8.25|UBE2H,WDR26,SNF8,VPS25,CHMP4B,CUL1,CHMP6|
|modification-dependent macromolecule catabolic process|8.08|UBE2H,WDR26,SNF8,VPS25,CHMP4B,CUL1,CHMP6|
|proteolysis involved in protein catabolic process|7.37|UBE2H,WDR26,SNF8,VPS25,CHMP4B,CUL1,CHMP6|
No GO term hits below threshold. (FDR <0.05)