====== Pomalidomide 20μM R07 exp391 ======
==== Mechanism of Action ====
IMiD that targets neo-substrates IKZF1/3 for ubiquitination by CUL4A-DDB1-cereblon complex
  * **<color #00a2e8>Class / Subclass 1:</color>** Proteostasis / Ubiquitin-Proteasome Activator




==== Technical Notes ====
<accordion collapsed='true'>
<panel title='Protein References' collapsed='true'>
    * **<color #00a2e8>PubChem Name:</color>** %%Pomalidomide%%
    * **<color #00a2e8>Synonyms:</color>** CC-4047
    * **<color #00a2e8>CAS #:</color>** 19171-19-8
    * **<color #00a2e8>PubChem CID:</color>** [[https://pubchem.ncbi.nlm.nih.gov/compound/134780|134780]]
    * **<color #00a2e8>IUPAC:</color>** %%4-amino-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione%%
    * **<color #00a2e8>INCHI Name:</color>** InChI=1S/C13H11N3O4/c14-7-3-1-2-6-10(7)13(20)16(12(6)19)8-4-5-9(17)15-11(8)18/h1-3,8H,4-5,14H2,(H,15,17,18)
    * **<color #00a2e8>INCHI Key:</color>** UVSMNLNDYGZFPF-UHFFFAOYSA-N
    * **<color #00a2e8>Molecular Weight:</color>** 273.24
    * **<color #00a2e8>Canonical SMILES:</color>** C1CC(=O)NC(=O)C1N2C(=O)C3=C(C2=O)C(=CC=C3)N
    * **<color #00a2e8>Isomeric SMILES:</color>** N/A
    * **<color #00a2e8>Molecular Formula:</color>** C13H11N3O4
{{:chemogenomics:structures:chem-0233.svg?nolink}}
</panel>


<panel title='Protein Supplier' collapsed='true'>
    * **<color #00a2e8>Supplier Name:</color>** TCI America
    * **<color #00a2e8>Catalog #:</color>** P2074
    * **<color #00a2e8>Lot #:</color>** 3IUQJ-FB
</panel>


<panel title='Protein Characterization' collapsed='true'>
    * **<color #00a2e8>HRMS (ESI-TOF) m/z:</color>** (M+H)+ Calcd for C13H11N3O4 274.08223; found 274.07926
</panel>


<panel title='Dose Response Curve' collapsed='true'>
    * **<color #00a2e8>Platform ID:</color>** Pomalidomide
    * **<color #00a2e8>Min:</color>** -9.8487; **<color #00a2e8>Max:</color>** 7.7553
{{:chemogenomics:dose_response:dr_441.png?nolink&500 |}}
\\ 
\\ 
\\ 
\\ 
|< 300px 100px 200px >|
^ IC   ^ Concentration (µM) ^
| IC10  |N/A    |
| IC20  |N/A    |
| IC30  |N/A    |
| IC40  |N/A    |
| IC50  |N/A    |
| IC60  |N/A    |
| IC70  |N/A    |
| IC80  |N/A    |
| IC90  |N/A    |
\\ 
</panel>
</accordion>
==== Screen Summary ====
    * **<color #00a2e8>Round</color>**: 07
    * **<color #00a2e8>Dose</color>**: 20µM
    * **<color #00a2e8>Days of incubation</color>**: 8
    * **<color #00a2e8>Doublings</color>**: 6.8
    * **<color #00a2e8>Numbers of reads</color>**: 22978121


==== Screen Results ====


^Sensitive/Resistant hits (FDR<0.05)^CRANKS^Score Plot^Top 30 Genes^Screen Similarity^Top 30 Sensitive GO terms^Top 30 Resistant GO terms^
|0/1|<color #e85500>[[https://files.tyerslab.com/files/public/chemogenomics/cranks/Pomalidomide_20uM_Round-7_exp391.txt|Scores]]</color>|<button type="primary" size="sm" modal="ScorePlot">View</button>|<button type="primary" size="sm" modal="modal_hits">View</button>|<button type="default" size="sm" modal="modal_screen_similarity">View</button>|<button type="default" size="sm" modal="modal_go_sensitive">View</button>|<button type="default" size="sm" modal="modal_go_resistant">View</button>|
<modal id='ScorePlot' size='lg' title='Pomalidomide 20μM R07 exp391'>
{{:chemogenomics:cranks_plots:exp391.png?nolink}}
</modal>


<modal id="modal_hits" size="sm" title="Top 30 S/R Genes">
^Gene^CRANKS Score^FDR^
|[[:human_genes:S:SLC1A5|SLC1A5]]|-2.60|0.25|
|[[:human_genes:A:ASB3|ASB3]]|-2.55|0.25|
|[[:human_genes:A:ASXL2|ASXL2]]|-2.49|0.25|
|[[:human_genes:A:ANKEF1|ANKEF1]]|-2.47|0.25|
|[[:human_genes:P:PGGT1B|PGGT1B]]|-2.46|0.25|
|[[:human_genes:Z:ZNF865|ZNF865]]|-2.29|0.27|
|[[:human_genes:G:GPNMB|GPNMB]]|-2.27|0.27|
|[[:human_genes:Z:ZNF366|ZNF366]]|-2.18|0.27|
|[[:human_genes:S:SIN3B|SIN3B]]|-2.18|0.27|
|[[:human_genes:M:MRPL15|MRPL15]]|-2.18|0.27|
|[[:human_genes:K:KDSR|KDSR]]|-2.18|0.27|
|[[:human_genes:P:PRRT3|PRRT3]]|-2.16|0.27|
|[[:human_genes:G:GNAS|GNAS]]|-2.12|0.27|
|[[:human_genes:C:CASP10|CASP10]]|-2.09|0.27|
|[[:human_genes:F:FILIP1|FILIP1]]|-2.08|0.27|
|[[:human_genes:C:CDKAL1|CDKAL1]]|-2.06|0.27|
|[[:human_genes:I:ID3|ID3]]|-2.06|0.27|
|[[:human_genes:M:MAPKAP1|MAPKAP1]]|-2.05|0.27|
|[[:human_genes:M:MEF2C|MEF2C]]|-2.05|0.33|
|[[:human_genes:O:OTOR|OTOR]]|-2.05|0.27|
|[[:human_genes:S:SUPT7L|SUPT7L]]|-2.03|0.33|
|[[:human_genes:F:FRYL|FRYL]]|-2.02|0.30|
|[[:human_genes:N:NMU|NMU]]|-2.01|0.31|
|[[:human_genes:R:RPE|RPE]]|-1.97|0.35|
|[[:human_genes:T:TCOF1|TCOF1]]|-1.97|0.35|
|[[:human_genes:C:CCDC43|CCDC43]]|-1.97|0.35|
|[[:human_genes:U:UNK|UNK]]|-1.96|0.36|
|[[:human_genes:H:HUS1|HUS1]]|-1.96|0.33|
|[[:human_genes:S:SSBP2|SSBP2]]|-1.95|0.33|
|[[:human_genes:T:TEN1|TEN1]]|-1.95|0.33|
|[[:human_genes:C:CSTF3|CSTF3]]|2.05|0.29|
|[[:human_genes:W:WAC|WAC]]|2.05|0.54|
|[[:human_genes:R:RPL27|RPL27]]|2.05|0.54|
|[[:human_genes:A:AKAP8L|AKAP8L]]|2.06|0.29|
|[[:human_genes:U:UTY|UTY]]|2.08|0.27|
|[[:human_genes:C:COL11A1|COL11A1]]|2.08|0.27|
|[[:human_genes:P:PPAN-P2RY11|PPAN-P2RY11]]|2.09|0.40|
|[[:human_genes:P:PPAN|PPAN]]|2.10|0.40|
|[[:human_genes:A:ARHGAP28|ARHGAP28]]|2.10|0.27|
|[[:human_genes:P:PCGF1|PCGF1]]|2.10|0.27|
|[[:human_genes:T:TSC2|TSC2]]|2.12|0.27|
|[[:human_genes:S:SMARCAL1|SMARCAL1]]|2.12|0.27|
|[[:human_genes:B:BCOR|BCOR]]|2.12|0.27|
|[[:human_genes:P:POLR2H|POLR2H]]|2.13|0.27|
|[[:human_genes:R:RING1|RING1]]|2.15|0.32|
|[[:human_genes:I:ISY1-RAB43|ISY1-RAB43]]|2.17|0.54|
|[[:human_genes:I:IGF2BP1|IGF2BP1]]|2.18|0.27|
|[[:human_genes:A:ATP6V0C|ATP6V0C]]|2.18|0.54|
|[[:human_genes:C:COPS7B|COPS7B]]|2.22|0.27|
|[[:human_genes:P:PES1|PES1]]|2.28|0.58|
|[[:human_genes:N:NARFL|NARFL]]|2.29|0.49|
|[[:human_genes:C:CD74|CD74]]|2.31|0.27|
|[[:human_genes:F:FCHO2|FCHO2]]|2.34|0.27|
|[[:human_genes:M:MTRNR2L4|MTRNR2L4]]|2.38|0.64|
|[[:human_genes:N:NEFM|NEFM]]|2.43|0.35|
|[[:human_genes:T:TRIM44|TRIM44]]|2.52|0.27|
|[[:human_genes:R:RPS3|RPS3]]|2.57|0.27|
|[[:human_genes:N:NBPF1|NBPF1]]|2.64|0.21|
|[[:human_genes:C:CRBN|CRBN]]|3.05|0.02|
|[[:human_genes:T:TMSB15B|TMSB15B]]|3.07|0.27|
</modal>


<modal id="modal_screen_similarity" size="lg" title="Correlated Screens">
No correlation data above threshold. (correlation > 0.05)
</modal>


<modal id="modal_go_sensitive" size="lg" title="Top 30 sensitive GO terms">No GO term hits below threshold. (FDR <0.05)</modal>
<modal id="modal_go_resistant" size="lg" title="Top 30 resistant GO terms">No GO term hits below threshold. (FDR <0.05)</modal>