====== Thalidomide 20μM R07 exp406 ======
==== Mechanism of Action ====
IMiD that targets neo-substrates IKZF1/3 for ubiquitination by CUL4A-DDB1-cereblon complex
  * **<color #00a2e8>Class / Subclass 1:</color>** Proteostasis / Bivalent Ligand




==== Technical Notes ====
<accordion collapsed='true'>
<panel title='Protein References' collapsed='true'>
    * **<color #00a2e8>PubChem Name:</color>** %%Thalidomide%%
    * **<color #00a2e8>Synonyms:</color>** N/A
    * **<color #00a2e8>CAS #:</color>** 50-35-1
    * **<color #00a2e8>PubChem CID:</color>** [[https://pubchem.ncbi.nlm.nih.gov/compound/5426|5426]]
    * **<color #00a2e8>IUPAC:</color>** %%2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione%%
    * **<color #00a2e8>INCHI Name:</color>** InChI=1S/C13H10N2O4/c16-10-6-5-9(11(17)14-10)15-12(18)7-3-1-2-4-8(7)13(15)19/h1-4,9H,5-6H2,(H,14,16,17)
    * **<color #00a2e8>INCHI Key:</color>** UEJJHQNACJXSKW-UHFFFAOYSA-N
    * **<color #00a2e8>Molecular Weight:</color>** 258.23
    * **<color #00a2e8>Canonical SMILES:</color>** C1CC(=O)NC(=O)C1N2C(=O)C3=CC=CC=C3C2=O
    * **<color #00a2e8>Isomeric SMILES:</color>** N/A
    * **<color #00a2e8>Molecular Formula:</color>** C13H10N2O4
{{:chemogenomics:structures:chem-0244.svg?nolink}}
</panel>


<panel title='Protein Supplier' collapsed='true'>
    * **<color #00a2e8>Supplier Name:</color>** Cayman Chemical
    * **<color #00a2e8>Catalog #:</color>** 14610
    * **<color #00a2e8>Lot #:</color>** 0485409-6
</panel>


<panel title='Protein Characterization' collapsed='true'>
    * **<color #00a2e8>LCMS:</color>** Tr 1.04 min, m/z 259+ [M+H]+
</panel>


<panel title='Dose Response Curve' collapsed='true'>
    * **<color #00a2e8>Platform ID:</color>** rac-Thalidomide
    * **<color #00a2e8>Min:</color>** -5.7941; **<color #00a2e8>Max:</color>** 9.9969
{{:chemogenomics:dose_response:dr_444.png?nolink&500 |}}
\\ 
\\ 
\\ 
\\ 
|< 300px 100px 200px >|
^ IC   ^ Concentration (µM) ^
| IC10  |N/A    |
| IC20  |N/A    |
| IC30  |N/A    |
| IC40  |N/A    |
| IC50  |N/A    |
| IC60  |N/A    |
| IC70  |N/A    |
| IC80  |N/A    |
| IC90  |N/A    |
\\ 
</panel>
</accordion>
==== Screen Summary ====
    * **<color #00a2e8>Round</color>**: 07
    * **<color #00a2e8>Dose</color>**: 20µM
    * **<color #00a2e8>Days of incubation</color>**: 8
    * **<color #00a2e8>Doublings</color>**: 6.9
    * **<color #00a2e8>Numbers of reads</color>**: 23258473


==== Screen Results ====


^Sensitive/Resistant hits (FDR<0.05)^CRANKS^Score Plot^Top 30 Genes^Screen Similarity^Top 30 Sensitive GO terms^Top 30 Resistant GO terms^
|0/0|<color #e85500>[[https://files.tyerslab.com/files/public/chemogenomics/cranks/Thalidomide_20uM_Round-7_exp406.txt|Scores]]</color>|<button type="primary" size="sm" modal="ScorePlot">View</button>|<button type="primary" size="sm" modal="modal_hits">View</button>|<button type="default" size="sm" modal="modal_screen_similarity">View</button>|<button type="default" size="sm" modal="modal_go_sensitive">View</button>|<button type="default" size="sm" modal="modal_go_resistant">View</button>|
<modal id='ScorePlot' size='lg' title='Thalidomide 20μM R07 exp406'>
{{:chemogenomics:cranks_plots:exp406.png?nolink}}
</modal>


<modal id="modal_hits" size="sm" title="Top 30 S/R Genes">
^Gene^CRANKS Score^FDR^
|[[:human_genes:V:VEZT|VEZT]]|-2.50|0.35|
|[[:human_genes:G:GPR137C|GPR137C]]|-2.34|0.53|
|[[:human_genes:Z:ZNHIT1|ZNHIT1]]|-2.27|0.43|
|[[:human_genes:M:MDN1|MDN1]]|-2.27|0.70|
|[[:human_genes:Z:ZKSCAN7|ZKSCAN7]]|-2.22|0.43|
|[[:human_genes:S:SESTD1|SESTD1]]|-2.21|0.43|
|[[:human_genes:D:DUOXA2|DUOXA2]]|-2.17|0.43|
|[[:human_genes:R:RPS6KA6|RPS6KA6]]|-2.14|0.43|
|[[:human_genes:C:C7orf55-LUC7L2|C7orf55-LUC7L2]]|-2.12|0.43|
|[[:human_genes:T:TXNL4B|TXNL4B]]|-2.12|0.43|
|[[:human_genes:N:NPRL3|NPRL3]]|-2.10|0.58|
|[[:human_genes:A:AGPAT1|AGPAT1]]|-2.06|0.59|
|[[:human_genes:S:SOGA3|SOGA3]]|-2.03|0.60|
|[[:human_genes:F:FZR1|FZR1]]|-2.03|0.58|
|[[:human_genes:W:WARS|WARS]]|-2.02|0.58|
|[[:human_genes:P:PLA2G1B|PLA2G1B]]|-1.99|0.58|
|[[:human_genes:P:PDAP1|PDAP1]]|-1.98|0.58|
|[[:human_genes:C:C5orf51|C5orf51]]|-1.98|0.58|
|[[:human_genes:F:FAM172A|FAM172A]]|-1.96|0.58|
|[[:human_genes:S:SPEF2|SPEF2]]|-1.95|0.58|
|[[:human_genes:Y:YAP1|YAP1]]|-1.95|0.58|
|[[:human_genes:C:CDH1|CDH1]]|-1.93|0.58|
|[[:human_genes:S:SDC2|SDC2]]|-1.92|0.58|
|[[:human_genes:S:SNF8|SNF8]]|-1.91|0.60|
|[[:human_genes:D:DHPS|DHPS]]|-1.91|0.73|
|[[:human_genes:O:OR6T1|OR6T1]]|-1.90|0.58|
|[[:human_genes:S:SRP68|SRP68]]|-1.90|0.58|
|[[:human_genes:P:PGAP1|PGAP1]]|-1.89|0.58|
|[[:human_genes:P:PAM16|PAM16]]|-1.88|0.60|
|[[:human_genes:A:ABHD6|ABHD6]]|-1.87|0.58|
|[[:human_genes:M:METTL8|METTL8]]|1.87|0.76|
|[[:human_genes:S:SMC1A|SMC1A]]|1.88|0.77|
|[[:human_genes:C:CRYBB3|CRYBB3]]|1.88|0.69|
|[[:human_genes:G:G0S2|G0S2]]|1.90|0.69|
|[[:human_genes:M:MTRNR2L4|MTRNR2L4]]|1.90|0.84|
|[[:human_genes:E:EBNA1BP2|EBNA1BP2]]|1.92|0.69|
|[[:human_genes:P:PDZD7|PDZD7]]|1.93|0.69|
|[[:human_genes:B:BANP|BANP]]|1.94|0.69|
|[[:human_genes:D:DONSON|DONSON]]|1.94|0.76|
|[[:human_genes:P:PAF1|PAF1]]|1.96|0.69|
|[[:human_genes:S:SF3B2|SF3B2]]|1.99|0.76|
|[[:human_genes:I:INO80D|INO80D]]|2.05|0.69|
|[[:human_genes:S:SKIV2L2|SKIV2L2]]|2.05|0.84|
|[[:human_genes:N:NXPE1|NXPE1]]|2.06|0.69|
|[[:human_genes:T:TRAPPC6B|TRAPPC6B]]|2.07|0.69|
|[[:human_genes:P:PRICKLE4|PRICKLE4]]|2.07|0.69|
|[[:human_genes:N:NUP205|NUP205]]|2.08|0.69|
|[[:human_genes:M:MAPK11|MAPK11]]|2.11|0.69|
|[[:human_genes:L:LOC100505679|LOC100505679]]|2.14|0.84|
|[[:human_genes:C:CD74|CD74]]|2.18|0.42|
|[[:human_genes:P:PAPSS1|PAPSS1]]|2.19|0.42|
|[[:human_genes:K:KIAA0907|KIAA0907]]|2.19|0.42|
|[[:human_genes:A:A1BG|A1BG]]|2.20|0.42|
|[[:human_genes:P:PPAN-P2RY11|PPAN-P2RY11]]|2.23|0.69|
|[[:human_genes:P:PPAN|PPAN]]|2.24|0.69|
|[[:human_genes:S:SF3A3|SF3A3]]|2.25|0.76|
|[[:human_genes:F:FANCM|FANCM]]|2.37|0.42|
|[[:human_genes:G:GJA10|GJA10]]|2.51|0.42|
|[[:human_genes:S:SPC25|SPC25]]|2.51|0.69|
|[[:human_genes:R:RPSA|RPSA]]|2.69|0.69|
</modal>


<modal id="modal_screen_similarity" size="lg" title="Correlated Screens">
No correlation data above threshold. (correlation > 0.05)
</modal>


<modal id="modal_go_sensitive" size="lg" title="Top 30 sensitive GO terms">No GO term hits below threshold. (FDR <0.05)</modal>
<modal id="modal_go_resistant" size="lg" title="Top 30 resistant GO terms">No GO term hits below threshold. (FDR <0.05)</modal>