====== Trichostatin-A 0.06μM R07 exp415 ======
==== Mechanism of Action ====
Inhibits class I and II HDAC enzymes
* **Class / Subclass 1:** Gene Regulation / Epigenetic Inhibitor
* **Class / Subclass 2:** Infectious Disease / Antifungal
==== Technical Notes ====
* **PubChem Name:** %%Trichostatin A%%
* **Synonyms:** TSA
* **CAS #:** 58880-19-6
* **PubChem CID:** [[https://pubchem.ncbi.nlm.nih.gov/compound/444732|444732]]
* **IUPAC:** %%(2E,4E,6R)-7-[4-(dimethylamino)phenyl]-N-hydroxy-4,6-dimethyl-7-oxohepta-2,4-dienamide%%
* **INCHI Name:** InChI=1S/C17H22N2O3/c1-12(5-10-16(20)18-22)11-13(2)17(21)14-6-8-15(9-7-14)19(3)4/h5-11,13,22H,1-4H3,(H,18,20)/b10-5+,12-11+/t13-/m1/s1
* **INCHI Key:** RTKIYFITIVXBLE-QEQCGCAPSA-N
* **Molecular Weight:** 302.37
* **Canonical SMILES:** CC(C=C(C)C=CC(=O)NO)C(=O)C1=CC=C(C=C1)N(C)C
* **Isomeric SMILES:** C[C@H](/C=C(\\C)/C=C/C(=O)NO)C(=O)C1=CC=C(C=C1)N(C)C
* **Molecular Formula:** C17H22N2O3
{{:chemogenomics:structures:chem-0248.svg?nolink}}
* **Supplier Name:** Toronto Research Chemicals
* **Catalog #:** T774710
* **Lot #:** 1-JLM-53-1
* **HRMS (ESI-TOF) m/z:** (M+H)+ Calcd for C17H22N2O3 303.17032; found 303.1712
* **Platform ID:** Trichostatin_A
* **Min:** -6.6261; **Max:** 99.5126
{{:chemogenomics:dose_response:dr_409.png?nolink&500 |}}
\\
\\
\\
\\
|< 300px 100px 200px >|
^ IC ^ Concentration (µM) ^
| IC10 |N/A |
| IC20 |0.0475 |
| IC30 |0.0559 |
| IC40 |0.0645 |
| IC50 |0.0740 |
| IC60 |N/A |
| IC70 |N/A |
| IC80 |N/A |
| IC90 |N/A |
\\
==== Screen Summary ====
* **Round**: 07
* **Dose**: 60nM
* **Days of incubation**: 8
* **Doublings**: 4.6
* **Numbers of reads**: 18763387
==== Screen Results ====
^Sensitive/Resistant hits (FDR<0.05)^CRANKS^Score Plot^Top 30 Genes^Screen Similarity^Top 30 Sensitive GO terms^Top 30 Resistant GO terms^
|3/0|[[https://files.tyerslab.com/files/public/chemogenomics/cranks/Trichostatin_A_0.06uM_Round-7_exp415.txt|Scores]]||||||
{{:chemogenomics:cranks_plots:exp415.png?nolink}}
^Gene^CRANKS Score^FDR^
|[[:human_genes:B:BCL2|BCL2]]|-4.92|<0.01|
|[[:human_genes:T:TCF4|TCF4]]|-3.56|<0.01|
|[[:human_genes:G:GNAS|GNAS]]|-2.69|0.04|
|[[:human_genes:I:INTS12|INTS12]]|-2.54|0.07|
|[[:human_genes:P:PRKACA|PRKACA]]|-2.38|0.16|
|[[:human_genes:U:UHRF1|UHRF1]]|-2.36|0.23|
|[[:human_genes:M:MBD2|MBD2]]|-2.32|0.17|
|[[:human_genes:A:ANAPC2|ANAPC2]]|-2.31|0.17|
|[[:human_genes:G:GPRC5A|GPRC5A]]|-2.25|0.32|
|[[:human_genes:S:SKA3|SKA3]]|-2.21|0.33|
|[[:human_genes:S:STT3A|STT3A]]|-2.21|0.52|
|[[:human_genes:K:KIF4A|KIF4A]]|-2.20|0.23|
|[[:human_genes:C:CHD1|CHD1]]|-2.19|0.23|
|[[:human_genes:S:SNF8|SNF8]]|-2.18|0.34|
|[[:human_genes:D:DNAI2|DNAI2]]|-2.09|0.33|
|[[:human_genes:F:FBXW11|FBXW11]]|-2.08|0.42|
|[[:human_genes:D:DOT1L|DOT1L]]|-2.06|0.42|
|[[:human_genes:R:RLIM|RLIM]]|-2.06|0.34|
|[[:human_genes:P:PPP2CA|PPP2CA]]|-2.02|0.47|
|[[:human_genes:C:C4orf3|C4orf3]]|-2.00|0.42|
|[[:human_genes:M:MSI2|MSI2]]|-1.99|0.49|
|[[:human_genes:U:URI1|URI1]]|-1.99|0.42|
|[[:human_genes:G:GMPPB|GMPPB]]|-1.98|0.62|
|[[:human_genes:D:DYNLT1|DYNLT1]]|-1.97|0.42|
|[[:human_genes:C:CPSF3L|CPSF3L]]|-1.96|0.52|
|[[:human_genes:P:POLK|POLK]]|-1.95|0.42|
|[[:human_genes:S:SEPHS1|SEPHS1]]|-1.95|0.42|
|[[:human_genes:L:LMO7|LMO7]]|-1.95|0.52|
|[[:human_genes:A:ADSL|ADSL]]|-1.94|0.57|
|[[:human_genes:Z:ZNF718|ZNF718]]|-1.94|0.63|
|[[:human_genes:C:COMMD4|COMMD4]]|1.91|0.45|
|[[:human_genes:U:USHBP1|USHBP1]]|1.92|0.55|
|[[:human_genes:D:DGKD|DGKD]]|1.95|0.40|
|[[:human_genes:R:REXO1|REXO1]]|1.95|0.40|
|[[:human_genes:I:INHA|INHA]]|1.96|0.40|
|[[:human_genes:T:THOP1|THOP1]]|1.96|0.40|
|[[:human_genes:P:PRPS1L1|PRPS1L1]]|1.97|0.40|
|[[:human_genes:R:RASAL3|RASAL3]]|1.98|0.50|
|[[:human_genes:S:SRM|SRM]]|2.02|0.36|
|[[:human_genes:G:GALR3|GALR3]]|2.03|0.36|
|[[:human_genes:H:HAT1|HAT1]]|2.03|0.36|
|[[:human_genes:Z:ZDHHC3|ZDHHC3]]|2.05|0.36|
|[[:human_genes:S:SLC39A3|SLC39A3]]|2.06|0.36|
|[[:human_genes:B:BRD1|BRD1]]|2.07|0.36|
|[[:human_genes:V:VPS13C|VPS13C]]|2.07|0.36|
|[[:human_genes:F:FAM200B|FAM200B]]|2.08|0.36|
|[[:human_genes:V:VDAC2|VDAC2]]|2.08|0.36|
|[[:human_genes:B:BCAS2|BCAS2]]|2.10|0.40|
|[[:human_genes:L:LARP4|LARP4]]|2.11|0.36|
|[[:human_genes:U:UTY|UTY]]|2.13|0.36|
|[[:human_genes:S:SART1|SART1]]|2.13|0.73|
|[[:human_genes:T:TIE1|TIE1]]|2.17|0.36|
|[[:human_genes:G:GOT2|GOT2]]|2.22|0.35|
|[[:human_genes:M:MRPL33|MRPL33]]|2.23|0.64|
|[[:human_genes:M:MICAL3|MICAL3]]|2.24|0.35|
|[[:human_genes:Z:ZNF521|ZNF521]]|2.28|0.35|
|[[:human_genes:B:BAK1|BAK1]]|2.31|0.35|
|[[:human_genes:B:BIK|BIK]]|2.31|0.35|
|[[:human_genes:R:RPSA|RPSA]]|2.33|0.67|
|[[:human_genes:B:BHLHB9|BHLHB9]]|2.55|0.35|
^Screen^Correlation^Plot^
|[[:results:exp393|Resminostat 0.5μM R07 exp393]]|0.055||
{{:chemogenomics:comparison_plots:exp393_vs_exp415.png?nolink |}}
No GO term hits below threshold. (FDR <0.05)
No GO term hits below threshold. (FDR <0.05)