====== Calcipotriol 5μM R08 exp464 ======
==== Mechanism of Action ====
Synthetic vitamin D3 analog, binds vitamin D nuclear hormone receptor
* **Class / Subclass 1:** Metabolism / Vitamin
* **Class / Subclass 2:** Signal Transduction / Nuclear Receptor Ligand
==== Technical Notes ====
* **PubChem Name:** %%Calcipotriol%%
* **Synonyms:** MC 903; Calcipotriene
* **CAS #:** 112965-21-6
* **PubChem CID:** [[https://pubchem.ncbi.nlm.nih.gov/compound/5288783|5288783]]
* **IUPAC:** %%(1R,3S,5Z)-5-[(2E)-2-[(1R,3aS,7aR)-1-[(E,2R,5S)-5-cyclopropyl-5-hydroxypent-3-en-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexane-1,3-diol%%
* **INCHI Name:** InChI=1S/C27H40O3/c1-17(6-13-25(29)20-8-9-20)23-11-12-24-19(5-4-14-27(23,24)3)7-10-21-15-22(28)16-26(30)18(21)2/h6-7,10,13,17,20,22-26,28-30H,2,4-5,8-9,11-12,14-16H2,1,3H3/b13-6+,19-7+,21-10-/t17-,22-,23-,24+,25-,26+,27-/m1/s1
* **INCHI Key:** LWQQLNNNIPYSNX-UROSTWAQSA-N
* **Molecular Weight:** 412.6
* **Canonical SMILES:** CC(C=CC(C1CC1)O)C2CCC3C2(CCCC3=CC=C4CC(CC(C4=C)O)O)C
* **Isomeric SMILES:** C[C@H](/C=C/[C@H](C1CC1)O)[C@H]2CC[C@@H]\\3[C@@]2(CCC/C3=C\\C=C/4\\C[C@H](C[C@@H](C4=C)O)O)C
* **Molecular Formula:** C27H40O3
{{:chemogenomics:structures:chem-0274.svg?nolink}}
* **Supplier Name:** Med Chem Express
* **Catalog #:** HY-10001
* **Lot #:** 18957
* **HRMS (ESI-TOF) m/z:** (M+Na)+ Calcd for C27H40O3 435.28697; found 435.28817
* **Platform ID:** Calcipotriol
* **Min:** -20.7096; **Max:** 79.7081
{{:chemogenomics:dose_response:dr_510.png?nolink&500 |}}
\\
\\
\\
\\
|< 300px 100px 200px >|
^ IC ^ Concentration (µM) ^
| IC10 |37.6200 |
| IC20 |40.2200 |
| IC30 |42.0400 |
| IC40 |43.5900 |
| IC50 |45.0700 |
| IC60 |46.6000 |
| IC70 |48.3200 |
| IC80 |50.5100 |
| IC90 |53.9900 |
\\
==== Screen Summary ====
* **Round**: 08
* **Dose**: 5µM
* **Days of incubation**: 8
* **Doublings**: 6.3
* **Numbers of reads**: 14154949
==== Screen Results ====
^Sensitive/Resistant hits (FDR<0.05)^CRANKS^Score Plot^Top 30 Genes^Screen Similarity^Top 30 Sensitive GO terms^Top 30 Resistant GO terms^
|0/0|[[https://files.tyerslab.com/files/public/chemogenomics/cranks/Calcipotriol_5uM_Round-8_exp464.txt|Scores]]||||||
{{:chemogenomics:cranks_plots:exp464.png?nolink}}
^Gene^CRANKS Score^FDR^
|[[:human_genes:U:UHRF1|UHRF1]]|-2.39|0.47|
|[[:human_genes:R:RNASEH2B|RNASEH2B]]|-2.37|0.47|
|[[:human_genes:D:DEPDC5|DEPDC5]]|-2.26|0.47|
|[[:human_genes:L:LIG4|LIG4]]|-2.16|0.47|
|[[:human_genes:S:SPATA16|SPATA16]]|-2.11|0.47|
|[[:human_genes:R:REST|REST]]|-2.09|0.47|
|[[:human_genes:D:DNMBP|DNMBP]]|-2.09|0.47|
|[[:human_genes:L:LEUTX|LEUTX]]|-2.09|0.62|
|[[:human_genes:R:RLBP1|RLBP1]]|-2.09|0.47|
|[[:human_genes:C:CEPT1|CEPT1]]|-2.09|0.47|
|[[:human_genes:S:SRP68|SRP68]]|-2.07|0.47|
|[[:human_genes:X:XRCC2|XRCC2]]|-2.04|0.47|
|[[:human_genes:S:SYNC|SYNC]]|-2.04|0.47|
|[[:human_genes:P:POM121|POM121]]|-2.04|0.47|
|[[:human_genes:A:ASB3|ASB3]]|-2.03|0.47|
|[[:human_genes:U:USP48|USP48]]|-2.02|0.47|
|[[:human_genes:D:DERL1|DERL1]]|-2.01|0.47|
|[[:human_genes:S:SNX18|SNX18]]|-2.01|0.47|
|[[:human_genes:I:ITPA|ITPA]]|-1.99|0.47|
|[[:human_genes:D:DCTN6|DCTN6]]|-1.97|0.62|
|[[:human_genes:M:MPI|MPI]]|-1.97|0.47|
|[[:human_genes:M:MCM9|MCM9]]|-1.97|0.47|
|[[:human_genes:A:ATL1|ATL1]]|-1.96|0.47|
|[[:human_genes:P:PCNXL3|PCNXL3]]|-1.95|0.47|
|[[:human_genes:M:MYPN|MYPN]]|-1.93|0.47|
|[[:human_genes:I:INO80C|INO80C]]|-1.92|0.47|
|[[:human_genes:A:ANKRD36B|ANKRD36B]]|-1.91|0.47|
|[[:human_genes:R:RNASEH2A|RNASEH2A]]|-1.90|0.62|
|[[:human_genes:K:KCNJ14|KCNJ14]]|-1.89|0.47|
|[[:human_genes:U:UBE2N|UBE2N]]|-1.88|0.47|
|[[:human_genes:N:NUP214|NUP214]]|1.86|0.77|
|[[:human_genes:H:HADH|HADH]]|1.87|0.61|
|[[:human_genes:D:DUSP21|DUSP21]]|1.87|0.61|
|[[:human_genes:T:TP53I13|TP53I13]]|1.89|0.63|
|[[:human_genes:A:AASDH|AASDH]]|1.89|0.61|
|[[:human_genes:P:PLEKHG7|PLEKHG7]]|1.90|0.61|
|[[:human_genes:C:CAPRIN2|CAPRIN2]]|1.90|0.61|
|[[:human_genes:A:ARMS2|ARMS2]]|1.90|0.61|
|[[:human_genes:T:TMEM136|TMEM136]]|1.92|0.61|
|[[:human_genes:N:NOL9|NOL9]]|1.96|0.64|
|[[:human_genes:P:PPP1R13L|PPP1R13L]]|1.96|0.61|
|[[:human_genes:E:EMC8|EMC8]]|1.97|0.61|
|[[:human_genes:N:NIPAL2|NIPAL2]]|1.97|0.61|
|[[:human_genes:H:HIST1H2BF|HIST1H2BF]]|1.98|0.63|
|[[:human_genes:D:DAAM1|DAAM1]]|2.00|0.61|
|[[:human_genes:T:TMSB15B|TMSB15B]]|2.01|0.77|
|[[:human_genes:S:SEC23IP|SEC23IP]]|2.07|0.61|
|[[:human_genes:C:CEP192|CEP192]]|2.15|0.61|
|[[:human_genes:U:USF2|USF2]]|2.17|0.34|
|[[:human_genes:R:RANGAP1|RANGAP1]]|2.18|0.61|
|[[:human_genes:S:SF3B5|SF3B5]]|2.19|0.61|
|[[:human_genes:U:UTP20|UTP20]]|2.28|0.61|
|[[:human_genes:S:SPNS3|SPNS3]]|2.28|0.24|
|[[:human_genes:H:HRH2|HRH2]]|2.30|0.24|
|[[:human_genes:D:DDX41|DDX41]]|2.37|0.27|
|[[:human_genes:C:CCDC135|CCDC135]]|2.39|0.19|
|[[:human_genes:P:PMM1|PMM1]]|2.49|0.19|
|[[:human_genes:D:DNTTIP2|DNTTIP2]]|2.57|0.19|
|[[:human_genes:P:PAFAH1B1|PAFAH1B1]]|2.58|0.63|
|[[:human_genes:A:ANO5|ANO5]]|2.76|0.08|
No correlation data above threshold. (correlation > 0.05)
No GO term hits below threshold. (FDR <0.05)
No GO term hits below threshold. (FDR <0.05)