====== Ethambutol 25μM R08 exp481 ======
==== Mechanism of Action ====
Inhibits arabinosyl transferase, interferes with cell wall formation
  * **<color #00a2e8>Class / Subclass 1:</color>** Infectious Disease / Antibiotic




==== Technical Notes ====
<accordion collapsed='true'>
<panel title='Protein References' collapsed='true'>
    * **<color #00a2e8>PubChem Name:</color>** %%Ethambutol Hydrochloride%%
    * **<color #00a2e8>Synonyms:</color>** Emb dihydrochloride
    * **<color #00a2e8>CAS #:</color>** 1070-11-7
    * **<color #00a2e8>PubChem CID:</color>** [[https://pubchem.ncbi.nlm.nih.gov/compound/14051|14051]]
    * **<color #00a2e8>IUPAC:</color>** %%(2S)-2-[2-[[(2S)-1-hydroxybutan-2-yl]amino]ethylamino]butan-1-ol;dihydrochloride%%
    * **<color #00a2e8>INCHI Name:</color>** InChI=1S/C10H24N2O2.2ClH/c1-3-9(7-13)11-5-6-12-10(4-2)8-14;;/h9-14H,3-8H2,1-2H3;2*1H/t9-,10-;;/m0../s1
    * **<color #00a2e8>INCHI Key:</color>** AUAHHJJRFHRVPV-BZDVOYDHSA-N
    * **<color #00a2e8>Molecular Weight:</color>** 277.23
    * **<color #00a2e8>Canonical SMILES:</color>** CCC(CO)NCCNC(CC)CO.Cl.Cl
    * **<color #00a2e8>Isomeric SMILES:</color>** CC[C@@H](CO)NCCN[C@@H](CC)CO.Cl.Cl
    * **<color #00a2e8>Molecular Formula:</color>** C10H26Cl2N2O2
{{:chemogenomics:structures:chem-0290.svg?nolink}}
</panel>


<panel title='Protein Supplier' collapsed='true'>
    * **<color #00a2e8>Supplier Name:</color>** Med Chem Express
    * **<color #00a2e8>Catalog #:</color>** HY-B0535A
    * **<color #00a2e8>Lot #:</color>** 13585
</panel>


<panel title='Protein Characterization' collapsed='true'>
    * **<color #00a2e8>HRMS (ESI-TOF) m/z:</color>** (M+H)+ Calcd for C10H24N2O2 205.19105; found 205.19059
</panel>


<panel title='Dose Response Curve' collapsed='true'>
    * **<color #00a2e8>Platform ID:</color>** Ethambutol
    * **<color #00a2e8>Min:</color>** -10.7445; **<color #00a2e8>Max:</color>** 28.8248
{{:chemogenomics:dose_response:dr_534.png?nolink&500 |}}
\\ 
\\ 
\\ 
\\ 
|< 300px 100px 200px >|
^ IC   ^ Concentration (µM) ^
| IC10  |N/A    |
| IC20  |N/A    |
| IC30  |N/A    |
| IC40  |N/A    |
| IC50  |N/A    |
| IC60  |N/A    |
| IC70  |N/A    |
| IC80  |N/A    |
| IC90  |N/A    |
\\ 
</panel>
</accordion>
==== Screen Summary ====
    * **<color #00a2e8>Round</color>**: 08
    * **<color #00a2e8>Dose</color>**: 25µM
    * **<color #00a2e8>Days of incubation</color>**: 8
    * **<color #00a2e8>Doublings</color>**: 7.2
    * **<color #00a2e8>Numbers of reads</color>**: 17949001


==== Screen Results ====


^Sensitive/Resistant hits (FDR<0.05)^CRANKS^Score Plot^Top 30 Genes^Screen Similarity^Top 30 Sensitive GO terms^Top 30 Resistant GO terms^
|0/0|<color #e85500>[[https://files.tyerslab.com/files/public/chemogenomics/cranks/Ethambutol_25uM_Round-8_exp481.txt|Scores]]</color>|<button type="primary" size="sm" modal="ScorePlot">View</button>|<button type="primary" size="sm" modal="modal_hits">View</button>|<button type="default" size="sm" modal="modal_screen_similarity">View</button>|<button type="default" size="sm" modal="modal_go_sensitive">View</button>|<button type="default" size="sm" modal="modal_go_resistant">View</button>|
<modal id='ScorePlot' size='lg' title='Ethambutol 25μM R08 exp481'>
{{:chemogenomics:cranks_plots:exp481.png?nolink}}
</modal>


<modal id="modal_hits" size="sm" title="Top 30 S/R Genes">
^Gene^CRANKS Score^FDR^
|[[:human_genes:P:PTAR1|PTAR1]]|-2.93|0.08|
|[[:human_genes:C:CXorf56|CXorf56]]|-2.47|0.19|
|[[:human_genes:L:LRP5|LRP5]]|-2.45|0.16|
|[[:human_genes:T:TRMT12|TRMT12]]|-2.45|0.16|
|[[:human_genes:C:CD72|CD72]]|-2.33|0.19|
|[[:human_genes:V:VEZT|VEZT]]|-2.31|0.19|
|[[:human_genes:U:UBA3|UBA3]]|-2.17|0.68|
|[[:human_genes:S:SLC13A4|SLC13A4]]|-2.13|0.66|
|[[:human_genes:P:PPP2CA|PPP2CA]]|-2.11|0.66|
|[[:human_genes:I:INADL|INADL]]|-2.10|0.56|
|[[:human_genes:I:IFNGR2|IFNGR2]]|-2.04|0.66|
|[[:human_genes:D:DIS3L|DIS3L]]|-2.02|0.68|
|[[:human_genes:M:MPND|MPND]]|-2.01|0.66|
|[[:human_genes:P:PARL|PARL]]|-2.00|0.68|
|[[:human_genes:H:HCFC1|HCFC1]]|-1.94|0.89|
|[[:human_genes:C:COLGALT2|COLGALT2]]|-1.92|0.68|
|[[:human_genes:A:ACTR10|ACTR10]]|-1.92|0.70|
|[[:human_genes:M:MRPS11|MRPS11]]|-1.92|0.68|
|[[:human_genes:N:NUDT18|NUDT18]]|-1.92|0.90|
|[[:human_genes:S:SLC5A3|SLC5A3]]|-1.90|0.68|
|[[:human_genes:C:C6orf141|C6orf141]]|-1.88|0.68|
|[[:human_genes:T:TNPO3|TNPO3]]|-1.87|0.90|
|[[:human_genes:D:DPAGT1|DPAGT1]]|-1.87|0.76|
|[[:human_genes:P:PNRC2|PNRC2]]|-1.87|0.68|
|[[:human_genes:L:LHFPL1|LHFPL1]]|-1.86|0.68|
|[[:human_genes:A:ADRA1B|ADRA1B]]|-1.86|0.68|
|[[:human_genes:D:DPH5|DPH5]]|-1.85|0.68|
|[[:human_genes:H:HMGA1|HMGA1]]|-1.85|0.68|
|[[:human_genes:B:BUB3|BUB3]]|-1.85|0.90|
|[[:human_genes:S:SSB|SSB]]|-1.84|0.68|
|[[:human_genes:K:KLRF1|KLRF1]]|1.87|0.75|
|[[:human_genes:A:ARL2BP|ARL2BP]]|1.88|0.75|
|[[:human_genes:E:ENTHD1|ENTHD1]]|1.88|0.75|
|[[:human_genes:Z:ZDHHC15|ZDHHC15]]|1.91|0.75|
|[[:human_genes:L:LBX2|LBX2]]|1.91|0.75|
|[[:human_genes:D:DCTPP1|DCTPP1]]|1.92|0.75|
|[[:human_genes:R:RASGRP2|RASGRP2]]|1.93|0.75|
|[[:human_genes:Z:ZBED4|ZBED4]]|1.93|0.75|
|[[:human_genes:M:MYCBP2|MYCBP2]]|1.93|0.75|
|[[:human_genes:L:LAPTM4A|LAPTM4A]]|1.94|0.75|
|[[:human_genes:Z:ZNF829|ZNF829]]|1.95|0.75|
|[[:human_genes:S:SYVN1|SYVN1]]|1.95|0.78|
|[[:human_genes:K:KRTAP9-2|KRTAP9-2]]|1.96|0.75|
|[[:human_genes:D:DDX27|DDX27]]|1.98|0.75|
|[[:human_genes:C:CALD1|CALD1]]|1.99|0.75|
|[[:human_genes:S:SAA4|SAA4]]|1.99|0.75|
|[[:human_genes:S:SYNE2|SYNE2]]|2.00|0.75|
|[[:human_genes:U:UBP1|UBP1]]|2.00|0.75|
|[[:human_genes:C:CFHR2|CFHR2]]|2.05|0.75|
|[[:human_genes:X:XPO1|XPO1]]|2.06|0.79|
|[[:human_genes:A:ADRB2|ADRB2]]|2.07|0.75|
|[[:human_genes:N:NKX6-1|NKX6-1]]|2.08|0.75|
|[[:human_genes:K:KCND3|KCND3]]|2.15|0.75|
|[[:human_genes:C:CXXC5|CXXC5]]|2.16|0.72|
|[[:human_genes:P:PSMD14|PSMD14]]|2.21|0.78|
|[[:human_genes:P:POLR2J|POLR2J]]|2.31|0.77|
|[[:human_genes:H:HIC2|HIC2]]|2.33|0.36|
|[[:human_genes:R:RANGAP1|RANGAP1]]|2.36|0.75|
|[[:human_genes:M:MFRP|MFRP]]|2.44|0.28|
|[[:human_genes:R:RSBN1|RSBN1]]|2.49|0.28|
</modal>


<modal id="modal_screen_similarity" size="lg" title="Correlated Screens">
No correlation data above threshold. (correlation > 0.05)
</modal>


<modal id="modal_go_sensitive" size="lg" title="Top 30 sensitive GO terms">No GO term hits below threshold. (FDR <0.05)</modal>
<modal id="modal_go_resistant" size="lg" title="Top 30 resistant GO terms">No GO term hits below threshold. (FDR <0.05)</modal>