====== Pyrazinamide 100μM R08 exp516 ======
==== Mechanism of Action ====
Inhibits growth of Mycobacterium tuberculosis in combination with isoniazid, ethambutanol and rifampicin, converted to active pyrazinamide by pyrazinamidase
  * **<color #00a2e8>Class / Subclass 1:</color>** Infectious Disease / Antibiotic




==== Technical Notes ====
<accordion collapsed='true'>
<panel title='Protein References' collapsed='true'>
    * **<color #00a2e8>PubChem Name:</color>** %%Pyrazinamide%%
    * **<color #00a2e8>Synonyms:</color>** Pyrazinecarboxamide; Pyrazinoic acid amide
    * **<color #00a2e8>CAS #:</color>** 98-96-4
    * **<color #00a2e8>PubChem CID:</color>** [[https://pubchem.ncbi.nlm.nih.gov/compound/1046|1046]]
    * **<color #00a2e8>IUPAC:</color>** %%pyrazine-2-carboxamide%%
    * **<color #00a2e8>INCHI Name:</color>** InChI=1S/C5H5N3O/c6-5(9)4-3-7-1-2-8-4/h1-3H,(H2,6,9)
    * **<color #00a2e8>INCHI Key:</color>** IPEHBUMCGVEMRF-UHFFFAOYSA-N
    * **<color #00a2e8>Molecular Weight:</color>** 123.11
    * **<color #00a2e8>Canonical SMILES:</color>** C1=CN=C(C=N1)C(=O)N
    * **<color #00a2e8>Isomeric SMILES:</color>** N/A
    * **<color #00a2e8>Molecular Formula:</color>** C5H5N3O
{{:chemogenomics:structures:chem-0321.svg?nolink}}
</panel>


<panel title='Protein Supplier' collapsed='true'>
    * **<color #00a2e8>Supplier Name:</color>** Combi-Blocks
    * **<color #00a2e8>Catalog #:</color>** OR-0062
    * **<color #00a2e8>Lot #:</color>** B76356
</panel>


<panel title='Protein Characterization' collapsed='true'>
    * **<color #00a2e8>LCMS:</color>** Tr 0.23 min, m/z invisible, Lambda max 208, 270 nm
</panel>


<panel title='Dose Response Curve' collapsed='true'>
    * **<color #00a2e8>Platform ID:</color>** Pyrazinamide
    * **<color #00a2e8>Min:</color>** -11.1628; **<color #00a2e8>Max:</color>** 33.7224
{{:chemogenomics:dose_response:dr_570.png?nolink&500 |}}
\\ 
\\ 
\\ 
\\ 
|< 300px 100px 200px >|
^ IC   ^ Concentration (µM) ^
| IC10  |N/A    |
| IC20  |N/A    |
| IC30  |N/A    |
| IC40  |N/A    |
| IC50  |N/A    |
| IC60  |N/A    |
| IC70  |N/A    |
| IC80  |N/A    |
| IC90  |N/A    |
\\ 
</panel>
</accordion>
==== Screen Summary ====
    * **<color #00a2e8>Round</color>**: 08
    * **<color #00a2e8>Dose</color>**: 100µM
    * **<color #00a2e8>Days of incubation</color>**: 8
    * **<color #00a2e8>Doublings</color>**: 7.0
    * **<color #00a2e8>Numbers of reads</color>**: 18655839


==== Screen Results ====


^Sensitive/Resistant hits (FDR<0.05)^CRANKS^Score Plot^Top 30 Genes^Screen Similarity^Top 30 Sensitive GO terms^Top 30 Resistant GO terms^
|0/0|<color #e85500>[[https://files.tyerslab.com/files/public/chemogenomics/cranks/Pyrazinamide_100uM_Round-8_exp516.txt|Scores]]</color>|<button type="primary" size="sm" modal="ScorePlot">View</button>|<button type="primary" size="sm" modal="modal_hits">View</button>|<button type="default" size="sm" modal="modal_screen_similarity">View</button>|<button type="default" size="sm" modal="modal_go_sensitive">View</button>|<button type="default" size="sm" modal="modal_go_resistant">View</button>|
<modal id='ScorePlot' size='lg' title='Pyrazinamide 100μM R08 exp516'>
{{:chemogenomics:cranks_plots:exp516.png?nolink}}
</modal>


<modal id="modal_hits" size="sm" title="Top 30 S/R Genes">
^Gene^CRANKS Score^FDR^
|[[:human_genes:M:MAGEB1|MAGEB1]]|-2.70|0.11|
|[[:human_genes:S:SNF8|SNF8]]|-2.67|0.18|
|[[:human_genes:P:PPP2R2A|PPP2R2A]]|-2.33|0.34|
|[[:human_genes:I:IRF8|IRF8]]|-2.17|0.65|
|[[:human_genes:B:BRD9|BRD9]]|-2.17|0.70|
|[[:human_genes:Z:ZNF233|ZNF233]]|-2.11|0.70|
|[[:human_genes:K:KIAA1432|KIAA1432]]|-2.11|0.70|
|[[:human_genes:T:TMEM189-UBE2V1|TMEM189-UBE2V1]]|-2.07|0.70|
|[[:human_genes:O:OSGEP|OSGEP]]|-2.04|0.70|
|[[:human_genes:V:VWA3B|VWA3B]]|-1.99|0.70|
|[[:human_genes:K:KRTAP10-3|KRTAP10-3]]|-1.97|0.74|
|[[:human_genes:H:HIST1H2BO|HIST1H2BO]]|-1.95|0.74|
|[[:human_genes:Z:ZDHHC15|ZDHHC15]]|-1.94|0.70|
|[[:human_genes:P:POLR3B|POLR3B]]|-1.94|0.70|
|[[:human_genes:S:SCAP|SCAP]]|-1.92|0.70|
|[[:human_genes:G:GPCPD1|GPCPD1]]|-1.92|0.70|
|[[:human_genes:T:TSHZ1|TSHZ1]]|-1.92|0.70|
|[[:human_genes:O:OR4A16|OR4A16]]|-1.91|0.70|
|[[:human_genes:D:DPAGT1|DPAGT1]]|-1.89|0.76|
|[[:human_genes:C:CHAC1|CHAC1]]|-1.89|0.76|
|[[:human_genes:C:CEP135|CEP135]]|-1.89|0.73|
|[[:human_genes:T:TMEM259|TMEM259]]|-1.88|0.76|
|[[:human_genes:B:BUB1B|BUB1B]]|-1.88|0.76|
|[[:human_genes:E:EFCAB11|EFCAB11]]|-1.87|0.76|
|[[:human_genes:R:RTCB|RTCB]]|-1.87|0.83|
|[[:human_genes:C:CLEC4F|CLEC4F]]|-1.86|0.74|
|[[:human_genes:H:HMGCS2|HMGCS2]]|-1.85|0.74|
|[[:human_genes:D:DHX8|DHX8]]|-1.85|0.84|
|[[:human_genes:O:OPTN|OPTN]]|-1.84|0.74|
|[[:human_genes:L:LRRK2|LRRK2]]|-1.81|0.76|
|[[:human_genes:O:OLIG3|OLIG3]]|1.86|0.80|
|[[:human_genes:S:SNX13|SNX13]]|1.87|0.80|
|[[:human_genes:F:FOXP1|FOXP1]]|1.87|0.80|
|[[:human_genes:F:FKBP15|FKBP15]]|1.89|0.80|
|[[:human_genes:T:TMBIM4|TMBIM4]]|1.90|0.80|
|[[:human_genes:T:TPR|TPR]]|1.90|0.80|
|[[:human_genes:S:SLC16A8|SLC16A8]]|1.91|0.80|
|[[:human_genes:U:USP17L17|USP17L17]]|1.93|0.86|
|[[:human_genes:P:POTEF|POTEF]]|1.95|0.80|
|[[:human_genes:S:SLC6A17|SLC6A17]]|1.95|0.80|
|[[:human_genes:S:SCAF1|SCAF1]]|1.95|0.86|
|[[:human_genes:R:RNF157|RNF157]]|1.96|0.80|
|[[:human_genes:K:KRT39|KRT39]]|1.96|0.80|
|[[:human_genes:A:AQR|AQR]]|1.97|0.80|
|[[:human_genes:U:UPF1|UPF1]]|2.01|0.80|
|[[:human_genes:P:PSMD6|PSMD6]]|2.04|0.81|
|[[:human_genes:P:PSMD12|PSMD12]]|2.05|0.80|
|[[:human_genes:S:SPATA31D3|SPATA31D3]]|2.06|0.74|
|[[:human_genes:N:NUMA1|NUMA1]]|2.08|0.80|
|[[:human_genes:C:CSE1L|CSE1L]]|2.10|0.80|
|[[:human_genes:Y:YJEFN3|YJEFN3]]|2.11|0.64|
|[[:human_genes:R:RACGAP1|RACGAP1]]|2.12|0.80|
|[[:human_genes:A:ARMC3|ARMC3]]|2.16|0.58|
|[[:human_genes:M:MTRNR2L4|MTRNR2L4]]|2.24|0.86|
|[[:human_genes:T:TAX1BP1|TAX1BP1]]|2.42|0.48|
|[[:human_genes:N:NOTCH2NL|NOTCH2NL]]|2.45|0.58|
|[[:human_genes:T:TXLNG|TXLNG]]|2.46|0.23|
|[[:human_genes:R:RPS15|RPS15]]|2.60|0.80|
|[[:human_genes:R:RSRC2|RSRC2]]|2.72|0.80|
|[[:human_genes:F:FAM122A|FAM122A]]|2.72|0.10|
</modal>


<modal id="modal_screen_similarity" size="lg" title="Correlated Screens">
No correlation data above threshold. (correlation > 0.05)
</modal>


<modal id="modal_go_sensitive" size="lg" title="Top 30 sensitive GO terms">No GO term hits below threshold. (FDR <0.05)</modal>
<modal id="modal_go_resistant" size="lg" title="Top 30 resistant GO terms">No GO term hits below threshold. (FDR <0.05)</modal>