====== LB-100 4.1μM R02 exp72 ======
==== Mechanism of Action ====
Inhibits protein phosphatase 2A
* **Class / Subclass 1:** Signal Transduction / Phosphatase Inhibitor
==== Technical Notes ====
* **PubChem Name:** %%LB-100%%
* **Synonyms:** N/A
* **CAS #:** 1026680-07-8
* **PubChem CID:** [[https://pubchem.ncbi.nlm.nih.gov/compound/3578572|3578572]]
* **IUPAC:** %%3-(4-methylpiperazine-1-carbonyl)-7-oxabicyclo[2.2.1]heptane-2-carboxylic acid%%
* **INCHI Name:** InChI=1S/C13H20N2O4/c1-14-4-6-15(7-5-14)12(16)10-8-2-3-9(19-8)11(10)13(17)18/h8-11H,2-7H2,1H3,(H,17,18)
* **INCHI Key:** JUQMLSGOTNKJKI-UHFFFAOYSA-N
* **Molecular Weight:** 268.31
* **Canonical SMILES:** CN1CCN(CC1)C(=O)C2C3CCC(C2C(=O)O)O3
* **Isomeric SMILES:** N/A
* **Molecular Formula:** C13H20N2O4
{{:chemogenomics:structures:chem-0048.svg?nolink}}
* **Supplier Name:** Selleck Chemicals
* **Catalog #:** S7537
* **Lot #:** N/A
* **LCMS:** Tr 0.14 min, m/z 269+ [M+H]+, 267- [M-H]-
* **Platform ID:** LB-100
* **Min:** -10.4657; **Max:** 88.4509
{{:chemogenomics:dose_response:dr_13.png?nolink&500 |}}
\\
\\
\\
\\
|< 300px 100px 200px >|
^ IC ^ Concentration (µM) ^
| IC10 |N/A |
| IC20 |3.7707 |
| IC30 |4.7035 |
| IC40 |5.6380 |
| IC50 |6.6580 |
| IC60 |N/A |
| IC70 |N/A |
| IC80 |N/A |
| IC90 |N/A |
\\
==== Screen Summary ====
* **Round**: 02
* **Dose**: 4.1µM
* **Days of incubation**: 8
* **Doublings**: 1.8
* **Numbers of reads**: 11776627
==== Screen Results ====
^Sensitive/Resistant hits (FDR<0.05)^CRANKS^Score Plot^Top 30 Genes^Screen Similarity^Top 30 Sensitive GO terms^Top 30 Resistant GO terms^
|1/16|[[https://files.tyerslab.com/files/public/chemogenomics/cranks/LB-100_4.1uM_Round-2_exp72.txt|Scores]]||||||
{{:chemogenomics:cranks_plots:exp72.png?nolink}}
^Gene^CRANKS Score^FDR^
|[[:human_genes:L:LRRC8C|LRRC8C]]|-3.02|0.02|
|[[:human_genes:L:LRRC8A|LRRC8A]]|-2.42|0.14|
|[[:human_genes:T:TMEM30A|TMEM30A]]|-2.41|0.14|
|[[:human_genes:S:SEC24B|SEC24B]]|-2.40|0.14|
|[[:human_genes:T:TMEM230|TMEM230]]|-2.40|0.14|
|[[:human_genes:Z:ZNF566|ZNF566]]|-2.30|0.20|
|[[:human_genes:T:TLR7|TLR7]]|-2.26|0.22|
|[[:human_genes:O:OTUB1|OTUB1]]|-2.24|0.32|
|[[:human_genes:S:STMN1|STMN1]]|-2.20|0.26|
|[[:human_genes:P:PRKDC|PRKDC]]|-2.19|0.26|
|[[:human_genes:C:CENPK|CENPK]]|-2.18|0.48|
|[[:human_genes:L:LRRC20|LRRC20]]|-2.12|0.32|
|[[:human_genes:S:SH3GL3|SH3GL3]]|-2.10|0.32|
|[[:human_genes:F:FAM50B|FAM50B]]|-2.09|0.32|
|[[:human_genes:A:ASPM|ASPM]]|-2.07|0.36|
|[[:human_genes:N:NFRKB|NFRKB]]|-2.07|0.33|
|[[:human_genes:R:RPS8|RPS8]]|-2.01|0.60|
|[[:human_genes:M:MUL1|MUL1]]|-2.01|0.41|
|[[:human_genes:P:PDCD2L|PDCD2L]]|-2.01|0.36|
|[[:human_genes:R:RCC1|RCC1]]|-2.00|0.48|
|[[:human_genes:T:TAS2R4|TAS2R4]]|-2.00|0.36|
|[[:human_genes:D:DCAF15|DCAF15]]|-1.98|0.36|
|[[:human_genes:T:TMF1|TMF1]]|-1.97|0.46|
|[[:human_genes:C:CDK5RAP3|CDK5RAP3]]|-1.96|0.36|
|[[:human_genes:N:NAA60|NAA60]]|-1.95|0.36|
|[[:human_genes:T:THY1|THY1]]|-1.95|0.36|
|[[:human_genes:S:STK38|STK38]]|-1.95|0.36|
|[[:human_genes:R:RCOR1|RCOR1]]|-1.95|0.36|
|[[:human_genes:P:PPM1B|PPM1B]]|-1.95|0.36|
|[[:human_genes:K:KCNQ1|KCNQ1]]|-1.95|0.36|
|[[:human_genes:C:CD48|CD48]]|2.08|0.30|
|[[:human_genes:C:CMC2|CMC2]]|2.20|0.63|
|[[:human_genes:E:EME1|EME1]]|2.20|0.10|
|[[:human_genes:C:CCNL1|CCNL1]]|2.21|0.10|
|[[:human_genes:E:EIF3M|EIF3M]]|2.24|0.09|
|[[:human_genes:C:CKAP5|CKAP5]]|2.26|0.61|
|[[:human_genes:W:WDR53|WDR53]]|2.28|0.13|
|[[:human_genes:R:RALGAPB|RALGAPB]]|2.29|0.07|
|[[:human_genes:S:SNN|SNN]]|2.37|0.05|
|[[:human_genes:P:PACS1|PACS1]]|2.38|0.09|
|[[:human_genes:N:NAA15|NAA15]]|2.40|0.15|
|[[:human_genes:E:EIF3A|EIF3A]]|2.41|0.04|
|[[:human_genes:L:LGALS14|LGALS14]]|2.42|0.04|
|[[:human_genes:B:BAK1|BAK1]]|2.44|0.04|
|[[:human_genes:F:FAM122A|FAM122A]]|2.48|0.03|
|[[:human_genes:S:SMC3|SMC3]]|2.66|0.11|
|[[:human_genes:N:NPEPPS|NPEPPS]]|2.66|0.01|
|[[:human_genes:L:LIG1|LIG1]]|2.67|0.56|
|[[:human_genes:K:KLHDC3|KLHDC3]]|2.67|0.01|
|[[:human_genes:M:MARCH5|MARCH5]]|2.77|<0.01|
|[[:human_genes:P:PRKACA|PRKACA]]|2.85|<0.01|
|[[:human_genes:R:RPL36A-HNRNPH2|RPL36A-HNRNPH2]]|3.24|0.30|
|[[:human_genes:A:ATF4|ATF4]]|3.26|<0.01|
|[[:human_genes:H:HMHA1|HMHA1]]|3.59|<0.01|
|[[:human_genes:D:DDX3X|DDX3X]]|3.68|<0.01|
|[[:human_genes:E:EIF3G|EIF3G]]|3.81|<0.01|
|[[:human_genes:F:FLII|FLII]]|3.95|<0.01|
|[[:human_genes:E:EIF4A1|EIF4A1]]|5.31|<0.01|
|[[:human_genes:P:PEBP1|PEBP1]]|7.03|<0.01|
|[[:human_genes:K:KCTD10|KCTD10]]|7.10|<0.01|
^Screen^Correlation^Plot^
|[[:results:exp240|Pyridostatin 4μM R05 exp240]]|0.073||
|[[:results:exp210|LB-100 2μM R05 exp210]]|0.122||
|[[:results:exp216|Erlotinib 10μM R05 exp216]]|0.051||
{{:chemogenomics:comparison_plots:exp240_vs_exp72.png?nolink |}}
{{:chemogenomics:comparison_plots:exp210_vs_exp72.png?nolink |}}
{{:chemogenomics:comparison_plots:exp216_vs_exp72.png?nolink |}}
No GO term hits below threshold. (FDR <0.05)
^GO Term^Fold Change^Genes^
|viral translational termination-reinitiation|276.40|EIF3G,EIF3A|
|eukaryotic translation initiation factor 3 complex|118.46|EIF3G,EIF3A,EIF3M|
|eukaryotic 48S preinitiation complex|103.65|EIF3G,EIF3A,EIF3M|
|eukaryotic 43S preinitiation complex|97.55|EIF3G,EIF3A,EIF3M|
|translation preinitiation complex|92.13|EIF3G,EIF3A,EIF3M|
|cytoplasmic translational initiation|76.25|EIF4A1,EIF3G,EIF3A,EIF3M|
|translation initiation factor activity|46.07|EIF4A1,EIF3G,EIF3A,EIF3M|
|translational initiation|43.19|EIF4A1,EIF3G,DDX3X,EIF3A,EIF3M|
|translation factor activity, RNA binding|27.64|EIF4A1,EIF3G,EIF3A,EIF3M|