====== Selumetinib 20μM R02 exp81 ======
==== Mechanism of Action ====
Inhibits MEK1 and MEK2
  * **<color #00a2e8>Class / Subclass 1:</color>** Signal Transduction / Kinase Inhibitor




==== Technical Notes ====
<accordion collapsed='true'>
<panel title='Protein References' collapsed='true'>
    * **<color #00a2e8>PubChem Name:</color>** %%Selumetinib%%
    * **<color #00a2e8>Synonyms:</color>** AZD6244; ARRY-142886
    * **<color #00a2e8>CAS #:</color>** 606143-52-6
    * **<color #00a2e8>PubChem CID:</color>** [[https://pubchem.ncbi.nlm.nih.gov/compound/10127622|10127622]]
    * **<color #00a2e8>IUPAC:</color>** %%6-(4-bromo-2-chloroanilino)-7-fluoro-N-(2-hydroxyethoxy)-3-methylbenzimidazole-5-carboxamide%%
    * **<color #00a2e8>INCHI Name:</color>** InChI=1S/C17H15BrClFN4O3/c1-24-8-21-16-13(24)7-10(17(26)23-27-5-4-25)15(14(16)20)22-12-3-2-9(18)6-11(12)19/h2-3,6-8,22,25H,4-5H2,1H3,(H,23,26)
    * **<color #00a2e8>INCHI Key:</color>** CYOHGALHFOKKQC-UHFFFAOYSA-N
    * **<color #00a2e8>Molecular Weight:</color>** 457.7
    * **<color #00a2e8>Canonical SMILES:</color>** CN1C=NC2=C1C=C(C(=C2F)NC3=C(C=C(C=C3)Br)Cl)C(=O)NOCCO
    * **<color #00a2e8>Isomeric SMILES:</color>** N/A
    * **<color #00a2e8>Molecular Formula:</color>** C17H15BrClFN4O3
{{:chemogenomics:structures:chem-0057.svg?nolink}}
</panel>


<panel title='Protein Supplier' collapsed='true'>
    * **<color #00a2e8>Supplier Name:</color>** Selleck Chemicals
    * **<color #00a2e8>Catalog #:</color>** S1008
    * **<color #00a2e8>Lot #:</color>** S100831
</panel>


<panel title='Protein Characterization' collapsed='true'>
    * **<color #00a2e8>HRMS (ESI-TOF) m/z:</color>** (M+H)+ Calcd for C17H15BrClFN4O3 457.00729; found 457.00736
</panel>


<panel title='Dose Response Curve' collapsed='true'>
    * **<color #00a2e8>Platform ID:</color>** AZD6244
    * **<color #00a2e8>Min:</color>** -13.1322; **<color #00a2e8>Max:</color>** 7.7239
{{:chemogenomics:dose_response:dr_2.png?nolink&500 |}}
\\ 
\\ 
\\ 
\\ 
|< 300px 100px 200px >|
^ IC   ^ Concentration (µM) ^
| IC10  |N/A    |
| IC20  |N/A    |
| IC30  |N/A    |
| IC40  |N/A    |
| IC50  |N/A    |
| IC60  |N/A    |
| IC70  |N/A    |
| IC80  |N/A    |
| IC90  |N/A    |
\\ 
</panel>
</accordion>
==== Screen Summary ====
    * **<color #00a2e8>Round</color>**: 02
    * **<color #00a2e8>Dose</color>**: 20µM
    * **<color #00a2e8>Days of incubation</color>**: 8
    * **<color #00a2e8>Doublings</color>**: 6.3
    * **<color #00a2e8>Numbers of reads</color>**: 11566448


==== Screen Results ====


^Sensitive/Resistant hits (FDR<0.05)^CRANKS^Score Plot^Top 30 Genes^Screen Similarity^Top 30 Sensitive GO terms^Top 30 Resistant GO terms^
|6/3|<color #e85500>[[https://files.tyerslab.com/files/public/chemogenomics/cranks/Selumetinib_20uM_Round-2_exp81.txt|Scores]]</color>|<button type="primary" size="sm" modal="ScorePlot">View</button>|<button type="primary" size="sm" modal="modal_hits">View</button>|<button type="default" size="sm" modal="modal_screen_similarity">View</button>|<button type="default" size="sm" modal="modal_go_sensitive">View</button>|<button type="default" size="sm" modal="modal_go_resistant">View</button>|
<modal id='ScorePlot' size='lg' title='Selumetinib 20μM R02 exp81'>
{{:chemogenomics:cranks_plots:exp81.png?nolink}}
</modal>


<modal id="modal_hits" size="sm" title="Top 30 S/R Genes">
^Gene^CRANKS Score^FDR^
|[[:human_genes:D:DCAF15|DCAF15]]|-3.07|<0.01|
|[[:human_genes:G:GPR107|GPR107]]|-2.90|0.01|
|[[:human_genes:Z:ZBTB7A|ZBTB7A]]|-2.84|0.01|
|[[:human_genes:C:CPSF7|CPSF7]]|-2.75|0.04|
|[[:human_genes:S:SPEN|SPEN]]|-2.66|0.04|
|[[:human_genes:P:PIAS4|PIAS4]]|-2.59|0.04|
|[[:human_genes:N:NPRL3|NPRL3]]|-2.58|0.14|
|[[:human_genes:G:GGPS1|GGPS1]]|-2.52|0.10|
|[[:human_genes:M:MSI2|MSI2]]|-2.42|0.09|
|[[:human_genes:G:GMPPB|GMPPB]]|-2.41|0.47|
|[[:human_genes:R:RPS15A|RPS15A]]|-2.33|0.51|
|[[:human_genes:R:RBPJ|RBPJ]]|-2.33|0.18|
|[[:human_genes:E:ERG|ERG]]|-2.30|0.18|
|[[:human_genes:K:KDSR|KDSR]]|-2.29|0.14|
|[[:human_genes:S:SEPHS1|SEPHS1]]|-2.22|0.18|
|[[:human_genes:R:RBM7|RBM7]]|-2.21|0.24|
|[[:human_genes:S:SEPSECS|SEPSECS]]|-2.21|0.33|
|[[:human_genes:L:LMO2|LMO2]]|-2.18|0.18|
|[[:human_genes:D:DEPDC5|DEPDC5]]|-2.16|0.18|
|[[:human_genes:T:TRAF2|TRAF2]]|-2.16|0.27|
|[[:human_genes:S:SLC23A2|SLC23A2]]|-2.10|0.24|
|[[:human_genes:M:MKLN1|MKLN1]]|-2.09|0.24|
|[[:human_genes:R:RABGGTB|RABGGTB]]|-2.08|0.33|
|[[:human_genes:T:T|T]]|-2.05|0.26|
|[[:human_genes:I:ING1|ING1]]|-2.05|0.26|
|[[:human_genes:T:TNFRSF4|TNFRSF4]]|-2.05|0.34|
|[[:human_genes:C:CCNH|CCNH]]|-2.03|0.51|
|[[:human_genes:K:KIAA1551|KIAA1551]]|-2.02|0.28|
|[[:human_genes:A:ATF4|ATF4]]|-2.02|0.37|
|[[:human_genes:F:FOXD3|FOXD3]]|-2.00|0.30|
|[[:human_genes:R:RPS4X|RPS4X]]|2.04|0.40|
|[[:human_genes:D:DISP1|DISP1]]|2.04|0.40|
|[[:human_genes:M:MARCH5|MARCH5]]|2.05|0.30|
|[[:human_genes:F:FABP2|FABP2]]|2.05|0.30|
|[[:human_genes:P:PPP3R1|PPP3R1]]|2.07|0.30|
|[[:human_genes:S:SUPT6H|SUPT6H]]|2.07|0.40|
|[[:human_genes:N:NOBOX|NOBOX]]|2.08|0.40|
|[[:human_genes:C:COX5B|COX5B]]|2.09|0.52|
|[[:human_genes:N:NEFM|NEFM]]|2.10|0.45|
|[[:human_genes:U:UPF2|UPF2]]|2.11|0.67|
|[[:human_genes:P:PFKP|PFKP]]|2.12|0.36|
|[[:human_genes:S:SLC25A32|SLC25A32]]|2.12|0.36|
|[[:human_genes:S:SUV420H1|SUV420H1]]|2.13|0.23|
|[[:human_genes:A:ABCF3|ABCF3]]|2.16|0.20|
|[[:human_genes:F:FAM102B|FAM102B]]|2.17|0.20|
|[[:human_genes:R:RAD21|RAD21]]|2.17|0.41|
|[[:human_genes:M:MANEA|MANEA]]|2.18|0.20|
|[[:human_genes:R:RBMS3|RBMS3]]|2.28|0.15|
|[[:human_genes:C:CHAF1A|CHAF1A]]|2.32|0.40|
|[[:human_genes:M:MTHFD2|MTHFD2]]|2.32|0.14|
|[[:human_genes:H:HIF1A|HIF1A]]|2.33|0.14|
|[[:human_genes:M:MTR|MTR]]|2.34|0.14|
|[[:human_genes:B:BARHL1|BARHL1]]|2.38|0.16|
|[[:human_genes:N:NBPF10|NBPF10]]|2.41|0.15|
|[[:human_genes:S:SPOP|SPOP]]|2.53|0.08|
|[[:human_genes:D:DET1|DET1]]|2.58|0.12|
|[[:human_genes:R:RFWD2|RFWD2]]|2.80|0.02|
|[[:human_genes:P:PRPF8|PRPF8]]|2.81|0.40|
|[[:human_genes:Z:ZNF217|ZNF217]]|3.15|<0.01|
|[[:human_genes:E:ERF|ERF]]|3.75|<0.01|
</modal>


<modal id="modal_screen_similarity" size="lg" title="Correlated Screens">
No correlation data above threshold. (correlation > 0.05)
</modal>


<modal id="modal_go_sensitive" size="lg" title="Top 30 sensitive GO terms">No GO term hits below threshold. (FDR <0.05)</modal>
<modal id="modal_go_resistant" size="lg" title="Top 30 resistant GO terms">No GO term hits below threshold. (FDR <0.05)</modal>