CCCP 0.1μM R00 exp10 [The Human Chemical-Genetic Interaction Map Project]

This page is read only. You can view the source, but not change it. Ask your administrator if you think this is wrong.
====== CCCP 0.1μM R00 exp10 ======
==== Mechanism of Action ====
Mitochondrial proton gradient uncoupler, disrupts ATP synthesis
  * **<color #00a2e8>Class / Subclass 1:</color>** Organelle Function / Mitochondrial Inhibitor




==== Technical Notes ====
<accordion collapsed='true'>
<panel title='Compound References' collapsed='true'>
    * **<color #00a2e8>PubChem Name:</color>** %%(3-Chlorophenyl)hydrazonomalononitrile%%
    * **<color #00a2e8>Synonyms:</color>** Carbonyl cyanide 3-chlorophenylhydrazone; Carbonyl Cyanide m-Chlorophenylhydrazone; Carbonyl cyanide 3-chlorophenylhydrazone;Carbonyl Cyanide m-Chlorophenylhydrazone
    * **<color #00a2e8>CAS #:</color>** 555-60-2
    * **<color #00a2e8>PubChem CID:</color>** [[https://pubchem.ncbi.nlm.nih.gov/compound/2603|2603]]
    * **<color #00a2e8>IUPAC:</color>** %%2-[(3-chlorophenyl)hydrazinylidene]propanedinitrile%%
    * **<color #00a2e8>INCHI Name:</color>** InChI=1S/C9H5ClN4/c10-7-2-1-3-8(4-7)13-14-9(5-11)6-12/h1-4,13H
    * **<color #00a2e8>INCHI Key:</color>** UGTJLJZQQFGTJD-UHFFFAOYSA-N
    * **<color #00a2e8>Molecular Weight:</color>** 204.61
    * **<color #00a2e8>Canonical SMILES:</color>** C1=CC(=CC(=C1)Cl)NN=C(C#N)C#N
    * **<color #00a2e8>Isomeric SMILES:</color>** N/A
    * **<color #00a2e8>Molecular Formula:</color>** C9H5ClN4
{{:chemogenomics:structures:chem-0006.svg?nolink}}
</panel>


<panel title='Compound Supplier' collapsed='true'>
    * **<color #00a2e8>Supplier Name:</color>** Sigma-Aldrich
    * **<color #00a2e8>Catalog #:</color>** C2759
    * **<color #00a2e8>Lot #:</color>** MKBT2015V
</panel>


<panel title='Compound Characterization' collapsed='true'>
    * **<color #00a2e8>HRMS (ESI-TOF) m/z:</color>** [M-H]- Calcd for C9H5NClN4 203.0130; found 202.9946
</panel>


<panel title='Dose Response Curve' collapsed='true'>
    * **<color #00a2e8>Platform ID:</color>** CCCP
    * **<color #00a2e8>Min:</color>** -13.9463; **<color #00a2e8>Max:</color>** 78.4067
{{:chemogenomics:dose_response:dr_259.png?nolink&500 |}}
\\ 
\\ 
\\ 
\\ 
|< 300px 100px 200px >|
^ IC   ^ Concentration (µM) ^
| IC10  |N/A    |
| IC20  |3.0761    |
| IC30  |4.2919    |
| IC40  |5.6392    |
| IC50  |7.2449    |
| IC60  |N/A    |
| IC70  |N/A    |
| IC80  |N/A    |
| IC90  |N/A    |
\\ 
</panel>
</accordion>
==== Screen Summary ====
    * **<color #00a2e8>Round</color>**: 00
    * **<color #00a2e8>Dose</color>**: 100nM
    * **<color #00a2e8>Days of incubation</color>**: 8
    * **<color #00a2e8>Doublings</color>**: 6.7
    * **<color #00a2e8>Numbers of reads</color>**: 11956535


==== Screen Results ====


^Sensitive/Resistant hits (FDR<0.05)^CRANKS^Score Plot^Top 30 Genes^Screen Similarity^Top 30 Sensitive GO terms^Top 30 Resistant GO terms^
|2/0|<color #e85500>[[https://files.tyerslab.com/files/public/chemogenomics/cranks/CCCP_0.1uM_Round-0_exp10.txt|Scores]]</color>|<button type="primary" size="sm" modal="ScorePlot">View</button>|<button type="primary" size="sm" modal="modal_hits">View</button>|<button type="primary" size="sm" modal="modal_screen_similarity">View</button>|<button type="default" size="sm" modal="modal_go_sensitive">View</button>|<button type="default" size="sm" modal="modal_go_resistant">View</button>|
<modal id='ScorePlot' size='lg' title='CCCP 0.1μM R00 exp10'>
{{:chemogenomics:cranks_plots:exp10.png?nolink}}
</modal>


<modal id="modal_hits" size="sm" title="Top 30 S/R Genes">
^Gene^CRANKS Score^FDR^
|[[:human_genes:A:ADK|ADK]]|-2.95|0.05|
|[[:human_genes:P:PRAMEF25|PRAMEF25]]|-2.87|0.61|
|[[:human_genes:P:PRAMEF26|PRAMEF26]]|-2.85|0.61|
|[[:human_genes:C:CAMLG|CAMLG]]|-2.72|0.05|
|[[:human_genes:P:PADI2|PADI2]]|-2.41|0.35|
|[[:human_genes:M:MOCS3|MOCS3]]|-2.40|0.35|
|[[:human_genes:M:MPHOSPH6|MPHOSPH6]]|-2.26|0.37|
|[[:human_genes:R:RAB24|RAB24]]|-2.20|0.35|
|[[:human_genes:E:EEF1E1|EEF1E1]]|-2.19|0.35|
|[[:human_genes:R:RREB1|RREB1]]|-2.17|0.35|
|[[:human_genes:T:TMEM240|TMEM240]]|-2.16|0.35|
|[[:human_genes:L:LAMTOR4|LAMTOR4]]|-2.11|0.61|
|[[:human_genes:D:DDX55|DDX55]]|-2.07|0.61|
|[[:human_genes:K:KIAA1432|KIAA1432]]|-2.06|0.50|
|[[:human_genes:S:SHOX2|SHOX2]]|-2.02|0.61|
|[[:human_genes:R:RPE|RPE]]|-2.02|0.61|
|[[:human_genes:U:UIMC1|UIMC1]]|-2.01|0.61|
|[[:human_genes:M:MAP1B|MAP1B]]|-2.01|0.61|
|[[:human_genes:T:TAF1A|TAF1A]]|-2.00|0.61|
|[[:human_genes:S:SEPHS2|SEPHS2]]|-1.98|0.61|
|[[:human_genes:M:MYO9B|MYO9B]]|-1.97|0.61|
|[[:human_genes:P:PRAMEF9|PRAMEF9]]|-1.95|0.61|
|[[:human_genes:F:FCAR|FCAR]]|-1.94|0.61|
|[[:human_genes:G:GMPPB|GMPPB]]|-1.94|0.61|
|[[:human_genes:R:RARS|RARS]]|-1.91|0.75|
|[[:human_genes:C:CEP57|CEP57]]|-1.91|0.61|
|[[:human_genes:A:ACAN|ACAN]]|-1.91|0.61|
|[[:human_genes:C:CSNK1D|CSNK1D]]|-1.91|0.61|
|[[:human_genes:P:PRDM10|PRDM10]]|-1.89|0.61|
|[[:human_genes:L:LIAS|LIAS]]|-1.89|0.61|
|[[:human_genes:C:C5orf28|C5orf28]]|2.07|0.31|
|[[:human_genes:P:PPP1R15B|PPP1R15B]]|2.10|0.33|
|[[:human_genes:F:FAM184A|FAM184A]]|2.11|0.33|
|[[:human_genes:F:FBXL19|FBXL19]]|2.12|0.44|
|[[:human_genes:R:RPL10A|RPL10A]]|2.14|0.38|
|[[:human_genes:P:PSMD13|PSMD13]]|2.17|0.35|
|[[:human_genes:S:SPZ1|SPZ1]]|2.19|0.31|
|[[:human_genes:O:ORC1|ORC1]]|2.21|0.33|
|[[:human_genes:A:APEX1|APEX1]]|2.22|0.16|
|[[:human_genes:N:NTNG1|NTNG1]]|2.23|0.16|
|[[:human_genes:R:RPS14|RPS14]]|2.25|0.35|
|[[:human_genes:C:CCDC90B|CCDC90B]]|2.27|0.14|
|[[:human_genes:G:GPSM3|GPSM3]]|2.27|0.33|
|[[:human_genes:P:PLG|PLG]]|2.28|0.14|
|[[:human_genes:N:NOP2|NOP2]]|2.28|0.35|
|[[:human_genes:T:TRIM59|TRIM59]]|2.29|0.14|
|[[:human_genes:C:CDH17|CDH17]]|2.31|0.14|
|[[:human_genes:M:MSLN|MSLN]]|2.33|0.31|
|[[:human_genes:C:CKAP5|CKAP5]]|2.35|0.44|
|[[:human_genes:P:PRPF8|PRPF8]]|2.38|0.44|
|[[:human_genes:P:PPWD1|PPWD1]]|2.38|0.35|
|[[:human_genes:N:NDC1|NDC1]]|2.40|0.12|
|[[:human_genes:S:SLCO1C1|SLCO1C1]]|2.43|0.12|
|[[:human_genes:E:EMD|EMD]]|2.47|0.12|
|[[:human_genes:U:USP27X|USP27X]]|2.52|0.45|
|[[:human_genes:E:EGR2|EGR2]]|2.58|0.26|
|[[:human_genes:I:IDE|IDE]]|2.61|0.11|
|[[:human_genes:A:ANKRD50|ANKRD50]]|2.69|0.11|
|[[:human_genes:C:CHAF1A|CHAF1A]]|3.14|0.14|
|[[:human_genes:C:COPE|COPE]]|3.22|0.12|
</modal>


<modal id="modal_screen_similarity" size="lg" title="Correlated Screens">
^Screen^Correlation^Plot^
|[[:results:exp12|Chloramphenicol 2μM R00 exp12]]|0.081|<button type="primary" size="small" modal="1">View</button>|
|[[:results:exp15|Cycloheximide 0.2μM R00 exp15]]|0.074|<button type="primary" size="small" modal="2">View</button>|
|[[:results:exp31|Rifampicin 1μM R00 exp31]]|0.054|<button type="primary" size="small" modal="3">View</button>|
|[[:results:exp5|Alpha-Amanitin 0.5μM R00 exp5]]|0.057|<button type="primary" size="small" modal="4">View</button>|
</modal>


<modal id="1" size="lg" title="CCCP 0.1μM R00 exp10  vs  Chloramphenicol 2μM R00 exp12">
{{:chemogenomics:comparison_plots:exp10_vs_exp12.png?nolink |}}
</modal>

<modal id="2" size="lg" title="CCCP 0.1μM R00 exp10  vs  Cycloheximide 0.2μM R00 exp15">
{{:chemogenomics:comparison_plots:exp10_vs_exp15.png?nolink |}}
</modal>

<modal id="3" size="lg" title="CCCP 0.1μM R00 exp10  vs  Rifampicin 1μM R00 exp31">
{{:chemogenomics:comparison_plots:exp10_vs_exp31.png?nolink |}}
</modal>

<modal id="4" size="lg" title="Alpha-Amanitin 0.5μM R00 exp5  vs  CCCP 0.1μM R00 exp10">
{{:chemogenomics:comparison_plots:exp10_vs_exp5.png?nolink |}}
</modal>



<modal id="modal_go_sensitive" size="lg" title="Top 30 sensitive GO terms">No GO term hits below threshold. (FDR <0.05)</modal>
<modal id="modal_go_resistant" size="lg" title="Top 30 resistant GO terms">No GO term hits below threshold. (FDR <0.05)</modal>