1-Methyl-nicotinamide-chloride 1000μM R03 exp113 [The Human Chemical-Genetic Interaction Map Project]

This page is read only. You can view the source, but not change it. Ask your administrator if you think this is wrong.
====== 1-Methyl-nicotinamide-chloride 1000μM R03 exp113 ======
==== Mechanism of Action ====
Nicotinamde metabolite, generated by nicotinamide N-methyltransferase (NNMT)
  * **<color #00a2e8>Class / Subclass 1:</color>** Metabolism / Metabolite




==== Technical Notes ====
<accordion collapsed='true'>
<panel title='Compound References' collapsed='true'>
    * **<color #00a2e8>PubChem Name:</color>** %%3-Carbamyl-1-methylpyridinium chloride%%
    * **<color #00a2e8>Synonyms:</color>** N/A
    * **<color #00a2e8>CAS #:</color>** 1005-24-9
    * **<color #00a2e8>PubChem CID:</color>** [[https://pubchem.ncbi.nlm.nih.gov/compound/70495|70495]]
    * **<color #00a2e8>IUPAC:</color>** %%1-methylpyridin-1-ium-3-carboxamide;chloride%%
    * **<color #00a2e8>INCHI Name:</color>** InChI=1S/C7H8N2O.ClH/c1-9-4-2-3-6(5-9)7(8)10;/h2-5H,1H3,(H-,8,10);1H
    * **<color #00a2e8>INCHI Key:</color>** BWVDQVQUNNBTLK-UHFFFAOYSA-N
    * **<color #00a2e8>Molecular Weight:</color>** 172.61
    * **<color #00a2e8>Canonical SMILES:</color>** C[N+]1=CC=CC(=C1)C(=O)N.[Cl-]
    * **<color #00a2e8>Isomeric SMILES:</color>** N/A
    * **<color #00a2e8>Molecular Formula:</color>** C7H9ClN2O
{{:chemogenomics:structures:chem-0069.svg?nolink}}
</panel>


<panel title='Compound Supplier' collapsed='true'>
    * **<color #00a2e8>Supplier Name:</color>** Santa Cruz Biotechnology
    * **<color #00a2e8>Catalog #:</color>** N-3376
    * **<color #00a2e8>Lot #:</color>** J2512
</panel>


<panel title='Compound Characterization' collapsed='true'>
    * **<color #00a2e8>HRMS (ESI-TOF) m/z:</color>** (M)+ Calcd for C7 H9 N2 O 137.07149; found 137.07026
</panel>


<panel title='Dose Response Curve' collapsed='true'>
    * **<color #00a2e8>Platform ID:</color>** 1-METH-NICOTINAMIDE
    * **<color #00a2e8>Min:</color>** -8.6656; **<color #00a2e8>Max:</color>** 9.4829
{{:chemogenomics:dose_response:dr_56.png?nolink&500 |}}
\\ 
\\ 
\\ 
\\ 
|< 300px 100px 200px >|
^ IC   ^ Concentration (µM) ^
| IC10  |N/A    |
| IC20  |N/A    |
| IC30  |N/A    |
| IC40  |N/A    |
| IC50  |N/A    |
| IC60  |N/A    |
| IC70  |N/A    |
| IC80  |N/A    |
| IC90  |N/A    |
\\ 
</panel>
</accordion>
==== Screen Summary ====
    * **<color #00a2e8>Round</color>**: 03
    * **<color #00a2e8>Dose</color>**: 1000µM
    * **<color #00a2e8>Days of incubation</color>**: 8
    * **<color #00a2e8>Doublings</color>**: 7.8
    * **<color #00a2e8>Numbers of reads</color>**: 10512009


==== Screen Results ====


^Sensitive/Resistant hits (FDR<0.05)^CRANKS^Score Plot^Top 30 Genes^Screen Similarity^Top 30 Sensitive GO terms^Top 30 Resistant GO terms^
|0/0|<color #e85500>[[https://files.tyerslab.com/files/public/chemogenomics/cranks/1-Methyl-nicotinamide_chloride_1000uM_Round-3_exp113.txt|Scores]]</color>|<button type="primary" size="sm" modal="ScorePlot">View</button>|<button type="primary" size="sm" modal="modal_hits">View</button>|<button type="default" size="sm" modal="modal_screen_similarity">View</button>|<button type="default" size="sm" modal="modal_go_sensitive">View</button>|<button type="primary" size="sm" modal="modal_go_resistant">View</button>|
<modal id='ScorePlot' size='lg' title='1-Methyl-nicotinamide-chloride 1000μM R03 exp113'>
{{:chemogenomics:cranks_plots:exp113.png?nolink}}
</modal>


<modal id="modal_hits" size="sm" title="Top 30 S/R Genes">
^Gene^CRANKS Score^FDR^
|[[:human_genes:S:SLC35F3|SLC35F3]]|-2.66|0.14|
|[[:human_genes:P:PDSS1|PDSS1]]|-2.64|0.26|
|[[:human_genes:N:NAE1|NAE1]]|-2.52|0.26|
|[[:human_genes:G:GCLC|GCLC]]|-2.49|0.26|
|[[:human_genes:S:SEPSECS|SEPSECS]]|-2.35|0.57|
|[[:human_genes:O:OR2D3|OR2D3]]|-2.30|0.52|
|[[:human_genes:L:LOXL4|LOXL4]]|-2.22|0.57|
|[[:human_genes:K:KDSR|KDSR]]|-2.14|0.52|
|[[:human_genes:T:TMEM173|TMEM173]]|-2.09|0.70|
|[[:human_genes:R:RNF39|RNF39]]|-2.07|0.70|
|[[:human_genes:F:FUBP3|FUBP3]]|-2.04|0.62|
|[[:human_genes:M:METAP2|METAP2]]|-2.03|0.91|
|[[:human_genes:G:GLI3|GLI3]]|-2.02|0.63|
|[[:human_genes:F:FAM98B|FAM98B]]|-1.96|0.87|
|[[:human_genes:O:OPRL1|OPRL1]]|-1.94|0.70|
|[[:human_genes:D:DSCR4|DSCR4]]|-1.94|0.70|
|[[:human_genes:R:RNMT|RNMT]]|-1.92|0.91|
|[[:human_genes:R:RDH5|RDH5]]|-1.90|0.78|
|[[:human_genes:D:DPH6|DPH6]]|-1.89|0.78|
|[[:human_genes:C:CBFB|CBFB]]|-1.88|0.78|
|[[:human_genes:G:GFRA2|GFRA2]]|-1.86|0.91|
|[[:human_genes:Z:ZSCAN12|ZSCAN12]]|-1.86|0.91|
|[[:human_genes:F:FANCI|FANCI]]|-1.85|0.91|
|[[:human_genes:R:RGS9BP|RGS9BP]]|-1.85|0.91|
|[[:human_genes:S:SCN10A|SCN10A]]|-1.81|0.91|
|[[:human_genes:O:OSGIN2|OSGIN2]]|-1.80|0.91|
|[[:human_genes:T:TIMM22|TIMM22]]|-1.80|0.91|
|[[:human_genes:E:EPB41L2|EPB41L2]]|-1.80|0.91|
|[[:human_genes:A:AMELX|AMELX]]|-1.78|0.91|
|[[:human_genes:H:HSPA13|HSPA13]]|-1.78|0.91|
|[[:human_genes:S:SYNCRIP|SYNCRIP]]|1.98|0.65|
|[[:human_genes:N:NUP214|NUP214]]|1.98|0.61|
|[[:human_genes:T:THOC2|THOC2]]|2.00|0.68|
|[[:human_genes:O:OR8U8|OR8U8]]|2.00|0.68|
|[[:human_genes:R:RAD23B|RAD23B]]|2.00|0.50|
|[[:human_genes:N:NPIPB3|NPIPB3]]|2.02|0.70|
|[[:human_genes:G:GPR45|GPR45]]|2.02|0.50|
|[[:human_genes:C:CDC20|CDC20]]|2.02|0.68|
|[[:human_genes:M:MCM7|MCM7]]|2.04|0.65|
|[[:human_genes:S:SUSD3|SUSD3]]|2.06|0.39|
|[[:human_genes:P:PRKAR2B|PRKAR2B]]|2.11|0.35|
|[[:human_genes:O:OR52E6|OR52E6]]|2.13|0.35|
|[[:human_genes:H:HNRNPA1|HNRNPA1]]|2.14|0.40|
|[[:human_genes:R:RBX1|RBX1]]|2.14|0.59|
|[[:human_genes:T:TMED5|TMED5]]|2.16|0.39|
|[[:human_genes:M:MDM2|MDM2]]|2.22|0.35|
|[[:human_genes:A:APBA1|APBA1]]|2.23|0.35|
|[[:human_genes:T:TMEM61|TMEM61]]|2.25|0.35|
|[[:human_genes:Z:ZNF781|ZNF781]]|2.25|0.35|
|[[:human_genes:C:CD52|CD52]]|2.29|0.35|
|[[:human_genes:T:TSPYL1|TSPYL1]]|2.31|0.39|
|[[:human_genes:N:NUP88|NUP88]]|2.33|0.50|
|[[:human_genes:N:NACA2|NACA2]]|2.35|0.28|
|[[:human_genes:P:POLR2J2|POLR2J2]]|2.38|0.65|
|[[:human_genes:R:RPS28|RPS28]]|2.52|0.62|
|[[:human_genes:S:SIRPG|SIRPG]]|2.54|0.17|
|[[:human_genes:N:NPAP1|NPAP1]]|2.69|0.17|
|[[:human_genes:D:DNM2|DNM2]]|2.77|0.65|
|[[:human_genes:C:CLSPN|CLSPN]]|2.83|0.28|
|[[:human_genes:P:POLR2J|POLR2J]]|3.14|0.35|
</modal>


<modal id="modal_screen_similarity" size="lg" title="Correlated Screens">
No correlation data above threshold. (correlation > 0.05)
</modal>


<modal id="modal_go_sensitive" size="lg" title="Top 30 sensitive GO terms">No GO term hits below threshold. (FDR <0.05)</modal>
<modal id="modal_go_resistant" size="lg" title="Top 30 resistant GO terms">
^GO Term^Fold Change^Genes^
|structural constituent of nuclear pore|75.36|NPAP1,NUP88,NUP214|
|RNA export from nucleus|35.89|NPAP1,NUP88,HNRNPA1,THOC2,NUP214|
|nuclear export|22.28|NPAP1,NUP88,HNRNPA1,THOC2,NUP214|
|RNA transport|19.60|NPAP1,NUP88,HNRNPA1,THOC2,NUP214|
|establishment of RNA localization|19.32|NPAP1,NUP88,HNRNPA1,THOC2,NUP214|
|RNA localization|16.85|NPAP1,NUP88,HNRNPA1,THOC2,NUP214|
</modal>