CCCP 1μM R00 exp11 [The Human Chemical-Genetic Interaction Map Project]

This page is read only. You can view the source, but not change it. Ask your administrator if you think this is wrong.
====== CCCP 1μM R00 exp11 ======
==== Mechanism of Action ====
Mitochondrial proton gradient uncoupler, disrupts ATP synthesis
  * **<color #00a2e8>Class / Subclass 1:</color>** Organelle Function / Mitochondrial Inhibitor




==== Technical Notes ====
<accordion collapsed='true'>
<panel title='Compound References' collapsed='true'>
    * **<color #00a2e8>PubChem Name:</color>** %%(3-Chlorophenyl)hydrazonomalononitrile%%
    * **<color #00a2e8>Synonyms:</color>** Carbonyl cyanide 3-chlorophenylhydrazone; Carbonyl Cyanide m-Chlorophenylhydrazone; Carbonyl cyanide 3-chlorophenylhydrazone;Carbonyl Cyanide m-Chlorophenylhydrazone
    * **<color #00a2e8>CAS #:</color>** 555-60-2
    * **<color #00a2e8>PubChem CID:</color>** [[https://pubchem.ncbi.nlm.nih.gov/compound/2603|2603]]
    * **<color #00a2e8>IUPAC:</color>** %%2-[(3-chlorophenyl)hydrazinylidene]propanedinitrile%%
    * **<color #00a2e8>INCHI Name:</color>** InChI=1S/C9H5ClN4/c10-7-2-1-3-8(4-7)13-14-9(5-11)6-12/h1-4,13H
    * **<color #00a2e8>INCHI Key:</color>** UGTJLJZQQFGTJD-UHFFFAOYSA-N
    * **<color #00a2e8>Molecular Weight:</color>** 204.61
    * **<color #00a2e8>Canonical SMILES:</color>** C1=CC(=CC(=C1)Cl)NN=C(C#N)C#N
    * **<color #00a2e8>Isomeric SMILES:</color>** N/A
    * **<color #00a2e8>Molecular Formula:</color>** C9H5ClN4
{{:chemogenomics:structures:chem-0006.svg?nolink}}
</panel>


<panel title='Compound Supplier' collapsed='true'>
    * **<color #00a2e8>Supplier Name:</color>** Sigma-Aldrich
    * **<color #00a2e8>Catalog #:</color>** C2759
    * **<color #00a2e8>Lot #:</color>** MKBT2015V
</panel>


<panel title='Compound Characterization' collapsed='true'>
    * **<color #00a2e8>HRMS (ESI-TOF) m/z:</color>** [M-H]- Calcd for C9H5NClN4 203.0130; found 202.9946
</panel>


<panel title='Dose Response Curve' collapsed='true'>
    * **<color #00a2e8>Platform ID:</color>** CCCP
    * **<color #00a2e8>Min:</color>** -13.9463; **<color #00a2e8>Max:</color>** 78.4067
{{:chemogenomics:dose_response:dr_259.png?nolink&500 |}}
\\ 
\\ 
\\ 
\\ 
|< 300px 100px 200px >|
^ IC   ^ Concentration (µM) ^
| IC10  |N/A    |
| IC20  |3.0761    |
| IC30  |4.2919    |
| IC40  |5.6392    |
| IC50  |7.2449    |
| IC60  |N/A    |
| IC70  |N/A    |
| IC80  |N/A    |
| IC90  |N/A    |
\\ 
</panel>
</accordion>
==== Screen Summary ====
    * **<color #00a2e8>Round</color>**: 00
    * **<color #00a2e8>Dose</color>**: 1µM
    * **<color #00a2e8>Days of incubation</color>**: 8
    * **<color #00a2e8>Doublings</color>**: 5.5
    * **<color #00a2e8>Numbers of reads</color>**: 12187984


==== Screen Results ====


^Sensitive/Resistant hits (FDR<0.05)^CRANKS^Score Plot^Top 30 Genes^Screen Similarity^Top 30 Sensitive GO terms^Top 30 Resistant GO terms^
|0/2|<color #e85500>[[https://files.tyerslab.com/files/public/chemogenomics/cranks/CCCP_1uM_Round-0_exp11.txt|Scores]]</color>|<button type="primary" size="sm" modal="ScorePlot">View</button>|<button type="primary" size="sm" modal="modal_hits">View</button>|<button type="primary" size="sm" modal="modal_screen_similarity">View</button>|<button type="default" size="sm" modal="modal_go_sensitive">View</button>|<button type="primary" size="sm" modal="modal_go_resistant">View</button>|
<modal id='ScorePlot' size='lg' title='CCCP 1μM R00 exp11'>
{{:chemogenomics:cranks_plots:exp11.png?nolink}}
</modal>


<modal id="modal_hits" size="sm" title="Top 30 S/R Genes">
^Gene^CRANKS Score^FDR^
|[[:human_genes:K:KIAA0391|KIAA0391]]|-3.15|0.13|
|[[:human_genes:O:ORC3|ORC3]]|-2.54|0.28|
|[[:human_genes:P:PTRHD1|PTRHD1]]|-2.51|0.13|
|[[:human_genes:K:KIAA1432|KIAA1432]]|-2.46|0.13|
|[[:human_genes:A:ARL1|ARL1]]|-2.44|0.13|
|[[:human_genes:L:LGALS14|LGALS14]]|-2.35|0.18|
|[[:human_genes:C:CEP57|CEP57]]|-2.25|0.34|
|[[:human_genes:B:BLOC1S4|BLOC1S4]]|-2.20|0.30|
|[[:human_genes:C:CHCHD1|CHCHD1]]|-2.18|0.30|
|[[:human_genes:N:NCAPG2|NCAPG2]]|-2.18|0.48|
|[[:human_genes:S:SOGA1|SOGA1]]|-2.15|0.32|
|[[:human_genes:D:DKC1|DKC1]]|-2.07|0.63|
|[[:human_genes:Z:ZBTB48|ZBTB48]]|-2.07|0.42|
|[[:human_genes:Z:ZNF732|ZNF732]]|-2.04|0.48|
|[[:human_genes:C:CDIPT|CDIPT]]|-2.03|0.50|
|[[:human_genes:T:THOC5|THOC5]]|-2.00|0.48|
|[[:human_genes:B:BOD1|BOD1]]|-1.99|0.48|
|[[:human_genes:D:DNTTIP1|DNTTIP1]]|-1.99|0.48|
|[[:human_genes:P:PIP5K1C|PIP5K1C]]|-1.98|0.48|
|[[:human_genes:L:LSM11|LSM11]]|-1.96|0.50|
|[[:human_genes:F:FAM9B|FAM9B]]|-1.96|0.52|
|[[:human_genes:F:FAM50A|FAM50A]]|-1.96|0.65|
|[[:human_genes:C:CHMP1A|CHMP1A]]|-1.96|0.50|
|[[:human_genes:M:MED25|MED25]]|-1.94|0.50|
|[[:human_genes:T:TRIAP1|TRIAP1]]|-1.94|0.50|
|[[:human_genes:A:AWAT1|AWAT1]]|-1.93|0.48|
|[[:human_genes:E:ENO1|ENO1]]|-1.92|0.63|
|[[:human_genes:A:ALG13|ALG13]]|-1.92|0.48|
|[[:human_genes:G:GDPD4|GDPD4]]|-1.92|0.50|
|[[:human_genes:G:GPBP1|GPBP1]]|-1.92|0.48|
|[[:human_genes:D:DENND4A|DENND4A]]|2.23|0.17|
|[[:human_genes:R:RPS9|RPS9]]|2.23|0.21|
|[[:human_genes:S:SLC25A25|SLC25A25]]|2.27|0.12|
|[[:human_genes:L:LRR1|LRR1]]|2.27|0.22|
|[[:human_genes:W:WDR43|WDR43]]|2.31|0.30|
|[[:human_genes:V:VWDE|VWDE]]|2.31|0.14|
|[[:human_genes:W:WTAP|WTAP]]|2.32|0.18|
|[[:human_genes:A:AZIN1|AZIN1]]|2.32|0.10|
|[[:human_genes:R:RAD21|RAD21]]|2.33|0.21|
|[[:human_genes:S:SF3A2|SF3A2]]|2.34|0.14|
|[[:human_genes:O:ORC1|ORC1]]|2.35|0.17|
|[[:human_genes:I:IVNS1ABP|IVNS1ABP]]|2.35|0.10|
|[[:human_genes:C:C18orf32|C18orf32]]|2.41|0.51|
|[[:human_genes:I:ISY1-RAB43|ISY1-RAB43]]|2.43|0.23|
|[[:human_genes:N:NPIPB3|NPIPB3]]|2.44|0.35|
|[[:human_genes:R:RPL12|RPL12]]|2.45|0.22|
|[[:human_genes:U:UBL3|UBL3]]|2.46|0.10|
|[[:human_genes:A:ANKH|ANKH]]|2.48|0.05|
|[[:human_genes:P:PRPF4B|PRPF4B]]|2.52|0.05|
|[[:human_genes:P:POLA2|POLA2]]|2.53|0.21|
|[[:human_genes:S:SEC13|SEC13]]|2.56|0.12|
|[[:human_genes:S:SLC25A33|SLC25A33]]|2.58|0.05|
|[[:human_genes:P:PSMA1|PSMA1]]|2.58|0.21|
|[[:human_genes:T:TRAPPC2L|TRAPPC2L]]|2.60|0.05|
|[[:human_genes:C:COX7A2L|COX7A2L]]|2.79|0.03|
|[[:human_genes:I:IFT74|IFT74]]|2.82|0.10|
|[[:human_genes:A:AAAS|AAAS]]|2.83|0.05|
|[[:human_genes:P:PSMB4|PSMB4]]|2.86|0.05|
|[[:human_genes:P:PSMD1|PSMD1]]|3.14|0.16|
|[[:human_genes:W:WEE1|WEE1]]|3.72|0.03|
</modal>


<modal id="modal_screen_similarity" size="lg" title="Correlated Screens">
^Screen^Correlation^Plot^
|[[:results:exp12|Chloramphenicol 2μM R00 exp12]]|0.075|<button type="primary" size="small" modal="1">View</button>|
|[[:results:exp16|DABN 2μM R00 exp16]]|0.063|<button type="primary" size="small" modal="2">View</button>|
|[[:results:exp14|Cycloheximide 0.02μM R00 exp14]]|0.06|<button type="primary" size="small" modal="3">View</button>|
</modal>


<modal id="1" size="lg" title="CCCP 1μM R00 exp11  vs  Chloramphenicol 2μM R00 exp12">
{{:chemogenomics:comparison_plots:exp11_vs_exp12.png?nolink |}}
</modal>

<modal id="2" size="lg" title="CCCP 1μM R00 exp11  vs  DABN 2μM R00 exp16">
{{:chemogenomics:comparison_plots:exp11_vs_exp16.png?nolink |}}
</modal>

<modal id="3" size="lg" title="CCCP 1μM R00 exp11  vs  Cycloheximide 0.02μM R00 exp14">
{{:chemogenomics:comparison_plots:exp11_vs_exp14.png?nolink |}}
</modal>



<modal id="modal_go_sensitive" size="lg" title="Top 30 sensitive GO terms">No GO term hits below threshold. (FDR <0.05)</modal>
<modal id="modal_go_resistant" size="lg" title="Top 30 resistant GO terms">
^GO Term^Fold Change^Genes^
|nucleobase-containing compound transport|16.10|AAAS,SLC25A33,SEC13,ANKH,SLC25A25,TPR|
</modal>