Dimethyl-Sulfoxide 1pc R03 exp120 [The Human Chemical-Genetic Interaction Map Project]

This page is read only. You can view the source, but not change it. Ask your administrator if you think this is wrong.
====== Dimethyl-Sulfoxide 1pc R03 exp120 ======
==== Mechanism of Action ====
N/A
  * **<color #00a2e8>Class / Subclass 1:</color>** Chemogenomic Negative Control / Solvent




==== Technical Notes ====
<accordion collapsed='true'>
<panel title='Compound References' collapsed='true'>
    * **<color #00a2e8>PubChem Name:</color>** %%Dimethyl sulfoxide%%
    * **<color #00a2e8>Synonyms:</color>** N/A
    * **<color #00a2e8>CAS #:</color>** 67-68-5
    * **<color #00a2e8>PubChem CID:</color>** [[https://pubchem.ncbi.nlm.nih.gov/compound/679|679]]
    * **<color #00a2e8>IUPAC:</color>** %%methylsulfinylmethane%%
    * **<color #00a2e8>INCHI Name:</color>** InChI=1S/C2H6OS/c1-4(2)3/h1-2H3
    * **<color #00a2e8>INCHI Key:</color>** IAZDPXIOMUYVGZ-UHFFFAOYSA-N
    * **<color #00a2e8>Molecular Weight:</color>** 78.14
    * **<color #00a2e8>Canonical SMILES:</color>** CS(=O)C
    * **<color #00a2e8>Isomeric SMILES:</color>** N/A
    * **<color #00a2e8>Molecular Formula:</color>** C2H6OS
{{:chemogenomics:structures:chem-0074.svg?nolink}}
</panel>


<panel title='Compound Supplier' collapsed='true'>
    * **<color #00a2e8>Supplier Name:</color>** Corning
    * **<color #00a2e8>Catalog #:</color>** 25-950-CQC
    * **<color #00a2e8>Lot #:</color>** N/A
</panel>


<panel title='Compound Characterization' collapsed='true'>
    * **<color #00a2e8>HRMS (ESI-TOF) m/z:</color>** (M+Na)+ Calcd for C2H6OS 101.00316; found 101.00155
</panel>


<panel title='Dose Response Curve'>
Dose response curve not available.
</panel>


</accordion>
==== Screen Summary ====
    * **<color #00a2e8>Round</color>**: 03
    * **<color #00a2e8>Dose</color>**: 1%
    * **<color #00a2e8>Days of incubation</color>**: 8
    * **<color #00a2e8>Doublings</color>**: 4.1
    * **<color #00a2e8>Numbers of reads</color>**: 10652331


==== Screen Results ====


^Sensitive/Resistant hits (FDR<0.05)^CRANKS^Score Plot^Top 30 Genes^Screen Similarity^Top 30 Sensitive GO terms^Top 30 Resistant GO terms^
|0/7|<color #e85500>[[https://files.tyerslab.com/files/public/chemogenomics/cranks/Dimethyl-Sulfoxide_1pc_Round-3_exp120.txt|Scores]]</color>|<button type="primary" size="sm" modal="ScorePlot">View</button>|<button type="primary" size="sm" modal="modal_hits">View</button>|<button type="primary" size="sm" modal="modal_screen_similarity">View</button>|<button type="default" size="sm" modal="modal_go_sensitive">View</button>|<button type="default" size="sm" modal="modal_go_resistant">View</button>|
<modal id='ScorePlot' size='lg' title='Dimethyl-Sulfoxide 1pc R03 exp120'>
{{:chemogenomics:cranks_plots:exp120.png?nolink}}
</modal>


<modal id="modal_hits" size="sm" title="Top 30 S/R Genes">
^Gene^CRANKS Score^FDR^
|[[:human_genes:S:SPI1|SPI1]]|-2.89|0.08|
|[[:human_genes:C:CHPF2|CHPF2]]|-2.71|0.18|
|[[:human_genes:X:XPOT|XPOT]]|-2.65|0.08|
|[[:human_genes:T:TCF4|TCF4]]|-2.62|0.23|
|[[:human_genes:C:C2orf78|C2orf78]]|-2.46|0.15|
|[[:human_genes:I:IRF4|IRF4]]|-2.41|0.24|
|[[:human_genes:F:FPGS|FPGS]]|-2.29|0.56|
|[[:human_genes:C:CALCR|CALCR]]|-2.25|0.24|
|[[:human_genes:U:UBE3A|UBE3A]]|-2.17|0.33|
|[[:human_genes:S:SORL1|SORL1]]|-2.14|0.35|
|[[:human_genes:U:UBE2L3|UBE2L3]]|-2.10|0.38|
|[[:human_genes:B:BCL2|BCL2]]|-2.09|0.38|
|[[:human_genes:D:DHDDS|DHDDS]]|-2.08|0.74|
|[[:human_genes:O:OR4P4|OR4P4]]|-2.05|0.55|
|[[:human_genes:D:DNAJC3|DNAJC3]]|-2.03|0.49|
|[[:human_genes:G:GATSL3|GATSL3]]|-2.03|0.55|
|[[:human_genes:D:DNAJC27|DNAJC27]]|-2.02|0.55|
|[[:human_genes:T:TOR1B|TOR1B]]|-2.01|0.55|
|[[:human_genes:G:GNA13|GNA13]]|-1.99|0.55|
|[[:human_genes:T:TRIP10|TRIP10]]|-1.99|0.56|
|[[:human_genes:E:EEFSEC|EEFSEC]]|-1.96|0.63|
|[[:human_genes:C:CHKA|CHKA]]|-1.94|0.55|
|[[:human_genes:S:SBSN|SBSN]]|-1.93|0.67|
|[[:human_genes:F:FAIM2|FAIM2]]|-1.93|0.55|
|[[:human_genes:C:COPE|COPE]]|-1.93|0.78|
|[[:human_genes:H:HOXA6|HOXA6]]|-1.92|0.55|
|[[:human_genes:G:GTF2H5|GTF2H5]]|-1.91|0.55|
|[[:human_genes:P:PRKAR1A|PRKAR1A]]|-1.90|0.55|
|[[:human_genes:K:KPTN|KPTN]]|-1.90|0.73|
|[[:human_genes:G:GALNT6|GALNT6]]|-1.88|0.73|
|[[:human_genes:R:RFX7|RFX7]]|2.05|0.27|
|[[:human_genes:D:DVL3|DVL3]]|2.07|0.28|
|[[:human_genes:P:PLXDC1|PLXDC1]]|2.07|0.28|
|[[:human_genes:T:TM2D3|TM2D3]]|2.08|0.25|
|[[:human_genes:E:ELF1|ELF1]]|2.09|0.25|
|[[:human_genes:L:LGALS3BP|LGALS3BP]]|2.09|0.25|
|[[:human_genes:S:SIRT6|SIRT6]]|2.09|0.34|
|[[:human_genes:M:MTBP|MTBP]]|2.10|0.25|
|[[:human_genes:A:ACSL4|ACSL4]]|2.10|0.25|
|[[:human_genes:Z:ZNF773|ZNF773]]|2.11|0.28|
|[[:human_genes:M:MEP1A|MEP1A]]|2.13|0.25|
|[[:human_genes:F:FAM50A|FAM50A]]|2.17|0.57|
|[[:human_genes:T:TTC36|TTC36]]|2.18|0.27|
|[[:human_genes:C:CCDC79|CCDC79]]|2.21|0.28|
|[[:human_genes:C:CAMKK2|CAMKK2]]|2.21|0.21|
|[[:human_genes:E:EIF3E|EIF3E]]|2.22|0.35|
|[[:human_genes:H:HMGN2|HMGN2]]|2.23|0.28|
|[[:human_genes:F:FAM58A|FAM58A]]|2.25|0.19|
|[[:human_genes:P:POLD3|POLD3]]|2.35|0.60|
|[[:human_genes:K:KLF16|KLF16]]|2.43|0.25|
|[[:human_genes:U:UPF2|UPF2]]|2.44|0.34|
|[[:human_genes:M:MAPKAP1|MAPKAP1]]|2.59|0.07|
|[[:human_genes:C:CDK12|CDK12]]|2.66|0.23|
|[[:human_genes:T:TNPO1|TNPO1]]|2.70|0.04|
|[[:human_genes:T:TOX4|TOX4]]|2.73|0.04|
|[[:human_genes:P:PRR14L|PRR14L]]|2.74|0.04|
|[[:human_genes:C:CEP57|CEP57]]|2.80|0.04|
|[[:human_genes:S:SPOP|SPOP]]|3.12|<0.01|
|[[:human_genes:M:MEMO1|MEMO1]]|3.34|<0.01|
|[[:human_genes:S:SART3|SART3]]|3.52|0.04|
</modal>


<modal id="modal_screen_similarity" size="lg" title="Correlated Screens">
^Screen^Correlation^Plot^
|[[:results:exp365|I-BRD9 4μM R07 exp365]]|0.061|<button type="primary" size="small" modal="1">View</button>|
</modal>


<modal id="1" size="lg" title="Dimethyl-Sulfoxide 1pc R03 exp120  vs  I-BRD9 4μM R07 exp365">
{{:chemogenomics:comparison_plots:exp120_vs_exp365.png?nolink |}}
</modal>



<modal id="modal_go_sensitive" size="lg" title="Top 30 sensitive GO terms">No GO term hits below threshold. (FDR <0.05)</modal>
<modal id="modal_go_resistant" size="lg" title="Top 30 resistant GO terms">No GO term hits below threshold. (FDR <0.05)</modal>