Metformin 40μM R03 exp132 [The Human Chemical-Genetic Interaction Map Project]

This page is read only. You can view the source, but not change it. Ask your administrator if you think this is wrong.
====== Metformin 40μM R03 exp132 ======
==== Mechanism of Action ====
Inhibits mitochondrial respiratory chain complex I, indirectly activates AMPK
  * **<color #00a2e8>Class / Subclass 1:</color>** Organelle Function / Mitochondrial Inhibitor
  * **<color #00a2e8>Class / Subclass 2:</color>** Signal Transduction / Kinase Activator



==== Technical Notes ====
<accordion collapsed='true'>
<panel title='Compound References' collapsed='true'>
    * **<color #00a2e8>PubChem Name:</color>** %%Metformin hydrochloride%%
    * **<color #00a2e8>Synonyms:</color>** 1,1-Dimethylbiguanide hydrochloride
    * **<color #00a2e8>CAS #:</color>** 1115-70-4
    * **<color #00a2e8>PubChem CID:</color>** [[https://pubchem.ncbi.nlm.nih.gov/compound/14219|14219]]
    * **<color #00a2e8>IUPAC:</color>** %%3-(diaminomethylidene)-1,1-dimethylguanidine;hydrochloride%%
    * **<color #00a2e8>INCHI Name:</color>** InChI=1S/C4H11N5.ClH/c1-9(2)4(7)8-3(5)6;/h1-2H3,(H5,5,6,7,8);1H
    * **<color #00a2e8>INCHI Key:</color>** OETHQSJEHLVLGH-UHFFFAOYSA-N
    * **<color #00a2e8>Molecular Weight:</color>** 165.62
    * **<color #00a2e8>Canonical SMILES:</color>** CN(C)C(=N)N=C(N)N.Cl
    * **<color #00a2e8>Isomeric SMILES:</color>** N/A
    * **<color #00a2e8>Molecular Formula:</color>** C4H12ClN5
{{:chemogenomics:structures:chem-0084.svg?nolink}}
</panel>


<panel title='Compound Supplier' collapsed='true'>
    * **<color #00a2e8>Supplier Name:</color>** Sigma-Aldrich
    * **<color #00a2e8>Catalog #:</color>** D150959
    * **<color #00a2e8>Lot #:</color>** BCBF1484V
</panel>


<panel title='Compound Characterization' collapsed='true'>
    * **<color #00a2e8>HRMS (ESI-TOF) m/z:</color>** (M+H)+ Calcd for C4H11N5 130.10872; found 130.10841
</panel>


<panel title='Dose Response Curve' collapsed='true'>
    * **<color #00a2e8>Platform ID:</color>** METFORMINE
    * **<color #00a2e8>Min:</color>** -12.1710; **<color #00a2e8>Max:</color>** 14.1584
{{:chemogenomics:dose_response:dr_92.png?nolink&500 |}}
\\ 
\\ 
\\ 
\\ 
|< 300px 100px 200px >|
^ IC   ^ Concentration (µM) ^
| IC10  |N/A    |
| IC20  |N/A    |
| IC30  |N/A    |
| IC40  |N/A    |
| IC50  |N/A    |
| IC60  |N/A    |
| IC70  |N/A    |
| IC80  |N/A    |
| IC90  |N/A    |
\\ 
</panel>
</accordion>
==== Screen Summary ====
    * **<color #00a2e8>Round</color>**: 03
    * **<color #00a2e8>Dose</color>**: 40µM
    * **<color #00a2e8>Days of incubation</color>**: 8
    * **<color #00a2e8>Doublings</color>**: 7.9
    * **<color #00a2e8>Numbers of reads</color>**: 10584693


==== Screen Results ====


^Sensitive/Resistant hits (FDR<0.05)^CRANKS^Score Plot^Top 30 Genes^Screen Similarity^Top 30 Sensitive GO terms^Top 30 Resistant GO terms^
|0/0|<color #e85500>[[https://files.tyerslab.com/files/public/chemogenomics/cranks/Metformin_40uM_Round-3_exp132.txt|Scores]]</color>|<button type="primary" size="sm" modal="ScorePlot">View</button>|<button type="primary" size="sm" modal="modal_hits">View</button>|<button type="primary" size="sm" modal="modal_screen_similarity">View</button>|<button type="default" size="sm" modal="modal_go_sensitive">View</button>|<button type="default" size="sm" modal="modal_go_resistant">View</button>|
<modal id='ScorePlot' size='lg' title='Metformin 40μM R03 exp132'>
{{:chemogenomics:cranks_plots:exp132.png?nolink}}
</modal>


<modal id="modal_hits" size="sm" title="Top 30 S/R Genes">
^Gene^CRANKS Score^FDR^
|[[:human_genes:C:CDIPT|CDIPT]]|-2.62|0.92|
|[[:human_genes:C:C6orf118|C6orf118]]|-2.51|0.92|
|[[:human_genes:G:GCLC|GCLC]]|-2.43|0.66|
|[[:human_genes:S:SCO2|SCO2]]|-2.30|0.66|
|[[:human_genes:P:PABPC1L|PABPC1L]]|-2.27|0.92|
|[[:human_genes:C:CCNH|CCNH]]|-2.23|0.92|
|[[:human_genes:A:ACSL3|ACSL3]]|-2.15|0.92|
|[[:human_genes:C:CLDN5|CLDN5]]|-2.08|0.92|
|[[:human_genes:C:CORO2B|CORO2B]]|-2.08|0.92|
|[[:human_genes:H:HARS|HARS]]|-2.07|0.92|
|[[:human_genes:D:DHRSX|DHRSX]]|-2.06|0.92|
|[[:human_genes:T:TNRC6A|TNRC6A]]|-1.99|0.92|
|[[:human_genes:U:UBB|UBB]]|-1.99|0.92|
|[[:human_genes:R:RSRC2|RSRC2]]|-1.94|0.92|
|[[:human_genes:M:MAP3K13|MAP3K13]]|-1.88|0.92|
|[[:human_genes:M:MUC15|MUC15]]|-1.86|0.92|
|[[:human_genes:P:PLXDC2|PLXDC2]]|-1.83|0.92|
|[[:human_genes:S:SLC38A4|SLC38A4]]|-1.82|0.92|
|[[:human_genes:G:GPC2|GPC2]]|-1.82|0.92|
|[[:human_genes:R:RUSC1-AS1|RUSC1-AS1]]|-1.81|0.92|
|[[:human_genes:Z:ZBTB11|ZBTB11]]|-1.80|0.92|
|[[:human_genes:D:DPAGT1|DPAGT1]]|-1.79|0.92|
|[[:human_genes:C:CDK11B|CDK11B]]|-1.77|0.92|
|[[:human_genes:G:GFRA4|GFRA4]]|-1.77|0.92|
|[[:human_genes:K:KIF25|KIF25]]|-1.77|0.92|
|[[:human_genes:I:INPP5K|INPP5K]]|-1.76|0.92|
|[[:human_genes:R:RFK|RFK]]|-1.76|0.92|
|[[:human_genes:M:MMP12|MMP12]]|-1.75|0.92|
|[[:human_genes:Z:ZNF259|ZNF259]]|-1.75|0.92|
|[[:human_genes:N:NRG2|NRG2]]|-1.75|0.92|
|[[:human_genes:O:OR51E1|OR51E1]]|1.88|0.74|
|[[:human_genes:A:AFF1|AFF1]]|1.88|0.78|
|[[:human_genes:M:MYH4|MYH4]]|1.88|0.74|
|[[:human_genes:R:RPL18|RPL18]]|1.89|0.86|
|[[:human_genes:S:STIP1|STIP1]]|1.89|0.74|
|[[:human_genes:E:EFCAB4B|EFCAB4B]]|1.89|0.74|
|[[:human_genes:C:CFDP1|CFDP1]]|1.90|0.74|
|[[:human_genes:U:USF2|USF2]]|1.90|0.74|
|[[:human_genes:T:TRAPPC1|TRAPPC1]]|1.93|0.74|
|[[:human_genes:C:C11orf68|C11orf68]]|1.95|0.74|
|[[:human_genes:R:RBBP8|RBBP8]]|1.96|0.74|
|[[:human_genes:S:SGPL1|SGPL1]]|1.96|0.74|
|[[:human_genes:A:ABHD12B|ABHD12B]]|1.98|0.74|
|[[:human_genes:S:SBNO1|SBNO1]]|1.99|0.74|
|[[:human_genes:G:GIF|GIF]]|2.00|0.74|
|[[:human_genes:A:ALKBH2|ALKBH2]]|2.02|0.74|
|[[:human_genes:T:TBC1D3I|TBC1D3I]]|2.06|0.81|
|[[:human_genes:T:TBC1D3E|TBC1D3E]]|2.06|0.81|
|[[:human_genes:T:TBC1D3K|TBC1D3K]]|2.06|0.81|
|[[:human_genes:T:TBC1D3L|TBC1D3L]]|2.06|0.81|
|[[:human_genes:S:SLC36A1|SLC36A1]]|2.09|0.74|
|[[:human_genes:S:SLC13A2|SLC13A2]]|2.17|0.74|
|[[:human_genes:Z:ZNF781|ZNF781]]|2.20|0.74|
|[[:human_genes:S:SHFM1|SHFM1]]|2.22|0.74|
|[[:human_genes:T:TCTN2|TCTN2]]|2.25|0.74|
|[[:human_genes:Z:ZNF681|ZNF681]]|2.31|0.74|
|[[:human_genes:Z:ZC3H13|ZC3H13]]|2.32|0.74|
|[[:human_genes:T:TMEM106C|TMEM106C]]|2.34|0.51|
|[[:human_genes:U:UBA1|UBA1]]|2.50|0.51|
|[[:human_genes:F:FAM72C|FAM72C]]|3.21|0.74|
</modal>


<modal id="modal_screen_similarity" size="lg" title="Correlated Screens">
^Screen^Correlation^Plot^
|[[:results:exp142|OICR-9429 10μM R03 exp142]]|0.056|<button type="primary" size="small" modal="1">View</button>|
|[[:results:exp537|WNT3A 44ng/ml R08 exp537]]|0.054|<button type="primary" size="small" modal="2">View</button>|
|[[:results:exp101|Nicotinamide 1000μM R03 exp101]]|0.051|<button type="primary" size="small" modal="3">View</button>|
</modal>


<modal id="1" size="lg" title="Metformin 40μM R03 exp132  vs  OICR-9429 10μM R03 exp142">
{{:chemogenomics:comparison_plots:exp132_vs_exp142.png?nolink |}}
</modal>

<modal id="2" size="lg" title="Metformin 40μM R03 exp132  vs  WNT3A 44ng/ml R08 exp537">
{{:chemogenomics:comparison_plots:exp132_vs_exp537.png?nolink |}}
</modal>

<modal id="3" size="lg" title="Metformin 40μM R03 exp132  vs  Nicotinamide 1000μM R03 exp101">
{{:chemogenomics:comparison_plots:exp101_vs_exp132.png?nolink |}}
</modal>



<modal id="modal_go_sensitive" size="lg" title="Top 30 sensitive GO terms">No GO term hits below threshold. (FDR <0.05)</modal>
<modal id="modal_go_resistant" size="lg" title="Top 30 resistant GO terms">No GO term hits below threshold. (FDR <0.05)</modal>