MKC9989 10μM R03 exp133 [The Human Chemical-Genetic Interaction Map Project]

This page is read only. You can view the source, but not change it. Ask your administrator if you think this is wrong.
====== MKC9989 10μM R03 exp133 ======
==== Mechanism of Action ====
Inhibits IRE1, prevents ER unfolded protein response
  * **<color #00a2e8>Class / Subclass 1:</color>** Proteostasis / Unfolded Protein Response Inhibitor
  * **<color #00a2e8>Class / Subclass 2:</color>** Signal Transduction / Kinase Inhibitor



==== Technical Notes ====
<accordion collapsed='true'>
<panel title='Compound References' collapsed='true'>
    * **<color #00a2e8>PubChem Name:</color>** %%7-Hydroxy-6-methoxy-3-[2-(2-methoxyethoxy)ethyl]-4-methyl-2-oxochromene-8-carbaldehyde%%
    * **<color #00a2e8>Synonyms:</color>** N/A
    * **<color #00a2e8>CAS #:</color>** 1338934-20-5
    * **<color #00a2e8>PubChem CID:</color>** [[https://pubchem.ncbi.nlm.nih.gov/compound/89542001|89542001]]
    * **<color #00a2e8>IUPAC:</color>** %%7-hydroxy-6-methoxy-3-[2-(2-methoxyethoxy)ethyl]-4-methyl-2-oxochromene-8-carbaldehyde%%
    * **<color #00a2e8>INCHI Name:</color>** InChI=1S/C17H20O7/c1-10-11(4-5-23-7-6-21-2)17(20)24-16-12(10)8-14(22-3)15(19)13(16)9-18/h8-9,19H,4-7H2,1-3H3
    * **<color #00a2e8>INCHI Key:</color>** QSVDQIXSUDHAOF-UHFFFAOYSA-N
    * **<color #00a2e8>Molecular Weight:</color>** 336.3
    * **<color #00a2e8>Canonical SMILES:</color>** CC1=C(C(=O)OC2=C(C(=C(C=C12)OC)O)C=O)CCOCCOC
    * **<color #00a2e8>Isomeric SMILES:</color>** N/A
    * **<color #00a2e8>Molecular Formula:</color>** C17H20O7
{{:chemogenomics:structures:chem-0085.svg?nolink}}
</panel>


<panel title='Compound Supplier' collapsed='true'>
    * **<color #00a2e8>Supplier Name:</color>** Med Chem Express
    * **<color #00a2e8>Catalog #:</color>** HY-12399
    * **<color #00a2e8>Lot #:</color>** N/A
</panel>


<panel title='Compound Characterization' collapsed='true'>
    * **<color #00a2e8>HRMS (ESI-TOF) m/z:</color>** (M+H)+ Calcd for C17H20O7 337.12818; found 337.12666
</panel>


<panel title='Dose Response Curve' collapsed='true'>
    * **<color #00a2e8>Platform ID:</color>** MKC4500-B-03
    * **<color #00a2e8>Min:</color>** -6.3858; **<color #00a2e8>Max:</color>** 13.1219
{{:chemogenomics:dose_response:dr_93.png?nolink&500 |}}
\\ 
\\ 
\\ 
\\ 
|< 300px 100px 200px >|
^ IC   ^ Concentration (µM) ^
| IC10  |N/A    |
| IC20  |N/A    |
| IC30  |N/A    |
| IC40  |N/A    |
| IC50  |N/A    |
| IC60  |N/A    |
| IC70  |N/A    |
| IC80  |N/A    |
| IC90  |N/A    |
\\ 
</panel>
</accordion>
==== Screen Summary ====
    * **<color #00a2e8>Round</color>**: 03
    * **<color #00a2e8>Dose</color>**: 10µM
    * **<color #00a2e8>Days of incubation</color>**: 8
    * **<color #00a2e8>Doublings</color>**: 7.4
    * **<color #00a2e8>Numbers of reads</color>**: 11690289


==== Screen Results ====


^Sensitive/Resistant hits (FDR<0.05)^CRANKS^Score Plot^Top 30 Genes^Screen Similarity^Top 30 Sensitive GO terms^Top 30 Resistant GO terms^
|0/0|<color #e85500>[[https://files.tyerslab.com/files/public/chemogenomics/cranks/MKC9989_10uM_Round-3_exp133.txt|Scores]]</color>|<button type="primary" size="sm" modal="ScorePlot">View</button>|<button type="primary" size="sm" modal="modal_hits">View</button>|<button type="primary" size="sm" modal="modal_screen_similarity">View</button>|<button type="primary" size="sm" modal="modal_go_sensitive">View</button>|<button type="default" size="sm" modal="modal_go_resistant">View</button>|
<modal id='ScorePlot' size='lg' title='MKC9989 10μM R03 exp133'>
{{:chemogenomics:cranks_plots:exp133.png?nolink}}
</modal>


<modal id="modal_hits" size="sm" title="Top 30 S/R Genes">
^Gene^CRANKS Score^FDR^
|[[:human_genes:G:GCLC|GCLC]]|-2.78|0.07|
|[[:human_genes:G:GCLM|GCLM]]|-2.76|0.06|
|[[:human_genes:G:GSS|GSS]]|-2.69|0.06|
|[[:human_genes:G:GSTM5|GSTM5]]|-2.51|0.22|
|[[:human_genes:T:TRIM7|TRIM7]]|-2.40|0.31|
|[[:human_genes:S:SEPSECS|SEPSECS]]|-2.33|0.49|
|[[:human_genes:S:SARS|SARS]]|-2.24|0.83|
|[[:human_genes:L:LRP8|LRP8]]|-2.23|0.31|
|[[:human_genes:N:NUP93|NUP93]]|-2.23|0.63|
|[[:human_genes:R:RPL36A-HNRNPH2|RPL36A-HNRNPH2]]|-2.19|0.83|
|[[:human_genes:N:NDUFS5|NDUFS5]]|-2.17|0.63|
|[[:human_genes:G:GFM2|GFM2]]|-2.16|0.49|
|[[:human_genes:N:NUPR1|NUPR1]]|-2.16|0.49|
|[[:human_genes:K:KDSR|KDSR]]|-2.15|0.42|
|[[:human_genes:C:CNIH2|CNIH2]]|-2.11|0.52|
|[[:human_genes:E:ENO1|ENO1]]|-2.09|0.63|
|[[:human_genes:E:ELOVL1|ELOVL1]]|-2.08|0.49|
|[[:human_genes:P:POLI|POLI]]|-2.07|0.81|
|[[:human_genes:U:UROS|UROS]]|-2.03|0.49|
|[[:human_genes:D:DOK5|DOK5]]|-2.01|0.63|
|[[:human_genes:S:SLC25A26|SLC25A26]]|-1.99|0.63|
|[[:human_genes:O:OR56A4|OR56A4]]|-1.99|0.52|
|[[:human_genes:P:PCDHB12|PCDHB12]]|-1.98|0.52|
|[[:human_genes:R:RENBP|RENBP]]|-1.93|0.63|
|[[:human_genes:F:FES|FES]]|-1.91|0.63|
|[[:human_genes:T:TMEM126B|TMEM126B]]|-1.91|0.63|
|[[:human_genes:W:WWC3|WWC3]]|-1.90|0.63|
|[[:human_genes:S:SPR|SPR]]|-1.89|0.63|
|[[:human_genes:R:RPE|RPE]]|-1.88|0.64|
|[[:human_genes:T:TMEM150C|TMEM150C]]|-1.88|0.63|
|[[:human_genes:X:XAB2|XAB2]]|1.93|0.82|
|[[:human_genes:M:MCM7|MCM7]]|1.93|0.68|
|[[:human_genes:C:CALU|CALU]]|1.94|0.62|
|[[:human_genes:A:ADH1A|ADH1A]]|1.94|0.62|
|[[:human_genes:M:MAU2|MAU2]]|1.95|0.71|
|[[:human_genes:C:COPZ1|COPZ1]]|1.95|0.66|
|[[:human_genes:F:FZD6|FZD6]]|1.95|0.62|
|[[:human_genes:N:NOM1|NOM1]]|1.95|0.64|
|[[:human_genes:E:EXOSC5|EXOSC5]]|1.98|0.62|
|[[:human_genes:Z:ZFP14|ZFP14]]|1.99|0.62|
|[[:human_genes:T:TRAF3IP3|TRAF3IP3]]|2.00|0.62|
|[[:human_genes:O:OR51Q1|OR51Q1]]|2.00|0.64|
|[[:human_genes:T:TCEAL2|TCEAL2]]|2.01|0.62|
|[[:human_genes:A:AFP|AFP]]|2.04|0.62|
|[[:human_genes:F:FAM109B|FAM109B]]|2.07|0.64|
|[[:human_genes:T:TFRC|TFRC]]|2.09|0.80|
|[[:human_genes:U:USP11|USP11]]|2.09|0.62|
|[[:human_genes:B:BIRC5|BIRC5]]|2.11|0.66|
|[[:human_genes:E:EIF3J|EIF3J]]|2.11|0.66|
|[[:human_genes:R:RPL38|RPL38]]|2.13|0.64|
|[[:human_genes:M:MED19|MED19]]|2.13|0.64|
|[[:human_genes:N:NFS1|NFS1]]|2.14|0.66|
|[[:human_genes:N:NEGR1|NEGR1]]|2.23|0.62|
|[[:human_genes:P:PES1|PES1]]|2.25|0.64|
|[[:human_genes:G:GOT1|GOT1]]|2.27|0.38|
|[[:human_genes:M:MMP16|MMP16]]|2.27|0.38|
|[[:human_genes:C:CORO6|CORO6]]|2.47|0.38|
|[[:human_genes:R:RBM7|RBM7]]|2.58|0.38|
|[[:human_genes:S:SART1|SART1]]|2.84|0.66|
|[[:human_genes:P:POLA1|POLA1]]|3.00|0.62|
</modal>


<modal id="modal_screen_similarity" size="lg" title="Correlated Screens">
^Screen^Correlation^Plot^
|[[:results:exp230|Epigallocatechin gallate 20μM R05 exp230]]|0.059|<button type="primary" size="small" modal="1">View</button>|
|[[:results:exp281|Disulfiram 4.3μM R06 exp281]]|0.054|<button type="primary" size="small" modal="2">View</button>|
</modal>


<modal id="1" size="lg" title="Epigallocatechin gallate 20μM R05 exp230  vs  MKC9989 10μM R03 exp133">
{{:chemogenomics:comparison_plots:exp133_vs_exp230.png?nolink |}}
</modal>

<modal id="2" size="lg" title="Disulfiram 4.3μM R06 exp281  vs  MKC9989 10μM R03 exp133">
{{:chemogenomics:comparison_plots:exp133_vs_exp281.png?nolink |}}
</modal>



<modal id="modal_go_sensitive" size="lg" title="Top 30 sensitive GO terms">
^GO Term^Fold Change^Genes^
|nonribosomal peptide biosynthetic process|126.88|GCLC,GCLM,GSS|
|acid-amino acid ligase activity|84.59|GCLC,GCLM,GSS|
|glutathione metabolic process|45.55|GCLC,GCLM,GSS,GSTM5|
</modal>
<modal id="modal_go_resistant" size="lg" title="Top 30 resistant GO terms">No GO term hits below threshold. (FDR <0.05)</modal>