Phenformin 20μM R03 exp143 [The Human Chemical-Genetic Interaction Map Project]

This page is read only. You can view the source, but not change it. Ask your administrator if you think this is wrong.
====== Phenformin 20μM R03 exp143 ======
==== Mechanism of Action ====
Inhibits mitochondrial respiratory chain complex I, indirectly activates AMPK
  * **<color #00a2e8>Class / Subclass 1:</color>** Organelle Function / Mitochondrial Inhibitor
  * **<color #00a2e8>Class / Subclass 2:</color>** Metabolism / Metabolic Enzyme Activator



==== Technical Notes ====
<accordion collapsed='true'>
<panel title='Compound References' collapsed='true'>
    * **<color #00a2e8>PubChem Name:</color>** %%Phenformin hydrochloride%%
    * **<color #00a2e8>Synonyms:</color>** Phenethylbiguanide hydrochloride
    * **<color #00a2e8>CAS #:</color>** 834-28-6
    * **<color #00a2e8>PubChem CID:</color>** [[https://pubchem.ncbi.nlm.nih.gov/compound/13266|13266]]
    * **<color #00a2e8>IUPAC:</color>** %%1-(diaminomethylidene)-2-(2-phenylethyl)guanidine;hydrochloride%%
    * **<color #00a2e8>INCHI Name:</color>** InChI=1S/C10H15N5.ClH/c11-9(12)15-10(13)14-7-6-8-4-2-1-3-5-8;/h1-5H,6-7H2,(H6,11,12,13,14,15);1H
    * **<color #00a2e8>INCHI Key:</color>** YSUCWSWKRIOILX-UHFFFAOYSA-N
    * **<color #00a2e8>Molecular Weight:</color>** 241.72
    * **<color #00a2e8>Canonical SMILES:</color>** C1=CC=C(C=C1)CCN=C(N)N=C(N)N.Cl
    * **<color #00a2e8>Isomeric SMILES:</color>** N/A
    * **<color #00a2e8>Molecular Formula:</color>** C10H16ClN5
{{:chemogenomics:structures:chem-0094.svg?nolink}}
</panel>


<panel title='Compound Supplier' collapsed='true'>
    * **<color #00a2e8>Supplier Name:</color>** Sigma-Aldrich (Supelco)
    * **<color #00a2e8>Catalog #:</color>** P7045
    * **<color #00a2e8>Lot #:</color>** MKBV9127V
</panel>


<panel title='Compound Characterization' collapsed='true'>
    * **<color #00a2e8>HRMS (ESI-TOF) m/z:</color>** (M+H)+ Calcd for C10H15N5 208.14493; found 208.14677
</panel>


<panel title='Dose Response Curve' collapsed='true'>
    * **<color #00a2e8>Platform ID:</color>** PHENFORMINE
    * **<color #00a2e8>Min:</color>** -0.7796; **<color #00a2e8>Max:</color>** 41.1406
{{:chemogenomics:dose_response:dr_109.png?nolink&500 |}}
\\ 
\\ 
\\ 
\\ 
|< 300px 100px 200px >|
^ IC   ^ Concentration (µM) ^
| IC10  |N/A    |
| IC20  |4.1494    |
| IC30  |21.8108    |
| IC40  |85.0051    |
| IC50  |N/A    |
| IC60  |N/A    |
| IC70  |N/A    |
| IC80  |N/A    |
| IC90  |N/A    |
\\ 
</panel>
</accordion>
==== Screen Summary ====
    * **<color #00a2e8>Round</color>**: 03
    * **<color #00a2e8>Dose</color>**: 20µM
    * **<color #00a2e8>Days of incubation</color>**: 8
    * **<color #00a2e8>Doublings</color>**: 4.0
    * **<color #00a2e8>Numbers of reads</color>**: 11383615


==== Screen Results ====


^Sensitive/Resistant hits (FDR<0.05)^CRANKS^Score Plot^Top 30 Genes^Screen Similarity^Top 30 Sensitive GO terms^Top 30 Resistant GO terms^
|2/4|<color #e85500>[[https://files.tyerslab.com/files/public/chemogenomics/cranks/Phenformin_20uM_Round-3_exp143.txt|Scores]]</color>|<button type="primary" size="sm" modal="ScorePlot">View</button>|<button type="primary" size="sm" modal="modal_hits">View</button>|<button type="primary" size="sm" modal="modal_screen_similarity">View</button>|<button type="default" size="sm" modal="modal_go_sensitive">View</button>|<button type="default" size="sm" modal="modal_go_resistant">View</button>|
<modal id='ScorePlot' size='lg' title='Phenformin 20μM R03 exp143'>
{{:chemogenomics:cranks_plots:exp143.png?nolink}}
</modal>


<modal id="modal_hits" size="sm" title="Top 30 S/R Genes">
^Gene^CRANKS Score^FDR^
|[[:human_genes:G:GOT1|GOT1]]|-4.58|<0.01|
|[[:human_genes:A:AGPAT6|AGPAT6]]|-2.95|0.01|
|[[:human_genes:G:GCLC|GCLC]]|-2.75|0.08|
|[[:human_genes:P:PGP|PGP]]|-2.70|0.08|
|[[:human_genes:P:PAFAH1B1|PAFAH1B1]]|-2.59|0.41|
|[[:human_genes:S:SUCLG1|SUCLG1]]|-2.46|0.32|
|[[:human_genes:E:ENO1|ENO1]]|-2.40|0.32|
|[[:human_genes:S:SNCB|SNCB]]|-2.34|0.32|
|[[:human_genes:R:RBM19|RBM19]]|-2.30|0.32|
|[[:human_genes:P:PMPCA|PMPCA]]|-2.30|0.42|
|[[:human_genes:P:PLEKHA2|PLEKHA2]]|-2.27|0.38|
|[[:human_genes:X:XPO1|XPO1]]|-2.24|0.84|
|[[:human_genes:P:PIPOX|PIPOX]]|-2.16|0.32|
|[[:human_genes:H:HNRNPA0|HNRNPA0]]|-2.14|0.32|
|[[:human_genes:G:GCDH|GCDH]]|-2.12|0.32|
|[[:human_genes:C:C7orf55-LUC7L2|C7orf55-LUC7L2]]|-2.09|0.41|
|[[:human_genes:C:C6orf132|C6orf132]]|-2.08|0.45|
|[[:human_genes:P:PFDN6|PFDN6]]|-2.07|0.41|
|[[:human_genes:N:NMT1|NMT1]]|-2.06|0.41|
|[[:human_genes:T:TRAPPC3|TRAPPC3]]|-2.06|0.37|
|[[:human_genes:L:LRRC4C|LRRC4C]]|-2.05|0.41|
|[[:human_genes:U:USHBP1|USHBP1]]|-2.04|0.37|
|[[:human_genes:A:APOA2|APOA2]]|-2.04|0.37|
|[[:human_genes:C:CFL1|CFL1]]|-2.04|0.82|
|[[:human_genes:E:ECHS1|ECHS1]]|-2.04|0.37|
|[[:human_genes:L:LETM2|LETM2]]|-2.03|0.37|
|[[:human_genes:A:ADK|ADK]]|-2.02|0.37|
|[[:human_genes:N:NAE1|NAE1]]|-2.01|0.42|
|[[:human_genes:Z:ZNF470|ZNF470]]|-1.99|0.42|
|[[:human_genes:P:PURG|PURG]]|-1.99|0.42|
|[[:human_genes:M:METTL18|METTL18]]|2.01|0.28|
|[[:human_genes:G:GARS|GARS]]|2.03|0.68|
|[[:human_genes:C:CYC1|CYC1]]|2.03|0.26|
|[[:human_genes:E:ERBB2IP|ERBB2IP]]|2.04|0.26|
|[[:human_genes:S:SMC2|SMC2]]|2.11|0.45|
|[[:human_genes:T:TMSB15B|TMSB15B]]|2.12|0.54|
|[[:human_genes:S:SBDS|SBDS]]|2.13|0.20|
|[[:human_genes:O:OR10H4|OR10H4]]|2.15|0.20|
|[[:human_genes:I:ITPK1|ITPK1]]|2.18|0.19|
|[[:human_genes:P:PCYT1A|PCYT1A]]|2.19|0.19|
|[[:human_genes:U:UBA5|UBA5]]|2.19|0.25|
|[[:human_genes:E:ENTPD6|ENTPD6]]|2.19|0.25|
|[[:human_genes:Z:ZNF804A|ZNF804A]]|2.21|0.19|
|[[:human_genes:F:FAM50A|FAM50A]]|2.21|0.50|
|[[:human_genes:S:SMC1A|SMC1A]]|2.26|0.60|
|[[:human_genes:N:NEK1|NEK1]]|2.27|0.20|
|[[:human_genes:T:TMEM261|TMEM261]]|2.27|0.17|
|[[:human_genes:N:NDUFAF7|NDUFAF7]]|2.28|0.17|
|[[:human_genes:K:KDSR|KDSR]]|2.28|0.17|
|[[:human_genes:C:C1orf27|C1orf27]]|2.29|0.17|
|[[:human_genes:C:CD79A|CD79A]]|2.33|0.25|
|[[:human_genes:S:SPC24|SPC24]]|2.35|0.40|
|[[:human_genes:U:UQCC1|UQCC1]]|2.35|0.19|
|[[:human_genes:P:PRPS1|PRPS1]]|2.37|0.23|
|[[:human_genes:M:MTCH2|MTCH2]]|2.43|0.20|
|[[:human_genes:H:HSD17B12|HSD17B12]]|2.59|0.17|
|[[:human_genes:P:PI4KB|PI4KB]]|2.68|0.03|
|[[:human_genes:M:MDH1|MDH1]]|3.21|<0.01|
|[[:human_genes:A:ACSL4|ACSL4]]|3.34|<0.01|
|[[:human_genes:S:SLC25A51|SLC25A51]]|4.98|<0.01|
</modal>


<modal id="modal_screen_similarity" size="lg" title="Correlated Screens">
^Screen^Correlation^Plot^
|[[:results:exp241|QNZ 0.01μM R05 exp241]]|0.079|<button type="primary" size="small" modal="1">View</button>|
|[[:results:exp212|Phenformin 20μM R05 exp212]]|0.061|<button type="primary" size="small" modal="2">View</button>|
|[[:results:exp431|Rotenone 0.07μM R08 exp431]]|0.057|<button type="primary" size="small" modal="3">View</button>|
|[[:results:exp439|QNZ 0.01μM R08 exp439]]|0.056|<button type="primary" size="small" modal="4">View</button>|
|[[:results:exp380|NMS-873 0.07μM R07 exp380]]|0.051|<button type="primary" size="small" modal="5">View</button>|
</modal>


<modal id="1" size="lg" title="Phenformin 20μM R03 exp143  vs  QNZ 0.01μM R05 exp241">
{{:chemogenomics:comparison_plots:exp143_vs_exp241.png?nolink |}}
</modal>

<modal id="2" size="lg" title="Phenformin 20μM R03 exp143  vs  Phenformin 20μM R05 exp212">
{{:chemogenomics:comparison_plots:exp143_vs_exp212.png?nolink |}}
</modal>

<modal id="3" size="lg" title="Phenformin 20μM R03 exp143  vs  Rotenone 0.07μM R08 exp431">
{{:chemogenomics:comparison_plots:exp143_vs_exp431.png?nolink |}}
</modal>

<modal id="4" size="lg" title="Phenformin 20μM R03 exp143  vs  QNZ 0.01μM R08 exp439">
{{:chemogenomics:comparison_plots:exp143_vs_exp439.png?nolink |}}
</modal>

<modal id="5" size="lg" title="NMS-873 0.07μM R07 exp380  vs  Phenformin 20μM R03 exp143">
{{:chemogenomics:comparison_plots:exp143_vs_exp380.png?nolink |}}
</modal>



<modal id="modal_go_sensitive" size="lg" title="Top 30 sensitive GO terms">No GO term hits below threshold. (FDR <0.05)</modal>
<modal id="modal_go_resistant" size="lg" title="Top 30 resistant GO terms">No GO term hits below threshold. (FDR <0.05)</modal>