PFI-3 10μM R03 exp144 [The Human Chemical-Genetic Interaction Map Project]

This page is read only. You can view the source, but not change it. Ask your administrator if you think this is wrong.
====== PFI-3 10μM R03 exp144 ======
==== Mechanism of Action ====
Inhibits SMARCA2/4 and PB1 bromodomain proteins, components of SNF/SWI chromatin remodelling complex
  * **<color #00a2e8>Class / Subclass 1:</color>** Gene Regulation / Epigenetic Inhibitor




==== Technical Notes ====
<accordion collapsed='true'>
<panel title='Compound References' collapsed='true'>
    * **<color #00a2e8>PubChem Name:</color>** %%(E)-1-(2-Hydroxyphenyl)-3-[(1R,4R)-5-pyridin-2-yl-2,5-diazabicyclo[2.2.1]heptan-2-yl]prop-2-en-1-one%%
    * **<color #00a2e8>Synonyms:</color>** N/A
    * **<color #00a2e8>CAS #:</color>** 1819363-80-8
    * **<color #00a2e8>PubChem CID:</color>** [[https://pubchem.ncbi.nlm.nih.gov/compound/78243717|78243717]]
    * **<color #00a2e8>IUPAC:</color>** %%(E)-1-(2-hydroxyphenyl)-3-[(1R,4R)-5-pyridin-2-yl-2,5-diazabicyclo[2.2.1]heptan-2-yl]prop-2-en-1-one%%
    * **<color #00a2e8>INCHI Name:</color>** InChI=1S/C19H19N3O2/c23-17-6-2-1-5-16(17)18(24)8-10-21-12-15-11-14(21)13-22(15)19-7-3-4-9-20-19/h1-10,14-15,23H,11-13H2/b10-8+/t14-,15-/m1/s1
    * **<color #00a2e8>INCHI Key:</color>** INAICWLVUAKEPB-QSTFCLMHSA-N
    * **<color #00a2e8>Molecular Weight:</color>** 321.4
    * **<color #00a2e8>Canonical SMILES:</color>** C1C2CN(C1CN2C3=CC=CC=N3)C=CC(=O)C4=CC=CC=C4O
    * **<color #00a2e8>Isomeric SMILES:</color>** C1[C@@H]2CN([C@H]1CN2C3=CC=CC=N3)/C=C/C(=O)C4=CC=CC=C4O
    * **<color #00a2e8>Molecular Formula:</color>** C19H19N3O2
{{:chemogenomics:structures:chem-0095.svg?nolink}}
</panel>


<panel title='Compound Supplier' collapsed='true'>
    * **<color #00a2e8>Supplier Name:</color>** Structural Genomics Consortium
    * **<color #00a2e8>Catalog #:</color>** N/A
    * **<color #00a2e8>Lot #:</color>** N/A
</panel>


<panel title='Compound Characterization' collapsed='true'>
    * **<color #00a2e8>HRMS (ESI-TOF) m/z:</color>** [M+H]+ Calcd for C19H20N3O2 322.1550; found 322.1532
</panel>


<panel title='Dose Response Curve' collapsed='true'>
    * **<color #00a2e8>Platform ID:</color>** PFI3
    * **<color #00a2e8>Min:</color>** -3.6038; **<color #00a2e8>Max:</color>** 30.9773
{{:chemogenomics:dose_response:dr_108.png?nolink&500 |}}
\\ 
\\ 
\\ 
\\ 
|< 300px 100px 200px >|
^ IC   ^ Concentration (µM) ^
| IC10  |N/A    |
| IC20  |N/A    |
| IC30  |N/A    |
| IC40  |N/A    |
| IC50  |N/A    |
| IC60  |N/A    |
| IC70  |N/A    |
| IC80  |N/A    |
| IC90  |N/A    |
\\ 
</panel>
</accordion>
==== Screen Summary ====
    * **<color #00a2e8>Round</color>**: 03
    * **<color #00a2e8>Dose</color>**: 10µM
    * **<color #00a2e8>Days of incubation</color>**: 8
    * **<color #00a2e8>Doublings</color>**: 7.6
    * **<color #00a2e8>Numbers of reads</color>**: 8729480


==== Screen Results ====


^Sensitive/Resistant hits (FDR<0.05)^CRANKS^Score Plot^Top 30 Genes^Screen Similarity^Top 30 Sensitive GO terms^Top 30 Resistant GO terms^
|0/0|<color #e85500>[[https://files.tyerslab.com/files/public/chemogenomics/cranks/PFI-3_10uM_Round-3_exp144.txt|Scores]]</color>|<button type="primary" size="sm" modal="ScorePlot">View</button>|<button type="primary" size="sm" modal="modal_hits">View</button>|<button type="primary" size="sm" modal="modal_screen_similarity">View</button>|<button type="default" size="sm" modal="modal_go_sensitive">View</button>|<button type="default" size="sm" modal="modal_go_resistant">View</button>|
<modal id='ScorePlot' size='lg' title='PFI-3 10μM R03 exp144'>
{{:chemogenomics:cranks_plots:exp144.png?nolink}}
</modal>


<modal id="modal_hits" size="sm" title="Top 30 S/R Genes">
^Gene^CRANKS Score^FDR^
|[[:human_genes:D:DPAGT1|DPAGT1]]|-2.78|0.78|
|[[:human_genes:V:VPS25|VPS25]]|-2.48|0.84|
|[[:human_genes:C:CRKL|CRKL]]|-2.30|0.78|
|[[:human_genes:X:XPO5|XPO5]]|-2.23|0.84|
|[[:human_genes:D:DSN1|DSN1]]|-2.20|0.81|
|[[:human_genes:U:UHRF1|UHRF1]]|-2.19|0.81|
|[[:human_genes:T:THAP6|THAP6]]|-2.17|0.78|
|[[:human_genes:U:UBE2N|UBE2N]]|-2.14|0.78|
|[[:human_genes:G:GCLM|GCLM]]|-2.03|0.84|
|[[:human_genes:C:CCDC30|CCDC30]]|-2.01|0.84|
|[[:human_genes:P:PCDHB11|PCDHB11]]|-1.97|0.84|
|[[:human_genes:H:HARS|HARS]]|-1.97|0.95|
|[[:human_genes:W:WARS|WARS]]|-1.94|0.85|
|[[:human_genes:P:PPP2R3C|PPP2R3C]]|-1.93|0.84|
|[[:human_genes:Q:QARS|QARS]]|-1.92|0.93|
|[[:human_genes:T:TEX35|TEX35]]|-1.92|0.84|
|[[:human_genes:N:NRCAM|NRCAM]]|-1.92|0.84|
|[[:human_genes:I:ITGA5|ITGA5]]|-1.92|0.84|
|[[:human_genes:A:ANXA13|ANXA13]]|-1.89|0.84|
|[[:human_genes:A:ARHGAP35|ARHGAP35]]|-1.89|0.84|
|[[:human_genes:P:POT1|POT1]]|-1.89|0.85|
|[[:human_genes:F:FUBP3|FUBP3]]|-1.89|0.84|
|[[:human_genes:C:CERS2|CERS2]]|-1.85|0.84|
|[[:human_genes:M:MLC1|MLC1]]|-1.85|0.84|
|[[:human_genes:D:DKC1|DKC1]]|-1.85|0.95|
|[[:human_genes:N:NEUROD4|NEUROD4]]|-1.84|0.84|
|[[:human_genes:C:CHIT1|CHIT1]]|-1.83|0.84|
|[[:human_genes:G:GUCY1A2|GUCY1A2]]|-1.82|0.84|
|[[:human_genes:S:SLC24A2|SLC24A2]]|-1.82|0.84|
|[[:human_genes:I:ID3|ID3]]|-1.82|0.84|
|[[:human_genes:C:COPB2|COPB2]]|1.89|0.78|
|[[:human_genes:I:ISY1-RAB43|ISY1-RAB43]]|1.92|0.78|
|[[:human_genes:K:KDR|KDR]]|1.94|0.64|
|[[:human_genes:G:GJA10|GJA10]]|1.96|0.64|
|[[:human_genes:M:MTERF|MTERF]]|1.97|0.64|
|[[:human_genes:T:TXLNG|TXLNG]]|2.01|0.64|
|[[:human_genes:T:TRAPPC12|TRAPPC12]]|2.01|0.45|
|[[:human_genes:L:LRRN3|LRRN3]]|2.04|0.44|
|[[:human_genes:T:TRAPPC8|TRAPPC8]]|2.08|0.41|
|[[:human_genes:A:ATP6V1D|ATP6V1D]]|2.09|0.49|
|[[:human_genes:O:OR10G3|OR10G3]]|2.11|0.47|
|[[:human_genes:P:PRPF4|PRPF4]]|2.12|0.78|
|[[:human_genes:P:POP1|POP1]]|2.15|0.44|
|[[:human_genes:M:MIOX|MIOX]]|2.15|0.40|
|[[:human_genes:C:CLRN1|CLRN1]]|2.16|0.64|
|[[:human_genes:P:PLA2G7|PLA2G7]]|2.19|0.42|
|[[:human_genes:I:IFNGR2|IFNGR2]]|2.23|0.40|
|[[:human_genes:E:ESPL1|ESPL1]]|2.25|0.75|
|[[:human_genes:C:CDK12|CDK12]]|2.26|0.64|
|[[:human_genes:C:CPZ|CPZ]]|2.26|0.40|
|[[:human_genes:R:RPL8|RPL8]]|2.28|0.68|
|[[:human_genes:F:FAM150A|FAM150A]]|2.29|0.40|
|[[:human_genes:P:PCNA|PCNA]]|2.33|0.75|
|[[:human_genes:A:ASH1L|ASH1L]]|2.35|0.40|
|[[:human_genes:Z:ZNF207|ZNF207]]|2.38|0.40|
|[[:human_genes:N:NFATC2IP|NFATC2IP]]|2.40|0.40|
|[[:human_genes:T:TOP1MT|TOP1MT]]|2.42|0.40|
|[[:human_genes:C:CKAP5|CKAP5]]|2.43|0.64|
|[[:human_genes:G:G6PC3|G6PC3]]|2.47|0.40|
|[[:human_genes:P:PRPF8|PRPF8]]|2.56|0.40|
</modal>


<modal id="modal_screen_similarity" size="lg" title="Correlated Screens">
^Screen^Correlation^Plot^
|[[:results:exp421|VHL-ligand-1 20μM R07 exp421]]|0.055|<button type="primary" size="small" modal="1">View</button>|
|[[:results:exp121|Golgicide-A 2μM R03 exp121]]|0.051|<button type="primary" size="small" modal="2">View</button>|
</modal>


<modal id="1" size="lg" title="PFI-3 10μM R03 exp144  vs  VHL-ligand-1 20μM R07 exp421">
{{:chemogenomics:comparison_plots:exp144_vs_exp421.png?nolink |}}
</modal>

<modal id="2" size="lg" title="Golgicide-A 2μM R03 exp121  vs  PFI-3 10μM R03 exp144">
{{:chemogenomics:comparison_plots:exp121_vs_exp144.png?nolink |}}
</modal>



<modal id="modal_go_sensitive" size="lg" title="Top 30 sensitive GO terms">No GO term hits below threshold. (FDR <0.05)</modal>
<modal id="modal_go_resistant" size="lg" title="Top 30 resistant GO terms">No GO term hits below threshold. (FDR <0.05)</modal>