NN-Diethyl-meta-toluamide 100μM R05 exp237 [The Human Chemical-Genetic Interaction Map Project]

This page is read only. You can view the source, but not change it. Ask your administrator if you think this is wrong.
====== NN-Diethyl-meta-toluamide 100μM R05 exp237 ======
==== Mechanism of Action ====
Insect repellent
  * **<color #00a2e8>Class / Subclass 1:</color>** Environmental Stresses / Environmental Contaminant




==== Technical Notes ====
<accordion collapsed='true'>
<panel title='Compound References' collapsed='true'>
    * **<color #00a2e8>PubChem Name:</color>** %%N,N-Diethyl-3-methylbenzamide%%
    * **<color #00a2e8>Synonyms:</color>** DEET; N,N-Diethyl-m-toluamide; DEET;N,N-Diethyl-m-toluamide
    * **<color #00a2e8>CAS #:</color>** 134-62-3
    * **<color #00a2e8>PubChem CID:</color>** [[https://pubchem.ncbi.nlm.nih.gov/compound/4284|4284]]
    * **<color #00a2e8>IUPAC:</color>** %%N,N-diethyl-3-methylbenzamide%%
    * **<color #00a2e8>INCHI Name:</color>** InChI=1S/C12H17NO/c1-4-13(5-2)12(14)11-8-6-7-10(3)9-11/h6-9H,4-5H2,1-3H3
    * **<color #00a2e8>INCHI Key:</color>** MMOXZBCLCQITDF-UHFFFAOYSA-N
    * **<color #00a2e8>Molecular Weight:</color>** 191.27
    * **<color #00a2e8>Canonical SMILES:</color>** CCN(CC)C(=O)C1=CC=CC(=C1)C
    * **<color #00a2e8>Isomeric SMILES:</color>** N/A
    * **<color #00a2e8>Molecular Formula:</color>** C4H13N3
{{:chemogenomics:structures:chem-0142.svg?nolink}}
</panel>


<panel title='Compound Supplier' collapsed='true'>
    * **<color #00a2e8>Supplier Name:</color>** Med Chem Express
    * **<color #00a2e8>Catalog #:</color>** HY-B0978
    * **<color #00a2e8>Lot #:</color>** 17164
</panel>


<panel title='Compound Characterization' collapsed='true'>
    * **<color #00a2e8>HRMS (ESI-TOF) m/z:</color>** (M+H)+ Calcd for C12H17NO 192.13829; found 192.13825
</panel>


<panel title='Dose Response Curve' collapsed='true'>
    * **<color #00a2e8>Platform ID:</color>** DEET
    * **<color #00a2e8>Min:</color>** -7.9357; **<color #00a2e8>Max:</color>** 8.0090
{{:chemogenomics:dose_response:dr_205.png?nolink&500 |}}
\\ 
\\ 
\\ 
\\ 
|< 300px 100px 200px >|
^ IC   ^ Concentration (µM) ^
| IC10  |N/A    |
| IC20  |N/A    |
| IC30  |N/A    |
| IC40  |N/A    |
| IC50  |N/A    |
| IC60  |N/A    |
| IC70  |N/A    |
| IC80  |N/A    |
| IC90  |N/A    |
\\ 
</panel>
</accordion>
==== Screen Summary ====
    * **<color #00a2e8>Round</color>**: 05
    * **<color #00a2e8>Dose</color>**: 100µM
    * **<color #00a2e8>Days of incubation</color>**: 8
    * **<color #00a2e8>Doublings</color>**: 7.2
    * **<color #00a2e8>Numbers of reads</color>**: 19782063


==== Screen Results ====


^Sensitive/Resistant hits (FDR<0.05)^CRANKS^Score Plot^Top 30 Genes^Screen Similarity^Top 30 Sensitive GO terms^Top 30 Resistant GO terms^
|1/1|<color #e85500>[[https://files.tyerslab.com/files/public/chemogenomics/cranks/NN-Diethyl-meta-toluamide_100uM_Round-5_exp237.txt|Scores]]</color>|<button type="primary" size="sm" modal="ScorePlot">View</button>|<button type="primary" size="sm" modal="modal_hits">View</button>|<button type="primary" size="sm" modal="modal_screen_similarity">View</button>|<button type="default" size="sm" modal="modal_go_sensitive">View</button>|<button type="default" size="sm" modal="modal_go_resistant">View</button>|
<modal id='ScorePlot' size='lg' title='NN-Diethyl-meta-toluamide 100μM R05 exp237'>
{{:chemogenomics:cranks_plots:exp237.png?nolink}}
</modal>


<modal id="modal_hits" size="sm" title="Top 30 S/R Genes">
^Gene^CRANKS Score^FDR^
|[[:human_genes:G:GCLC|GCLC]]|-3.64|<0.01|
|[[:human_genes:Q:QRICH1|QRICH1]]|-2.72|0.14|
|[[:human_genes:S:SH3GL3|SH3GL3]]|-2.71|0.11|
|[[:human_genes:S:SNF8|SNF8]]|-2.68|0.11|
|[[:human_genes:P:POLG|POLG]]|-2.40|0.14|
|[[:human_genes:C:CFAP45|CFAP45]]|-2.37|0.58|
|[[:human_genes:R:RSRC2|RSRC2]]|-2.24|0.57|
|[[:human_genes:G:GCLM|GCLM]]|-2.23|0.31|
|[[:human_genes:K:KDSR|KDSR]]|-2.18|0.32|
|[[:human_genes:C:CR1L|CR1L]]|-2.17|0.32|
|[[:human_genes:R:ROCK2|ROCK2]]|-2.15|0.51|
|[[:human_genes:C:CCDC150|CCDC150]]|-2.10|0.43|
|[[:human_genes:Z:ZNF259|ZNF259]]|-2.10|0.51|
|[[:human_genes:M:MSTO1|MSTO1]]|-2.09|0.51|
|[[:human_genes:C:CBL|CBL]]|-2.08|0.51|
|[[:human_genes:C:CDIPT|CDIPT]]|-2.07|0.51|
|[[:human_genes:C:CSF2RB|CSF2RB]]|-2.05|0.51|
|[[:human_genes:S:SZT2|SZT2]]|-2.04|0.51|
|[[:human_genes:Z:ZNF330|ZNF330]]|-2.00|0.51|
|[[:human_genes:G:GPR75-ASB3|GPR75-ASB3]]|-1.98|0.51|
|[[:human_genes:C:CXorf61|CXorf61]]|-1.97|0.51|
|[[:human_genes:N:NFIB|NFIB]]|-1.95|0.51|
|[[:human_genes:S:SMG5|SMG5]]|-1.93|0.85|
|[[:human_genes:M:MRPL15|MRPL15]]|-1.93|0.51|
|[[:human_genes:M:MVB12B|MVB12B]]|-1.92|0.51|
|[[:human_genes:S:SCRIB|SCRIB]]|-1.92|0.51|
|[[:human_genes:G:GEMIN8|GEMIN8]]|-1.92|0.57|
|[[:human_genes:N:NDUFA10|NDUFA10]]|-1.91|0.57|
|[[:human_genes:N:NDUFB3|NDUFB3]]|-1.91|0.51|
|[[:human_genes:S:SPEN|SPEN]]|-1.90|0.51|
|[[:human_genes:P:PRODH|PRODH]]|1.91|0.74|
|[[:human_genes:Z:ZSCAN12|ZSCAN12]]|1.92|0.78|
|[[:human_genes:W:WDR65|WDR65]]|1.92|0.56|
|[[:human_genes:S:SUPT6H|SUPT6H]]|1.93|0.74|
|[[:human_genes:D:DCHS2|DCHS2]]|1.93|0.56|
|[[:human_genes:I:IDE|IDE]]|1.95|0.56|
|[[:human_genes:G:GPR173|GPR173]]|2.01|0.43|
|[[:human_genes:C:C1orf100|C1orf100]]|2.05|0.43|
|[[:human_genes:M:MKRN1|MKRN1]]|2.10|0.41|
|[[:human_genes:A:APC2|APC2]]|2.10|0.41|
|[[:human_genes:C:CHAF1A|CHAF1A]]|2.11|0.63|
|[[:human_genes:C:CREBZF|CREBZF]]|2.14|0.43|
|[[:human_genes:P:POLE2|POLE2]]|2.14|0.74|
|[[:human_genes:N:NUFIP2|NUFIP2]]|2.16|0.37|
|[[:human_genes:E:EXOSC3|EXOSC3]]|2.16|0.43|
|[[:human_genes:N:NDC80|NDC80]]|2.18|0.74|
|[[:human_genes:N:NOP14|NOP14]]|2.18|0.43|
|[[:human_genes:P:PSMA7|PSMA7]]|2.18|0.74|
|[[:human_genes:T:TP53TG3D|TP53TG3D]]|2.18|0.56|
|[[:human_genes:M:MED24|MED24]]|2.19|0.37|
|[[:human_genes:P:PHAX|PHAX]]|2.20|0.43|
|[[:human_genes:G:GAGE2A|GAGE2A]]|2.30|0.76|
|[[:human_genes:D:DNAJC30|DNAJC30]]|2.31|0.37|
|[[:human_genes:P:PSMD14|PSMD14]]|2.32|0.74|
|[[:human_genes:R:RPL23|RPL23]]|2.32|0.74|
|[[:human_genes:G:GID4|GID4]]|2.38|0.28|
|[[:human_genes:L:LRP10|LRP10]]|2.39|0.37|
|[[:human_genes:G:GOLGA8M|GOLGA8M]]|2.56|0.15|
|[[:human_genes:P:PNO1|PNO1]]|2.86|0.37|
|[[:human_genes:A:AAMP|AAMP]]|3.65|0.04|
</modal>


<modal id="modal_screen_similarity" size="lg" title="Correlated Screens">
^Screen^Correlation^Plot^
|[[:results:exp239|PFI-2 4μM R05 exp239]]|0.057|<button type="primary" size="small" modal="1">View</button>|
|[[:results:exp101|Nicotinamide 1000μM R03 exp101]]|0.052|<button type="primary" size="small" modal="2">View</button>|
|[[:results:exp219|A-395N 10μM R05 exp219]]|0.052|<button type="primary" size="small" modal="3">View</button>|
</modal>


<modal id="1" size="lg" title="NN-Diethyl-meta-toluamide 100μM R05 exp237  vs  PFI-2 4μM R05 exp239">
{{:chemogenomics:comparison_plots:exp237_vs_exp239.png?nolink |}}
</modal>

<modal id="2" size="lg" title="NN-Diethyl-meta-toluamide 100μM R05 exp237  vs  Nicotinamide 1000μM R03 exp101">
{{:chemogenomics:comparison_plots:exp101_vs_exp237.png?nolink |}}
</modal>

<modal id="3" size="lg" title="A-395N 10μM R05 exp219  vs  NN-Diethyl-meta-toluamide 100μM R05 exp237">
{{:chemogenomics:comparison_plots:exp219_vs_exp237.png?nolink |}}
</modal>



<modal id="modal_go_sensitive" size="lg" title="Top 30 sensitive GO terms">No GO term hits below threshold. (FDR <0.05)</modal>
<modal id="modal_go_resistant" size="lg" title="Top 30 resistant GO terms">No GO term hits below threshold. (FDR <0.05)</modal>