ABT-702 5μM R06 exp261 [The Human Chemical-Genetic Interaction Map Project]

This page is read only. You can view the source, but not change it. Ask your administrator if you think this is wrong.
====== ABT-702 5μM R06 exp261 ======
==== Mechanism of Action ====
Inhibits adenosine kinase (ADK)
  * **<color #00a2e8>Class / Subclass 1:</color>** Metabolism / Metabolic Enzyme Inhibitor




==== Technical Notes ====
<accordion collapsed='true'>
<panel title='Compound References' collapsed='true'>
    * **<color #00a2e8>PubChem Name:</color>** %%Adenosine Kinase Inhibitor%%
    * **<color #00a2e8>Synonyms:</color>** N/A
    * **<color #00a2e8>CAS #:</color>** 1188890-28-9
    * **<color #00a2e8>PubChem CID:</color>** [[https://pubchem.ncbi.nlm.nih.gov/compound/16760265|16760265]]
    * **<color #00a2e8>IUPAC:</color>** %%5-(3-bromophenyl)-7-(6-morpholin-4-ylpyridin-3-yl)pyrido[2,3-d]pyrimidin-4-amine;dihydrochloride%%
    * **<color #00a2e8>INCHI Name:</color>** InChI=1S/C22H19BrN6O.2ClH/c23-16-3-1-2-14(10-16)17-11-18(28-22-20(17)21(24)26-13-27-22)15-4-5-19(25-12-15)29-6-8-30-9-7-29;;/h1-5,10-13H,6-9H2,(H2,24,26,27,28);2*1H
    * **<color #00a2e8>INCHI Key:</color>** OOXNYFKPOPJIOT-UHFFFAOYSA-N
    * **<color #00a2e8>Molecular Weight:</color>** 536.2
    * **<color #00a2e8>Canonical SMILES:</color>** C1COCCN1C2=NC=C(C=C2)C3=NC4=NC=NC(=C4C(=C3)C5=CC(=CC=C5)Br)N.Cl.Cl
    * **<color #00a2e8>Isomeric SMILES:</color>** N/A
    * **<color #00a2e8>Molecular Formula:</color>** C22H21BrCl2N6O
{{:chemogenomics:structures:chem-0155.svg?nolink}}
</panel>


<panel title='Compound Supplier' collapsed='true'>
    * **<color #00a2e8>Supplier Name:</color>** Tocris Bioscience
    * **<color #00a2e8>Catalog #:</color>** 2372
    * **<color #00a2e8>Lot #:</color>** 1B/195137
</panel>


<panel title='Compound Characterization' collapsed='true'>
    * **<color #00a2e8>HRMS (ESI-TOF) m/z:</color>** (M+H)+ Calcd for C22H19BrN6O 463.08765; found 463.08744
</panel>


<panel title='Dose Response Curve' collapsed='true'>
    * **<color #00a2e8>Platform ID:</color>** ABT-702
    * **<color #00a2e8>Min:</color>** -17.1478; **<color #00a2e8>Max:</color>** 50.6783
{{:chemogenomics:dose_response:dr_281.png?nolink&500 |}}
\\ 
\\ 
\\ 
\\ 
|< 300px 100px 200px >|
^ IC   ^ Concentration (µM) ^
| IC10  |N/A    |
| IC20  |27.2987    |
| IC30  |35.4200    |
| IC40  |43.8496    |
| IC50  |N/A    |
| IC60  |N/A    |
| IC70  |N/A    |
| IC80  |N/A    |
| IC90  |N/A    |
\\ 
</panel>
</accordion>
==== Screen Summary ====
    * **<color #00a2e8>Round</color>**: 06
    * **<color #00a2e8>Dose</color>**: 5µM
    * **<color #00a2e8>Days of incubation</color>**: 8
    * **<color #00a2e8>Doublings</color>**: 7.1
    * **<color #00a2e8>Numbers of reads</color>**: 7794730


==== Screen Results ====


^Sensitive/Resistant hits (FDR<0.05)^CRANKS^Score Plot^Top 30 Genes^Screen Similarity^Top 30 Sensitive GO terms^Top 30 Resistant GO terms^
|1/1|<color #e85500>[[https://files.tyerslab.com/files/public/chemogenomics/cranks/ABT-702_5uM_Round-6_exp261.txt|Scores]]</color>|<button type="primary" size="sm" modal="ScorePlot">View</button>|<button type="primary" size="sm" modal="modal_hits">View</button>|<button type="default" size="sm" modal="modal_screen_similarity">View</button>|<button type="default" size="sm" modal="modal_go_sensitive">View</button>|<button type="default" size="sm" modal="modal_go_resistant">View</button>|
<modal id='ScorePlot' size='lg' title='ABT-702 5μM R06 exp261'>
{{:chemogenomics:cranks_plots:exp261.png?nolink}}
</modal>


<modal id="modal_hits" size="sm" title="Top 30 S/R Genes">
^Gene^CRANKS Score^FDR^
|[[:human_genes:S:SLC5A3|SLC5A3]]|-3.76|<0.01|
|[[:human_genes:M:MARK2|MARK2]]|-2.68|0.06|
|[[:human_genes:K:KRTAP10-11|KRTAP10-11]]|-2.43|0.19|
|[[:human_genes:G:GNG2|GNG2]]|-2.42|0.35|
|[[:human_genes:V:VHL|VHL]]|-2.24|0.36|
|[[:human_genes:A:ALDH18A1|ALDH18A1]]|-2.17|0.60|
|[[:human_genes:N:NTRK1|NTRK1]]|-2.15|0.60|
|[[:human_genes:Z:ZNF433|ZNF433]]|-2.14|0.52|
|[[:human_genes:G:GIGYF2|GIGYF2]]|-2.11|0.82|
|[[:human_genes:P:PKD2L2|PKD2L2]]|-2.11|0.53|
|[[:human_genes:C:CPA5|CPA5]]|-2.08|0.55|
|[[:human_genes:F:FNTB|FNTB]]|-2.04|0.82|
|[[:human_genes:F:FASTKD5|FASTKD5]]|-2.03|0.82|
|[[:human_genes:M:MS4A13|MS4A13]]|-2.02|0.92|
|[[:human_genes:M:MINOS1|MINOS1]]|-2.00|0.63|
|[[:human_genes:R:RBM15|RBM15]]|-1.97|0.67|
|[[:human_genes:C:C21orf91|C21orf91]]|-1.97|0.82|
|[[:human_genes:T:TBC1D19|TBC1D19]]|-1.96|0.67|
|[[:human_genes:F:FXYD5|FXYD5]]|-1.94|0.69|
|[[:human_genes:R:RIF1|RIF1]]|-1.90|0.78|
|[[:human_genes:T:TSPAN12|TSPAN12]]|-1.89|0.78|
|[[:human_genes:E:EMC10|EMC10]]|-1.88|0.82|
|[[:human_genes:S:SWI5|SWI5]]|-1.85|0.82|
|[[:human_genes:S:SDAD1|SDAD1]]|-1.83|0.82|
|[[:human_genes:G:GNB1L|GNB1L]]|-1.82|0.82|
|[[:human_genes:N:NFU1|NFU1]]|-1.82|0.87|
|[[:human_genes:H:HIST1H1T|HIST1H1T]]|-1.82|0.82|
|[[:human_genes:D:DNAJC13|DNAJC13]]|-1.81|0.82|
|[[:human_genes:Z:ZNF708|ZNF708]]|-1.79|0.82|
|[[:human_genes:O:OR8B4|OR8B4]]|-1.79|0.82|
|[[:human_genes:Z:ZNF202|ZNF202]]|1.90|0.75|
|[[:human_genes:L:LEMD3|LEMD3]]|1.90|0.75|
|[[:human_genes:T:TMCO3|TMCO3]]|1.92|0.75|
|[[:human_genes:A:ATG9A|ATG9A]]|1.95|0.75|
|[[:human_genes:C:CLCN6|CLCN6]]|1.95|0.75|
|[[:human_genes:P:POLA2|POLA2]]|1.95|0.84|
|[[:human_genes:S:SDPR|SDPR]]|1.96|0.75|
|[[:human_genes:D:DHX15|DHX15]]|1.97|0.80|
|[[:human_genes:E:ETFDH|ETFDH]]|1.99|0.75|
|[[:human_genes:A:ATP12A|ATP12A]]|1.99|0.75|
|[[:human_genes:S:SIPA1L1|SIPA1L1]]|1.99|0.75|
|[[:human_genes:K:KLLN|KLLN]]|1.99|0.75|
|[[:human_genes:A:AAMP|AAMP]]|1.99|0.75|
|[[:human_genes:H:HSPA8|HSPA8]]|2.00|0.75|
|[[:human_genes:D:DDX52|DDX52]]|2.01|0.75|
|[[:human_genes:P:POLR1B|POLR1B]]|2.03|0.80|
|[[:human_genes:N:NUP133|NUP133]]|2.03|0.75|
|[[:human_genes:R:RAD21|RAD21]]|2.04|0.79|
|[[:human_genes:M:MICU1|MICU1]]|2.10|0.75|
|[[:human_genes:G:GOLGA8H|GOLGA8H]]|2.12|0.80|
|[[:human_genes:P:PSMD12|PSMD12]]|2.15|0.75|
|[[:human_genes:C:CTSV|CTSV]]|2.15|0.75|
|[[:human_genes:D:DARS|DARS]]|2.17|0.75|
|[[:human_genes:A:ARRDC4|ARRDC4]]|2.22|0.69|
|[[:human_genes:S:SMC3|SMC3]]|2.24|0.75|
|[[:human_genes:C:CAMKMT|CAMKMT]]|2.27|0.69|
|[[:human_genes:P:PWP2|PWP2]]|2.41|0.75|
|[[:human_genes:P:PRPF19|PRPF19]]|2.46|0.75|
|[[:human_genes:S:SCAF1|SCAF1]]|2.55|0.79|
|[[:human_genes:P:PSMB4|PSMB4]]|3.78|<0.01|
</modal>


<modal id="modal_screen_similarity" size="lg" title="Correlated Screens">
No correlation data above threshold. (correlation > 0.05)
</modal>


<modal id="modal_go_sensitive" size="lg" title="Top 30 sensitive GO terms">No GO term hits below threshold. (FDR <0.05)</modal>
<modal id="modal_go_resistant" size="lg" title="Top 30 resistant GO terms">No GO term hits below threshold. (FDR <0.05)</modal>