Alda-1 10μM R06 exp262 [The Human Chemical-Genetic Interaction Map Project]

This page is read only. You can view the source, but not change it. Ask your administrator if you think this is wrong.
====== Alda-1 10μM R06 exp262 ======
==== Mechanism of Action ====
Activates mitochondrial aldehyde dehydrogenase (ALDH2), may attenuate ethanol addiction
  * **<color #00a2e8>Class / Subclass 1:</color>** Metabolism / Metabolic Enzyme Activator




==== Technical Notes ====
<accordion collapsed='true'>
<panel title='Compound References' collapsed='true'>
    * **<color #00a2e8>PubChem Name:</color>** %%N-(1,3-Benzodioxol-5-ylmethyl)-2,6-dichlorobenzamide%%
    * **<color #00a2e8>Synonyms:</color>** N/A
    * **<color #00a2e8>CAS #:</color>** 349438-38-6
    * **<color #00a2e8>PubChem CID:</color>** [[https://pubchem.ncbi.nlm.nih.gov/compound/831629|831629]]
    * **<color #00a2e8>IUPAC:</color>** %%N-(1,3-benzodioxol-5-ylmethyl)-2,6-dichlorobenzamide%%
    * **<color #00a2e8>INCHI Name:</color>** InChI=1S/C15H11Cl2NO3/c16-10-2-1-3-11(17)14(10)15(19)18-7-9-4-5-12-13(6-9)21-8-20-12/h1-6H,7-8H2,(H,18,19)
    * **<color #00a2e8>INCHI Key:</color>** NMKJFZCBCIUYHI-UHFFFAOYSA-N
    * **<color #00a2e8>Molecular Weight:</color>** 324.2
    * **<color #00a2e8>Canonical SMILES:</color>** C1OC2=C(O1)C=C(C=C2)CNC(=O)C3=C(C=CC=C3Cl)Cl
    * **<color #00a2e8>Isomeric SMILES:</color>** N/A
    * **<color #00a2e8>Molecular Formula:</color>** C15H11Cl2NO3
{{:chemogenomics:structures:chem-0156.svg?nolink}}
</panel>


<panel title='Compound Supplier' collapsed='true'>
    * **<color #00a2e8>Supplier Name:</color>** Toronto Research Chemicals
    * **<color #00a2e8>Catalog #:</color>** A514590
    * **<color #00a2e8>Lot #:</color>** 1-ARD-48-4
</panel>


<panel title='Compound Characterization' collapsed='true'>
    * **<color #00a2e8>HRMS (ESI-TOF) m/z:</color>** (M+H)+ Calcd for C15H11Cl2NO3 324.01888; found 324.0189
</panel>


<panel title='Dose Response Curve' collapsed='true'>
    * **<color #00a2e8>Platform ID:</color>** Alda1
    * **<color #00a2e8>Min:</color>** -16.4759; **<color #00a2e8>Max:</color>** 23.5071
{{:chemogenomics:dose_response:dr_322.png?nolink&500 |}}
\\ 
\\ 
\\ 
\\ 
|< 300px 100px 200px >|
^ IC   ^ Concentration (µM) ^
| IC10  |N/A    |
| IC20  |N/A    |
| IC30  |N/A    |
| IC40  |N/A    |
| IC50  |N/A    |
| IC60  |N/A    |
| IC70  |N/A    |
| IC80  |N/A    |
| IC90  |N/A    |
\\ 
</panel>
</accordion>
==== Screen Summary ====
    * **<color #00a2e8>Round</color>**: 06
    * **<color #00a2e8>Dose</color>**: 10µM
    * **<color #00a2e8>Days of incubation</color>**: 8
    * **<color #00a2e8>Doublings</color>**: 7.4
    * **<color #00a2e8>Numbers of reads</color>**: 7248085


==== Screen Results ====


^Sensitive/Resistant hits (FDR<0.05)^CRANKS^Score Plot^Top 30 Genes^Screen Similarity^Top 30 Sensitive GO terms^Top 30 Resistant GO terms^
|0/0|<color #e85500>[[https://files.tyerslab.com/files/public/chemogenomics/cranks/Alda-1_10uM_Round-6_exp262.txt|Scores]]</color>|<button type="primary" size="sm" modal="ScorePlot">View</button>|<button type="primary" size="sm" modal="modal_hits">View</button>|<button type="default" size="sm" modal="modal_screen_similarity">View</button>|<button type="default" size="sm" modal="modal_go_sensitive">View</button>|<button type="default" size="sm" modal="modal_go_resistant">View</button>|
<modal id='ScorePlot' size='lg' title='Alda-1 10μM R06 exp262'>
{{:chemogenomics:cranks_plots:exp262.png?nolink}}
</modal>


<modal id="modal_hits" size="sm" title="Top 30 S/R Genes">
^Gene^CRANKS Score^FDR^
|[[:human_genes:U:USP17L17|USP17L17]]|-3.03|0.73|
|[[:human_genes:P:PHYH|PHYH]]|-2.13|0.73|
|[[:human_genes:P:PCYT1A|PCYT1A]]|-2.11|0.73|
|[[:human_genes:C:CTC1|CTC1]]|-2.09|0.73|
|[[:human_genes:N:NEUROD6|NEUROD6]]|-2.08|0.73|
|[[:human_genes:T:TMEM179|TMEM179]]|-2.05|0.73|
|[[:human_genes:R:RBMX2|RBMX2]]|-2.03|0.73|
|[[:human_genes:T:TNFRSF6B|TNFRSF6B]]|-2.02|0.73|
|[[:human_genes:G:GCLC|GCLC]]|-2.00|0.73|
|[[:human_genes:I:IGSF21|IGSF21]]|-1.98|0.73|
|[[:human_genes:H:HIST4H4|HIST4H4]]|-1.98|0.73|
|[[:human_genes:D:DPM2|DPM2]]|-1.97|0.73|
|[[:human_genes:X:XPO5|XPO5]]|-1.97|0.78|
|[[:human_genes:N:NTNG2|NTNG2]]|-1.96|0.73|
|[[:human_genes:T:TIMM10|TIMM10]]|-1.95|0.78|
|[[:human_genes:C:CALB1|CALB1]]|-1.92|0.73|
|[[:human_genes:M:MINOS1|MINOS1]]|-1.90|0.73|
|[[:human_genes:Z:ZNF609|ZNF609]]|-1.90|0.73|
|[[:human_genes:S:SART3|SART3]]|-1.90|0.87|
|[[:human_genes:K:KRTAP12-3|KRTAP12-3]]|-1.89|0.73|
|[[:human_genes:P:POLG|POLG]]|-1.89|0.73|
|[[:human_genes:S:STBD1|STBD1]]|-1.88|0.73|
|[[:human_genes:F:FAM129C|FAM129C]]|-1.86|0.73|
|[[:human_genes:L:LCE1F|LCE1F]]|-1.85|0.73|
|[[:human_genes:R:RELA|RELA]]|-1.84|0.73|
|[[:human_genes:M:MBTPS2|MBTPS2]]|-1.84|0.73|
|[[:human_genes:V:VPS53|VPS53]]|-1.84|0.87|
|[[:human_genes:P:PNPLA1|PNPLA1]]|-1.82|0.73|
|[[:human_genes:Z:ZBTB42|ZBTB42]]|-1.82|0.73|
|[[:human_genes:R:RNASEH2A|RNASEH2A]]|-1.82|0.85|
|[[:human_genes:W:WBSCR22|WBSCR22]]|1.87|0.84|
|[[:human_genes:H:H2AFY|H2AFY]]|1.87|0.68|
|[[:human_genes:A:AGBL5|AGBL5]]|1.88|0.84|
|[[:human_genes:W:WDR46|WDR46]]|1.89|0.84|
|[[:human_genes:G:GMPR|GMPR]]|1.91|0.77|
|[[:human_genes:O:OLFM2|OLFM2]]|1.92|0.56|
|[[:human_genes:W:WDR52|WDR52]]|1.92|0.56|
|[[:human_genes:I:IL1RAP|IL1RAP]]|1.93|0.56|
|[[:human_genes:A:ACE2|ACE2]]|1.93|0.56|
|[[:human_genes:C:C3orf62|C3orf62]]|1.95|0.68|
|[[:human_genes:C:CSTL1|CSTL1]]|1.96|0.56|
|[[:human_genes:L:LYZL1|LYZL1]]|1.96|0.56|
|[[:human_genes:P:POLD2|POLD2]]|1.97|0.84|
|[[:human_genes:N:NOP10|NOP10]]|1.99|0.84|
|[[:human_genes:K:KHSRP|KHSRP]]|1.99|0.56|
|[[:human_genes:B:BRD1|BRD1]]|2.02|0.56|
|[[:human_genes:T:TNPO1|TNPO1]]|2.02|0.56|
|[[:human_genes:C:CYTL1|CYTL1]]|2.05|0.56|
|[[:human_genes:C:CSPG4|CSPG4]]|2.08|0.56|
|[[:human_genes:T:TCP11L1|TCP11L1]]|2.12|0.56|
|[[:human_genes:F:FAM72C|FAM72C]]|2.14|0.84|
|[[:human_genes:C:CCNA2|CCNA2]]|2.18|0.56|
|[[:human_genes:G:GPR98|GPR98]]|2.22|0.56|
|[[:human_genes:O:OR5F1|OR5F1]]|2.26|0.56|
|[[:human_genes:G:GBP5|GBP5]]|2.29|0.56|
|[[:human_genes:R:RNF138|RNF138]]|2.31|0.56|
|[[:human_genes:E:ERCC6|ERCC6]]|2.34|0.56|
|[[:human_genes:R:RPS8|RPS8]]|2.43|0.84|
|[[:human_genes:C:COPB1|COPB1]]|2.53|0.56|
|[[:human_genes:S:SPDL1|SPDL1]]|2.66|0.14|
</modal>


<modal id="modal_screen_similarity" size="lg" title="Correlated Screens">
No correlation data above threshold. (correlation > 0.05)
</modal>


<modal id="modal_go_sensitive" size="lg" title="Top 30 sensitive GO terms">No GO term hits below threshold. (FDR <0.05)</modal>
<modal id="modal_go_resistant" size="lg" title="Top 30 resistant GO terms">No GO term hits below threshold. (FDR <0.05)</modal>