CCT251545 0.2μM R06 exp271 [The Human Chemical-Genetic Interaction Map Project]

This page is read only. You can view the source, but not change it. Ask your administrator if you think this is wrong.
====== CCT251545 0.2μM R06 exp271 ======
==== Mechanism of Action ====
Inhibits CDK8 and CDK19 mediator-associated kinases
  * **<color #00a2e8>Class / Subclass 1:</color>** Gene Regulation / Transcription Inhibitor
  * **<color #00a2e8>Class / Subclass 2:</color>** Signal Transduction / Kinase Inhibitor



==== Technical Notes ====
<accordion collapsed='true'>
<panel title='Compound References' collapsed='true'>
    * **<color #00a2e8>PubChem Name:</color>** %%8-{3-Chloro-5-[4-(1-Methyl-1h-Pyrazol-4-Yl)phenyl]pyridin-4-Yl}-2,8-Diazaspiro[4.5]decan-1-One%%
    * **<color #00a2e8>Synonyms:</color>** N/A
    * **<color #00a2e8>CAS #:</color>** 1661839-45-7
    * **<color #00a2e8>PubChem CID:</color>** [[https://pubchem.ncbi.nlm.nih.gov/compound/77050682|77050682]]
    * **<color #00a2e8>IUPAC:</color>** %%8-[3-chloro-5-[4-(1-methylpyrazol-4-yl)phenyl]pyridin-4-yl]-2,8-diazaspiro[4.5]decan-1-one%%
    * **<color #00a2e8>INCHI Name:</color>** InChI=1S/C23H24ClN5O/c1-28-15-18(12-27-28)16-2-4-17(5-3-16)19-13-25-14-20(24)21(19)29-10-7-23(8-11-29)6-9-26-22(23)30/h2-5,12-15H,6-11H2,1H3,(H,26,30)
    * **<color #00a2e8>INCHI Key:</color>** LBFYQISQYCGDDW-UHFFFAOYSA-N
    * **<color #00a2e8>Molecular Weight:</color>** 421.9
    * **<color #00a2e8>Canonical SMILES:</color>** CN1C=C(C=N1)C2=CC=C(C=C2)C3=CN=CC(=C3N4CCC5(CCNC5=O)CC4)Cl
    * **<color #00a2e8>Isomeric SMILES:</color>** N/A
    * **<color #00a2e8>Molecular Formula:</color>** C23H24ClN5O
{{:chemogenomics:structures:chem-0163.svg?nolink}}
</panel>


<panel title='Compound Supplier' collapsed='true'>
    * **<color #00a2e8>Supplier Name:</color>** Cayman Chemical
    * **<color #00a2e8>Catalog #:</color>** 18761
    * **<color #00a2e8>Lot #:</color>** N/A
</panel>


<panel title='Compound Characterization' collapsed='true'>
    * **<color #00a2e8>HRMS (ESI-TOF) m/z:</color>** (M+H)+ Calcd for C23H24ClN5O 422.17421; found 422.1743
</panel>


<panel title='Dose Response Curve' collapsed='true'>
    * **<color #00a2e8>Platform ID:</color>** CCT251545
    * **<color #00a2e8>Min:</color>** -8.9474; **<color #00a2e8>Max:</color>** 38.9173
{{:chemogenomics:dose_response:dr_377.png?nolink&500 |}}
\\ 
\\ 
\\ 
\\ 
|< 300px 100px 200px >|
^ IC   ^ Concentration (µM) ^
| IC10  |N/A    |
| IC20  |N/A    |
| IC30  |N/A    |
| IC40  |N/A    |
| IC50  |N/A    |
| IC60  |N/A    |
| IC70  |N/A    |
| IC80  |N/A    |
| IC90  |N/A    |
\\ 
</panel>
</accordion>
==== Screen Summary ====
    * **<color #00a2e8>Round</color>**: 06
    * **<color #00a2e8>Dose</color>**: 200nM
    * **<color #00a2e8>Days of incubation</color>**: 8
    * **<color #00a2e8>Doublings</color>**: 6.9
    * **<color #00a2e8>Numbers of reads</color>**: 9191896


==== Screen Results ====


^Sensitive/Resistant hits (FDR<0.05)^CRANKS^Score Plot^Top 30 Genes^Screen Similarity^Top 30 Sensitive GO terms^Top 30 Resistant GO terms^
|1/1|<color #e85500>[[https://files.tyerslab.com/files/public/chemogenomics/cranks/CCT251545_0.2uM_Round-6_exp271.txt|Scores]]</color>|<button type="primary" size="sm" modal="ScorePlot">View</button>|<button type="primary" size="sm" modal="modal_hits">View</button>|<button type="primary" size="sm" modal="modal_screen_similarity">View</button>|<button type="default" size="sm" modal="modal_go_sensitive">View</button>|<button type="default" size="sm" modal="modal_go_resistant">View</button>|
<modal id='ScorePlot' size='lg' title='CCT251545 0.2μM R06 exp271'>
{{:chemogenomics:cranks_plots:exp271.png?nolink}}
</modal>


<modal id="modal_hits" size="sm" title="Top 30 S/R Genes">
^Gene^CRANKS Score^FDR^
|[[:human_genes:R:RHOA|RHOA]]|-3.06|<0.01|
|[[:human_genes:T:TPK1|TPK1]]|-2.84|0.17|
|[[:human_genes:R:RBM7|RBM7]]|-2.77|0.05|
|[[:human_genes:I:IL16|IL16]]|-2.58|0.05|
|[[:human_genes:C:C17orf104|C17orf104]]|-2.58|0.05|
|[[:human_genes:S:SLC5A3|SLC5A3]]|-2.58|0.05|
|[[:human_genes:K:KIAA1432|KIAA1432]]|-2.43|0.19|
|[[:human_genes:R:RBMX2|RBMX2]]|-2.33|0.21|
|[[:human_genes:C:CACNG3|CACNG3]]|-2.30|0.21|
|[[:human_genes:M:MCM9|MCM9]]|-2.30|0.21|
|[[:human_genes:T:TPI1|TPI1]]|-2.25|0.31|
|[[:human_genes:C:CNOT2|CNOT2]]|-2.23|0.21|
|[[:human_genes:A:ARID4B|ARID4B]]|-2.22|0.23|
|[[:human_genes:S:SOD1|SOD1]]|-2.22|0.57|
|[[:human_genes:F:FAAH|FAAH]]|-2.22|0.23|
|[[:human_genes:K:KIF2A|KIF2A]]|-2.21|0.21|
|[[:human_genes:P:PEMT|PEMT]]|-2.19|0.21|
|[[:human_genes:G:GMPPB|GMPPB]]|-2.14|0.61|
|[[:human_genes:Z:ZRSR2|ZRSR2]]|-2.13|0.23|
|[[:human_genes:S:SPCS1|SPCS1]]|-2.11|0.55|
|[[:human_genes:J:JAM3|JAM3]]|-2.10|0.23|
|[[:human_genes:S:SLC5A12|SLC5A12]]|-2.09|0.23|
|[[:human_genes:M:MOK|MOK]]|-2.05|0.35|
|[[:human_genes:S:SLIT3|SLIT3]]|-2.05|0.28|
|[[:human_genes:S:SMC2|SMC2]]|-2.03|0.57|
|[[:human_genes:A:AGPS|AGPS]]|-2.02|0.51|
|[[:human_genes:D:DDX3X|DDX3X]]|-2.01|0.31|
|[[:human_genes:P:PGGT1B|PGGT1B]]|-2.01|0.31|
|[[:human_genes:S:SARS2|SARS2]]|-2.00|0.41|
|[[:human_genes:R:RSRC2|RSRC2]]|-2.00|0.87|
|[[:human_genes:A:ABCA7|ABCA7]]|1.89|0.56|
|[[:human_genes:T:TMEM64|TMEM64]]|1.89|0.67|
|[[:human_genes:N:NKX2-5|NKX2-5]]|1.89|0.56|
|[[:human_genes:C:CD302|CD302]]|1.89|0.56|
|[[:human_genes:S:SSBP1|SSBP1]]|1.90|0.67|
|[[:human_genes:F:FBXL2|FBXL2]]|1.90|0.56|
|[[:human_genes:D:DMC1|DMC1]]|1.91|0.56|
|[[:human_genes:P:PES1|PES1]]|1.94|0.84|
|[[:human_genes:P:PRRT1|PRRT1]]|1.95|0.56|
|[[:human_genes:N:NUP160|NUP160]]|1.96|0.82|
|[[:human_genes:U:UFSP2|UFSP2]]|1.96|0.56|
|[[:human_genes:P:POLA1|POLA1]]|1.98|0.85|
|[[:human_genes:S:SLC35C2|SLC35C2]]|1.99|0.56|
|[[:human_genes:C:CEBPA|CEBPA]]|2.01|0.56|
|[[:human_genes:C:CT45A2|CT45A2]]|2.01|0.56|
|[[:human_genes:S:SPOCD1|SPOCD1]]|2.05|0.56|
|[[:human_genes:S:S100Z|S100Z]]|2.08|0.56|
|[[:human_genes:P:PPP6R3|PPP6R3]]|2.09|0.56|
|[[:human_genes:P:PEX11G|PEX11G]]|2.12|0.56|
|[[:human_genes:P:PTPLAD2|PTPLAD2]]|2.14|0.56|
|[[:human_genes:R:RPL32|RPL32]]|2.18|0.56|
|[[:human_genes:P:PSMB4|PSMB4]]|2.23|0.56|
|[[:human_genes:I:ISY1|ISY1]]|2.27|0.70|
|[[:human_genes:M:MED14|MED14]]|2.29|0.56|
|[[:human_genes:T:THOC2|THOC2]]|2.41|0.67|
|[[:human_genes:S:SIX2|SIX2]]|2.43|0.46|
|[[:human_genes:K:KCNK17|KCNK17]]|2.54|0.39|
|[[:human_genes:C:COPB2|COPB2]]|2.65|0.56|
|[[:human_genes:I:ISY1-RAB43|ISY1-RAB43]]|2.76|0.56|
|[[:human_genes:N:NUP205|NUP205]]|3.43|<0.01|
</modal>


<modal id="modal_screen_similarity" size="lg" title="Correlated Screens">
^Screen^Correlation^Plot^
|[[:results:exp245|UM0011500 5μM R05 exp245]]|0.052|<button type="primary" size="small" modal="1">View</button>|
|[[:results:exp318|ABT-702 5μM R07 exp318]]|0.059|<button type="primary" size="small" modal="2">View</button>|
</modal>


<modal id="1" size="lg" title="CCT251545 0.2μM R06 exp271  vs  UM0011500 5μM R05 exp245">
{{:chemogenomics:comparison_plots:exp245_vs_exp271.png?nolink |}}
</modal>

<modal id="2" size="lg" title="ABT-702 5μM R07 exp318  vs  CCT251545 0.2μM R06 exp271">
{{:chemogenomics:comparison_plots:exp271_vs_exp318.png?nolink |}}
</modal>



<modal id="modal_go_sensitive" size="lg" title="Top 30 sensitive GO terms">No GO term hits below threshold. (FDR <0.05)</modal>
<modal id="modal_go_resistant" size="lg" title="Top 30 resistant GO terms">No GO term hits below threshold. (FDR <0.05)</modal>