CVT-10216 0.1μM R06 exp278 [The Human Chemical-Genetic Interaction Map Project]

This page is read only. You can view the source, but not change it. Ask your administrator if you think this is wrong.
====== CVT-10216 0.1μM R06 exp278 ======
==== Mechanism of Action ====
Inhibits mitochondrial aldehyde dehydrogenase (ALDH2), main enzyme for oxidative alcohol metabolism
  * **<color #00a2e8>Class / Subclass 1:</color>** Metabolism / Metabolic Enzyme Inhibitor




==== Technical Notes ====
<accordion collapsed='true'>
<panel title='Compound References' collapsed='true'>
    * **<color #00a2e8>PubChem Name:</color>** %%3-(((3-(4-((Methylsulfonyl)amino)phenyl)-4-oxo-4H-chromen-7-yl)oxy)methyl)benzoic acid%%
    * **<color #00a2e8>Synonyms:</color>** N/A
    * **<color #00a2e8>CAS #:</color>** 1005334-57-5
    * **<color #00a2e8>PubChem CID:</color>** [[https://pubchem.ncbi.nlm.nih.gov/compound/23661666|23661666]]
    * **<color #00a2e8>IUPAC:</color>** %%3-[[3-[4-(methanesulfonamido)phenyl]-4-oxochromen-7-yl]oxymethyl]benzoic acid%%
    * **<color #00a2e8>INCHI Name:</color>** InChI=1S/C24H19NO7S/c1-33(29,30)25-18-7-5-16(6-8-18)21-14-32-22-12-19(9-10-20(22)23(21)26)31-13-15-3-2-4-17(11-15)24(27)28/h2-12,14,25H,13H2,1H3,(H,27,28)
    * **<color #00a2e8>INCHI Key:</color>** YYOOFJZTRCPVFD-UHFFFAOYSA-N
    * **<color #00a2e8>Molecular Weight:</color>** 465.5
    * **<color #00a2e8>Canonical SMILES:</color>** CS(=O)(=O)NC1=CC=C(C=C1)C2=COC3=C(C2=O)C=CC(=C3)OCC4=CC(=CC=C4)C(=O)O
    * **<color #00a2e8>Isomeric SMILES:</color>** N/A
    * **<color #00a2e8>Molecular Formula:</color>** C24H19NO7S
{{:chemogenomics:structures:chem-0168.svg?nolink}}
</panel>


<panel title='Compound Supplier' collapsed='true'>
    * **<color #00a2e8>Supplier Name:</color>** Sigma-Aldrich
    * **<color #00a2e8>Catalog #:</color>** SML1366
    * **<color #00a2e8>Lot #:</color>** N/A
</panel>


<panel title='Compound Characterization' collapsed='true'>
    * **<color #00a2e8>HRMS (ESI-TOF) m/z:</color>** (M+H)+ Calcd for C24H19NO7S 466.0955; found 466.0966
</panel>


<panel title='Dose Response Curve' collapsed='true'>
    * **<color #00a2e8>Platform ID:</color>** CVT-10216
    * **<color #00a2e8>Min:</color>** -2.3464; **<color #00a2e8>Max:</color>** 12.4545
{{:chemogenomics:dose_response:dr_318.png?nolink&500 |}}
\\ 
\\ 
\\ 
\\ 
|< 300px 100px 200px >|
^ IC   ^ Concentration (µM) ^
| IC10  |N/A    |
| IC20  |N/A    |
| IC30  |N/A    |
| IC40  |N/A    |
| IC50  |N/A    |
| IC60  |N/A    |
| IC70  |N/A    |
| IC80  |N/A    |
| IC90  |N/A    |
\\ 
</panel>
</accordion>
==== Screen Summary ====
    * **<color #00a2e8>Round</color>**: 06
    * **<color #00a2e8>Dose</color>**: 100nM
    * **<color #00a2e8>Days of incubation</color>**: 8
    * **<color #00a2e8>Doublings</color>**: 7.7
    * **<color #00a2e8>Numbers of reads</color>**: 7851599


==== Screen Results ====


^Sensitive/Resistant hits (FDR<0.05)^CRANKS^Score Plot^Top 30 Genes^Screen Similarity^Top 30 Sensitive GO terms^Top 30 Resistant GO terms^
|1/0|<color #e85500>[[https://files.tyerslab.com/files/public/chemogenomics/cranks/CVT-10216_0.1uM_Round-6_exp278.txt|Scores]]</color>|<button type="primary" size="sm" modal="ScorePlot">View</button>|<button type="primary" size="sm" modal="modal_hits">View</button>|<button type="default" size="sm" modal="modal_screen_similarity">View</button>|<button type="default" size="sm" modal="modal_go_sensitive">View</button>|<button type="primary" size="sm" modal="modal_go_resistant">View</button>|
<modal id='ScorePlot' size='lg' title='CVT-10216 0.1μM R06 exp278'>
{{:chemogenomics:cranks_plots:exp278.png?nolink}}
</modal>


<modal id="modal_hits" size="sm" title="Top 30 S/R Genes">
^Gene^CRANKS Score^FDR^
|[[:human_genes:A:ARIH1|ARIH1]]|-3.02|0.05|
|[[:human_genes:U:UQCC2|UQCC2]]|-2.63|0.21|
|[[:human_genes:T:TRMT10A|TRMT10A]]|-2.62|0.09|
|[[:human_genes:C:CMC2|CMC2]]|-2.43|0.51|
|[[:human_genes:N:N6AMT1|N6AMT1]]|-2.41|0.47|
|[[:human_genes:A:ADAT2|ADAT2]]|-2.37|0.21|
|[[:human_genes:V:VEZT|VEZT]]|-2.30|0.21|
|[[:human_genes:P:PDCD5|PDCD5]]|-2.29|0.21|
|[[:human_genes:R:RBMX2|RBMX2]]|-2.29|0.35|
|[[:human_genes:C:CCDC77|CCDC77]]|-2.20|0.31|
|[[:human_genes:R:RNASEH2A|RNASEH2A]]|-2.18|0.49|
|[[:human_genes:G:GMPPB|GMPPB]]|-2.14|0.64|
|[[:human_genes:A:ADSL|ADSL]]|-2.12|0.53|
|[[:human_genes:L:LRRTM2|LRRTM2]]|-2.11|0.40|
|[[:human_genes:P:PMVK|PMVK]]|-2.09|0.40|
|[[:human_genes:Z:ZC3H7A|ZC3H7A]]|-2.08|0.40|
|[[:human_genes:A:ANKRD31|ANKRD31]]|-2.06|0.40|
|[[:human_genes:H:HSD17B10|HSD17B10]]|-2.06|0.57|
|[[:human_genes:K:KIAA1432|KIAA1432]]|-2.06|0.49|
|[[:human_genes:P:PRKCB|PRKCB]]|-2.05|0.40|
|[[:human_genes:F:FH|FH]]|-2.03|0.53|
|[[:human_genes:D:DARS2|DARS2]]|-2.02|0.63|
|[[:human_genes:C:CTC1|CTC1]]|-2.01|0.53|
|[[:human_genes:C:C14orf39|C14orf39]]|-2.01|0.46|
|[[:human_genes:A:ATRX|ATRX]]|-2.00|0.46|
|[[:human_genes:T:TMEM129|TMEM129]]|-1.99|0.51|
|[[:human_genes:O:OXSM|OXSM]]|-1.96|0.48|
|[[:human_genes:P:PPP4C|PPP4C]]|-1.96|0.48|
|[[:human_genes:N:NFYA|NFYA]]|-1.95|0.64|
|[[:human_genes:F:FDPS|FDPS]]|-1.93|0.57|
|[[:human_genes:Z:ZNF106|ZNF106]]|1.99|0.60|
|[[:human_genes:M:MYH7B|MYH7B]]|1.99|0.62|
|[[:human_genes:X:XAB2|XAB2]]|2.00|0.79|
|[[:human_genes:S:SRRM1|SRRM1]]|2.00|0.60|
|[[:human_genes:T:TMEM159|TMEM159]]|2.00|0.62|
|[[:human_genes:K:KANSL1|KANSL1]]|2.01|0.60|
|[[:human_genes:M:MIP|MIP]]|2.03|0.60|
|[[:human_genes:R:RPS5|RPS5]]|2.07|0.60|
|[[:human_genes:N:NPAS2|NPAS2]]|2.07|0.60|
|[[:human_genes:C:CDT1|CDT1]]|2.11|0.66|
|[[:human_genes:C:CHAF1A|CHAF1A]]|2.11|0.62|
|[[:human_genes:F:FOXB2|FOXB2]]|2.11|0.60|
|[[:human_genes:P:PLK1|PLK1]]|2.11|0.66|
|[[:human_genes:R:RSL1D1|RSL1D1]]|2.12|0.60|
|[[:human_genes:B:BIRC5|BIRC5]]|2.14|0.65|
|[[:human_genes:D:DDX11|DDX11]]|2.16|0.60|
|[[:human_genes:F:FZD9|FZD9]]|2.16|0.60|
|[[:human_genes:S:SELENBP1|SELENBP1]]|2.24|0.60|
|[[:human_genes:R:RPS9|RPS9]]|2.28|0.62|
|[[:human_genes:A:AURKA|AURKA]]|2.29|0.60|
|[[:human_genes:P:POLR2C|POLR2C]]|2.32|0.60|
|[[:human_genes:B:BOP1|BOP1]]|2.37|0.60|
|[[:human_genes:R:RPL34|RPL34]]|2.40|0.62|
|[[:human_genes:P:PRPF38B|PRPF38B]]|2.45|0.60|
|[[:human_genes:S:SF3A1|SF3A1]]|2.53|0.60|
|[[:human_genes:W:WEE1|WEE1]]|2.54|0.60|
|[[:human_genes:L:LRR1|LRR1]]|2.57|0.62|
|[[:human_genes:P:PRAMEF26|PRAMEF26]]|2.63|0.66|
|[[:human_genes:P:PRAMEF25|PRAMEF25]]|2.63|0.66|
|[[:human_genes:S:SNRPF|SNRPF]]|3.47|0.60|
</modal>


<modal id="modal_screen_similarity" size="lg" title="Correlated Screens">
No correlation data above threshold. (correlation > 0.05)
</modal>


<modal id="modal_go_sensitive" size="lg" title="Top 30 sensitive GO terms">No GO term hits below threshold. (FDR <0.05)</modal>
<modal id="modal_go_resistant" size="lg" title="Top 30 resistant GO terms">
^GO Term^Fold Change^Genes^
|ribonucleoprotein complex|8.01|SNRPF,SF3A1,PRPF38B,RPL34,BOP1,RPS9,RSL1D1,RPS5,SRRM1,XAB2|
</modal>