Disulfiram 4.3μM R06 exp281 [The Human Chemical-Genetic Interaction Map Project]

This page is read only. You can view the source, but not change it. Ask your administrator if you think this is wrong.
====== Disulfiram 4.3μM R06 exp281 ======
==== Mechanism of Action ====
ALDH1 inhibitor, putative 26S proteasome inhibitor
  * **<color #00a2e8>Class / Subclass 1:</color>** Metabolism / Metabolic Enzyme Inhibitor
  * **<color #00a2e8>Class / Subclass 2:</color>** Proteostasis / Ubiquitin-Proteasome Inhibitor



==== Technical Notes ====
<accordion collapsed='true'>
<panel title='Compound References' collapsed='true'>
    * **<color #00a2e8>PubChem Name:</color>** %%Disulfiram%%
    * **<color #00a2e8>Synonyms:</color>** Tetraethylthiuram disulfide; TETD
    * **<color #00a2e8>CAS #:</color>** 97-77-8
    * **<color #00a2e8>PubChem CID:</color>** [[https://pubchem.ncbi.nlm.nih.gov/compound/3117|3117]]
    * **<color #00a2e8>IUPAC:</color>** %%diethylcarbamothioylsulfanyl N,N-diethylcarbamodithioate%%
    * **<color #00a2e8>INCHI Name:</color>** InChI=1S/C10H20N2S4/c1-5-11(6-2)9(13)15-16-10(14)12(7-3)8-4/h5-8H2,1-4H3
    * **<color #00a2e8>INCHI Key:</color>** AUZONCFQVSMFAP-UHFFFAOYSA-N
    * **<color #00a2e8>Molecular Weight:</color>** 296.5
    * **<color #00a2e8>Canonical SMILES:</color>** CCN(CC)C(=S)SSC(=S)N(CC)CC
    * **<color #00a2e8>Isomeric SMILES:</color>** N/A
    * **<color #00a2e8>Molecular Formula:</color>** C10H20N2S4
{{:chemogenomics:structures:chem-0171.svg?nolink}}
</panel>


<panel title='Compound Supplier' collapsed='true'>
    * **<color #00a2e8>Supplier Name:</color>** Sigma-Aldrich (Supelco)
    * **<color #00a2e8>Catalog #:</color>** PHR1690
    * **<color #00a2e8>Lot #:</color>** LRAA6757
</panel>


<panel title='Compound Characterization' collapsed='true'>
    * **<color #00a2e8>HRMS (ESI-TOF) m/z:</color>** (M+H)+ Calcd for C10H20N2S4 297.05821; found 297.05867
</panel>


<panel title='Dose Response Curve' collapsed='true'>
    * **<color #00a2e8>Platform ID:</color>** Disulfiram
    * **<color #00a2e8>Min:</color>** -18.8948; **<color #00a2e8>Max:</color>** 99.3710
{{:chemogenomics:dose_response:dr_286.png?nolink&500 |}}
\\ 
\\ 
\\ 
\\ 
|< 300px 100px 200px >|
^ IC   ^ Concentration (µM) ^
| IC10  |N/A    |
| IC20  |5.5369    |
| IC30  |5.7585    |
| IC40  |5.9467    |
| IC50  |6.1249    |
| IC60  |N/A    |
| IC70  |N/A    |
| IC80  |N/A    |
| IC90  |N/A    |
\\ 
</panel>
</accordion>
==== Screen Summary ====
    * **<color #00a2e8>Round</color>**: 06
    * **<color #00a2e8>Dose</color>**: 4.3µM
    * **<color #00a2e8>Days of incubation</color>**: 8
    * **<color #00a2e8>Doublings</color>**: 5.8
    * **<color #00a2e8>Numbers of reads</color>**: 9578940


==== Screen Results ====


^Sensitive/Resistant hits (FDR<0.05)^CRANKS^Score Plot^Top 30 Genes^Screen Similarity^Top 30 Sensitive GO terms^Top 30 Resistant GO terms^
|1/2|<color #e85500>[[https://files.tyerslab.com/files/public/chemogenomics/cranks/Disulfiram_4.3uM_Round-6_exp281.txt|Scores]]</color>|<button type="primary" size="sm" modal="ScorePlot">View</button>|<button type="primary" size="sm" modal="modal_hits">View</button>|<button type="primary" size="sm" modal="modal_screen_similarity">View</button>|<button type="default" size="sm" modal="modal_go_sensitive">View</button>|<button type="default" size="sm" modal="modal_go_resistant">View</button>|
<modal id='ScorePlot' size='lg' title='Disulfiram 4.3μM R06 exp281'>
{{:chemogenomics:cranks_plots:exp281.png?nolink}}
</modal>


<modal id="modal_hits" size="sm" title="Top 30 S/R Genes">
^Gene^CRANKS Score^FDR^
|[[:human_genes:S:SLC30A1|SLC30A1]]|-4.10|<0.01|
|[[:human_genes:T:TXNL4A|TXNL4A]]|-3.25|0.46|
|[[:human_genes:A:ARIH1|ARIH1]]|-2.69|0.16|
|[[:human_genes:R:RPSA|RPSA]]|-2.45|0.86|
|[[:human_genes:S:SEPHS1|SEPHS1]]|-2.44|0.18|
|[[:human_genes:V:VPS25|VPS25]]|-2.44|0.78|
|[[:human_genes:O:OTUD5|OTUD5]]|-2.39|0.35|
|[[:human_genes:Z:ZNF407|ZNF407]]|-2.24|0.30|
|[[:human_genes:G:GCLM|GCLM]]|-2.22|0.30|
|[[:human_genes:G:GCLC|GCLC]]|-2.21|0.30|
|[[:human_genes:A:ABCA5|ABCA5]]|-2.19|0.30|
|[[:human_genes:U:UACA|UACA]]|-2.17|0.30|
|[[:human_genes:P:PLK2|PLK2]]|-2.16|0.30|
|[[:human_genes:F:FLCN|FLCN]]|-2.12|0.43|
|[[:human_genes:F:FBXO7|FBXO7]]|-2.10|0.35|
|[[:human_genes:P:PPP2R2A|PPP2R2A]]|-2.08|0.36|
|[[:human_genes:P:PRKAA1|PRKAA1]]|-2.07|0.36|
|[[:human_genes:A:ANKRD32|ANKRD32]]|-2.07|0.64|
|[[:human_genes:Z:ZNF208|ZNF208]]|-2.04|0.40|
|[[:human_genes:M:MINA|MINA]]|-2.02|0.71|
|[[:human_genes:L:LTBR|LTBR]]|-2.01|0.43|
|[[:human_genes:T:TMEM206|TMEM206]]|-1.98|0.45|
|[[:human_genes:C:CPA4|CPA4]]|-1.95|0.46|
|[[:human_genes:A:AP3M2|AP3M2]]|-1.94|0.46|
|[[:human_genes:C:CSRP2BP|CSRP2BP]]|-1.94|0.46|
|[[:human_genes:S:ST20|ST20]]|-1.90|0.90|
|[[:human_genes:C:CDIPT|CDIPT]]|-1.89|0.90|
|[[:human_genes:S:STT3A|STT3A]]|-1.89|0.86|
|[[:human_genes:O:OR52B4|OR52B4]]|-1.85|0.64|
|[[:human_genes:R:RFC3|RFC3]]|-1.84|0.90|
|[[:human_genes:S:SUPT20HL2|SUPT20HL2]]|1.95|0.88|
|[[:human_genes:R:RAN|RAN]]|1.95|0.88|
|[[:human_genes:C:CACTIN|CACTIN]]|1.98|0.65|
|[[:human_genes:L:LRRC63|LRRC63]]|1.98|0.88|
|[[:human_genes:H:HNRNPM|HNRNPM]]|1.99|0.81|
|[[:human_genes:R:RHOC|RHOC]]|2.00|0.81|
|[[:human_genes:P:PES1|PES1]]|2.01|0.88|
|[[:human_genes:R:RRM2|RRM2]]|2.05|0.88|
|[[:human_genes:D:DNM2|DNM2]]|2.09|0.88|
|[[:human_genes:P:PNKD|PNKD]]|2.09|0.65|
|[[:human_genes:I:INO80C|INO80C]]|2.09|0.50|
|[[:human_genes:C:CHST12|CHST12]]|2.10|0.65|
|[[:human_genes:I:IMP3|IMP3]]|2.11|0.88|
|[[:human_genes:A:ABLIM1|ABLIM1]]|2.19|0.35|
|[[:human_genes:N:NPM3|NPM3]]|2.20|0.50|
|[[:human_genes:I:IL4I1|IL4I1]]|2.28|0.29|
|[[:human_genes:B:BAGE4|BAGE4]]|2.30|0.88|
|[[:human_genes:B:BAGE5|BAGE5]]|2.30|0.88|
|[[:human_genes:R:RPL37A|RPL37A]]|2.30|0.88|
|[[:human_genes:B:BAGE2|BAGE2]]|2.31|0.88|
|[[:human_genes:B:BAGE3|BAGE3]]|2.31|0.88|
|[[:human_genes:B:BAGE|BAGE]]|2.31|0.88|
|[[:human_genes:N:NAA40|NAA40]]|2.34|0.50|
|[[:human_genes:C:CSN3|CSN3]]|2.38|0.20|
|[[:human_genes:T:TINAG|TINAG]]|2.45|0.17|
|[[:human_genes:S:SETD1A|SETD1A]]|2.51|0.35|
|[[:human_genes:C:COPB2|COPB2]]|2.56|0.72|
|[[:human_genes:P:POLA1|POLA1]]|2.59|0.88|
|[[:human_genes:H:HOXD12|HOXD12]]|2.80|0.03|
|[[:human_genes:K:KMT2D|KMT2D]]|3.13|<0.01|
</modal>


<modal id="modal_screen_similarity" size="lg" title="Correlated Screens">
^Screen^Correlation^Plot^
|[[:results:exp133|MKC9989 10μM R03 exp133]]|0.054|<button type="primary" size="small" modal="1">View</button>|
</modal>


<modal id="1" size="lg" title="Disulfiram 4.3μM R06 exp281  vs  MKC9989 10μM R03 exp133">
{{:chemogenomics:comparison_plots:exp133_vs_exp281.png?nolink |}}
</modal>



<modal id="modal_go_sensitive" size="lg" title="Top 30 sensitive GO terms">No GO term hits below threshold. (FDR <0.05)</modal>
<modal id="modal_go_resistant" size="lg" title="Top 30 resistant GO terms">No GO term hits below threshold. (FDR <0.05)</modal>