HMS-I2 5μM R06 exp287 [The Human Chemical-Genetic Interaction Map Project]

This page is read only. You can view the source, but not change it. Ask your administrator if you think this is wrong.
====== HMS-I2 5μM R06 exp287 ======
==== Mechanism of Action ====
putative HDAC inhibitor from cell-based screen
  * **<color #00a2e8>Class / Subclass 1:</color>** Uncharacterized Mechanism / Chemical Screen Hit




==== Technical Notes ====
<accordion collapsed='true'>
<panel title='Compound References' collapsed='true'>
    * **<color #00a2e8>PubChem Name:</color>** %%N-(1-Benzothiophen-2-yl)-4-[(2-chloro-6-fluorophenyl)methyl]piperazine-1-carboxamide%%
    * **<color #00a2e8>Synonyms:</color>** N/A
    * **<color #00a2e8>CAS #:</color>** 690626-60-9
    * **<color #00a2e8>PubChem CID:</color>** [[https://pubchem.ncbi.nlm.nih.gov/compound/2811440|2811440]]
    * **<color #00a2e8>IUPAC:</color>** %%N-(1-benzothiophen-2-yl)-4-[(2-chloro-6-fluorophenyl)methyl]piperazine-1-carboxamide%%
    * **<color #00a2e8>INCHI Name:</color>** InChI=1S/C20H19ClFN3OS/c21-16-5-3-6-17(22)15(16)13-24-8-10-25(11-9-24)20(26)23-19-12-14-4-1-2-7-18(14)27-19/h1-7,12H,8-11,13H2,(H,23,26)
    * **<color #00a2e8>INCHI Key:</color>** BPEPKMJSLJPOFO-UHFFFAOYSA-N
    * **<color #00a2e8>Molecular Weight:</color>** 403.9
    * **<color #00a2e8>Canonical SMILES:</color>** C1CN(CCN1CC2=C(C=CC=C2Cl)F)C(=O)NC3=CC4=CC=CC=C4S3
    * **<color #00a2e8>Isomeric SMILES:</color>** N/A
    * **<color #00a2e8>Molecular Formula:</color>** C20H19ClFN3OS
{{:chemogenomics:structures:chem-0176.svg?nolink}}
</panel>


<panel title='Compound Supplier' collapsed='true'>
    * **<color #00a2e8>Supplier Name:</color>** MayBridge
    * **<color #00a2e8>Catalog #:</color>** HTS 03843
    * **<color #00a2e8>Lot #:</color>** N/A
</panel>


<panel title='Compound Characterization' collapsed='true'>
    * **<color #00a2e8>HRMS (ESI-TOF) m/z:</color>** (M+H)+ Calcd for C20H19ClFN3OS 404.09942; found 404.10247
</panel>


<panel title='Dose Response Curve'>
Dose response curve not available.
</panel>


</accordion>
==== Screen Summary ====
    * **<color #00a2e8>Round</color>**: 06
    * **<color #00a2e8>Dose</color>**: 5µM
    * **<color #00a2e8>Days of incubation</color>**: 8
    * **<color #00a2e8>Doublings</color>**: 6.4
    * **<color #00a2e8>Numbers of reads</color>**: 9351885


==== Screen Results ====


^Sensitive/Resistant hits (FDR<0.05)^CRANKS^Score Plot^Top 30 Genes^Screen Similarity^Top 30 Sensitive GO terms^Top 30 Resistant GO terms^
|8/1|<color #e85500>[[https://files.tyerslab.com/files/public/chemogenomics/cranks/HMS-I2_5uM_Round-6_exp287.txt|Scores]]</color>|<button type="primary" size="sm" modal="ScorePlot">View</button>|<button type="primary" size="sm" modal="modal_hits">View</button>|<button type="default" size="sm" modal="modal_screen_similarity">View</button>|<button type="default" size="sm" modal="modal_go_sensitive">View</button>|<button type="default" size="sm" modal="modal_go_resistant">View</button>|
<modal id='ScorePlot' size='lg' title='HMS-I2 5μM R06 exp287'>
{{:chemogenomics:cranks_plots:exp287.png?nolink}}
</modal>


<modal id="modal_hits" size="sm" title="Top 30 S/R Genes">
^Gene^CRANKS Score^FDR^
|[[:human_genes:N:NPIPB6|NPIPB6]]|-2.96|0.04|
|[[:human_genes:T:TNPO3|TNPO3]]|-2.86|0.51|
|[[:human_genes:N:NFRKB|NFRKB]]|-2.83|0.04|
|[[:human_genes:S:SLC29A1|SLC29A1]]|-2.72|0.04|
|[[:human_genes:C:CFAP45|CFAP45]]|-2.66|0.50|
|[[:human_genes:H:HELZ|HELZ]]|-2.63|0.04|
|[[:human_genes:U:UCHL5|UCHL5]]|-2.62|0.04|
|[[:human_genes:M:MNX1|MNX1]]|-2.60|0.04|
|[[:human_genes:K:KDSR|KDSR]]|-2.60|0.04|
|[[:human_genes:A:ATF7IP|ATF7IP]]|-2.49|0.05|
|[[:human_genes:U:UQCC2|UQCC2]]|-2.45|0.16|
|[[:human_genes:S:SNX4|SNX4]]|-2.41|0.07|
|[[:human_genes:D:DCAF7|DCAF7]]|-2.37|0.51|
|[[:human_genes:S:SIGLEC7|SIGLEC7]]|-2.33|0.14|
|[[:human_genes:U:UCK2|UCK2]]|-2.29|0.12|
|[[:human_genes:T:TCP11L1|TCP11L1]]|-2.28|0.12|
|[[:human_genes:U:UXS1|UXS1]]|-2.27|0.12|
|[[:human_genes:D:DPY30|DPY30]]|-2.26|0.29|
|[[:human_genes:A:AP4B1|AP4B1]]|-2.24|0.13|
|[[:human_genes:P:PPP1R12A|PPP1R12A]]|-2.24|0.20|
|[[:human_genes:C:CSDE1|CSDE1]]|-2.23|0.13|
|[[:human_genes:L:LARP1B|LARP1B]]|-2.21|0.14|
|[[:human_genes:D:DCAF15|DCAF15]]|-2.12|0.29|
|[[:human_genes:S:SMCHD1|SMCHD1]]|-2.11|0.20|
|[[:human_genes:D:DARS2|DARS2]]|-2.10|0.51|
|[[:human_genes:C:CYP1A1|CYP1A1]]|-2.10|0.29|
|[[:human_genes:C:CCDC30|CCDC30]]|-2.10|0.29|
|[[:human_genes:C:CBX3|CBX3]]|-2.10|0.20|
|[[:human_genes:C:COX16|COX16]]|-2.06|0.34|
|[[:human_genes:E:EDNRA|EDNRA]]|-2.05|0.25|
|[[:human_genes:X:XRCC4|XRCC4]]|1.94|0.60|
|[[:human_genes:P:PSMC3|PSMC3]]|1.95|0.79|
|[[:human_genes:F:FAM109A|FAM109A]]|1.98|0.61|
|[[:human_genes:N:NDUFA1|NDUFA1]]|1.99|0.60|
|[[:human_genes:F:FGF10|FGF10]]|2.00|0.60|
|[[:human_genes:F:FAM198B|FAM198B]]|2.00|0.52|
|[[:human_genes:O:OR6K6|OR6K6]]|2.01|0.52|
|[[:human_genes:N:NUP155|NUP155]]|2.05|0.70|
|[[:human_genes:M:MTERF|MTERF]]|2.05|0.46|
|[[:human_genes:S:SRP54|SRP54]]|2.06|0.65|
|[[:human_genes:M:MMP19|MMP19]]|2.07|0.60|
|[[:human_genes:C:CCDC85C|CCDC85C]]|2.09|0.41|
|[[:human_genes:Z:ZNF283|ZNF283]]|2.14|0.41|
|[[:human_genes:R:RPL8|RPL8]]|2.14|0.82|
|[[:human_genes:I:IPPK|IPPK]]|2.15|0.41|
|[[:human_genes:B:BYSL|BYSL]]|2.18|0.60|
|[[:human_genes:S:SUPT5H|SUPT5H]]|2.18|0.70|
|[[:human_genes:L:LOC403312|LOC403312]]|2.21|0.41|
|[[:human_genes:M:MYH2|MYH2]]|2.30|0.60|
|[[:human_genes:A:ACAD9|ACAD9]]|2.30|0.41|
|[[:human_genes:X:XRRA1|XRRA1]]|2.33|0.41|
|[[:human_genes:M:METAP1|METAP1]]|2.33|0.41|
|[[:human_genes:R:RPL35A|RPL35A]]|2.33|0.80|
|[[:human_genes:P:PSMD3|PSMD3]]|2.38|0.70|
|[[:human_genes:C:COPS6|COPS6]]|2.40|0.41|
|[[:human_genes:C:CCL20|CCL20]]|2.58|0.13|
|[[:human_genes:P:PRPF19|PRPF19]]|2.61|0.41|
|[[:human_genes:I:IMP4|IMP4]]|2.68|0.61|
|[[:human_genes:R:RFC1|RFC1]]|2.71|0.70|
|[[:human_genes:Y:YME1L1|YME1L1]]|2.89|0.04|
</modal>


<modal id="modal_screen_similarity" size="lg" title="Correlated Screens">
No correlation data above threshold. (correlation > 0.05)
</modal>


<modal id="modal_go_sensitive" size="lg" title="Top 30 sensitive GO terms">No GO term hits below threshold. (FDR <0.05)</modal>
<modal id="modal_go_resistant" size="lg" title="Top 30 resistant GO terms">No GO term hits below threshold. (FDR <0.05)</modal>