LLY-284 2.6μM R06 exp291 [The Human Chemical-Genetic Interaction Map Project]

This page is read only. You can view the source, but not change it. Ask your administrator if you think this is wrong.
====== LLY-284 2.6μM R06 exp291 ======
==== Mechanism of Action ====
Inactive control for LLY-283 PRMT5 inhibitor
  * **<color #00a2e8>Class / Subclass 1:</color>** Gene Regulation / Epigenetic Inhibitor




==== Technical Notes ====
<accordion collapsed='true'>
<panel title='Compound References' collapsed='true'>
    * **<color #00a2e8>PubChem Name:</color>** %%(2R,3R,4S,5R)-2-(4-Aminopyrrolo[2,3-d]pyrimidin-7-yl)-5-[(S)-hydroxy(phenyl)methyl]oxolane-3,4-diol%%
    * **<color #00a2e8>Synonyms:</color>** N/A
    * **<color #00a2e8>CAS #:</color>** 2226515-75-7
    * **<color #00a2e8>PubChem CID:</color>** [[https://pubchem.ncbi.nlm.nih.gov/compound/136213035|136213035]]
    * **<color #00a2e8>IUPAC:</color>** %%(2R,3R,4S,5R)-2-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-5-[(S)-hydroxy(phenyl)methyl]oxolane-3,4-diol%%
    * **<color #00a2e8>INCHI Name:</color>** InChI=1S/C17H18N4O4/c18-15-10-6-7-21(16(10)20-8-19-15)17-13(24)12(23)14(25-17)11(22)9-4-2-1-3-5-9/h1-8,11-14,17,22-24H,(H2,18,19,20)/t11-,12-,13+,14+,17+/m0/s1
    * **<color #00a2e8>INCHI Key:</color>** WWOOWAHTEXIWBO-CNUKPYSBSA-N
    * **<color #00a2e8>Molecular Weight:</color>** 342.35
    * **<color #00a2e8>Canonical SMILES:</color>** C1=CC=C(C=C1)C(C2C(C(C(O2)N3C=CC4=C(N=CN=C43)N)O)O)O
    * **<color #00a2e8>Isomeric SMILES:</color>** C1=CC=C(C=C1)[C@@H]([C@@H]2[C@H]([C@H]([C@@H](O2)N3C=CC4=C(N=CN=C43)N)O)O)O
    * **<color #00a2e8>Molecular Formula:</color>** C17H18N4O4
{{:chemogenomics:structures:chem-0179.svg?nolink}}
</panel>


<panel title='Compound Supplier' collapsed='true'>
    * **<color #00a2e8>Supplier Name:</color>** Structural Genomics Consortium
    * **<color #00a2e8>Catalog #:</color>** N/A
    * **<color #00a2e8>Lot #:</color>** N/A
</panel>


<panel title='Compound Characterization' collapsed='true'>
    * **<color #00a2e8>HRMS (ESI-TOF) m/z:</color>** (M+H)+ Calcd for C17H18N4O4 343.14008; found 343.14074
</panel>


<panel title='Dose Response Curve' collapsed='true'>
    * **<color #00a2e8>Platform ID:</color>** LLY-284
    * **<color #00a2e8>Min:</color>** -29.3869; **<color #00a2e8>Max:</color>** 6.8518
{{:chemogenomics:dose_response:dr_292.png?nolink&500 |}}
\\ 
\\ 
\\ 
\\ 
|< 300px 100px 200px >|
^ IC   ^ Concentration (µM) ^
| IC10  |N/A    |
| IC20  |N/A    |
| IC30  |N/A    |
| IC40  |N/A    |
| IC50  |N/A    |
| IC60  |N/A    |
| IC70  |N/A    |
| IC80  |N/A    |
| IC90  |N/A    |
\\ 
</panel>
</accordion>
==== Screen Summary ====
    * **<color #00a2e8>Round</color>**: 06
    * **<color #00a2e8>Dose</color>**: 2.6µM
    * **<color #00a2e8>Days of incubation</color>**: 8
    * **<color #00a2e8>Doublings</color>**: 6.7
    * **<color #00a2e8>Numbers of reads</color>**: 9746153


==== Screen Results ====


^Sensitive/Resistant hits (FDR<0.05)^CRANKS^Score Plot^Top 30 Genes^Screen Similarity^Top 30 Sensitive GO terms^Top 30 Resistant GO terms^
|0/0|<color #e85500>[[https://files.tyerslab.com/files/public/chemogenomics/cranks/LLY-284_2.6uM_Round-6_exp291.txt|Scores]]</color>|<button type="primary" size="sm" modal="ScorePlot">View</button>|<button type="primary" size="sm" modal="modal_hits">View</button>|<button type="default" size="sm" modal="modal_screen_similarity">View</button>|<button type="default" size="sm" modal="modal_go_sensitive">View</button>|<button type="default" size="sm" modal="modal_go_resistant">View</button>|
<modal id='ScorePlot' size='lg' title='LLY-284 2.6μM R06 exp291'>
{{:chemogenomics:cranks_plots:exp291.png?nolink}}
</modal>


<modal id="modal_hits" size="sm" title="Top 30 S/R Genes">
^Gene^CRANKS Score^FDR^
|[[:human_genes:D:DDX39A|DDX39A]]|-2.65|0.16|
|[[:human_genes:S:SNRPD3|SNRPD3]]|-2.45|0.78|
|[[:human_genes:H:HNRNPH1|HNRNPH1]]|-2.44|0.27|
|[[:human_genes:G:GTF3C1|GTF3C1]]|-2.37|0.39|
|[[:human_genes:S:SLC4A7|SLC4A7]]|-2.36|0.39|
|[[:human_genes:T:TXNRD1|TXNRD1]]|-2.35|0.53|
|[[:human_genes:G:GPS2|GPS2]]|-2.34|0.35|
|[[:human_genes:R:RDX|RDX]]|-2.32|0.35|
|[[:human_genes:A:ARIH1|ARIH1]]|-2.32|0.35|
|[[:human_genes:V:VRK1|VRK1]]|-2.21|0.39|
|[[:human_genes:P:PCBP2|PCBP2]]|-2.20|0.35|
|[[:human_genes:D:DPEP2|DPEP2]]|-2.18|0.35|
|[[:human_genes:R:RNPS1|RNPS1]]|-2.16|0.53|
|[[:human_genes:X:XPO5|XPO5]]|-2.14|0.53|
|[[:human_genes:M:MAPKBP1|MAPKBP1]]|-2.10|0.39|
|[[:human_genes:D:DCTN6|DCTN6]]|-2.09|0.53|
|[[:human_genes:H:HDAC8|HDAC8]]|-2.09|0.53|
|[[:human_genes:C:CD34|CD34]]|-2.09|0.53|
|[[:human_genes:R:RPRD1B|RPRD1B]]|-2.08|0.53|
|[[:human_genes:K:KDSR|KDSR]]|-2.06|0.41|
|[[:human_genes:P:PFN1|PFN1]]|-2.03|0.45|
|[[:human_genes:A:ATP6V0A1|ATP6V0A1]]|-1.98|0.53|
|[[:human_genes:L:LIG4|LIG4]]|-1.95|0.53|
|[[:human_genes:G:GMPPB|GMPPB]]|-1.92|0.79|
|[[:human_genes:V:VEZT|VEZT]]|-1.92|0.53|
|[[:human_genes:G:GPRC5C|GPRC5C]]|-1.92|0.53|
|[[:human_genes:F:FOXJ1|FOXJ1]]|-1.90|0.53|
|[[:human_genes:N:NPRL2|NPRL2]]|-1.89|0.53|
|[[:human_genes:S:SIX4|SIX4]]|-1.88|0.59|
|[[:human_genes:A:ANAPC11|ANAPC11]]|-1.88|0.67|
|[[:human_genes:H:HSD17B1|HSD17B1]]|1.99|0.60|
|[[:human_genes:C:C19orf53|C19orf53]]|2.00|0.44|
|[[:human_genes:P:PSMD3|PSMD3]]|2.00|0.72|
|[[:human_genes:L:LRFN3|LRFN3]]|2.00|0.40|
|[[:human_genes:S:SLC39A3|SLC39A3]]|2.02|0.40|
|[[:human_genes:S:SREBF2|SREBF2]]|2.03|0.60|
|[[:human_genes:C:CDK4|CDK4]]|2.07|0.34|
|[[:human_genes:N:NUDCD1|NUDCD1]]|2.07|0.34|
|[[:human_genes:A:A4GALT|A4GALT]]|2.07|0.40|
|[[:human_genes:M:MOGS|MOGS]]|2.07|0.40|
|[[:human_genes:T:TOP1MT|TOP1MT]]|2.11|0.40|
|[[:human_genes:S:SYNE2|SYNE2]]|2.12|0.33|
|[[:human_genes:P:PHYKPL|PHYKPL]]|2.12|0.33|
|[[:human_genes:K:KIR3DL2|KIR3DL2]]|2.13|0.33|
|[[:human_genes:Z:ZDHHC15|ZDHHC15]]|2.14|0.33|
|[[:human_genes:Z:ZNF347|ZNF347]]|2.15|0.33|
|[[:human_genes:A:AFF4|AFF4]]|2.17|0.33|
|[[:human_genes:Y:YME1L1|YME1L1]]|2.20|0.33|
|[[:human_genes:W:WDR26|WDR26]]|2.20|0.34|
|[[:human_genes:P:PLK1|PLK1]]|2.22|0.60|
|[[:human_genes:R:RPL32|RPL32]]|2.22|0.40|
|[[:human_genes:V:VTA1|VTA1]]|2.24|0.33|
|[[:human_genes:K:KARS|KARS]]|2.29|0.44|
|[[:human_genes:R:RPL36A-HNRNPH2|RPL36A-HNRNPH2]]|2.31|0.70|
|[[:human_genes:R:RRM2|RRM2]]|2.32|0.70|
|[[:human_genes:H:HNRNPH3|HNRNPH3]]|2.42|0.33|
|[[:human_genes:P:POLR2J2|POLR2J2]]|2.48|0.68|
|[[:human_genes:F:FOXN2|FOXN2]]|2.48|0.33|
|[[:human_genes:P:PMPCA|PMPCA]]|2.84|0.40|
|[[:human_genes:G:GOLGA8H|GOLGA8H]]|3.38|0.33|
</modal>


<modal id="modal_screen_similarity" size="lg" title="Correlated Screens">
No correlation data above threshold. (correlation > 0.05)
</modal>


<modal id="modal_go_sensitive" size="lg" title="Top 30 sensitive GO terms">No GO term hits below threshold. (FDR <0.05)</modal>
<modal id="modal_go_resistant" size="lg" title="Top 30 resistant GO terms">No GO term hits below threshold. (FDR <0.05)</modal>