Myriocin 25μM R06 exp293 [The Human Chemical-Genetic Interaction Map Project]

This page is read only. You can view the source, but not change it. Ask your administrator if you think this is wrong.
====== Myriocin 25μM R06 exp293 ======
==== Mechanism of Action ====
Inhibits serine palmitoyltransferase (SPT1), sphingolipid biosynthesis
  * **<color #00a2e8>Class / Subclass 1:</color>** Infectious Disease / Antibiotic
  * **<color #00a2e8>Class / Subclass 2:</color>** Metabolism / Metabolic Enzyme Inhibitor



==== Technical Notes ====
<accordion collapsed='true'>
<panel title='Compound References' collapsed='true'>
    * **<color #00a2e8>PubChem Name:</color>** %%Myriocin%%
    * **<color #00a2e8>Synonyms:</color>** N/A
    * **<color #00a2e8>CAS #:</color>** 35891-70-4
    * **<color #00a2e8>PubChem CID:</color>** [[https://pubchem.ncbi.nlm.nih.gov/compound/6438394|6438394]]
    * **<color #00a2e8>IUPAC:</color>** %%(E,2S,3R,4R)-2-amino-3,4-dihydroxy-2-(hydroxymethyl)-14-oxoicos-6-enoic acid%%
    * **<color #00a2e8>INCHI Name:</color>** InChI=1S/C21H39NO6/c1-2-3-4-10-13-17(24)14-11-8-6-5-7-9-12-15-18(25)19(26)21(22,16-23)20(27)28/h9,12,18-19,23,25-26H,2-8,10-11,13-16,22H2,1H3,(H,27,28)/b12-9+/t18-,19+,21+/m1/s1
    * **<color #00a2e8>INCHI Key:</color>** ZZIKIHCNFWXKDY-GNTQXERDSA-N
    * **<color #00a2e8>Molecular Weight:</color>** 401.5
    * **<color #00a2e8>Canonical SMILES:</color>** CCCCCCC(=O)CCCCCCC=CCC(C(C(CO)(C(=O)O)N)O)O
    * **<color #00a2e8>Isomeric SMILES:</color>** CCCCCCC(=O)CCCCCC/C=C/C[C@H]([C@@H]([C@@](CO)(C(=O)O)N)O)O
    * **<color #00a2e8>Molecular Formula:</color>** C21H39NO6
{{:chemogenomics:structures:chem-0181.svg?nolink}}
</panel>


<panel title='Compound Supplier' collapsed='true'>
    * **<color #00a2e8>Supplier Name:</color>** Sigma-Aldrich
    * **<color #00a2e8>Catalog #:</color>** M1177
    * **<color #00a2e8>Lot #:</color>** N/A
</panel>


<panel title='Compound Characterization' collapsed='true'>
    * **<color #00a2e8>HRMS (ESI-TOF) m/z:</color>** (M+H)+ Calcd for C21H39NO6 402.28501; found 402.28657
</panel>


<panel title='Dose Response Curve' collapsed='true'>
    * **<color #00a2e8>Platform ID:</color>** Myriocin
    * **<color #00a2e8>Min:</color>** -22.5595; **<color #00a2e8>Max:</color>** 3.5656
{{:chemogenomics:dose_response:dr_293.png?nolink&500 |}}
\\ 
\\ 
\\ 
\\ 
|< 300px 100px 200px >|
^ IC   ^ Concentration (µM) ^
| IC10  |N/A    |
| IC20  |N/A    |
| IC30  |N/A    |
| IC40  |N/A    |
| IC50  |N/A    |
| IC60  |N/A    |
| IC70  |N/A    |
| IC80  |N/A    |
| IC90  |N/A    |
\\ 
</panel>
</accordion>
==== Screen Summary ====
    * **<color #00a2e8>Round</color>**: 06
    * **<color #00a2e8>Dose</color>**: 25µM
    * **<color #00a2e8>Days of incubation</color>**: 8
    * **<color #00a2e8>Doublings</color>**: 7.2
    * **<color #00a2e8>Numbers of reads</color>**: 8003920


==== Screen Results ====


^Sensitive/Resistant hits (FDR<0.05)^CRANKS^Score Plot^Top 30 Genes^Screen Similarity^Top 30 Sensitive GO terms^Top 30 Resistant GO terms^
|1/0|<color #e85500>[[https://files.tyerslab.com/files/public/chemogenomics/cranks/Myriocin_25uM_Round-6_exp293.txt|Scores]]</color>|<button type="primary" size="sm" modal="ScorePlot">View</button>|<button type="primary" size="sm" modal="modal_hits">View</button>|<button type="primary" size="sm" modal="modal_screen_similarity">View</button>|<button type="default" size="sm" modal="modal_go_sensitive">View</button>|<button type="primary" size="sm" modal="modal_go_resistant">View</button>|
<modal id='ScorePlot' size='lg' title='Myriocin 25μM R06 exp293'>
{{:chemogenomics:cranks_plots:exp293.png?nolink}}
</modal>


<modal id="modal_hits" size="sm" title="Top 30 S/R Genes">
^Gene^CRANKS Score^FDR^
|[[:human_genes:U:USO1|USO1]]|-3.29|<0.01|
|[[:human_genes:T:TMC2|TMC2]]|-3.00|0.20|
|[[:human_genes:V:VPS25|VPS25]]|-2.60|0.81|
|[[:human_genes:R:RSRC2|RSRC2]]|-2.44|0.81|
|[[:human_genes:D:DEFB126|DEFB126]]|-2.43|0.29|
|[[:human_genes:G:GPR107|GPR107]]|-2.42|0.20|
|[[:human_genes:O:OTUD7B|OTUD7B]]|-2.36|0.32|
|[[:human_genes:C:CDIPT|CDIPT]]|-2.33|0.81|
|[[:human_genes:T:TSSC1|TSSC1]]|-2.27|0.29|
|[[:human_genes:U:UBXN1|UBXN1]]|-2.22|0.81|
|[[:human_genes:P:PCYT1A|PCYT1A]]|-2.18|0.33|
|[[:human_genes:S:SLC5A3|SLC5A3]]|-2.16|0.33|
|[[:human_genes:M:MBTPS2|MBTPS2]]|-2.15|0.33|
|[[:human_genes:G:GCLC|GCLC]]|-2.09|0.40|
|[[:human_genes:N:NAV1|NAV1]]|-2.08|0.40|
|[[:human_genes:A:AURKB|AURKB]]|-2.04|0.81|
|[[:human_genes:F:FAM26D|FAM26D]]|-2.01|0.55|
|[[:human_genes:A:ARPP19|ARPP19]]|-1.95|0.65|
|[[:human_genes:P:PSTPIP2|PSTPIP2]]|-1.95|0.65|
|[[:human_genes:R:RTF1|RTF1]]|-1.94|0.81|
|[[:human_genes:A:ADD1|ADD1]]|-1.91|0.75|
|[[:human_genes:S:SEPSECS|SEPSECS]]|-1.91|0.81|
|[[:human_genes:U:UBE2QL1|UBE2QL1]]|-1.90|0.81|
|[[:human_genes:C:C6orf203|C6orf203]]|-1.90|0.81|
|[[:human_genes:Y:YARS2|YARS2]]|-1.89|0.81|
|[[:human_genes:C:C17orf51|C17orf51]]|-1.86|0.81|
|[[:human_genes:N:NUDT5|NUDT5]]|-1.84|0.81|
|[[:human_genes:T:TRIM55|TRIM55]]|-1.83|0.81|
|[[:human_genes:G:GTF2IRD2B|GTF2IRD2B]]|-1.82|0.81|
|[[:human_genes:B:BUB3|BUB3]]|-1.81|0.81|
|[[:human_genes:H:HACL1|HACL1]]|1.92|0.67|
|[[:human_genes:H:HDGFRP2|HDGFRP2]]|1.93|0.67|
|[[:human_genes:C:CLUH|CLUH]]|1.95|0.67|
|[[:human_genes:I:ISY1|ISY1]]|1.95|0.71|
|[[:human_genes:S:SART1|SART1]]|1.95|0.71|
|[[:human_genes:P:PRPF4|PRPF4]]|1.98|0.71|
|[[:human_genes:C:COPB1|COPB1]]|1.98|0.71|
|[[:human_genes:R:RPS3A|RPS3A]]|1.99|0.67|
|[[:human_genes:S:SYT10|SYT10]]|1.99|0.66|
|[[:human_genes:R:RAET1L|RAET1L]]|1.99|0.66|
|[[:human_genes:C:C20orf173|C20orf173]]|2.00|0.66|
|[[:human_genes:U:UMPS|UMPS]]|2.00|0.82|
|[[:human_genes:A:ATG9A|ATG9A]]|2.00|0.67|
|[[:human_genes:I:ISY1-RAB43|ISY1-RAB43]]|2.01|0.70|
|[[:human_genes:P:POFUT1|POFUT1]]|2.01|0.66|
|[[:human_genes:G:GNG11|GNG11]]|2.02|0.67|
|[[:human_genes:C:CDC5L|CDC5L]]|2.03|0.67|
|[[:human_genes:E:EIF5|EIF5]]|2.09|0.67|
|[[:human_genes:M:MFSD2A|MFSD2A]]|2.09|0.66|
|[[:human_genes:R:RCSD1|RCSD1]]|2.10|0.66|
|[[:human_genes:R:RFC2|RFC2]]|2.12|0.67|
|[[:human_genes:M:MED1|MED1]]|2.12|0.67|
|[[:human_genes:A:AATF|AATF]]|2.13|0.67|
|[[:human_genes:T:TRIP10|TRIP10]]|2.17|0.66|
|[[:human_genes:S:SLC10A5|SLC10A5]]|2.19|0.66|
|[[:human_genes:T:TMEM114|TMEM114]]|2.23|0.66|
|[[:human_genes:P:PDIA3|PDIA3]]|2.43|0.29|
|[[:human_genes:S:SPC25|SPC25]]|2.49|0.66|
|[[:human_genes:Z:ZBTB18|ZBTB18]]|2.58|0.25|
|[[:human_genes:C:CCT2|CCT2]]|2.84|0.66|
</modal>


<modal id="modal_screen_similarity" size="lg" title="Correlated Screens">
^Screen^Correlation^Plot^
|[[:results:exp149|SB203580 25μM R03 exp149]]|0.063|<button type="primary" size="small" modal="1">View</button>|
|[[:results:exp77|Prochlorperazine 5.2μM R02 exp77]]|0.056|<button type="primary" size="small" modal="2">View</button>|
|[[:results:exp422|Wiskostatin 3μM R07 exp422]]|0.051|<button type="primary" size="small" modal="3">View</button>|
|[[:results:exp486|Heregulin-B 44ng/ml R08 exp486]]|0.065|<button type="primary" size="small" modal="4">View</button>|
|[[:results:exp457|Bisphenol F 50μM R08 exp457]]|0.061|<button type="primary" size="small" modal="5">View</button>|
</modal>


<modal id="1" size="lg" title="Myriocin 25μM R06 exp293  vs  SB203580 25μM R03 exp149">
{{:chemogenomics:comparison_plots:exp149_vs_exp293.png?nolink |}}
</modal>

<modal id="2" size="lg" title="Myriocin 25μM R06 exp293  vs  Prochlorperazine 5.2μM R02 exp77">
{{:chemogenomics:comparison_plots:exp293_vs_exp77.png?nolink |}}
</modal>

<modal id="3" size="lg" title="Myriocin 25μM R06 exp293  vs  Wiskostatin 3μM R07 exp422">
{{:chemogenomics:comparison_plots:exp293_vs_exp422.png?nolink |}}
</modal>

<modal id="4" size="lg" title="Heregulin-B 44ng/ml R08 exp486  vs  Myriocin 25μM R06 exp293">
{{:chemogenomics:comparison_plots:exp293_vs_exp486.png?nolink |}}
</modal>

<modal id="5" size="lg" title="Bisphenol F 50μM R08 exp457  vs  Myriocin 25μM R06 exp293">
{{:chemogenomics:comparison_plots:exp293_vs_exp457.png?nolink |}}
</modal>



<modal id="modal_go_sensitive" size="lg" title="Top 30 sensitive GO terms">No GO term hits below threshold. (FDR <0.05)</modal>
<modal id="modal_go_resistant" size="lg" title="Top 30 resistant GO terms">
^GO Term^Fold Change^Genes^
|U2-type spliceosomal complex|32.12|CDC5L,PRPF4,SART1,ISY1,ZMAT2|
</modal>