Geldanamycin 0.015 to 0.05μM on day4 R07 exp317 [The Human Chemical-Genetic Interaction Map Project]

This page is read only. You can view the source, but not change it. Ask your administrator if you think this is wrong.
====== Geldanamycin 0.015 to 0.05μM on day4 R07 exp317 ======
==== Mechanism of Action ====
HSP90 inhibitor
  * **<color #00a2e8>Class / Subclass 1:</color>** Proteostasis / Chaperone Inhibitor




==== Technical Notes ====
<accordion collapsed='true'>
<panel title='Compound References' collapsed='true'>
    * **<color #00a2e8>PubChem Name:</color>** %%Geldanamycin%%
    * **<color #00a2e8>Synonyms:</color>** N/A
    * **<color #00a2e8>CAS #:</color>** 30562-34-6
    * **<color #00a2e8>PubChem CID:</color>** [[https://pubchem.ncbi.nlm.nih.gov/compound/5288382|5288382]]
    * **<color #00a2e8>IUPAC:</color>** %%[(4E,6Z,8S,9S,10E,12S,13R,14S,16R)-13-hydroxy-8,14,19-trimethoxy-4,10,12,16-tetramethyl-3,20,22-trioxo-2-azabicyclo[16.3.1]docosa-1(21),4,6,10,18-pentaen-9-yl] carbamate%%
    * **<color #00a2e8>INCHI Name:</color>** InChI=1S/C29H40N2O9/c1-15-11-19-25(34)20(14-21(32)27(19)39-7)31-28(35)16(2)9-8-10-22(37-5)26(40-29(30)36)18(4)13-17(3)24(33)23(12-15)38-6/h8-10,13-15,17,22-24,26,33H,11-12H2,1-7H3,(H2,30,36)(H,31,35)/b10-8-,16-9+,18-13+/t15-,17+,22+,23+,24-,26+/m1/s1
    * **<color #00a2e8>INCHI Key:</color>** QTQAWLPCGQOSGP-KSRBKZBZSA-N
    * **<color #00a2e8>Molecular Weight:</color>** 560.6
    * **<color #00a2e8>Canonical SMILES:</color>** CC1CC(C(C(C=C(C(C(C=CC=C(C(=O)NC2=CC(=O)C(=C(C1)C2=O)OC)C)OC)OC(=O)N)C)C)O)OC
    * **<color #00a2e8>Isomeric SMILES:</color>** C[C@H]1C[C@@H]([C@@H]([C@H](/C=C(/[C@@H]([C@H](/C=C\\C=C(\\C(=O)NC2=CC(=O)C(=C(C1)C2=O)OC)/C)OC)OC(=O)N)\\C)C)O)OC
    * **<color #00a2e8>Molecular Formula:</color>** C29H40N2O9
{{:chemogenomics:structures:chem-0140.svg?nolink}}
</panel>


<panel title='Compound Supplier' collapsed='true'>
    * **<color #00a2e8>Supplier Name:</color>** Ark Pharm Inc.
    * **<color #00a2e8>Catalog #:</color>** AK130527
    * **<color #00a2e8>Lot #:</color>** WG0131921-180318001
</panel>


<panel title='Compound Characterization' collapsed='true'>
    * **<color #00a2e8>HRMS (ESI-TOF) m/z:</color>** (M+Na)+ Calcd for C29 H40 N2 O9 583.2626; found 583.26208
</panel>


<panel title='Dose Response Curve' collapsed='true'>
    * **<color #00a2e8>Platform ID:</color>** Geldanamycin
    * **<color #00a2e8>Min:</color>** 5.0711; **<color #00a2e8>Max:</color>** 99.6467
{{:chemogenomics:dose_response:dr_428.png?nolink&500 |}}
\\ 
\\ 
\\ 
\\ 
|< 300px 100px 200px >|
^ IC   ^ Concentration (µM) ^
| IC10  |N/A    |
| IC20  |N/A    |
| IC30  |0.0079    |
| IC40  |0.0197    |
| IC50  |0.0440    |
| IC60  |N/A    |
| IC70  |N/A    |
| IC80  |N/A    |
| IC90  |N/A    |
\\ 
</panel>
</accordion>
==== Screen Summary ====
    * **<color #00a2e8>Round</color>**: 07
    * **<color #00a2e8>Dose</color>**: 0.015-0.05µM
    * **<color #00a2e8>Days of incubation</color>**: 8
    * **<color #00a2e8>Doublings</color>**: 5.4
    * **<color #00a2e8>Numbers of reads</color>**: 13571170


==== Screen Results ====


^Sensitive/Resistant hits (FDR<0.05)^CRANKS^Score Plot^Top 30 Genes^Screen Similarity^Top 30 Sensitive GO terms^Top 30 Resistant GO terms^
|4/10|<color #e85500>[[https://files.tyerslab.com/files/public/chemogenomics/cranks/Geldanamycin_0.015-0.05day4uM_Round-7_exp317.txt|Scores]]</color>|<button type="primary" size="sm" modal="ScorePlot">View</button>|<button type="primary" size="sm" modal="modal_hits">View</button>|<button type="primary" size="sm" modal="modal_screen_similarity">View</button>|<button type="default" size="sm" modal="modal_go_sensitive">View</button>|<button type="default" size="sm" modal="modal_go_resistant">View</button>|
<modal id='ScorePlot' size='lg' title='Geldanamycin 0.015 to 0.05μM on day4 R07 exp317'>
{{:chemogenomics:cranks_plots:exp317.png?nolink}}
</modal>


<modal id="modal_hits" size="sm" title="Top 30 S/R Genes">
^Gene^CRANKS Score^FDR^
|[[:human_genes:H:HSP90AA1|HSP90AA1]]|-3.46|<0.01|
|[[:human_genes:S:SEPHS1|SEPHS1]]|-3.19|<0.01|
|[[:human_genes:N:NPIPA2|NPIPA2]]|-3.12|0.19|
|[[:human_genes:N:NPIPA3|NPIPA3]]|-2.77|0.31|
|[[:human_genes:R:RHOA|RHOA]]|-2.67|0.04|
|[[:human_genes:P:PRKAA1|PRKAA1]]|-2.63|0.04|
|[[:human_genes:D:DCAF15|DCAF15]]|-2.62|0.07|
|[[:human_genes:T:TBCD|TBCD]]|-2.55|0.08|
|[[:human_genes:G:GPR75-ASB3|GPR75-ASB3]]|-2.51|0.08|
|[[:human_genes:H:HSP90AB1|HSP90AB1]]|-2.51|0.14|
|[[:human_genes:U:UXS1|UXS1]]|-2.50|0.07|
|[[:human_genes:U:UBE2D3|UBE2D3]]|-2.46|0.07|
|[[:human_genes:T:TCF4|TCF4]]|-2.42|0.08|
|[[:human_genes:P:PTEN|PTEN]]|-2.36|0.08|
|[[:human_genes:C:CRTC3|CRTC3]]|-2.27|0.12|
|[[:human_genes:M:MAPK14|MAPK14]]|-2.24|0.14|
|[[:human_genes:S:SCAF8|SCAF8]]|-2.21|0.14|
|[[:human_genes:C:COX15|COX15]]|-2.19|0.23|
|[[:human_genes:A:ASXL2|ASXL2]]|-2.15|0.24|
|[[:human_genes:C:C7orf55-LUC7L2|C7orf55-LUC7L2]]|-2.14|0.19|
|[[:human_genes:V:VRK2|VRK2]]|-2.14|0.24|
|[[:human_genes:U:USP54|USP54]]|-2.13|0.19|
|[[:human_genes:Z:ZC3H11A|ZC3H11A]]|-2.10|0.21|
|[[:human_genes:R:RSRC2|RSRC2]]|-2.10|0.64|
|[[:human_genes:P:PROSER1|PROSER1]]|-2.07|0.29|
|[[:human_genes:E:ERG|ERG]]|-2.06|0.29|
|[[:human_genes:M:MESDC2|MESDC2]]|-2.06|0.23|
|[[:human_genes:S:SCN8A|SCN8A]]|-2.06|0.29|
|[[:human_genes:T:TNFSF11|TNFSF11]]|-2.05|0.23|
|[[:human_genes:Z:ZNF410|ZNF410]]|-2.05|0.23|
|[[:human_genes:L:LYAR|LYAR]]|2.08|0.25|
|[[:human_genes:A:ACRC|ACRC]]|2.10|0.19|
|[[:human_genes:P:PIH1D1|PIH1D1]]|2.11|0.18|
|[[:human_genes:G:GLYR1|GLYR1]]|2.15|0.16|
|[[:human_genes:P:PSMD7|PSMD7]]|2.16|0.50|
|[[:human_genes:S:SAMD4B|SAMD4B]]|2.18|0.28|
|[[:human_genes:O:OR1L1|OR1L1]]|2.19|0.19|
|[[:human_genes:P:POLE|POLE]]|2.19|0.40|
|[[:human_genes:W:WDR75|WDR75]]|2.19|0.40|
|[[:human_genes:P:PPP3CA|PPP3CA]]|2.25|0.12|
|[[:human_genes:K:KIAA1033|KIAA1033]]|2.30|0.09|
|[[:human_genes:H:HNRNPF|HNRNPF]]|2.31|0.09|
|[[:human_genes:B:BMS1|BMS1]]|2.32|0.19|
|[[:human_genes:M:MLNR|MLNR]]|2.34|0.19|
|[[:human_genes:W:WISP2|WISP2]]|2.35|0.12|
|[[:human_genes:M:MGST1|MGST1]]|2.36|0.12|
|[[:human_genes:S:SMNDC1|SMNDC1]]|2.41|0.17|
|[[:human_genes:R:RPS4X|RPS4X]]|2.46|0.15|
|[[:human_genes:E:EIF3G|EIF3G]]|2.49|0.08|
|[[:human_genes:C:CTNS|CTNS]]|2.50|0.08|
|[[:human_genes:I:IKZF2|IKZF2]]|2.59|0.03|
|[[:human_genes:I:IREB2|IREB2]]|2.93|<0.01|
|[[:human_genes:P:PKD2|PKD2]]|2.93|0.01|
|[[:human_genes:P:PCGF1|PCGF1]]|2.94|<0.01|
|[[:human_genes:C:CBLB|CBLB]]|3.00|0.02|
|[[:human_genes:E:ELF1|ELF1]]|3.09|<0.01|
|[[:human_genes:S:SF3A1|SF3A1]]|3.09|0.03|
|[[:human_genes:C:CYB561A3|CYB561A3]]|3.09|<0.01|
|[[:human_genes:P:PDS5B|PDS5B]]|3.33|<0.01|
|[[:human_genes:C:CISD1|CISD1]]|3.65|<0.01|
</modal>


<modal id="modal_screen_similarity" size="lg" title="Correlated Screens">
^Screen^Correlation^Plot^
|[[:results:exp242|Radicicol 0.16μM R05 exp242]]|0.071|<button type="primary" size="small" modal="1">View</button>|
|[[:results:exp30|Rapamycin 10μM R00 exp30]]|0.054|<button type="primary" size="small" modal="2">View</button>|
|[[:results:exp316|Geldanamycin 0.015 to 0.025μM on day4 R07 exp316]]|0.168|<button type="primary" size="small" modal="3">View</button>|
</modal>


<modal id="1" size="lg" title="Geldanamycin 0.015 to 0.05μM on day4 R07 exp317  vs  Radicicol 0.16μM R05 exp242">
{{:chemogenomics:comparison_plots:exp242_vs_exp317.png?nolink |}}
</modal>

<modal id="2" size="lg" title="Geldanamycin 0.015 to 0.05μM on day4 R07 exp317  vs  Rapamycin 10μM R00 exp30">
{{:chemogenomics:comparison_plots:exp30_vs_exp317.png?nolink |}}
</modal>

<modal id="3" size="lg" title="Geldanamycin 0.015 to 0.025μM on day4 R07 exp316  vs  Geldanamycin 0.015 to 0.05μM on day4 R07 exp317">
{{:chemogenomics:comparison_plots:exp316_vs_exp317.png?nolink |}}
</modal>



<modal id="modal_go_sensitive" size="lg" title="Top 30 sensitive GO terms">No GO term hits below threshold. (FDR <0.05)</modal>
<modal id="modal_go_resistant" size="lg" title="Top 30 resistant GO terms">No GO term hits below threshold. (FDR <0.05)</modal>